{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "abb360e9-b992-458d-b9d0-edea24868368",
          "code": "20298-69-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20298-69-5",
          "code_system": "CAS",
          "references": [
            "c364817b-49dd-4688-b654-8c0cfe1dac65",
            "02a93f29-3bb1-4019-b645-971ddbb969d2"
          ]
        },
        {
          "uuid": "64a53b30-5977-4e93-b475-3151f2d096df",
          "code": "243-718-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.039.728",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c364817b-49dd-4688-b654-8c0cfe1dac65"
          ]
        },
        {
          "uuid": "5452d7fc-699d-40d5-b20b-8060e874e627",
          "code": "21116400",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21116400",
          "code_system": "PUBCHEM",
          "references": [
            "c364817b-49dd-4688-b654-8c0cfe1dac65"
          ]
        },
        {
          "uuid": "f96d4bfe-cb06-c269-3e93-fa1be7ae3dcb",
          "code": "DTXSID2051845",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2051845",
          "code_system": "EPA CompTox",
          "references": [
            "e026e628-6a3b-1c58-a177-04458f89800f"
          ]
        },
        {
          "uuid": "caf54821-5724-466b-af49-7f27a04ca6c0",
          "code": "87JN7005XU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2b8c081a-ef4b-0577-29a8-5214d1167d5e",
          "code": "2604560",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2604560/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a84b997d-c77e-c7e3-e0a8-060b1766e1a9"
          ]
        },
        {
          "uuid": "5d12fe02-bc59-fb34-b5b9-eebeb9cbb443",
          "code": "87JN7005XU",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=87JN7005XU",
          "code_system": "DAILYMED",
          "references": [
            "ac56beda-e351-204e-5867-ff03aa496d29"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5eb37cac-d01d-4a0e-8879-91446b355816",
          "name": "2-TERT-BUTYLCYCLOHEXYL ACETATE, CIS-",
          "stdName": "2-TERT-BUTYLCYCLOHEXYL ACETATE, CIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "040d1635-b664-4497-804f-1e1df5372813",
            "2b1a24ae-7520-44f9-89cd-ba48513f0a7d"
          ],
          "display_name": true
        },
        {
          "uuid": "ab631035-fb55-4212-bb94-ac1f5cb0be3d",
          "name": "CIS-2-TERT-BUTYLCYCLOHEXYL ACETATE",
          "stdName": "CIS-2-TERT-BUTYLCYCLOHEXYL ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97ebd619-d06f-4eb9-a8bc-8dc71402dcbf",
            "2b1a24ae-7520-44f9-89cd-ba48513f0a7d"
          ],
          "display_name": false
        },
        {
          "uuid": "79339ebf-d057-432a-8d29-f0031a1d86e3",
          "name": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, 1-ACETATE, (1R,2R)-REL-",
          "stdName": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, 1-ACETATE, (1R,2R)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97ebd619-d06f-4eb9-a8bc-8dc71402dcbf",
            "2b1a24ae-7520-44f9-89cd-ba48513f0a7d"
          ],
          "display_name": false
        },
        {
          "uuid": "e91611fd-a7de-46d9-ae3b-6d68d725e8b5",
          "name": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, ACETATE, (1R,2R)-REL-",
          "stdName": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, ACETATE, (1R,2R)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97ebd619-d06f-4eb9-a8bc-8dc71402dcbf",
            "2b1a24ae-7520-44f9-89cd-ba48513f0a7d"
          ],
          "display_name": false
        },
        {
          "uuid": "50353adc-9e8a-40ff-b9eb-3794038075e0",
          "name": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, ACETATE, CIS-",
          "stdName": "CYCLOHEXANOL, 2-(1,1-DIMETHYLETHYL)-, ACETATE, CIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97ebd619-d06f-4eb9-a8bc-8dc71402dcbf",
            "2b1a24ae-7520-44f9-89cd-ba48513f0a7d"
          ],
          "display_name": false
        },
        {
          "uuid": "a451fd52-9578-4357-8fbd-d9ef75508fb5",
          "name": "CYCLOHEXANOL, 2-TERT-BUTYL-, ACETATE, CIS-",
          "stdName": "CYCLOHEXANOL, 2-TERT-BUTYL-, ACETATE, CIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97ebd619-d06f-4eb9-a8bc-8dc71402dcbf",
            "2b1a24ae-7520-44f9-89cd-ba48513f0a7d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "040d1635-b664-4497-804f-1e1df5372813",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2b1a24ae-7520-44f9-89cd-ba48513f0a7d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97ebd619-d06f-4eb9-a8bc-8dc71402dcbf",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c364817b-49dd-4688-b654-8c0cfe1dac65",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391406000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "990ae02a-4d79-41cb-b604-3b35a2be6001",
          "citation": "SRS import [87JN7005XU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=87JN7005XU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391406000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dc2107b-c2cf-487d-a971-09a32080f2be",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e026e628-6a3b-1c58-a177-04458f89800f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=20298-69-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a84b997d-c77e-c7e3-e0a8-060b1766e1a9",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "02a93f29-3bb1-4019-b645-971ddbb969d2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ac56beda-e351-204e-5867-ff03aa496d29",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "85c3ca23-85bb-49bb-b266-9fe2c9e1bdcb",
          "id": "85c3ca23-85bb-49bb-b266-9fe2c9e1bdcb",
          "molfile": "\n  Marvin  01132106562D          \n\n 14 14  0  0  0  0            999 V2000\n    4.7393   -3.9930    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.7393   -4.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0249   -5.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3104   -4.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3104   -3.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0249   -3.5805    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.0249   -2.7555    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.1999   -2.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0249   -1.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8499   -2.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4538   -3.5805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1683   -3.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1683   -4.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8828   -3.5805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1 11  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  1  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)O[C@H]1CCCC[C@H]1C(C)(C)C",
          "formula": "C12H22O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a8502d9f-bb1c-41c3-9fce-ff190e995169"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "198.3023",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a2cc6e0b-3ca9-442e-841f-5617ca27d4b3",
      "version": "6",
      "structure": {
        "id": "0ed725eb-901d-4ff7-8893-d0f609036b40",
        "molfile": "\n  Marvin  01132101002D          \n\n 14 14  0  0  0  0            999 V2000\n    3.3104   -4.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3104   -3.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0249   -3.5805    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7393   -3.9930    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7393   -4.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0249   -5.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4538   -3.5805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1683   -3.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8828   -3.5805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1683   -4.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0249   -2.7555    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.1999   -2.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0249   -1.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8499   -2.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  4  7  1  1  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n  3 11  1  1  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)O[C@H]1CCCC[C@H]1C(C)(C)C",
        "formula": "C12H22O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "198.3023",
        "optical_activity": "( + / - )",
        "references": [
          "9dc2107b-c2cf-487d-a971-09a32080f2be",
          "990ae02a-4d79-41cb-b604-3b35a2be6001"
        ],
        "stereo_centers": 2
      },
      "unii": "87JN7005XU"
    }
  ]
}