{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b3ac19fb-ae94-4979-b5dc-a17e0c439161", "code": "2864-50-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2864-50-8", "code_system": "CAS", "references": [ "64c650de-b314-4404-970b-8873f848fd3e", "2893a005-65b5-4869-b857-548f03fccdae" ] }, { "uuid": "4437c0cf-fac3-4b2f-bd66-515f63bb97bd", "code": "1366923", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1366923/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "64c650de-b314-4404-970b-8873f848fd3e" ] }, { "uuid": "7d2ed4f1-58fa-43ac-9f25-3d56e94ad8ad", "code": "SUB41772", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "64c650de-b314-4404-970b-8873f848fd3e" ] }, { "uuid": "70afe9f5-70c4-4f8b-90e6-b9b4538bafa7", "code": "23679068", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23679068", "code_system": "PUBCHEM", "references": [ "64c650de-b314-4404-970b-8873f848fd3e" ] }, { "uuid": "97053930-dd55-4bb8-9a4b-3a7c6e7b4556", "code": "87FG30X25H", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d3967074-2680-826b-208a-e65a6fc58914", "code": "100000130221", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "33490bba-55c5-d7f5-98bb-b9b6583aa605" ] }, { "uuid": "8cedf280-e50c-311b-6c52-7dda77d151c5", "code": "DTXSID00951301", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00951301", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "cabb4f25-1ece-43e2-8703-ab54e82e1c0d", "name": "5-CHOLESTEN-3.BETA.-OL SULFATE SODIUM SALT", "stdName": "5-CHOLESTEN-3.BETA.-OL SULFATE SODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9cb3a94-d5b6-4004-97c9-fa7a1eab691d", "49488fdd-cf7e-416c-a5ec-3ddf2afda7a8" ], "display_name": false }, { "uuid": "f39102a3-fa55-4542-9bc8-3be8d6c72a32", "name": "5-CHOLESTEN-3.BETA.-OL SULPHATE SODIUM SALT", "stdName": "5-CHOLESTEN-3.BETA.-OL SULPHATE SODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "19571c2b-3e09-4fb8-8bf6-88fe9cc46834" ], "display_name": false }, { "uuid": "822d3b2a-eaaf-40af-9adc-26ba23692f53", "name": "CHOLESTEROL 3-SULFATE SODIUM SALT", "stdName": "CHOLESTEROL 3-SULFATE SODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9cb3a94-d5b6-4004-97c9-fa7a1eab691d", "49488fdd-cf7e-416c-a5ec-3ddf2afda7a8" ], "display_name": false }, { "uuid": "90032743-1477-4113-b5d4-0ae6cf2ebfe1", "name": "CHOLESTEROL 3-SULPHATE SODIUM SALT", "stdName": "CHOLESTEROL 3-SULPHATE SODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "19571c2b-3e09-4fb8-8bf6-88fe9cc46834" ], "display_name": false }, { "uuid": "8311544e-a314-4179-ae03-a7af4fe0444b", "name": "SODIUM CHOLESTERYL SULFATE", "stdName": "SODIUM CHOLESTERYL SULFATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "64cb670f-edd7-4d87-9bfc-a3eb68c2be92", "e9cb3a94-d5b6-4004-97c9-fa7a1eab691d", "7587d828-83b8-4a0d-b9aa-95ebbc2bdb33", "5c6cf5c5-9c35-4be9-b2b0-aa094cab6354", "49488fdd-cf7e-416c-a5ec-3ddf2afda7a8" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "2e147c77-080d-424d-9ea2-6040fd341548", "name_org": "INCI" } ] }, { "uuid": "8e90b94d-818f-4263-89ea-7709a94972f4", "name": "SODIUM CHOLESTERYL SULFATE [II]", "stdName": "SODIUM CHOLESTERYL SULFATE [II]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e9cb3a94-d5b6-4004-97c9-fa7a1eab691d" ], "display_name": false }, { "uuid": "03fac46f-a4c7-4390-b6ac-acab40d17b45", "name": "SODIUM CHOLESTERYL SULPHATE", "stdName": "SODIUM CHOLESTERYL SULPHATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "19571c2b-3e09-4fb8-8bf6-88fe9cc46834" ], "display_name": false } ], "references": [ { "uuid": "e9cb3a94-d5b6-4004-97c9-fa7a1eab691d", "citation": "SIGMA-ALDRICH", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "49488fdd-cf7e-416c-a5ec-3ddf2afda7a8", "citation": "SIGMA-ALDRICH", "doc_type": "SIGMA-ALDRICH", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "19571c2b-3e09-4fb8-8bf6-88fe9cc46834", "citation": "FDA-SRS 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7587d828-83b8-4a0d-b9aa-95ebbc2bdb33", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "64c650de-b314-4404-970b-8873f848fd3e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390953000, "tags": [ "NOMEN" ] }, { "uuid": "c5b3307e-d524-4e9a-b011-ac0257740cc6", "citation": "SRS import [87FG30X25H]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=87FG30X25H", "doc_type": "SRS", "public_domain": true, "document_date": 1493390953000, "tags": [ "NOMEN" ] }, { "uuid": "b0d04934-4643-4981-9e3b-f0d14ede7683", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "64cb670f-edd7-4d87-9bfc-a3eb68c2be92", "citation": "SODIUM CHOLESTERYL SULFATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5c6cf5c5-9c35-4be9-b2b0-aa094cab6354", "citation": "SODIUM CHOLESTERYL SULFATE [II]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "33490bba-55c5-d7f5-98bb-b9b6583aa605", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "2893a005-65b5-4869-b857-548f03fccdae", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "6c6d2a10-1e8c-8a31-0402-a4de32227696", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "635eadae-a24d-40e1-b781-2388d11c7dac", "id": "635eadae-a24d-40e1-b781-2388d11c7dac", "molfile": "\n Marvin 01132105092D \n\n 1 0 0 0 1 0 999 V2000\n -0.9472 -4.1618 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8e7c5fc5-f2b9-43fa-b63b-df92eb458732" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "119c5e4f-4d66-4fb3-b40a-9ad8f16bf29a", "id": "119c5e4f-4d66-4fb3-b40a-9ad8f16bf29a", "molfile": "\n Marvin 01132101082D \n\n 32 35 0 0 1 0 999 V2000\n 6.9740 -0.6353 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.2514 -0.2230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6828 -0.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3961 -0.6307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1095 -0.2138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8182 -0.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5316 -0.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8182 -1.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9740 -1.4645 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.4465 -2.1408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9509 -2.8030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1682 -2.5390 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.4501 -2.9421 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.4501 -3.7619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7367 -4.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0234 -3.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3101 -4.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6013 -3.7527 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 2.6013 -2.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3101 -2.5112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0234 -2.9282 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.0234 -2.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7367 -2.5206 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 4.7367 -1.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4686 -1.2837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1682 -1.7054 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.1682 -0.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8786 -4.1604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0542 -4.1604 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2250 -4.1604 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1.0542 -4.9850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0542 -3.3312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 9 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 26 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 1 0 0 0\n 12 13 1 0 0 0 0\n 26 12 1 0 0 0 0\n 13 14 1 6 0 0 0\n 13 23 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 16 1 0 0 0 0\n 21 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 28 1 1 0 0 0\n 19 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 1 0 0 0\n 23 21 1 0 0 0 0\n 23 24 1 1 0 0 0\n 24 25 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 1 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 29 2 0 0 0 0\n 32 29 2 0 0 0 0\nM CHG 1 30 -1\nM END", "smiles": "CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OS(=O)(=O)[O-]", "formula": "C27H45O4S", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "704b5c2d-8cb4-4aff-a452-fa3342aacc96" }, "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "465.7109", "optical_activity": "UNSPECIFIED", "stereo_centers": 8 } ], "definition_level": "COMPLETE", "uuid": "7d86b6a6-0588-4c9b-9f00-fba961ffd4fb", "version": "8", "structure": { "id": "2971296b-1f58-468e-8744-bfceeb6150fb", "molfile": "\n Marvin 01132102162D \n\n 37 39 0 0 1 0 999 V2000\n 6.1703 -1.7060 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.1703 -2.5399 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.4520 -2.9431 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.7383 -2.5215 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.0248 -2.9292 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.0248 -3.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3112 -4.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6022 -3.7540 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1.8793 -4.1618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0546 -4.1618 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2251 -4.1618 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1.0546 -4.9867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0546 -3.3324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6022 -2.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3112 -2.5121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7383 -4.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4520 -3.7632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0248 -2.1044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7383 -3.3416 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7383 -1.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4705 -1.2841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4520 -2.1137 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9533 -2.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4491 -2.1415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9764 -1.4650 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.9764 -0.6355 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.6855 -0.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3990 -0.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1127 -0.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8216 -0.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5353 -0.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8216 -1.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2536 -0.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6855 -1.0433 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1703 -3.3602 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1703 -0.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9472 -4.1618 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 1 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 10 2 0 0 0 0\n 13 10 2 0 0 0 0\n 8 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 5 1 0 0 0 0\n 16 6 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 3 1 0 0 0 0\n 5 18 1 1 0 0 0\n 4 19 1 6 0 0 0\n 20 4 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 1 1 0 0 0 0\n 3 22 1 1 0 0 0\n 23 2 1 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 1 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 30 1 0 0 0 0\n 26 33 1 6 0 0 0\n 25 34 1 6 0 0 0\n 2 35 1 6 0 0 0\n 1 36 1 1 0 0 0\nM CHG 2 11 -1 37 1\nM END", "smiles": "CC(C)CCC[C@@H](C)[C@@]1([H])CC[C@@]2([H])[C@]3([H])CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)OS(=O)(=O)[O-].[Na+]", "formula": "C27H45O4S.Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "488.7007", "optical_activity": "UNSPECIFIED", "references": [ "b0d04934-4643-4981-9e3b-f0d14ede7683", "c5b3307e-d524-4e9a-b011-ac0257740cc6" ], "stereo_centers": 8 }, "unii": "87FG30X25H" } ] }