{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "40c32074-eb87-4752-b1bc-c15604e88a2b",
          "code": "118-08-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=118-08-1",
          "code_system": "CAS",
          "references": [
            "51f87c50-3cfd-4c38-b2e8-bdc7e975d9b9",
            "cc4e1ba8-a8db-4bf4-a3bf-ba722ab8dbb2"
          ]
        },
        {
          "uuid": "03bc4cf9-7281-46fb-907a-83be8ea7e5ce",
          "code": "C76031",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76031",
          "code_system": "NCI_THESAURUS",
          "references": [
            "51f87c50-3cfd-4c38-b2e8-bdc7e975d9b9"
          ]
        },
        {
          "uuid": "f3df5912-b37c-42f2-9fe3-6a4dbb957c61",
          "code": "C013024",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67013024",
          "code_system": "MESH",
          "references": [
            "51f87c50-3cfd-4c38-b2e8-bdc7e975d9b9"
          ]
        },
        {
          "uuid": "e21e2271-f12c-4ddf-a0c2-ba373041c44f",
          "code": "204-233-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.849",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "51f87c50-3cfd-4c38-b2e8-bdc7e975d9b9"
          ]
        },
        {
          "uuid": "f436e168-ba08-4983-ba7d-78fd4eae7d49",
          "code": "m6076",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6076?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "51f87c50-3cfd-4c38-b2e8-bdc7e975d9b9"
          ]
        },
        {
          "uuid": "cff60e2e-b4a6-42cd-b516-76ad14ce79f5",
          "code": "CHEMBL1256919",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1256919",
          "code_system": "ChEMBL",
          "references": [
            "51f87c50-3cfd-4c38-b2e8-bdc7e975d9b9"
          ]
        },
        {
          "uuid": "a99911ea-0ae9-4037-a4c3-429f6dc89a7f",
          "code": "197835",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/197835",
          "code_system": "PUBCHEM",
          "references": [
            "51f87c50-3cfd-4c38-b2e8-bdc7e975d9b9"
          ]
        },
        {
          "uuid": "a091f73e-d0ec-4ee0-951a-ba610f9e8a84",
          "code": "DTXSID9025409",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9025409",
          "code_system": "EPA CompTox",
          "references": [
            "8b067bec-2522-0625-9e58-cf47084b0e0c"
          ]
        },
        {
          "uuid": "ebae7ccb-225e-6641-0f52-b51e1637b488",
          "code": "C221",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Alkaloid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C221",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a75bc81c-0347-5695-39e4-7ca7ce7c84d4"
          ]
        },
        {
          "uuid": "82d66bb9-ec73-9deb-d9bf-1bd6b9d56ed9",
          "code": "1119 (Number of products:5)",
          "comments": "Dietary Supplement Label Database|Other|hydrastine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1119&item=hydrastine",
          "code_system": "DSLD",
          "references": [
            "a75bc81c-0347-5695-39e4-7ca7ce7c84d4"
          ]
        },
        {
          "uuid": "6e22de0f-0abf-49ab-b317-9a9ba430fd83",
          "code": "8890V3217X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ab51804e-9b72-5641-4113-4a67cd23ad2a",
          "code": "1313210",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1313210",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "a75bc81c-0347-5695-39e4-7ca7ce7c84d4"
          ]
        },
        {
          "uuid": "39a57ad9-0227-2f36-139f-0f766931d64a",
          "code": "Hydrastine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hydrastine",
          "code_system": "WIKIPEDIA",
          "references": [
            "865167a5-3432-1ca4-6545-75715b2ec14a"
          ]
        },
        {
          "uuid": "b7990301-eb6c-88f5-c61f-ddfc40cbfc99",
          "code": "757430",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=757430",
          "code_system": "NSC",
          "references": [
            "f89c903b-c16a-b14a-777f-cb5623be656e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "72d40f44-9fe2-404b-90c0-ed95b27d9a24",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d77ba42a-336f-4985-8b15-7f7a2a580131",
            "refuuid": "1aa019d7-ce95-407b-882d-fc1285b0ac88",
            "name": "HYDRASTINE",
            "unii": "8890V3217X",
            "linking_id": "8890V3217X",
            "ref_pname": "HYDRASTINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a888367c-4f5a-4b73-b57a-08fb7ae75db2",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "36df1281-abe2-4168-86bf-8044556313e1",
            "refuuid": "d68de102-364d-4ce3-9eb9-7febd235bf41",
            "name": "HYDRASTINE HYDROCHLORIDE",
            "unii": "562PDC2I9K",
            "linking_id": "562PDC2I9K",
            "ref_pname": "HYDRASTINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b5d69fc9-e02d-4db4-badb-f75a7c910632",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "465d553b-9a04-434b-bbd1-9948804b47c8",
            "refuuid": "d68de102-364d-4ce3-9eb9-7febd235bf41",
            "name": "HYDRASTINE HYDROCHLORIDE",
            "unii": "562PDC2I9K",
            "linking_id": "562PDC2I9K",
            "ref_pname": "HYDRASTINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d07ab7f2-0407-4c71-8f44-d4bc56f32acc",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "39470664-a15d-4ba6-b394-93646ce0b8d3",
            "refuuid": "acd31728-eac3-4005-a80f-aae4689f9eab",
            "name": "GOLDENSEAL",
            "unii": "ZW3Z11D0JV",
            "linking_id": "ZW3Z11D0JV",
            "ref_pname": "GOLDENSEAL"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f74a4aa0-45a1-43b5-ae3e-a44ab341b7f1",
          "name": "(S)-6,7-Dimethoxy-3-(R)-(6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)isobenzofuran-1(3H)-one",
          "stdName": "(S)-6,7-DIMETHOXY-3-(R)-(6-METHYL-5,6,7,8-TETRAHYDRO-(1,3)DIOXOLO(4,5-G)ISOQUINOLIN-5-YL)ISOBENZOFURAN-1(3H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b11bf37f-be05-434a-b2dc-d134f81250d2"
          ],
          "display_name": false
        },
        {
          "uuid": "1ec65fae-d802-43c9-9a49-8caf23e3dfbb",
          "name": "HYDRASTINE",
          "stdName": "HYDRASTINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b11bf37f-be05-434a-b2dc-d134f81250d2",
            "453b430c-e1e0-4786-bf6d-4f817a7118bb",
            "3b8f143d-07f0-433f-8c28-4ae2da0c961f",
            "3754be79-fbdd-479f-bdec-9cdb882f497c",
            "faab998d-2aae-4e1b-bd36-9da882ba9217",
            "9ae5d9f8-4e65-49b4-87d6-0d14f2afebec",
            "117ca535-a7b5-4ec7-b384-488c190de01f",
            "3c31c8af-39b7-43fc-936a-86d4ce6a7d26"
          ],
          "display_name": true
        },
        {
          "uuid": "91186bdf-7bae-4f91-ae19-3cf0508e7e3f",
          "name": "HYDRASTINE (CONSTITUENT OF GOLDENSEAL) [DSC]",
          "stdName": "HYDRASTINE (CONSTITUENT OF GOLDENSEAL) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566a7152-3f61-44d1-9d63-6ed20d02bb73",
            "faab998d-2aae-4e1b-bd36-9da882ba9217"
          ],
          "display_name": false
        },
        {
          "uuid": "a11a762e-8109-4754-a4b7-78d3ba8fb294",
          "name": "HYDRASTINE [MI]",
          "stdName": "HYDRASTINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "453b430c-e1e0-4786-bf6d-4f817a7118bb",
            "faab998d-2aae-4e1b-bd36-9da882ba9217"
          ],
          "display_name": false
        },
        {
          "uuid": "91736d79-9a69-485c-a598-1cc07d9c160e",
          "name": "HYDRASTINE [USP-RS]",
          "stdName": "HYDRASTINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b8f143d-07f0-433f-8c28-4ae2da0c961f",
            "faab998d-2aae-4e1b-bd36-9da882ba9217"
          ],
          "display_name": false
        },
        {
          "uuid": "5bdaf503-af78-414a-0b00-09c3f835ddf4",
          "name": "Hydrastine [WHO-DD]",
          "stdName": "HYDRASTINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72888558-6ff6-4414-40eb-7b733d19b9d3"
          ],
          "display_name": false
        },
        {
          "uuid": "49d8e23e-2ffe-9f8f-20bc-02bf003566ac",
          "name": "NSC-757430",
          "stdName": "NSC-757430",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f89c903b-c16a-b14a-777f-cb5623be656e"
          ],
          "display_name": false
        },
        {
          "uuid": "e6254585-d8ee-41f1-9a18-b6f6f968ccf0",
          "name": "PHTHALIDE (S)-6,7-DIMETHOXY-3-(R)-(5,6,7,8-TETRAHYDRO-6-METHYL-1,3-DIOXOLO(4,5-G)ISOQUINOLIN-5-YL)-",
          "stdName": "PHTHALIDE (S)-6,7-DIMETHOXY-3-(R)-(5,6,7,8-TETRAHYDRO-6-METHYL-1,3-DIOXOLO(4,5-G)ISOQUINOLIN-5-YL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b11bf37f-be05-434a-b2dc-d134f81250d2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b11bf37f-be05-434a-b2dc-d134f81250d2",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "453b430c-e1e0-4786-bf6d-4f817a7118bb",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "faab998d-2aae-4e1b-bd36-9da882ba9217",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b8f143d-07f0-433f-8c28-4ae2da0c961f",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c31c8af-39b7-43fc-936a-86d4ce6a7d26",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "566a7152-3f61-44d1-9d63-6ed20d02bb73",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51f87c50-3cfd-4c38-b2e8-bdc7e975d9b9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf1d3391-e9b9-419b-a594-e7bdc3a57daa",
          "citation": "ARTICLE",
          "doc_type": "LEUNGS ENCYLOPEDIA OF COMMON NATURAL INGREDIENTS 3RD ED.",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31700c32-6bd9-4423-9b5c-4436ff6b7c7e",
          "citation": "MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a917a9f8-86f2-418c-8b14-875c3a5ac1c3",
          "citation": "SRS import [8890V3217X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8890V3217X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "117ca535-a7b5-4ec7-b384-488c190de01f",
          "citation": "HYDRASTINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3754be79-fbdd-479f-bdec-9cdb882f497c",
          "citation": "HYDRASTINE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ae5d9f8-4e65-49b4-87d6-0d14f2afebec",
          "citation": "HYDRASTINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8b067bec-2522-0625-9e58-cf47084b0e0c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=118-08-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a75bc81c-0347-5695-39e4-7ca7ce7c84d4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "865167a5-3432-1ca4-6545-75715b2ec14a",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "cc4e1ba8-a8db-4bf4-a3bf-ba722ab8dbb2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f89c903b-c16a-b14a-777f-cb5623be656e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "72888558-6ff6-4414-40eb-7b733d19b9d3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5e1fe467-2249-485b-bff4-c7bc93e7d310",
          "id": "5e1fe467-2249-485b-bff4-c7bc93e7d310",
          "molfile": "\n  Marvin  01132104522D          \n\n 28 32  0  0  1  0            999 V2000\n    2.0650   -1.6574    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.7823   -2.0650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7958   -2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5403   -3.2958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3477   -2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3477   -2.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6276   -1.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0951   -2.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0951   -2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8124   -3.2958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8124   -4.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6276   -3.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6276   -4.1489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3558   -4.5755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0650   -0.8423    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.7823   -0.4348    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    3.5240   -0.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7823    0.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0650    0.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3477    0.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6276    0.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0951    0.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8124    0.7961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5297    0.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5297   -0.4184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0951   -0.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6276   -0.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3477   -0.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  6  1  0  0  0  0\n 15  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n 12  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 12  1  0  0  0  0\n 11 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  1  1  0  0  0\n 28 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 20 28  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 22 26  1  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\nM  END",
          "smiles": "CN1CCc2cc3c(cc2[C@@H]1[C@@H]4c5ccc(c(c5C(=O)O4)OC)OC)OCO3",
          "formula": "C21H21NO6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "67a12962-37af-4756-804b-a31d036a50ab"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "383.3953",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1aa019d7-ce95-407b-882d-fc1285b0ac88",
      "version": "15",
      "structure": {
        "id": "80fb551a-a305-4ef5-a557-515c9d34259e",
        "molfile": "\n  Marvin  01132106422D          \n\n 30 34  0  0  1  0            999 V2000\n    1.3477   -2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7958   -2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3477   -2.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0650   -1.6574    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7823   -2.0650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3477   -0.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0650   -0.8423    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.6276   -3.2958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7823   -0.4348    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3477    0.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6276   -0.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0951   -0.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0951    0.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6276   -1.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6276    0.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5403   -3.2958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5297   -0.4184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8124    0.7961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0951   -2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5297    0.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7823    0.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0650    0.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0951   -2.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6276   -4.1489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8124   -3.2958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5240   -0.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3558   -4.5755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8124   -4.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7741   -1.2499    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3477   -1.2471    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  6  2  0  0  0  0\n 11  6  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15 10  1  0  0  0  0\n 16  2  2  0  0  0  0\n 17 12  1  0  0  0  0\n 18 13  1  0  0  0  0\n 19  8  2  0  0  0  0\n 20 17  1  0  0  0  0\n 21  9  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 19  1  0  0  0  0\n 24  8  1  0  0  0  0\n 25 19  1  0  0  0  0\n 26  9  1  0  0  0  0\n 27 24  1  0  0  0  0\n 28 25  1  0  0  0  0\n  7 29  1  6  0  0  0\n  4 30  1  6  0  0  0\n  5  4  1  0  0  0  0\n 23 14  2  0  0  0  0\n 22 10  1  0  0  0  0\n 13 15  2  0  0  0  0\n 20 18  1  0  0  0  0\nM  END",
        "smiles": "CN1CCc2cc3c(cc2[C@]1([H])[C@]4([H])c5ccc(c(c5C(=O)O4)OC)OC)OCO3",
        "formula": "C21H21NO6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "383.3953",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b11bf37f-be05-434a-b2dc-d134f81250d2",
          "a917a9f8-86f2-418c-8b14-875c3a5ac1c3"
        ],
        "stereo_centers": 2
      },
      "unii": "8890V3217X"
    }
  ]
}