{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "209f97de-ffe3-4101-891f-946bd71ceebe",
          "code": "98537-42-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=98537-42-9",
          "code_system": "CAS",
          "references": [
            "35559b3e-94a6-4a44-9778-29af024167c0",
            "733c5155-bc35-4fca-80d7-0aec3510c487"
          ]
        },
        {
          "uuid": "0ed748c1-c6c9-463a-83f3-5cd75219a20a",
          "code": "BOB (PSYCHEDELIC)",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/BOB_(psychedelic)",
          "code_system": "WIKIPEDIA",
          "references": [
            "35559b3e-94a6-4a44-9778-29af024167c0"
          ]
        },
        {
          "uuid": "d599d716-e6e7-45c8-b53d-3939ec96e49f",
          "code": "15185771",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15185771",
          "code_system": "PUBCHEM",
          "references": [
            "35559b3e-94a6-4a44-9778-29af024167c0"
          ]
        },
        {
          "uuid": "36fb6892-25b6-c775-1cba-a196e8dadda3",
          "code": "DTXSID60569805",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60569805",
          "code_system": "EPA CompTox",
          "references": [
            "04ceb0e9-8505-e376-52a0-c0246b5d4d53"
          ]
        },
        {
          "uuid": "8ba4d169-78ab-4f0c-af13-5ffc567d057c",
          "code": "89A0HNR42S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6932a208-a6dd-dfa2-c424-c0f6519046e0",
          "code": "Designer-drugs-BOB",
          "comments": "Wikipedia|List of designer drugs|Psychedelics|2C-x (2,5-dimethoxy-phenethylamine derivatives)",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "ffb18740-c98a-384d-5b9d-d976589a809f"
          ]
        },
        {
          "uuid": "b58d0480-a761-4fa4-a24f-c378024f9ee7",
          "code": "PiHKAL",
          "comments": "Wikipedia|PiHKAL|Phenethylamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/PiHKAL",
          "code_system": "WIKIPEDIA"
        }
      ],
      "relationships": [
        {
          "uuid": "9ee925a0-08e0-4c23-b29d-bab6d436a1ba",
          "amount": {
            "uuid": "82dd3fea-7295-44e4-a512-ceeeffbb9fab"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2df5e03b-ad4b-439f-bcd6-a431498e24ad",
            "refuuid": "d491ab81-6213-4c62-a0c2-79cdbff00d16",
            "name": "BOB",
            "unii": "89A0HNR42S",
            "linking_id": "89A0HNR42S",
            "ref_pname": "BOB",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9a1840b0-448f-475c-b5fa-8ca28f49098c",
          "amount": {
            "uuid": "4d99410f-ef60-4e50-acdd-1db03214ee98"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "673f978c-d410-4a9a-a3d5-1d33e3121da3",
            "refuuid": "3592b3e9-4b71-4c81-8540-70bb07a092c1",
            "name": "BOB HYDROCHLORIDE",
            "unii": "V5Y6SRF77G",
            "linking_id": "V5Y6SRF77G",
            "ref_pname": "BOB HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "61f6e2a6-bc7a-4b6a-bac9-63f284339750",
          "name": ".BETA.-METHOXY-2C-B",
          "stdName": ".BETA.-METHOXY-2C-B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5144e567-e3a1-46ce-a642-3eb82373c727"
          ],
          "display_name": false
        },
        {
          "uuid": "3df599f5-7406-4ba2-b7bc-37b2aa37be7b",
          "name": "2,5,.BETA.-TRIMETHOXY-4-BROMOPHENETHYLAMINE",
          "stdName": "2,5,.BETA.-TRIMETHOXY-4-BROMOPHENETHYLAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "733c5155-bc35-4fca-80d7-0aec3510c487"
          ],
          "display_name": false
        },
        {
          "uuid": "8f9b7af4-de04-48ee-bbf2-865f31237eda",
          "name": "4-BROMO-.BETA.,2,5-TRIMETHOXYBENZENEETHANAMINE",
          "stdName": "4-BROMO-.BETA.,2,5-TRIMETHOXYBENZENEETHANAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "733c5155-bc35-4fca-80d7-0aec3510c487"
          ],
          "display_name": false
        },
        {
          "uuid": "bf5dffac-8639-445f-9336-c6da72fb2ade",
          "name": "BENZENEETHANAMINE, 4-BROMO-.BETA.,2,5-TRIMETHOXY-",
          "stdName": "BENZENEETHANAMINE, 4-BROMO-.BETA.,2,5-TRIMETHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "733c5155-bc35-4fca-80d7-0aec3510c487"
          ],
          "display_name": false
        },
        {
          "uuid": "2b623ef8-a7cd-49c0-a77d-d4b102565801",
          "name": "BOB",
          "stdName": "BOB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fe89a78-6fc7-4c67-aa13-3b5bef79ffbb"
          ],
          "display_name": true
        },
        {
          "uuid": "f0a2e528-dfd3-4d2c-913c-f8a3ef87bc56",
          "name": "BOB (PSYCHEDELIC)",
          "stdName": "BOB (PSYCHEDELIC)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fe89a78-6fc7-4c67-aa13-3b5bef79ffbb"
          ],
          "display_name": false
        },
        {
          "uuid": "c887d03d-6c78-4997-818c-7eff266bef6a",
          "name": "J961.018I",
          "stdName": "J961.018I",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb710588-965c-4cc6-b816-0c135941bfb8"
          ],
          "display_name": false
        },
        {
          "uuid": "72c5fe4a-0db8-4853-b42f-12dde3989d41",
          "name": "beta-Methoxy 2C-B",
          "stdName": "BETA-METHOXY 2C-B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12031ade-894a-4863-8169-b21dd0d09a52"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fb710588-965c-4cc6-b816-0c135941bfb8",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J961.018I",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J961.018I",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fe89a78-6fc7-4c67-aa13-3b5bef79ffbb",
          "citation": "https://en.wikipedia.org/wiki/BOB_(psychedelic)",
          "url": "https://en.wikipedia.org/wiki/BOB_(psychedelic)",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5144e567-e3a1-46ce-a642-3eb82373c727",
          "citation": "http://isomerdesign.com/PiHKAL/read.php?domain=pk&id=13",
          "url": "http://isomerdesign.com/PiHKAL/read.php?domain=pk&id=13",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "094e8f92-de25-47d4-a64e-498b4fe126af",
          "citation": "http://www.sciencedirect.com/science/article/pii/S0306362397004217",
          "url": "http://www.sciencedirect.com/science/article/pii/S0306362397004217",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35559b3e-94a6-4a44-9778-29af024167c0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393314000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "960746a4-8572-45fa-b74f-d31739cc2118",
          "citation": "SRS import [89A0HNR42S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=89A0HNR42S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393314000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04ceb0e9-8505-e376-52a0-c0246b5d4d53",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=98537-42-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "733c5155-bc35-4fca-80d7-0aec3510c487",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ffb18740-c98a-384d-5b9d-d976589a809f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "12031ade-894a-4863-8169-b21dd0d09a52",
          "citation": "https://en.wikipedia.org/wiki/BOB_(psychedelic)",
          "url": "https://en.wikipedia.org/wiki/BOB_(psychedelic)",
          "doc_type": "WIKI",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9a42b237-7dcf-4738-bb7e-d18ab538bc0b",
          "id": "9a42b237-7dcf-4738-bb7e-d18ab538bc0b",
          "molfile": "\n  Marvin  01132108012D          \n\n 16 16  0  0  0  0            999 V2000\n    1.4289    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.4289    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    0.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -0.8250    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 14  2  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 11  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(c(cc1C(CN)OC)OC)Br",
          "formula": "C11H16BrNO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a3c02556-31ed-41b9-8d90-806c81c690dd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "290.1536",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d491ab81-6213-4c62-a0c2-79cdbff00d16",
      "version": "15",
      "structure": {
        "id": "5b7eea0d-765b-4a4b-b67e-48c8a98b6886",
        "molfile": "\n  Marvin  01132104442D          \n\n 16 16  0  0  0  0            999 V2000\n   -1.4289    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -0.8250    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    0.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  2  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  6 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  3 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(c(cc1C(CN)OC)OC)Br",
        "formula": "C11H16BrNO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "290.1536",
        "optical_activity": "( + / - )",
        "references": [
          "733c5155-bc35-4fca-80d7-0aec3510c487",
          "1fe89a78-6fc7-4c67-aa13-3b5bef79ffbb"
        ],
        "stereo_centers": 1
      },
      "unii": "89A0HNR42S"
    }
  ]
}