{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d5870fa4-a1ee-439e-8086-d06a465c4e2c",
          "code": "5745",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5745",
          "code_system": "PUBCHEM",
          "references": [
            "0872c94c-3ebb-4848-aeea-787d23c5e827"
          ]
        },
        {
          "uuid": "266aea5d-f701-4aed-8cc8-b1728b1b2b08",
          "code": "50-04-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=50-04-4",
          "code_system": "CAS",
          "references": [
            "0872c94c-3ebb-4848-aeea-787d23c5e827",
            "4bc5b79a-4147-4d9f-af84-997354798866"
          ]
        },
        {
          "uuid": "44e8ab36-6e90-4881-84d0-e7506a6e506f",
          "code": "C1058",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1058",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0872c94c-3ebb-4848-aeea-787d23c5e827"
          ]
        },
        {
          "uuid": "9476b2f0-e924-4e4e-9f9d-41feff81640e",
          "code": "C015087",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67015087",
          "code_system": "MESH",
          "references": [
            "0872c94c-3ebb-4848-aeea-787d23c5e827"
          ]
        },
        {
          "uuid": "d629a3d8-3dc7-4884-a33c-502714c383e7",
          "code": "200-006-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.006",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0872c94c-3ebb-4848-aeea-787d23c5e827"
          ]
        },
        {
          "uuid": "ef8c2c75-583e-4eaa-9292-d8203284f801",
          "code": "21655",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/21655/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0872c94c-3ebb-4848-aeea-787d23c5e827"
          ]
        },
        {
          "uuid": "1f51689d-b863-4d08-a628-952d1b074ad0",
          "code": "m3795",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3795?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0872c94c-3ebb-4848-aeea-787d23c5e827"
          ]
        },
        {
          "uuid": "c568e44a-3a83-41c5-b633-9282716dec9c",
          "code": "DB01380",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01380",
          "code_system": "DRUG BANK",
          "references": [
            "0872c94c-3ebb-4848-aeea-787d23c5e827"
          ]
        },
        {
          "uuid": "197c08a7-a422-47f3-aede-0dee3b692d3d",
          "code": "SUB01467MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0872c94c-3ebb-4848-aeea-787d23c5e827"
          ]
        },
        {
          "uuid": "9a66a190-8448-4100-9da0-b9ee4589ea42",
          "code": "CHEMBL1650",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1650",
          "code_system": "ChEMBL",
          "references": [
            "0872c94c-3ebb-4848-aeea-787d23c5e827"
          ]
        },
        {
          "uuid": "acd391cb-1cfd-5ec4-07b1-362260707e4e",
          "code": "DTXSID0022858",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0022858",
          "code_system": "EPA CompTox",
          "references": [
            "4cfb8ded-185c-51b9-c919-788d6660c362"
          ]
        },
        {
          "uuid": "5b71a01f-fd6f-76b4-761a-fc3c0a0ad804",
          "code": "C521",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Adrenal Agent[C2364]|Therapeutic Corticosteroid[C211]|Therapeutic Glucocorticoid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C521",
          "code_system": "NCI_THESAURUS",
          "references": [
            "25a627fd-0a7d-69ea-0250-58053e00599c"
          ]
        },
        {
          "uuid": "07bed336-8254-5814-0421-1335c0ce70b9",
          "code": "734",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/734",
          "code_system": "DRUG CENTRAL",
          "references": [
            "25a627fd-0a7d-69ea-0250-58053e00599c"
          ]
        },
        {
          "uuid": "49a4bf95-76fa-4a10-afaa-165bb5378bcf",
          "code": "883WKN7W8X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "df921823-e61d-7486-89f5-4a633fd6da23",
          "code": "1150003",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1150003",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "25a627fd-0a7d-69ea-0250-58053e00599c"
          ]
        },
        {
          "uuid": "e63c48d9-635f-a487-3606-16ada30ef864",
          "code": "100000087965",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b7f00fa0-d037-24ef-7676-784365cd599d"
          ]
        },
        {
          "uuid": "c0b5ee5d-0237-1b2b-f4ca-1ce51757933d",
          "code": "49420",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=49420",
          "code_system": "NSC",
          "references": [
            "47118272-0d2b-52fc-cfa6-592174aab93e"
          ]
        },
        {
          "uuid": "069ee51b-9ea8-b813-e292-5b6958e6d592",
          "code": "883WKN7W8X",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=883WKN7W8X",
          "code_system": "DAILYMED",
          "references": [
            "b034af36-b38d-3eca-2a33-8b22bff32642"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "40c74233-c728-4e0b-9f38-28b0c0656def",
          "amount": {
            "uuid": "dda7d703-4a5a-4e22-8a2b-f3a7df4c269d"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "56264809-8fcc-49ce-b47d-6e2fb049e817",
            "refuuid": "b3968dd7-d6f1-40e3-bef0-6dc92a4921ed",
            "name": "Cortisone",
            "unii": "V27W9254FZ",
            "linking_id": "V27W9254FZ",
            "ref_pname": "Cortisone",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "49d870b0-6319-440f-91ac-9a4173407f4c",
          "amount": {
            "uuid": "6fcdda5d-7f15-4bf0-98c2-ec1356b61712",
            "type": "WEIGHT PERCENT",
            "units": "%",
            "high_limit": 0.3,
            "non_numeric_value": "PEAK VALUE"
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "4acf7d26-f8b2-3446-6147-0fb45a343f61"
          ],
          "related_substance": {
            "uuid": "e41738ea-e68e-4e27-8390-16dee4c70f73",
            "refuuid": "c327de78-59da-4fc0-b780-eb9ded06297d",
            "name": "Hydrocortisone Acetate",
            "unii": "3X7931PO74",
            "linking_id": "3X7931PO74",
            "ref_pname": "Hydrocortisone Acetate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "585314f9-87b1-473c-9534-8f168a0efae0",
          "amount": {
            "uuid": "b30b54c7-c739-4688-9f39-01a3de4bfd96",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "1261050f-f2a2-e8aa-5a43-8d8080aa1239"
          ],
          "related_substance": {
            "uuid": "a796a6d2-86b8-4fda-b1bf-663a0cd2fd4f",
            "refuuid": "c327de78-59da-4fc0-b780-eb9ded06297d",
            "name": "Hydrocortisone Acetate",
            "unii": "3X7931PO74",
            "linking_id": "3X7931PO74",
            "ref_pname": "Hydrocortisone Acetate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "51f65fb5-1f30-41f0-9129-4e19f419b061",
          "name": "17,21-Dihydroxypregn-4-ene-3,11,20-trione 21-acetate",
          "stdName": "17,21-DIHYDROXYPREGN-4-ENE-3,11,20-TRIONE 21-ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b5fa51d-6efb-4b35-8e9a-9f8887d9c891"
          ],
          "display_name": false
        },
        {
          "uuid": "fff4170a-d36e-46a1-a5d3-1abd7a9d06d7",
          "name": "17-HYDROXY-3,11,20-TRIOXOPREGN-4-EN-21-YL ACETATE",
          "stdName": "17-HYDROXY-3,11,20-TRIOXOPREGN-4-EN-21-YL ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4acf7d26-f8b2-3446-6147-0fb45a343f61",
            "4b5fa51d-6efb-4b35-8e9a-9f8887d9c891"
          ],
          "display_name": false
        },
        {
          "uuid": "d4153cb4-5a7f-4b6c-8e69-481f05d65091",
          "name": "CORTISONE 21-ACETATE",
          "stdName": "CORTISONE 21-ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68395b68-05f4-41eb-9932-5e0359781015",
            "db729516-39eb-4622-a723-ea26420b6285",
            "9282ccc0-4e8b-4a2d-9b4c-dff85355a096"
          ],
          "display_name": false
        },
        {
          "uuid": "82273f46-069e-4af9-96f7-f8c91e6ccac3",
          "name": "CORTISONE 21-ACETATE [MI]",
          "stdName": "CORTISONE 21-ACETATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68395b68-05f4-41eb-9932-5e0359781015",
            "9282ccc0-4e8b-4a2d-9b4c-dff85355a096"
          ],
          "display_name": false
        },
        {
          "uuid": "17f917f7-d23d-5129-4234-457509ff37e6",
          "name": "CORTISONE ACETATE [EP MONOGRAPH]",
          "stdName": "CORTISONE ACETATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c82ed2d-8b2b-023a-e7c7-52c91fed56ed"
          ],
          "display_name": false
        },
        {
          "uuid": "15fb94a6-261b-4e3f-8b66-2d95fc5be64e",
          "name": "CORTISONE ACETATE [JAN]",
          "stdName": "CORTISONE ACETATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6f015e0-85ad-261c-5c04-c5237b9efb01"
          ],
          "display_name": false
        },
        {
          "uuid": "aefbdd6d-117b-45c1-bca0-fe59a9fa2225",
          "name": "CORTISONE ACETATE [MART.]",
          "stdName": "CORTISONE ACETATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2533657a-0f49-44b2-a115-ab8b7a335f3d"
          ],
          "display_name": false
        },
        {
          "uuid": "18fd5b72-b4f6-49e2-9412-5166252eb70d",
          "name": "CORTISONE ACETATE [ORANGE BOOK]",
          "stdName": "CORTISONE ACETATE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26e48300-3d0d-47c9-94ce-caa49ccb3236"
          ],
          "display_name": false
        },
        {
          "uuid": "67829e7e-1259-c836-48d9-44d06de4c83b",
          "name": "CORTISONE ACETATE [USP MONOGRAPH]",
          "stdName": "CORTISONE ACETATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "968e5749-dc26-b52e-8bf8-06f5144e7c19"
          ],
          "display_name": false
        },
        {
          "uuid": "b9d8abf7-0257-47cb-ba44-dc62a7f774f7",
          "name": "CORTISONE ACETATE [USP-RS]",
          "stdName": "CORTISONE ACETATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e4c884a-661a-4ecf-ab35-88718f57e728",
            "68395b68-05f4-41eb-9932-5e0359781015"
          ],
          "display_name": false
        },
        {
          "uuid": "54dd21e7-fef2-4a69-98ce-113d7cb44041",
          "name": "CORTISONE ACETATE [VANDF]",
          "stdName": "CORTISONE ACETATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68395b68-05f4-41eb-9932-5e0359781015",
            "cf5f0186-4603-46d6-be14-ba039eaf7d22"
          ],
          "display_name": false
        },
        {
          "uuid": "f10746b8-0e53-4d18-a47c-0cf26b835a42",
          "name": "CORTISONE ACETICUM",
          "stdName": "CORTISONE ACETICUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68395b68-05f4-41eb-9932-5e0359781015",
            "0ce063c4-0ef9-4296-925e-00d8b9d9e6c4",
            "c1b88020-81e4-4111-afef-d617300c6bd6",
            "cc2fc861-4acf-45e0-a45d-251dcd46baaf"
          ],
          "display_name": false
        },
        {
          "uuid": "facdb754-f4a4-42f5-8d23-0dc7a907bcac",
          "name": "CORTISONE ACETICUM [HPUS]",
          "stdName": "CORTISONE ACETICUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ce063c4-0ef9-4296-925e-00d8b9d9e6c4",
            "c1b88020-81e4-4111-afef-d617300c6bd6"
          ],
          "display_name": false
        },
        {
          "uuid": "aa4e82dc-5785-4558-a437-d56231f82023",
          "name": "CORTONE",
          "stdName": "CORTONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68395b68-05f4-41eb-9932-5e0359781015",
            "8860e92e-9620-4529-9e89-0c9d4da959b7"
          ],
          "display_name": false
        },
        {
          "uuid": "a88c1661-59c9-49c6-b0ca-cc04e5d0c520",
          "name": "Cortisone acetate",
          "stdName": "CORTISONE ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca742258-5062-4426-a9d6-6f6335375dbc",
            "68395b68-05f4-41eb-9932-5e0359781015",
            "c777a99d-2f85-4626-8c97-8ffde84402d9",
            "95efcd05-70d8-47dc-99c8-de82eb91a6a5",
            "26e48300-3d0d-47c9-94ce-caa49ccb3236",
            "2533657a-0f49-44b2-a115-ab8b7a335f3d",
            "1e4c884a-661a-4ecf-ab35-88718f57e728",
            "393ab42d-b37f-4250-a013-2679d36ce1e6",
            "cf5f0186-4603-46d6-be14-ba039eaf7d22",
            "26b4d1ca-cb21-435e-bace-27920fd6bd7a",
            "fd259e8e-37ad-49d4-acf3-e8418d3db3f3",
            "82c2f5f2-12c3-4ae1-9e05-525a294dfa5d",
            "72127559-5fa6-4edf-b340-3a0208f084cd",
            "899a62c8-cd07-4e6e-bae6-ab7a002a6b28",
            "077ae277-2297-49b9-8fc1-8a5e291380b9",
            "656f8ae6-5a8c-4782-ab52-6772942339c0",
            "4acf7d26-f8b2-3446-6147-0fb45a343f61"
          ],
          "display_name": true
        },
        {
          "uuid": "48f5c12f-84a7-fa6c-60d9-e02fef68799e",
          "name": "Cortisone acetate [WHO-DD]",
          "stdName": "CORTISONE ACETATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47f46326-e3be-f8eb-9a91-c3c2525a2b7c"
          ],
          "display_name": false
        },
        {
          "uuid": "6b407ddf-8e3f-fd1c-12a5-96f7620ca247",
          "name": "HYDROCORTISONE ACETATE IMPURITY D [EP IMPURITY]",
          "stdName": "HYDROCORTISONE ACETATE IMPURITY D [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4acf7d26-f8b2-3446-6147-0fb45a343f61"
          ],
          "display_name": false
        },
        {
          "uuid": "f2b77b61-26b6-4400-b8ab-deefd9c8bcba",
          "name": "NSC-49420",
          "stdName": "NSC-49420",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68395b68-05f4-41eb-9932-5e0359781015",
            "b0e3b810-1a75-4168-8c99-2ba62d9dd329"
          ],
          "display_name": false
        },
        {
          "uuid": "f77559a7-e734-42bb-ad7f-46043d95279a",
          "name": "PREGN-4-ENE-3,11,20-TRIONE, 21-(ACETYLOXY)-17-HYDROXY-",
          "stdName": "PREGN-4-ENE-3,11,20-TRIONE, 21-(ACETYLOXY)-17-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "379434be-18f0-4946-8060-eb9528b90130"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4b5fa51d-6efb-4b35-8e9a-9f8887d9c891",
          "citation": "USAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ca742258-5062-4426-a9d6-6f6335375dbc",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "379434be-18f0-4946-8060-eb9528b90130",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1b88020-81e4-4111-afef-d617300c6bd6",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68395b68-05f4-41eb-9932-5e0359781015",
          "citation": "HOMEOPATHIC PHARMACOPOEIA US",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8860e92e-9620-4529-9e89-0c9d4da959b7",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c777a99d-2f85-4626-8c97-8ffde84402d9",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95efcd05-70d8-47dc-99c8-de82eb91a6a5",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ce063c4-0ef9-4296-925e-00d8b9d9e6c4",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26e48300-3d0d-47c9-94ce-caa49ccb3236",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2533657a-0f49-44b2-a115-ab8b7a335f3d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e4c884a-661a-4ecf-ab35-88718f57e728",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "393ab42d-b37f-4250-a013-2679d36ce1e6",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf5f0186-4603-46d6-be14-ba039eaf7d22",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9282ccc0-4e8b-4a2d-9b4c-dff85355a096",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0872c94c-3ebb-4848-aeea-787d23c5e827",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f360d947-846e-45c5-857b-01a4b01a038a",
          "citation": "SRS import [883WKN7W8X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=883WKN7W8X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26b4d1ca-cb21-435e-bace-27920fd6bd7a",
          "citation": "CORTISONE ACETATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fd259e8e-37ad-49d4-acf3-e8418d3db3f3",
          "citation": "CORTISONE ACETATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cc2fc861-4acf-45e0-a45d-251dcd46baaf",
          "citation": "CORTISONE ACETICUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "82c2f5f2-12c3-4ae1-9e05-525a294dfa5d",
          "citation": "CORTISONE ACETATE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "72127559-5fa6-4edf-b340-3a0208f084cd",
          "citation": "CORTISONE ACETATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "899a62c8-cd07-4e6e-bae6-ab7a002a6b28",
          "citation": "CORTISONE ACETATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "077ae277-2297-49b9-8fc1-8a5e291380b9",
          "citation": "CORTISONE ACETATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "656f8ae6-5a8c-4782-ab52-6772942339c0",
          "citation": "CORTISONE ACETATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "db729516-39eb-4622-a723-ea26420b6285",
          "citation": "CORTISONE 21-ACETATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b0e3b810-1a75-4168-8c99-2ba62d9dd329",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6f015e0-85ad-261c-5c04-c5237b9efb01",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4cfb8ded-185c-51b9-c919-788d6660c362",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=50-04-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4acf7d26-f8b2-3446-6147-0fb45a343f61",
          "citation": "EP",
          "url": "http://online6.edqm.eu/ep907/mobile/#documentPage",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "25a627fd-0a7d-69ea-0250-58053e00599c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4bc5b79a-4147-4d9f-af84-997354798866",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1261050f-f2a2-e8aa-5a43-8d8080aa1239",
          "citation": "USP43-NF38 - 1175, Cortisone Acetate Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "968e5749-dc26-b52e-8bf8-06f5144e7c19",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "5c82ed2d-8b2b-023a-e7c7-52c91fed56ed",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "b034af36-b38d-3eca-2a33-8b22bff32642",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "47f46326-e3be-f8eb-9a91-c3c2525a2b7c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "47118272-0d2b-52fc-cfa6-592174aab93e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b7f00fa0-d037-24ef-7676-784365cd599d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1bc452fa-f338-4d80-9e8e-2d48efb2e396",
          "id": "1bc452fa-f338-4d80-9e8e-2d48efb2e396",
          "molfile": "\n  Marvin  01132101372D          \n\n 29 32  0  0  1  0            999 V2000\n    4.4921   -3.1257    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.2859   -3.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7726   -2.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2859   -2.0405    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.2781   -1.4627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0432   -1.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0380   -1.0332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8266   -2.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5449   -1.6423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2710   -2.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9035   -1.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2789   -2.8056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4921   -2.2903    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.4999   -1.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7790   -1.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0685   -2.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3528   -1.8765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0685   -3.1257    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.7790   -3.5395    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.7790   -4.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0685   -4.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3528   -4.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6344   -4.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9213   -4.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1978   -4.7784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9213   -3.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6344   -3.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3528   -3.5395    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.3528   -2.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 13  1  0  0  0  0\n 19  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4  6  1  0  0  0  0\n 13  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 14  1  1  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  1  0  0  0\n 19 18  1  0  0  0  0\n 18 28  1  0  0  0  0\n 19 20  1  6  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  2  0  0  0  0\n 28 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  2  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 27  1  0  0  0  0\n 28 29  1  1  0  0  0\nM  END",
          "smiles": "CC(=O)OCC(=O)[C@]1(CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C)O",
          "formula": "C23H30O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2c65c721-1ae6-4049-a7a7-d771b3c106e4"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "402.4816",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d5bbada7-d962-425a-b873-3b49c1e7ffa5",
      "version": "32",
      "structure": {
        "id": "fec5a5ef-f655-4744-9a30-f08a8d9f7784",
        "molfile": "\n  Marvin  01132113112D          \n\n 32 35  0  0  1  0            999 V2000\n    4.4921   -2.2903    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.3528   -3.5395    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.2859   -2.0405    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.0685   -3.1257    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.7790   -3.5395    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.4921   -3.1257    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.0685   -2.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3528   -4.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7790   -1.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0432   -1.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6344   -4.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7726   -2.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2859   -3.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7790   -4.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6344   -3.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0685   -4.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9213   -4.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2710   -2.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3528   -1.8765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8266   -2.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0380   -1.0332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5449   -1.6423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2789   -2.8056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1978   -4.7784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2781   -1.4627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4999   -1.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9213   -3.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3528   -2.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9035   -1.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0633   -3.9507    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7738   -2.7119    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4921   -3.9507    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  7  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  1  1  0  0  0  0\n  3 10  1  1  0  0  0\n 11  8  2  0  0  0  0\n 12  3  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  5  1  0  0  0  0\n 15  2  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 27  1  0  0  0  0\n 18 22  1  0  0  0  0\n 19  7  2  0  0  0  0\n 20 10  1  0  0  0  0\n 21 10  2  0  0  0  0\n 22 20  1  0  0  0  0\n 23 18  2  0  0  0  0\n 24 17  2  0  0  0  0\n  3 25  1  6  0  0  0\n  1 26  1  1  0  0  0\n 27 15  1  0  0  0  0\n  2 28  1  1  0  0  0\n 29 18  1  0  0  0  0\n  4 30  1  6  0  0  0\n  5 31  1  1  0  0  0\n  6 32  1  6  0  0  0\n 13 12  1  0  0  0  0\n  5  4  1  0  0  0  0\n 16  8  1  0  0  0  0\n 17 11  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)OCC(=O)[C@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])C(=O)C[C@@]21C)O",
        "formula": "C23H30O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "402.4816",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ca742258-5062-4426-a9d6-6f6335375dbc",
          "f360d947-846e-45c5-857b-01a4b01a038a"
        ],
        "stereo_centers": 6
      },
      "unii": "883WKN7W8X"
    }
  ]
}