{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "99a26b10-7f77-432b-9ac3-9ad9e88024e3",
          "code": "109727-65-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=109727-65-3",
          "code_system": "CAS",
          "references": [
            "1ad7b18d-58d8-47b8-a0a7-1fac1a3a5e39",
            "21b60c2a-5226-4870-9ee4-f701c85384fa"
          ]
        },
        {
          "uuid": "4331b57e-878f-4e88-92ce-9a069dcb0067",
          "code": "71587413",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587413",
          "code_system": "PUBCHEM",
          "references": [
            "1ad7b18d-58d8-47b8-a0a7-1fac1a3a5e39"
          ]
        },
        {
          "uuid": "060da485-0177-d802-810e-d78eeb869d0c",
          "code": "DTXSID80149022",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80149022",
          "code_system": "EPA CompTox",
          "references": [
            "d9c4fae2-55e6-2580-6075-34451428573d"
          ]
        },
        {
          "uuid": "af0e3f7f-b7f5-4650-a98a-d55b037ecd65",
          "code": "87F930AZM1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "958f2242-a3f2-4316-8d76-ed8bab44780d",
          "name": "CAPROAMPHOACETATE",
          "stdName": "CAPROAMPHOACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02c28ac2-671d-4a76-8c26-1e2a60a93ce7",
            "5ba6aff8-de2f-404e-b5eb-d666fc028d56"
          ],
          "display_name": false
        },
        {
          "uuid": "be95e00e-cb0d-4ca5-b736-277873240b73",
          "name": "CAPROAMPHOGLYCINATE",
          "stdName": "CAPROAMPHOGLYCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02c28ac2-671d-4a76-8c26-1e2a60a93ce7",
            "5ba6aff8-de2f-404e-b5eb-d666fc028d56"
          ],
          "display_name": false
        },
        {
          "uuid": "23e9cdeb-91b5-41dd-8aaa-f7765a8c8640",
          "name": "GLYCINE, N-(2-DECANAMIDOETHYL)-N-2-HYDROXYETHYL-, SODIUM SALT",
          "stdName": "GLYCINE, N-(2-DECANAMIDOETHYL)-N-2-HYDROXYETHYL-, SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ba6aff8-de2f-404e-b5eb-d666fc028d56",
            "5b9d4710-ce8e-4c6e-b580-bdff4340a7e5"
          ],
          "display_name": false
        },
        {
          "uuid": "7f3f084e-0cfb-4af9-b22a-a94687c2473c",
          "name": "GLYCINE, N-(2-HYDROXYETHYL)-N-(2-((1-OXODECYL)AMINO)ETHYL)-, MONOSODIUM SALT",
          "stdName": "GLYCINE, N-(2-HYDROXYETHYL)-N-(2-((1-OXODECYL)AMINO)ETHYL)-, MONOSODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ba6aff8-de2f-404e-b5eb-d666fc028d56",
            "5b9d4710-ce8e-4c6e-b580-bdff4340a7e5"
          ],
          "display_name": false
        },
        {
          "uuid": "6d8320db-6cb1-41ba-a3dc-eb05a1c442b6",
          "name": "GLYCINE, N-(2-HYDROXYETHYL)-N-(2-((1-OXODECYL)AMINO)ETHYL)-, SODIUM SALT (1:1)",
          "stdName": "GLYCINE, N-(2-HYDROXYETHYL)-N-(2-((1-OXODECYL)AMINO)ETHYL)-, SODIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ba6aff8-de2f-404e-b5eb-d666fc028d56",
            "5b9d4710-ce8e-4c6e-b580-bdff4340a7e5"
          ],
          "display_name": false
        },
        {
          "uuid": "a6a22ec7-edf3-4fe3-aa58-87d2bdc02f95",
          "name": "SODIUM CAPROAMPHOACETATE",
          "stdName": "SODIUM CAPROAMPHOACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02c28ac2-671d-4a76-8c26-1e2a60a93ce7",
            "5ba6aff8-de2f-404e-b5eb-d666fc028d56",
            "e9fc12db-b088-477a-8474-8e547f1881a7"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "abad8cb4-ebb1-4ff7-9fa0-4bde6a2ef006",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "02c28ac2-671d-4a76-8c26-1e2a60a93ce7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5ba6aff8-de2f-404e-b5eb-d666fc028d56",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b9d4710-ce8e-4c6e-b580-bdff4340a7e5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ad7b18d-58d8-47b8-a0a7-1fac1a3a5e39",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391758000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5599f94-f66c-47a9-ace9-b7ddbb2ee3f5",
          "citation": "SRS import [87F930AZM1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=87F930AZM1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391758000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9fc12db-b088-477a-8474-8e547f1881a7",
          "citation": "SODIUM CAPROAMPHOACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d9c4fae2-55e6-2580-6075-34451428573d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=109727-65-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "21b60c2a-5226-4870-9ee4-f701c85384fa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c729e00d-9bbe-4583-91e2-e04061480883",
          "id": "c729e00d-9bbe-4583-91e2-e04061480883",
          "molfile": "\n  Marvin  01132110182D          \n\n  1  0  0  0  0  0            999 V2000\n    5.9071   -3.7411    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4cebc26e-53ec-44bf-9801-e4f714d111fc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "051566b4-d635-49b8-b96d-7f634fbbda7f",
          "id": "051566b4-d635-49b8-b96d-7f634fbbda7f",
          "molfile": "\n  Marvin  01132100342D          \n\n 22 21  0  0  0  0            999 V2000\n   -1.7129   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9985   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2839   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4305   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1450   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8595   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5741   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2885   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0030   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7176   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7176   -2.6320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4320   -1.3945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1465   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8610   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5755   -1.8070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2899   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0045   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7189   -1.3945    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.5755   -2.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2899   -3.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0045   -2.6320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2899   -3.8695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 19  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\nM  CHG  1  18  -1\nM  END",
          "smiles": "CCCCCCCCCC(=O)NCCN(CC[O-])CC(=O)O",
          "formula": "C16H31N2O4",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "de98c9f9-13da-477e-a3d7-9d4a321352f1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "315.429",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3f6c73fa-7041-4869-beba-001bc24150ee",
      "version": "4",
      "structure": {
        "id": "423d95ad-3a71-4434-b9ab-ecda92c3e1a6",
        "molfile": "\n  Marvin  01132103302D          \n\n 23 21  0  0  0  0            999 V2000\n    5.9075   -3.7414    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n   -0.2839   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4305   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1450   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8595   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5741   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2885   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0030   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7176   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7176   -2.6320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4320   -1.3945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1465   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8610   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5755   -1.8070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2899   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0045   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7189   -1.3945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5755   -2.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2899   -3.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0045   -2.6320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2899   -3.8695    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.9985   -1.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7129   -1.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 14 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n  2 22  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  CHG  2   1   1  21  -1\nM  END",
        "smiles": "CCCCCCCCCC(=O)NCCN(CCO)CC(=O)[O-].[Na+]",
        "formula": "C16H31N2O4.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "338.4187",
        "optical_activity": "NONE",
        "references": [
          "02c28ac2-671d-4a76-8c26-1e2a60a93ce7",
          "f5599f94-f66c-47a9-ace9-b7ddbb2ee3f5"
        ],
        "stereo_centers": 0
      },
      "unii": "87F930AZM1"
    }
  ]
}