{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cae6dc1e-af3c-4ede-bb5d-79e06dc3a503",
          "code": "637-58-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=637-58-1",
          "code_system": "CAS",
          "references": [
            "78e7f911-8965-4918-bb43-c6d3f2cd1400",
            "62dd7d80-17b3-4b53-8077-a340d705419a"
          ]
        },
        {
          "uuid": "a69cf7ad-4601-4885-9d50-2d5849638463",
          "code": "C47682",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47682",
          "code_system": "NCI_THESAURUS",
          "references": [
            "78e7f911-8965-4918-bb43-c6d3f2cd1400"
          ]
        },
        {
          "uuid": "51d7a935-9cca-4eaa-9af9-c350e02d0b6e",
          "code": "21 CFR 346.10",
          "comments": "PART 346 -- ANORECTAL DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart B--Active Ingredients|Sec. 346.10 Local anesthetic active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=346.10",
          "code_system": "CFR",
          "references": [
            "78e7f911-8965-4918-bb43-c6d3f2cd1400"
          ]
        },
        {
          "uuid": "c85650c9-d4ea-4884-8d6a-99fa74705e1b",
          "code": "21 CFR 310.201",
          "comments": "PART 310 -- NEW DRUGS|Subpart C--New Drugs Exempted From Prescription-Dispensing Requirements|Sec. 310.201 Exemption for certain drugs limited by new-drug applications to prescription sale.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=310.201",
          "code_system": "CFR",
          "references": [
            "78e7f911-8965-4918-bb43-c6d3f2cd1400"
          ]
        },
        {
          "uuid": "5c99f10c-365a-45d3-bdc1-15ec7a2bf395",
          "code": "211-293-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.267",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "78e7f911-8965-4918-bb43-c6d3f2cd1400"
          ]
        },
        {
          "uuid": "6aaf81fe-ad74-4eac-a2c2-f1570528c26b",
          "code": "57555",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/57555/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "78e7f911-8965-4918-bb43-c6d3f2cd1400"
          ]
        },
        {
          "uuid": "3f3e663e-0262-49a1-ab32-14747186748e",
          "code": "m9099",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9099?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "78e7f911-8965-4918-bb43-c6d3f2cd1400"
          ]
        },
        {
          "uuid": "8e3b42e3-7afd-4ac4-87b5-9f000e7c22eb",
          "code": "SUB15004MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "78e7f911-8965-4918-bb43-c6d3f2cd1400"
          ]
        },
        {
          "uuid": "bc685b4e-dfd7-468d-8735-a16235f64987",
          "code": "CHEMBL1198",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1198",
          "code_system": "ChEMBL",
          "references": [
            "78e7f911-8965-4918-bb43-c6d3f2cd1400"
          ]
        },
        {
          "uuid": "c258fbec-4a4c-e4f4-fcac-436452740a07",
          "code": "7220",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7220",
          "code_system": "HSDB",
          "references": [
            "65222c94-2d1a-da29-cb71-92bf2b1e2ffa"
          ]
        },
        {
          "uuid": "53d72980-dfd4-6866-8301-393b127ce5be",
          "code": "DTXSID2047777",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2047777",
          "code_system": "EPA CompTox",
          "references": [
            "13e00162-3633-34fb-6973-f8ef3e55fe13"
          ]
        },
        {
          "uuid": "a5670352-610b-d795-4401-6a0f4edfff77",
          "code": "C245",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anesthetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C245",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a8d34fe1-6a64-2423-4bdb-1e39d0b86f46"
          ]
        },
        {
          "uuid": "ae731e63-8768-5d71-ddf4-86644c424ab1",
          "code": "73957",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73957",
          "code_system": "PUBCHEM",
          "references": [
            "d6d2fce7-2129-4d56-5e85-0b8df3e4b792"
          ]
        },
        {
          "uuid": "37cbf014-b14b-bb86-da68-29e96290e9f7",
          "code": "DBSALT001353",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT001353",
          "code_system": "DRUG BANK",
          "references": [
            "a8d34fe1-6a64-2423-4bdb-1e39d0b86f46"
          ]
        },
        {
          "uuid": "099ad0db-6a94-4404-ac10-51b28730846b",
          "code": "88AYB867L5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "90b2eaad-e5f9-dd2e-b601-6221e7f392ee",
          "code": "1554002",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1554002",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "a8d34fe1-6a64-2423-4bdb-1e39d0b86f46"
          ]
        },
        {
          "uuid": "b4c781a1-2d75-c335-3864-f86bf2cd9b7e",
          "code": "88AYB867L5",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=88AYB867L5",
          "code_system": "DAILYMED",
          "references": [
            "99526d24-66b3-e326-52f3-2975c9659be7"
          ]
        },
        {
          "uuid": "4e067c60-0ac9-cee4-d5c7-7477ab061a9e",
          "code": "100000078849",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b886d21d-9d17-f375-0a1a-43f338e15378"
          ]
        },
        {
          "uuid": "6cabb6b2-5af5-5f5d-52a9-6eac7cf0f387",
          "code": "25573",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=25573",
          "code_system": "NSC",
          "references": [
            "9eccf0d3-ecda-3455-7e11-cfde7102b56e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "31bcf1bc-295b-4e1f-ad3d-2e16279342d4",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3085279a-9231-478e-afb6-7f4422bd5170",
            "refuuid": "f8db396e-09ac-434d-85a1-53b22dd6af4f",
            "name": "PRAMOXINE",
            "unii": "068X84E056",
            "linking_id": "068X84E056",
            "ref_pname": "PRAMOXINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bbbf728b-eebb-4623-a97c-ba9c416a6823",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "4689935b-051d-4364-9cfd-4443e89725dd",
            "refuuid": "f8db396e-09ac-434d-85a1-53b22dd6af4f",
            "name": "PRAMOXINE",
            "unii": "068X84E056",
            "linking_id": "068X84E056",
            "ref_pname": "PRAMOXINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f4b84414-4a85-4831-8b4c-788888142da2",
          "name": "4-N-BUTOXYPHENYL.GAMMA.-MORPHOLINOPROPYL ETHER HYDROCHLORIDE",
          "stdName": "4-N-BUTOXYPHENYL.GAMMA.-MORPHOLINOPROPYL ETHER HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d942d44-696f-43c2-8eb6-9df96a9be2f3",
            "66fab7ac-71ba-4cda-a90b-1a9d7c3f2b96"
          ],
          "display_name": false
        },
        {
          "uuid": "c9143491-20e4-448d-9b9e-0e83fcd4024b",
          "name": "EPIFOAM COMPONENT PRAMOXINE HYDROCHLORIDE",
          "stdName": "EPIFOAM COMPONENT PRAMOXINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7f1d615-ac8a-4931-be51-6439c9430af6",
            "aebcde05-168c-4798-95ba-44d5082cc002"
          ],
          "display_name": false
        },
        {
          "uuid": "fa74b3c3-bda4-4e91-b98e-06216fa69a4e",
          "name": "NSC-25573",
          "stdName": "NSC-25573",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb750dfc-92c2-4da6-855a-4a36901de7b3",
            "8855f0dd-336c-4dd2-978e-e22245051068"
          ],
          "display_name": false
        },
        {
          "uuid": "e2ec3979-f78c-4dfe-9233-7748f593212a",
          "name": "PRAMOCAINE HYDROCHLORIDE",
          "stdName": "PRAMOCAINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24f8da94-6aae-4dcf-a13d-de80c3d4bc04",
            "a27604a7-5213-47d1-aa9c-d543986974e8",
            "3c75fcac-0d0f-4946-8108-cab2111d4b9f",
            "8855f0dd-336c-4dd2-978e-e22245051068",
            "e8b6fedf-972b-47d0-a4be-6e839556dc5f",
            "349829d8-1eed-4ec8-bcb7-7754bde484c1"
          ],
          "display_name": false
        },
        {
          "uuid": "eb25f7c3-ea76-4dad-a15d-9d02176a05ff",
          "name": "PRAMOCAINE HYDROCHLORIDE [MART.]",
          "stdName": "PRAMOCAINE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24f8da94-6aae-4dcf-a13d-de80c3d4bc04"
          ],
          "display_name": false
        },
        {
          "uuid": "7742ed05-b0e3-4433-8c35-52df8ad378a2",
          "name": "PRAMOSONE COMPONENT PRAMOXINE HYDROCHLORIDE",
          "stdName": "PRAMOSONE COMPONENT PRAMOXINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7f1d615-ac8a-4931-be51-6439c9430af6",
            "aebcde05-168c-4798-95ba-44d5082cc002"
          ],
          "display_name": false
        },
        {
          "uuid": "b675ed67-d165-46b9-9dc8-4706ebe4978e",
          "name": "PRAMOXINE HCL",
          "stdName": "PRAMOXINE HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "8855f0dd-336c-4dd2-978e-e22245051068",
            "67dbe53e-f1b5-4d75-98ab-3dc173490611",
            "9e7ced8a-3efe-4dac-8d85-ffc0551958a5",
            "c8cbb8df-23df-42d0-ae05-c4003cf3c765"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c008279a-b185-4351-b09f-1f5db4e2060c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ad40ab67-81aa-48aa-b272-f858a3f0ede3",
          "name": "PRAMOXINE HYDROCHLORIDE",
          "stdName": "PRAMOXINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "670a3eb3-669f-42ab-ae79-cad64e7254f7",
            "65c75ee3-323b-43eb-a324-e017e001bd4d",
            "ed035983-db4c-4c82-8e94-fe8f703e8a9d",
            "5a22416d-4d6a-450f-8248-d93c88df19f8",
            "2c196b1b-59d6-45b8-9fba-b3336d360fc5",
            "c3de7849-e7c3-4f72-83d4-a737e1d9058e",
            "3648d109-e7b4-418b-96dc-9ce3df19d584",
            "2054b9e6-0c10-48a0-b1de-7e9cdbaf610c",
            "93331ea0-5912-4ec5-a296-69cef1b98f79",
            "8855f0dd-336c-4dd2-978e-e22245051068",
            "84a3586c-5e4c-492b-ba6a-634423dcbcde",
            "b37c6649-0f06-4b17-980d-5f7c67f166e5",
            "cc5c8912-97d6-42bb-9efa-8759464abebf",
            "ef040776-09f2-4dcd-8abf-f47b0d4c85c2"
          ],
          "display_name": true
        },
        {
          "uuid": "16552738-64a8-47c7-9d26-4915f8ff228e",
          "name": "PRAMOXINE HYDROCHLORIDE [HSDB]",
          "stdName": "PRAMOXINE HYDROCHLORIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65c75ee3-323b-43eb-a324-e017e001bd4d",
            "8855f0dd-336c-4dd2-978e-e22245051068"
          ],
          "display_name": false
        },
        {
          "uuid": "f4740344-64a9-437d-a32c-4bd3ec07e0f5",
          "name": "PRAMOXINE HYDROCHLORIDE [MI]",
          "stdName": "PRAMOXINE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93331ea0-5912-4ec5-a296-69cef1b98f79",
            "8855f0dd-336c-4dd2-978e-e22245051068"
          ],
          "display_name": false
        },
        {
          "uuid": "ef354548-5924-4f67-a48c-181116c14e5e",
          "name": "PRAMOXINE HYDROCHLORIDE [ORANGE BOOK]",
          "stdName": "PRAMOXINE HYDROCHLORIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc5c8912-97d6-42bb-9efa-8759464abebf"
          ],
          "display_name": false
        },
        {
          "uuid": "2f45ef23-2e30-53bd-a3a0-c9d0f5d48684",
          "name": "PRAMOXINE HYDROCHLORIDE [USP MONOGRAPH]",
          "stdName": "PRAMOXINE HYDROCHLORIDE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1678349e-a85e-8886-f4bf-cc07068d91b7"
          ],
          "display_name": false
        },
        {
          "uuid": "2b3f8024-fb35-44a7-9538-c52b7984f1b6",
          "name": "PRAMOXINE HYDROCHLORIDE [USP-RS]",
          "stdName": "PRAMOXINE HYDROCHLORIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8855f0dd-336c-4dd2-978e-e22245051068",
            "c3de7849-e7c3-4f72-83d4-a737e1d9058e"
          ],
          "display_name": false
        },
        {
          "uuid": "d07c58de-e130-44d3-8de2-ab51c7274fad",
          "name": "PRAMOXINE HYDROCHLORIDE [VANDF]",
          "stdName": "PRAMOXINE HYDROCHLORIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8855f0dd-336c-4dd2-978e-e22245051068",
            "b37c6649-0f06-4b17-980d-5f7c67f166e5"
          ],
          "display_name": false
        },
        {
          "uuid": "7830dcd6-3c77-4780-b373-e95b27b47e27",
          "name": "PROCTOFOAM HC COMPONENT PRAMOXINE HYDROCHLORIDE",
          "stdName": "PROCTOFOAM HC COMPONENT PRAMOXINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7f1d615-ac8a-4931-be51-6439c9430af6",
            "aebcde05-168c-4798-95ba-44d5082cc002"
          ],
          "display_name": false
        },
        {
          "uuid": "ff5dc9d2-af6a-1fe0-363c-b739034f2065",
          "name": "Pramocaine hydrochloride [WHO-DD]",
          "stdName": "PRAMOCAINE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d78679cb-1ec2-8fe8-92f7-786829431487"
          ],
          "display_name": false
        },
        {
          "uuid": "11f31229-ffbd-40c4-8ec6-2a396d0fdc81",
          "name": "TRONOTHANE",
          "stdName": "TRONOTHANE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80187793-e41e-4a3f-9fdd-563c588a905d",
            "8855f0dd-336c-4dd2-978e-e22245051068"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5a22416d-4d6a-450f-8248-d93c88df19f8",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c8cbb8df-23df-42d0-ae05-c4003cf3c765",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a27604a7-5213-47d1-aa9c-d543986974e8",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed035983-db4c-4c82-8e94-fe8f703e8a9d",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7f1d615-ac8a-4931-be51-6439c9430af6",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aebcde05-168c-4798-95ba-44d5082cc002",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc5c8912-97d6-42bb-9efa-8759464abebf",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24f8da94-6aae-4dcf-a13d-de80c3d4bc04",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e7ced8a-3efe-4dac-8d85-ffc0551958a5",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8855f0dd-336c-4dd2-978e-e22245051068",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80187793-e41e-4a3f-9fdd-563c588a905d",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65c75ee3-323b-43eb-a324-e017e001bd4d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3de7849-e7c3-4f72-83d4-a737e1d9058e",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "349829d8-1eed-4ec8-bcb7-7754bde484c1",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b37c6649-0f06-4b17-980d-5f7c67f166e5",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93331ea0-5912-4ec5-a296-69cef1b98f79",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d942d44-696f-43c2-8eb6-9df96a9be2f3",
          "citation": "YES",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66fab7ac-71ba-4cda-a90b-1a9d7c3f2b96",
          "citation": "CFR",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb750dfc-92c2-4da6-855a-4a36901de7b3",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78e7f911-8965-4918-bb43-c6d3f2cd1400",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390553000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a0dc380-a20c-4bd2-997d-f452a50e135a",
          "citation": "SRS import [88AYB867L5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=88AYB867L5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390553000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c196b1b-59d6-45b8-9fba-b3336d360fc5",
          "citation": "PRAMOXINE HYDROCHLORIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ef040776-09f2-4dcd-8abf-f47b0d4c85c2",
          "citation": "PRAMOXINE HYDROCHLORIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c75fcac-0d0f-4946-8108-cab2111d4b9f",
          "citation": "PRAMOCAINE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "67dbe53e-f1b5-4d75-98ab-3dc173490611",
          "citation": "PRAMOXINE HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3648d109-e7b4-418b-96dc-9ce3df19d584",
          "citation": "PRAMOXINE HYDROCHLORIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "670a3eb3-669f-42ab-ae79-cad64e7254f7",
          "citation": "PRAMOXINE HYDROCHLORIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8b6fedf-972b-47d0-a4be-6e839556dc5f",
          "citation": "PRAMOCAINE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2054b9e6-0c10-48a0-b1de-7e9cdbaf610c",
          "citation": "PRAMOXINE HYDROCHLORIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "84a3586c-5e4c-492b-ba6a-634423dcbcde",
          "citation": "PRAMOXINE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "65222c94-2d1a-da29-cb71-92bf2b1e2ffa",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+637-58-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "13e00162-3633-34fb-6973-f8ef3e55fe13",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=637-58-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b886d21d-9d17-f375-0a1a-43f338e15378",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "a8d34fe1-6a64-2423-4bdb-1e39d0b86f46",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d6d2fce7-2129-4d56-5e85-0b8df3e4b792",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "62dd7d80-17b3-4b53-8077-a340d705419a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1678349e-a85e-8886-f4bf-cc07068d91b7",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "9eccf0d3-ecda-3455-7e11-cfde7102b56e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "99526d24-66b3-e326-52f3-2975c9659be7",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d78679cb-1ec2-8fe8-92f7-786829431487",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d17c680c-b35a-4709-a9c4-80730dcc457e",
          "id": "d17c680c-b35a-4709-a9c4-80730dcc457e",
          "molfile": "\n  Marvin  01132110502D          \n\n  1  0  0  0  0  0            999 V2000\n    3.4522   -2.9031    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0e858164-2499-4dd4-96fe-ea96931cc330"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "6fc95db8-7133-4e98-8318-87b7cf2982d9",
          "id": "6fc95db8-7133-4e98-8318-87b7cf2982d9",
          "molfile": "\n  Marvin  01132105482D          \n\n 21 22  0  0  0  0            999 V2000\n    0.0000   -2.1296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8225   -2.1296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2169   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0600   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4777   -0.7296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3130   -0.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7075   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5325   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9501   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7649   -0.7219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1903   -1.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0153   -1.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4200   -2.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2554   -2.1296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6808   -2.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4852   -2.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9183   -2.1296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4929   -1.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6627   -1.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5505    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7203    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 21  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 20  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\nM  END",
          "smiles": "CCCCOc1ccc(cc1)OCCCN2CCOCC2",
          "formula": "C17H27NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2a851e3b-f0c8-4740-8192-2283caa3685a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "293.4018",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3cc57afb-b4ea-43a6-beed-4c73dd684f16",
      "version": "23",
      "structure": {
        "id": "db28513e-d371-47eb-82ef-57ac59ec728a",
        "molfile": "\n  Marvin  01132111222D          \n\n 22 22  0  0  0  0            999 V2000\n    8.2554   -2.1296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9183   -2.1296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9501   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3130   -0.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5505    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7075   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5325   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7203    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4200   -2.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0153   -1.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7649   -0.7219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4777   -0.7296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6627   -1.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6808   -2.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4852   -2.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4929   -1.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1903   -1.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0600   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2169   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8225   -2.1296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.1296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4522   -2.9031    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2 16  1  0  0  0  0\n  3 11  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  3  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 17  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14  1  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 10  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 15  2  1  0  0  0  0\n  8  4  2  0  0  0  0\nM  END",
        "smiles": "CCCCOc1ccc(cc1)OCCCN2CCOCC2.Cl",
        "formula": "C17H27NO3.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "329.8627",
        "optical_activity": "NONE",
        "references": [
          "8a0dc380-a20c-4bd2-997d-f452a50e135a",
          "5a22416d-4d6a-450f-8248-d93c88df19f8"
        ],
        "stereo_centers": 0
      },
      "unii": "88AYB867L5"
    }
  ]
}