{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b0b1ba92-ae09-4e41-9a93-e14fa6da86c7", "code": "143617-02-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=143617-02-1", "code_system": "CAS", "references": [ "160a8043-7d07-4a2d-b80e-c361a7bd653d", "afafd5c4-7460-4fe7-a886-4a2e25d10dd1" ] }, { "uuid": "055db4d1-a247-4a9e-b4f0-168d4b5b3fdf", "code": "C539158", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67539158", "code_system": "MESH", "references": [ "160a8043-7d07-4a2d-b80e-c361a7bd653d" ] }, { "uuid": "81fd574a-c3cb-41e4-ba05-0235cf183da0", "code": "16062094", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16062094", "code_system": "PUBCHEM", "references": [ "160a8043-7d07-4a2d-b80e-c361a7bd653d" ] }, { "uuid": "73840693-2b2b-4e77-9c7d-945cfee2c075", "code": "88458S9198", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "827c0d48-d33b-e0fc-ab0c-5983dc4fc1e3", "code": "DTXSID50162480", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50162480", "code_system": "EPA CompTox", "references": [ "bb75b2e6-9231-2a68-77c5-6eca55b9aafb" ] }, { "uuid": "2b73b35e-97a0-ffb0-252a-a261629b73e0", "code": "100000177490", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "3247b145-bd0f-4056-2fc4-85996ce6c615" ] } ], "substance_class": "chemical", "names": [ { "uuid": "98c4d560-7a63-4e34-a626-308ae5c71bd5", "name": ".BETA.-D-GLUCOPYRANOSIDE, 2-(3,4-DIHYDROXYPHENYL)ETHYL O-.BETA.-D-GALACTOPYRANOSYL-(1-2)-O-6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL-(1-3)-, 4-((2E)-3-(3,4-DIHYDROXYPHENYL)-2-PROPENOATE)", "stdName": ".BETA.-D-GLUCOPYRANOSIDE, 2-(3,4-DIHYDROXYPHENYL)ETHYL O-.BETA.-D-GALACTOPYRANOSYL-(1-2)-O-6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL-(1-3)-, 4-((2E)-3-(3,4-DIHYDROXYPHENYL)-2-PROPENOATE)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "765df75b-7645-48a1-9b62-55f1dc8eea56", "4a28bcc8-e7e3-4276-9c39-24f09b951c32" ], "display_name": false }, { "uuid": "9a0e638e-9d2a-473b-b066-a4d06fb4ac7b", "name": ".BETA.-D-GLUCOPYRANOSIDE, 2-(3,4-DIHYDROXYPHENYL)ETHYL O-.BETA.-D-GALACTOPYRANOSYL-(1-2)-O-6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL-(1-3)-, 4-(3-(3,4-DIHYDROXYPHENYL)-2-PROPENOATE), (E)-", "stdName": ".BETA.-D-GLUCOPYRANOSIDE, 2-(3,4-DIHYDROXYPHENYL)ETHYL O-.BETA.-D-GALACTOPYRANOSYL-(1-2)-O-6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL-(1-3)-, 4-(3-(3,4-DIHYDROXYPHENYL)-2-PROPENOATE), (E)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "765df75b-7645-48a1-9b62-55f1dc8eea56", "4a28bcc8-e7e3-4276-9c39-24f09b951c32" ], "display_name": false }, { "uuid": "9bd78eff-92fd-4e5b-bc32-1ac23f0b4785", "name": "LAMIUSIDE A", "stdName": "LAMIUSIDE A", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "765df75b-7645-48a1-9b62-55f1dc8eea56", "4a28bcc8-e7e3-4276-9c39-24f09b951c32" ], "display_name": false }, { "uuid": "8994a917-92b4-498b-82e2-91ea79234134", "name": "TEUPOLIOSIDE", "stdName": "TEUPOLIOSIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "1dc4390f-3d5a-46f5-bea7-642d6931a1d9", "00f13bfa-26c4-4cdd-bfa7-b7a728ab7f59", "4a28bcc8-e7e3-4276-9c39-24f09b951c32" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "5117769f-82e4-4a96-89fc-0d0b2d1b6536", "name_org": "INCI" } ] }, { "uuid": "2793afb4-eeb3-4b82-a7b6-b624bd68f0f7", "name": "TEUPOLIOSIDE HTN", "stdName": "TEUPOLIOSIDE HTN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "1dc4390f-3d5a-46f5-bea7-642d6931a1d9", "4a28bcc8-e7e3-4276-9c39-24f09b951c32" ], "display_name": false }, { "uuid": "d3df2016-0c7b-4959-ab08-b1282eaf5a94", "name": "TEUPOLIOSIDE, (-)-", "stdName": "TEUPOLIOSIDE, (-)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "50665f8d-8022-4cb2-922b-3d2d76376ed6", "4a28bcc8-e7e3-4276-9c39-24f09b951c32" ], "display_name": false }, { "uuid": "f6fb304d-0f58-49a3-ae4c-5735e0daa6ec", "name": "TRANS-LAMALBOSIDE", "stdName": "TRANS-LAMALBOSIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "765df75b-7645-48a1-9b62-55f1dc8eea56", "4a28bcc8-e7e3-4276-9c39-24f09b951c32" ], "display_name": false } ], "references": [ { "uuid": "1dc4390f-3d5a-46f5-bea7-642d6931a1d9", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4a28bcc8-e7e3-4276-9c39-24f09b951c32", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "765df75b-7645-48a1-9b62-55f1dc8eea56", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "50665f8d-8022-4cb2-922b-3d2d76376ed6", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "160a8043-7d07-4a2d-b80e-c361a7bd653d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391623000, "tags": [ "NOMEN" ] }, { "uuid": "23329b24-9a23-448f-bfa2-da09c38270c1", "citation": "SRS import [88458S9198]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=88458S9198", "doc_type": "SRS", "public_domain": true, "document_date": 1493391623000, "tags": [ "NOMEN" ] }, { "uuid": "00f13bfa-26c4-4cdd-bfa7-b7a728ab7f59", "citation": "TEUPOLIOSIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "008ef9e7-8783-8822-c539-d2401282193b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=143617-02-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "afafd5c4-7460-4fe7-a886-4a2e25d10dd1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "bb75b2e6-9231-2a68-77c5-6eca55b9aafb", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "3247b145-bd0f-4056-2fc4-85996ce6c615", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4c54667c-3e64-40e5-a44d-77246cdefa3b", "id": "4c54667c-3e64-40e5-a44d-77246cdefa3b", "molfile": "\n Marvin 01132103592D \n\n 55 59 0 0 1 0 999 V2000\n 5.6934 -7.3497 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.9180 -7.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8367 -8.1620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6119 -8.4441 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.7552 -9.2566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0407 -9.6692 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.3263 -9.2567 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.3262 -8.4317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6118 -9.6693 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 3.8973 -9.2568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1828 -9.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4683 -9.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7539 -9.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7539 -10.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0394 -10.9069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3250 -10.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3895 -10.9069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3249 -9.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3895 -9.2569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0394 -9.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6119 -10.4942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3264 -10.9067 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.3264 -11.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0409 -12.1441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0408 -10.4941 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.7553 -10.9066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3872 -10.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2440 -9.5638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1625 -10.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7945 -10.1281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5698 -10.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7130 -11.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4883 -11.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1203 -10.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8955 -11.2566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9770 -10.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6089 -9.6316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2017 -9.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2438 -7.9138 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.0191 -8.1960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6511 -7.6657 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.5078 -6.8532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1397 -6.3228 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.9964 -5.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6284 -4.9801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9150 -6.6049 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 10.5470 -6.0747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0583 -7.4174 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 10.8335 -7.6995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4263 -7.9477 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.5696 -8.7602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1006 -7.1014 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.7325 -6.5710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3253 -6.8193 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.1820 -6.0068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 54 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 6 0 0 0\n 4 39 1 0 0 0 0\n 6 5 1 1 0 0 0\n 6 7 1 0 0 0 0\n 25 6 1 0 0 0 0\n 7 8 1 6 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 21 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 20 2 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 16 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 18 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 1 0 0 0\n 25 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 26 1 6 0 0 0\n 27 26 1 0 0 0 0\n 27 28 2 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 38 2 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 34 2 0 0 0 0\n 36 37 1 0 0 0 0\n 38 36 1 0 0 0 0\n 39 40 1 1 0 0 0\n 39 52 1 0 0 0 0\n 41 40 1 6 0 0 0\n 41 42 1 0 0 0 0\n 41 50 1 0 0 0 0\n 43 42 1 0 0 0 0\n 43 44 1 6 0 0 0\n 46 43 1 0 0 0 0\n 44 45 1 0 0 0 0\n 46 47 1 6 0 0 0\n 48 46 1 0 0 0 0\n 48 49 1 6 0 0 0\n 50 48 1 0 0 0 0\n 50 51 1 1 0 0 0\n 52 53 1 1 0 0 0\n 52 54 1 0 0 0 0\n 54 55 1 6 0 0 0\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](OCCc3ccc(c(c3)O)O)O[C@H](CO)[C@H]2OC(=O)/C=C/c4ccc(c(c4)O)O)O)O[C@H]5[C@@H]([C@H]([C@H]([C@@H](CO)O5)O)O)O)O)O", "formula": "C35H46O20", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1ba886f3-83ff-40b2-a493-5d8ef9fb68e2" }, "defined_stereo": 15, "ez_centers": 1, "molecular_weight": "786.7291", "optical_activity": "UNSPECIFIED", "stereo_centers": 15 } ], "definition_level": "COMPLETE", "uuid": "09a2fa09-8e48-4f0a-ab6c-42dea86aac08", "version": "7", "structure": { "id": "0f8472fb-338c-4cd8-b032-dd373851f861", "molfile": "\n Marvin 01132101022D \n\n 55 59 0 0 1 0 999 V2000\n 6.6119 -8.4441 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.2438 -7.9138 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.6511 -7.6657 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.4263 -7.9477 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.0583 -7.4174 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.9150 -6.6049 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.1397 -6.3228 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.1006 -7.1014 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.3253 -6.8193 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.6934 -7.3497 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.0407 -9.6692 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.0408 -10.4941 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.3264 -10.9067 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.6118 -9.6693 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.3263 -9.2567 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.0191 -8.1960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5696 -8.7602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8335 -7.6995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5470 -6.0747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9964 -5.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6284 -4.9801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5078 -6.8532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7325 -6.5710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1820 -6.0068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9180 -7.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8367 -8.1620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7552 -9.2566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7553 -10.9066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3872 -10.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2440 -9.5638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1625 -10.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7945 -10.1281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5698 -10.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7130 -11.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4883 -11.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1203 -10.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8955 -11.2566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9770 -10.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6089 -9.6316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2017 -9.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3264 -11.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0409 -12.1441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6119 -10.4942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8973 -9.2568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1828 -9.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4683 -9.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7539 -9.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0394 -9.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3249 -9.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3895 -9.2569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3250 -10.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3895 -10.9069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0394 -10.9069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7539 -10.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3262 -8.4317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 2 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 11 1 0 0 0 0\n 3 16 1 6 0 0 0\n 2 16 1 1 0 0 0\n 4 17 1 1 0 0 0\n 5 18 1 6 0 0 0\n 6 19 1 6 0 0 0\n 7 20 1 6 0 0 0\n 20 21 1 0 0 0 0\n 7 22 1 0 0 0 0\n 3 22 1 0 0 0 0\n 8 23 1 1 0 0 0\n 9 24 1 6 0 0 0\n 10 25 1 1 0 0 0\n 10 26 1 0 0 0 0\n 1 26 1 0 0 0 0\n 11 27 1 1 0 0 0\n 1 27 1 6 0 0 0\n 12 28 1 6 0 0 0\n 29 28 1 0 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 2 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 2 0 0 0 0\n 36 37 1 0 0 0 0\n 38 36 1 0 0 0 0\n 38 39 1 0 0 0 0\n 40 38 2 0 0 0 0\n 33 40 1 0 0 0 0\n 13 41 1 1 0 0 0\n 41 42 1 0 0 0 0\n 13 43 1 0 0 0 0\n 14 43 1 0 0 0 0\n 14 44 1 1 0 0 0\n 45 44 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 1 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 2 0 0 0 0\n 49 50 1 0 0 0 0\n 49 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 51 53 2 0 0 0 0\n 53 54 1 0 0 0 0\n 47 54 2 0 0 0 0\n 15 55 1 6 0 0 0\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](OCCc3ccc(c(c3)O)O)O[C@H](CO)[C@H]2OC(=O)/C=C/c4ccc(c(c4)O)O)O)O[C@H]5[C@@H]([C@H]([C@H]([C@@H](CO)O5)O)O)O)O)O", "formula": "C35H46O20", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 15, "ez_centers": 1, "molecular_weight": "786.7291", "optical_activity": "UNSPECIFIED", "references": [ "765df75b-7645-48a1-9b62-55f1dc8eea56", "23329b24-9a23-448f-bfa2-da09c38270c1" ], "stereo_centers": 15 }, "unii": "88458S9198" } ] }