{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0f2b0df5-58e1-49d7-8223-eaf780652ebe", "code": "153195-60-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=153195-60-9", "code_system": "CAS", "references": [ "a3c67041-3cec-4315-87ab-4051c626ec65", "72d1a785-8de9-4dde-92ea-42872cba5ee9" ] }, { "uuid": "70295fb7-103b-4bc3-9827-602fc779a2c3", "code": "71587535", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587535", "code_system": "PUBCHEM", "references": [ "a3c67041-3cec-4315-87ab-4051c626ec65" ] }, { "uuid": "ac0ccdbf-df45-4a2d-930d-ef4c39575f44", "code": "88IO74IA6V", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "105f1c43-6e14-4991-8040-53f887c0a44d", "name": "(±)-1,3-DIHYDROXYBENZENE BIS(2-ETHYLHEXANOATE)", "stdName": "(+/-)-1,3-DIHYDROXYBENZENE BIS(2-ETHYLHEXANOATE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "87f8f18e-ac3a-47ef-978e-0bc39bf705dd", "6c55fdfd-6037-459f-9ce2-3e255a2c1fd3" ], "display_name": false }, { "uuid": "e4a2d16e-d896-413a-aa6e-fa732cdb6cde", "name": "1,3-DIHYDROXYBENZENE BIS(2-ETHYLHEXANOATE)", "stdName": "1,3-DIHYDROXYBENZENE BIS(2-ETHYLHEXANOATE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6f657b66-9368-4898-89f1-dfc788c7d142", "87f8f18e-ac3a-47ef-978e-0bc39bf705dd" ], "display_name": false }, { "uuid": "a0377add-c050-4669-8245-e390f8d7ba35", "name": "1,3-DIHYDROXYBENZENE BIS(2-ETHYLHEXANOATE), (±)-", "stdName": "1,3-DIHYDROXYBENZENE BIS(2-ETHYLHEXANOATE), (+/-)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "87f8f18e-ac3a-47ef-978e-0bc39bf705dd", "6c55fdfd-6037-459f-9ce2-3e255a2c1fd3" ], "display_name": false }, { "uuid": "2e076d33-94f3-4815-90dc-61aec4c884ff", "name": "ACTOWHITE362", "stdName": "ACTOWHITE362", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "71999830-b95f-45a8-9ae0-ffa06e4162a6", "87f8f18e-ac3a-47ef-978e-0bc39bf705dd" ], "display_name": false }, { "uuid": "02218042-a15c-4ca4-9b11-f6072cf0889f", "name": "HEXANOIC ACID, 2-ETHYL-, 1,3-PHENYLENE ESTER", "stdName": "HEXANOIC ACID, 2-ETHYL-, 1,3-PHENYLENE ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6f657b66-9368-4898-89f1-dfc788c7d142", "87f8f18e-ac3a-47ef-978e-0bc39bf705dd" ], "display_name": false }, { "uuid": "7af0b61f-d566-41c0-8494-d67a5959c2be", "name": "RESORCINOL BIS-ETHYLHEXANOATE", "stdName": "RESORCINOL BIS-ETHYLHEXANOATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "71999830-b95f-45a8-9ae0-ffa06e4162a6", "ba8e119e-7df9-4596-bdaa-a2737d8226ac", "87f8f18e-ac3a-47ef-978e-0bc39bf705dd" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f9543f9e-6b37-4b90-8c28-a4cbe2791581", "name_org": "INCI" } ] } ], "references": [ { "uuid": "71999830-b95f-45a8-9ae0-ffa06e4162a6", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "87f8f18e-ac3a-47ef-978e-0bc39bf705dd", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6f657b66-9368-4898-89f1-dfc788c7d142", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6c55fdfd-6037-459f-9ce2-3e255a2c1fd3", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a3c67041-3cec-4315-87ab-4051c626ec65", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391590000, "tags": [ "NOMEN" ] }, { "uuid": "646e77dc-80b3-4655-8c2e-c74a9c0bd658", "citation": "SRS import [88IO74IA6V]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=88IO74IA6V", "doc_type": "SRS", "public_domain": true, "document_date": 1493391590000, "tags": [ "NOMEN" ] }, { "uuid": "ba8e119e-7df9-4596-bdaa-a2737d8226ac", "citation": "RESORCINOL BIS-ETHYLHEXANOATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "72d1a785-8de9-4dde-92ea-42872cba5ee9", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7e7f9692-07d9-4caa-9111-138ff153a4ba", "id": "7e7f9692-07d9-4caa-9111-138ff153a4ba", "molfile": "\n Marvin 01132106342D \n\n 26 26 0 0 0 0 999 V2000\n 6.8085 -6.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5230 -6.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5230 -5.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2375 -4.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2375 -4.0942 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.5230 -3.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8085 -4.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9519 -3.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9519 -2.8567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6664 -4.0942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3809 -3.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3809 -2.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0953 -2.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8098 -2.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8098 -3.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5243 -4.0942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5243 -4.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8098 -5.3317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2388 -5.3317 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 13.2388 -6.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9532 -6.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9532 -4.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6677 -5.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3822 -4.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0967 -5.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0953 -4.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 26 2 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 15 16 1 0 0 0 0\n 26 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 22 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)C(=O)Oc1cccc(c1)OC(=O)C(CC)CCCC", "formula": "C22H34O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "149a8280-8243-493d-924a-0c20cfd57f66" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "362.5038", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "8741f820-49c1-45e0-ba6a-6a5a4db50ff5", "version": "3", "structure": { "id": "d23d7582-5f9a-40d2-9572-e73753bc870f", "molfile": "\n Marvin 01132110522D \n\n 26 26 0 0 0 0 999 V2000\n 10.3809 -3.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0953 -4.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8098 -3.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5243 -4.0942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8098 -2.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0953 -2.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3809 -2.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6664 -4.0942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9519 -3.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2375 -4.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2375 -4.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5230 -5.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5230 -6.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8085 -6.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5230 -3.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8085 -4.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9519 -2.8567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9532 -6.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2388 -6.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8098 -5.3317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5243 -4.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2388 -5.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9532 -4.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6677 -5.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3822 -4.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0967 -5.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 1 7 2 0 0 0 0\n 1 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 10 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 9 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 22 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 21 4 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)C(=O)Oc1cccc(c1)OC(=O)C(CC)CCCC", "formula": "C22H34O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "362.5038", "optical_activity": "UNSPECIFIED", "references": [ "646e77dc-80b3-4655-8c2e-c74a9c0bd658", "6f657b66-9368-4898-89f1-dfc788c7d142" ], "stereo_centers": 2 }, "unii": "88IO74IA6V" } ] }