{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "942d9e3a-5ca7-4fe0-a868-84b32c842706",
          "code": "N03AX13",
          "comments": "ATC|NERVOUS SYSTEM|ANTIEPILEPTICS|ANTIEPILEPTICS|Other antiepileptics|pheneturide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N03AX13&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767"
          ]
        },
        {
          "uuid": "04de1eb5-253c-4046-b2b2-dba758e750f2",
          "code": "QN03AX13",
          "comments": "VATC|ANTIEPILEPTICS|ANTIEPILEPTICS|Other antiepileptics|pheneturide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN03AX13&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767"
          ]
        },
        {
          "uuid": "83d800b1-d2d1-400b-8000-50a0843137a4",
          "code": "90-49-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=90-49-3",
          "code_system": "CAS",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767",
            "10248c7c-4ef4-41f4-bd34-b7b17c7fc6bb"
          ]
        },
        {
          "uuid": "5ebc2d67-545e-4706-881b-1a7aaf52c5e5",
          "code": "C72826",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72826",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767"
          ]
        },
        {
          "uuid": "0cc1ff53-72f6-48f3-bf75-28816ca58305",
          "code": "C005825",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005825",
          "code_system": "MESH",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767"
          ]
        },
        {
          "uuid": "9a30b083-6833-4dae-9633-02c324340a68",
          "code": "PHENETURIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pheneturide",
          "code_system": "WIKIPEDIA",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767"
          ]
        },
        {
          "uuid": "5917477e-bcf6-4500-a936-bcd8081a522b",
          "code": "SUB09760MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767"
          ]
        },
        {
          "uuid": "e2700129-33b6-40c7-9a3c-4630523d7980",
          "code": "648",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=648",
          "code_system": "INN",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767"
          ]
        },
        {
          "uuid": "f71b2c32-5004-4f2e-bc0f-c8f4d048245c",
          "code": "201-998-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.817",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767"
          ]
        },
        {
          "uuid": "ba996139-80aa-41e1-aa79-1e8cb6f2b97b",
          "code": "6509-31-5",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6509-31-5",
          "code_system": "CAS",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767",
            "856a3e0e-bd72-4a29-a61f-3ab3e1fd0120"
          ]
        },
        {
          "uuid": "070a3f6c-aad3-4744-964b-3d359fdc0326",
          "code": "m8614",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8614?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767"
          ]
        },
        {
          "uuid": "2c65b73b-ab04-447c-8c58-f4ea57aabd70",
          "code": "CHEMBL2107062",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2107062",
          "code_system": "ChEMBL",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767"
          ]
        },
        {
          "uuid": "b4c80ecf-21ad-40be-a1a3-3a576fed86ba",
          "code": "72060",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72060",
          "code_system": "PUBCHEM",
          "references": [
            "bdb23330-9b4d-4392-b025-32f75ff72767"
          ]
        },
        {
          "uuid": "c199408b-e9c5-84a0-7c1b-b4ff5eb4f3ba",
          "code": "DTXSID4020612",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4020612",
          "code_system": "EPA CompTox",
          "references": [
            "6d2f4fd0-dece-1e20-97db-3add6a5158d9"
          ]
        },
        {
          "uuid": "70aa92cf-a22a-2aae-226a-bc082331fda7",
          "code": "C264",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticonvulsant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C264",
          "code_system": "NCI_THESAURUS",
          "references": [
            "449537f2-0396-1db8-b403-4c190799c1d7"
          ]
        },
        {
          "uuid": "33b956c2-2361-4489-b241-cea3db0cb015",
          "code": "878CEJ4HGX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7e963b73-830a-4624-38b9-7d29ad8af80a",
          "code": "2125",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2125",
          "code_system": "DRUG CENTRAL",
          "references": [
            "449537f2-0396-1db8-b403-4c190799c1d7"
          ]
        },
        {
          "uuid": "8720d2d3-8f6b-b625-36f5-1dab1041f919",
          "code": "DB13362",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13362",
          "code_system": "DRUG BANK",
          "references": [
            "449537f2-0396-1db8-b403-4c190799c1d7"
          ]
        },
        {
          "uuid": "33647627-e613-0963-2d0d-11381433e832",
          "code": "100000082233",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9193cd8d-bfc5-1a57-7c80-c1a05b0d6418"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ba8cd852-c125-438b-87a3-8add6c766aef",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6592048a-efe3-46ee-99cb-306f63626cba",
            "refuuid": "02e8f467-3371-4775-af6c-2a06cd47056e",
            "name": "PHENETURIDE",
            "unii": "878CEJ4HGX",
            "linking_id": "878CEJ4HGX",
            "ref_pname": "PHENETURIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "47646045-6c2f-456d-806e-50cadcabc536",
          "name": ".ALPHA.-PHENYL-.ALPHA.-ETHYLACETYLUREA",
          "stdName": ".ALPHA.-PHENYL-.ALPHA.-ETHYLACETYLUREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "da3705d4-79c5-4d98-8564-a081cd7a92a6",
          "name": "1-((ETHYL)PHENYLACETYL)UREA",
          "stdName": "1-((ETHYL)PHENYLACETYL)UREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "d7a80003-831a-4b9a-b257-2af4812bd4de",
          "name": "2-PHENYLBUTYRYLUREA",
          "stdName": "2-PHENYLBUTYRYLUREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7585f89a-a667-40b9-9b70-270e61a0ffb4"
          ],
          "display_name": false
        },
        {
          "uuid": "028e44bb-4ed0-49ba-b854-ffb306fb2b41",
          "name": "BENURIDE",
          "stdName": "BENURIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "75c78869-8158-421c-8683-e27252a80c07",
          "name": "DL-PHENETURIDE",
          "stdName": "DL-PHENETURIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "be8ecefd-4653-45db-a71f-457c2b3c9cb3",
          "name": "ETHYLPHENACEMIDE",
          "stdName": "ETHYLPHENACEMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05",
            "d40abf53-6e0c-49bd-bf55-a837b1b4ad24",
            "d47655c1-8f50-4e13-af9e-0481e0fd7684",
            "ac95021b-c94b-4095-b701-49d608236080"
          ],
          "display_name": false
        },
        {
          "uuid": "ed49c475-ffc4-4297-b39d-483cdad0060d",
          "name": "ETHYLPHENACEMIDE [JAN]",
          "stdName": "ETHYLPHENACEMIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05",
            "d40abf53-6e0c-49bd-bf55-a837b1b4ad24"
          ],
          "display_name": false
        },
        {
          "uuid": "aacd1280-6e0b-498d-9ecf-1370266ac126",
          "name": "ETHYLPHENYLACETYLUREA",
          "stdName": "ETHYLPHENYLACETYLUREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aee7073d-8f6a-462e-8a44-aa101f7cd084",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "e0dd1f7e-8124-4a05-a154-cd9e70c18849",
          "name": "LIRCAPYL",
          "stdName": "LIRCAPYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "22c8b9fb-6255-4591-8c2b-79e25e1ca9e3",
          "name": "M-551",
          "stdName": "M-551",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "0b90576d-1d17-48b3-b8ee-564a1f233cb7",
          "name": "N-(.ALPHA.-PHENYLBUTYRYL)UREA",
          "stdName": "N-(.ALPHA.-PHENYLBUTYRYL)UREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "ee7a7900-636d-447e-a669-30d96bd6bfb4",
          "name": "PBU",
          "stdName": "PBU",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "18e3376b-d0b6-4a20-925b-37c7da9a84cc",
          "name": "PHENETURIDE",
          "stdName": "PHENETURIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "826811bb-2f2e-49cf-b089-f1395d2307b7",
            "1b4382a4-c10c-402e-bd3f-989f2a39b44a",
            "37e8b5ed-b781-4e96-886d-904c9e19539d",
            "638a53eb-4f6f-4ab6-9cd7-254babe9a989",
            "a4334994-b547-4ee3-b745-5d6a95ffbbe9",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05",
            "c7e73f5f-59cd-4b70-8784-85a7ed717307",
            "ca0406f9-5562-4050-b804-906c16d04e55",
            "2521bae5-73fc-4ded-a817-4a0f67284bba",
            "84fe3cd7-e584-4964-9f9f-f43b2ec18abc"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "9a69e3a1-dc97-4ccd-be2e-73220d3561d7",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "5d937f95-591f-42bc-bf3c-185e6b4f363e",
          "name": "PHENETURIDE [MART.]",
          "stdName": "PHENETURIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "638a53eb-4f6f-4ab6-9cd7-254babe9a989"
          ],
          "display_name": false
        },
        {
          "uuid": "c27edea5-b2ff-4e88-b46f-9ed215c6d187",
          "name": "PHENETURIDE [MI]",
          "stdName": "PHENETURIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05",
            "1b4382a4-c10c-402e-bd3f-989f2a39b44a"
          ],
          "display_name": false
        },
        {
          "uuid": "2f3f2a45-0a81-4acf-bfb1-c7a5ce39c520",
          "name": "PHENURIDE",
          "stdName": "PHENURIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "f2c341e6-a749-4242-8da6-65b99d703ec7",
          "name": "PHENYLETHYLACETYLUREA",
          "stdName": "PHENYLETHYLACETYLUREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "86488354-eece-7bb0-5f42-829d69f33be2",
          "name": "Pheneturide [WHO-DD]",
          "stdName": "PHENETURIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0354630-fea2-c061-c598-a18709f587dc"
          ],
          "display_name": false
        },
        {
          "uuid": "d4e90ece-9227-4caa-af0d-a3889c4714a7",
          "name": "S-46",
          "stdName": "S-46",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "4dfe9fbb-2430-44c5-ba4b-46d3876bee7a",
          "name": "UREA, (2-PHENYLBUTYRYL)-",
          "stdName": "UREA, (2-PHENYLBUTYRYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
            "27499d70-4fb7-47f0-812c-1f9eeff8ec05"
          ],
          "display_name": false
        },
        {
          "uuid": "664a06e2-55c9-4ed8-ac3d-7ddc7a3f0845",
          "name": "pheneturide [INN]",
          "stdName": "PHENETURIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84fe3cd7-e584-4964-9f9f-f43b2ec18abc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "37e8b5ed-b781-4e96-886d-904c9e19539d",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "99a0a662-06b1-4ea3-9c8a-8be6c5687228",
          "citation": "ACD 8.0",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7585f89a-a667-40b9-9b70-270e61a0ffb4",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d47655c1-8f50-4e13-af9e-0481e0fd7684",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84fe3cd7-e584-4964-9f9f-f43b2ec18abc",
          "citation": "INN Proposed List 42",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL42.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d40abf53-6e0c-49bd-bf55-a837b1b4ad24",
          "citation": "KEGG",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27499d70-4fb7-47f0-812c-1f9eeff8ec05",
          "citation": "KEGG",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "638a53eb-4f6f-4ab6-9cd7-254babe9a989",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b4382a4-c10c-402e-bd3f-989f2a39b44a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca0406f9-5562-4050-b804-906c16d04e55",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4c8ff32-ca10-4f1d-b250-888877a4e0f1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aee7073d-8f6a-462e-8a44-aa101f7cd084",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdb23330-9b4d-4392-b025-32f75ff72767",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389917000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50dcb2b5-c07c-4301-a6bf-b98aafcdce87",
          "citation": "SRS import [878CEJ4HGX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=878CEJ4HGX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389917000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0427c15-3f94-4365-92f8-81b970e0349d",
          "citation": "USP Dictionary;INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "826811bb-2f2e-49cf-b089-f1395d2307b7",
          "citation": "PHENETURIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ac95021b-c94b-4095-b701-49d608236080",
          "citation": "ETHYLPHENACEMIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2521bae5-73fc-4ded-a817-4a0f67284bba",
          "citation": "PHENETURIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c7e73f5f-59cd-4b70-8784-85a7ed717307",
          "citation": "PHENETURIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a4334994-b547-4ee3-b745-5d6a95ffbbe9",
          "citation": "PHENETURIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6d2f4fd0-dece-1e20-97db-3add6a5158d9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=90-49-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "449537f2-0396-1db8-b403-4c190799c1d7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "856a3e0e-bd72-4a29-a61f-3ab3e1fd0120",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "10248c7c-4ef4-41f4-bd34-b7b17c7fc6bb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a0354630-fea2-c061-c598-a18709f587dc",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9193cd8d-bfc5-1a57-7c80-c1a05b0d6418",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f38a1cd3-ba6f-486b-afbf-4ae7f73dd481",
          "id": "f38a1cd3-ba6f-486b-afbf-4ae7f73dd481",
          "molfile": "\n  Marvin  01132112382D          \n\n 15 15  0  0  0  0            999 V2000\n    3.7320   -0.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0175   -1.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0175   -1.9255    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.7300   -2.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7300   -3.1630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4425   -1.9255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1550   -2.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8675   -1.9255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1550   -3.1630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3050   -2.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5896   -1.9289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8778   -2.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8766   -3.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5914   -3.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3079   -3.1685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 10  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 15 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "CCC(c1ccccc1)C(=O)NC(=O)N",
          "formula": "C11H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c2e45135-d23d-4c7e-937d-c56e286e6507"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "206.2415",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "02e8f467-3371-4775-af6c-2a06cd47056e",
      "version": "11",
      "structure": {
        "id": "de2dbe8f-3e7f-43f4-8f39-3f19e3800f5f",
        "molfile": "\n  Marvin  01132111312D          \n\n 15 15  0  0  0  0            999 V2000\n    2.3050   -2.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0175   -1.9255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7300   -2.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4425   -1.9255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1550   -2.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8675   -1.9255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8778   -2.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8766   -3.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5914   -3.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3079   -3.1685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5896   -1.9289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0175   -1.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7320   -0.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7300   -3.1630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1550   -3.1630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  8  9  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1 11  2  0  0  0  0\n 11  7  1  0  0  0  0\n  5  6  1  0  0  0  0\n  2 12  1  0  0  0  0\n  1  2  1  0  0  0  0\n 12 13  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 14  2  0  0  0  0\n  7  8  2  0  0  0  0\n  5 15  2  0  0  0  0\nM  END",
        "smiles": "CCC(c1ccccc1)C(=O)NC(=O)N",
        "formula": "C11H14N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "206.2415",
        "optical_activity": "( + / - )",
        "references": [
          "50dcb2b5-c07c-4301-a6bf-b98aafcdce87",
          "e0427c15-3f94-4365-92f8-81b970e0349d",
          "84fe3cd7-e584-4964-9f9f-f43b2ec18abc"
        ],
        "stereo_centers": 1
      },
      "unii": "878CEJ4HGX"
    }
  ]
}