{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3945693d-4070-456c-99b1-803a76bac60a",
          "code": "76530-44-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=76530-44-4",
          "code_system": "CAS",
          "references": [
            "5a13ae31-257b-4f2e-be39-3220ecf2ca4c",
            "f27558c5-119d-4d4c-9188-73d1ee9d9ee7"
          ]
        },
        {
          "uuid": "2b6702bd-f82e-4e3e-90c6-9b4c9b6ad6b5",
          "code": "C83608",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83608",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5a13ae31-257b-4f2e-be39-3220ecf2ca4c"
          ]
        },
        {
          "uuid": "ce48d2ab-e372-4ce8-8d4a-f3d1d601945b",
          "code": "C489644",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67489644",
          "code_system": "MESH",
          "references": [
            "5a13ae31-257b-4f2e-be39-3220ecf2ca4c"
          ]
        },
        {
          "uuid": "f31064e2-660f-4379-b6b6-d8a9345c788b",
          "code": "SUB05633MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5a13ae31-257b-4f2e-be39-3220ecf2ca4c"
          ]
        },
        {
          "uuid": "1fba97ef-e73f-4bb4-8007-6840b795b2dd",
          "code": "5745",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5745",
          "code_system": "INN",
          "references": [
            "5a13ae31-257b-4f2e-be39-3220ecf2ca4c"
          ]
        },
        {
          "uuid": "a06f7c56-aa39-44d9-8da5-0bcb073758fe",
          "code": "CHEMBL2103760",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2103760",
          "code_system": "ChEMBL",
          "references": [
            "5a13ae31-257b-4f2e-be39-3220ecf2ca4c"
          ]
        },
        {
          "uuid": "090541ff-29d9-4325-81d9-6dbf808196e0",
          "code": "16072188",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16072188",
          "code_system": "PUBCHEM",
          "references": [
            "5a13ae31-257b-4f2e-be39-3220ecf2ca4c"
          ]
        },
        {
          "uuid": "06dec5ca-01a2-a807-4ec2-c327f529657a",
          "code": "C52588",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibacterial Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C52588",
          "code_system": "NCI_THESAURUS",
          "references": [
            "50e5376f-c7aa-80a8-5325-9ff618288cb4"
          ]
        },
        {
          "uuid": "dc28b8ad-cd45-4b4b-b3d4-f61ccd421d53",
          "code": "875AQ866X1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e04a9c0d-fb55-0039-2503-3c0acf7d8fac",
          "code": "DTXSID301046434",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301046434",
          "code_system": "EPA CompTox",
          "references": [
            "7f504508-24f0-3c78-f408-bae87d569df3"
          ]
        },
        {
          "uuid": "6ed43c05-ebf8-7811-7d14-bda46856e1c1",
          "code": "Azamulin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Azamulin",
          "code_system": "WIKIPEDIA",
          "references": [
            "7871d5a0-554b-b901-0bad-b6a9a92fa78c"
          ]
        },
        {
          "uuid": "7eefacca-69c9-4dc3-33e7-238931b14c9a",
          "code": "100000086890",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c2f8cfc2-29d5-8071-eb67-8556f5a447c5"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "db4d8975-ab7f-45ff-9ecd-34a2f7492b47",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7fc46d81-07ab-4286-a819-a2cc2021d00f",
            "refuuid": "07f646e0-041c-488f-b3c7-f07ecd46c088",
            "name": "AZAMULIN",
            "unii": "875AQ866X1",
            "linking_id": "875AQ866X1",
            "ref_pname": "AZAMULIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "78cfa058-61b1-494e-abbd-d628dd592b3e",
          "name": "((5-AMINO-S-TRIAZOL-3-YL)THIO)ACETIC ACID, 8-ESTER WITH (3AS,4R,5S,6R,8R,9R,9AR,10R)-6-ETHYLOCTAHYDRO-5,8-DIHYDROXY-4,6,9,10-TETRAMETHYL-3A,9-PROPANO-3AH-CYCLOPENTACYCLOOCTEN-1(4H)-ONE",
          "stdName": "((5-AMINO-S-TRIAZOL-3-YL)THIO)ACETIC ACID, 8-ESTER WITH (3AS,4R,5S,6R,8R,9R,9AR,10R)-6-ETHYLOCTAHYDRO-5,8-DIHYDROXY-4,6,9,10-TETRAMETHYL-3A,9-PROPANO-3AH-CYCLOPENTACYCLOOCTEN-1(4H)-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90e999cd-5506-4fec-acf0-eb805fde9e34"
          ],
          "display_name": false
        },
        {
          "uuid": "dcd096bb-56f4-4269-90e5-9f40aab3368d",
          "name": "14-((5-AMINO-4H-1,2,4-TRIAZOL-3-YL)-THIOACETOXY)-14-DEOXY-19,20-DIHYDROMUTILIN",
          "stdName": "14-((5-AMINO-4H-1,2,4-TRIAZOL-3-YL)-THIOACETOXY)-14-DEOXY-19,20-DIHYDROMUTILIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8dfc609a-f888-4f3e-b2f0-965c681e4864",
            "8e6b9578-fc96-456d-9e8b-f239fe0d27df"
          ],
          "display_name": false
        },
        {
          "uuid": "7a7fdb1d-c917-4246-8d2a-62ae3ee561c1",
          "name": "AZAMULIN",
          "stdName": "AZAMULIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd4358dc-497b-4398-a79d-818befb416fc",
            "90e999cd-5506-4fec-acf0-eb805fde9e34",
            "1be9a038-736f-4cf2-95f6-957b022c6dab"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "1a0e0ebd-2611-4100-a8bb-b88d5b19103b",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "28d21cff-52cc-4e58-99a8-4480adb33b4a",
          "name": "azamulin [INN]",
          "stdName": "AZAMULIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1be9a038-736f-4cf2-95f6-957b022c6dab"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8dfc609a-f888-4f3e-b2f0-965c681e4864",
          "citation": "https://data.epo.org/PublicationServer/getpdf.jsp?cc=EP&pn=1875903&ki=A1",
          "url": "https://data.epo.org/PublicationServer/getpdf.jsp?cc=EP&pn=1875903&ki=A1",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8e6b9578-fc96-456d-9e8b-f239fe0d27df",
          "citation": "DMF 5315",
          "doc_type": "PATENT",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90e999cd-5506-4fec-acf0-eb805fde9e34",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1be9a038-736f-4cf2-95f6-957b022c6dab",
          "citation": "INN Proposed List 54",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL54.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5a13ae31-257b-4f2e-be39-3220ecf2ca4c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390101000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28d2e303-5a6d-4a26-8eaf-4ba9e5a95faa",
          "citation": "SRS import [875AQ866X1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=875AQ866X1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390101000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd4358dc-497b-4398-a79d-818befb416fc",
          "citation": "AZAMULIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2f8cfc2-29d5-8071-eb67-8556f5a447c5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "50e5376f-c7aa-80a8-5325-9ff618288cb4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7871d5a0-554b-b901-0bad-b6a9a92fa78c",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "f27558c5-119d-4d4c-9188-73d1ee9d9ee7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7f504508-24f0-3c78-f408-bae87d569df3",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b9a212a1-cf54-4853-8054-c4e30ed6eaaa",
          "id": "b9a212a1-cf54-4853-8054-c4e30ed6eaaa",
          "molfile": "\n  Marvin  01132109362D          \n\n 33 36  0  0  1  0            999 V2000\n    1.1922   -0.3111    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.4022    0.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1891    0.5204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0342   -0.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3503   -1.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2200   -1.0860    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.4885   -0.7150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8590    0.1186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0106    0.8067    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    0.8772    1.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6807    0.3539    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.8669    1.1576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5229    0.4219    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.1507   -0.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2241   -0.9250    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.5966   -1.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0500   -0.8609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5365   -1.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6763   -1.5542    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.9918   -2.3884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8587   -1.6171    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.5782   -2.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8869    1.1543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5931    1.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5885    2.3939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3432    1.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0585    1.6141    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8002    1.2347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5590    1.5743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1144    1.0171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7287    0.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0950   -0.4189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9042    0.4396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  6  1  1  0  0  0  0\n  1 11  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  6  0  0  0\n  6  7  1  0  0  0  0\n  6 21  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  6  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 23  1  6  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  6  0  0  0\n 15 17  1  0  0  0  0\n 19 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 20  1  1  0  0  0\n 21 19  1  0  0  0  0\n 21 22  1  6  0  0  0\n 24 23  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 24  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  2  0  0  0  0\n 33 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 30 31  1  0  0  0  0\n 32 31  1  0  0  0  0\n 31 33  2  0  0  0  0\nM  END",
          "smiles": "CC[C@]1(C)C[C@H]([C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@@H]23)[C@@H](C)[C@@H]1O)OC(=O)CSc4nc(N)[nH]n4",
          "formula": "C24H38N4O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f6fd6468-325c-4dfb-ba9f-c184a15ab106"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "478.6499",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "07f646e0-041c-488f-b3c7-f07ecd46c088",
      "version": "8",
      "structure": {
        "id": "5371518a-b92a-4d29-bdff-0b525babb6fa",
        "molfile": "\n  Marvin  01132104212D          \n\n 34 37  0  0  1  0            999 V2000\n    1.2200   -1.0860    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.1922   -0.3111    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.6807    0.3539    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.9042    0.4396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8002    1.2347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7287    0.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5590    1.5743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1144    1.0171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5229    0.4219    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.8587   -1.6171    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.2241   -0.9250    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.6763   -1.5542    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.4022    0.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1507   -0.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3503   -1.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4885   -0.7150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8869    1.1543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5931    1.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0585    1.6141    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0106    0.8067    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.0342   -0.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8590    0.1186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1891    0.5204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5885    2.3939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0950   -0.4189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3432    1.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9918   -2.3884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8669    1.1576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0500   -0.8609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5966   -1.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5782   -2.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8772    1.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5365   -1.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0623    0.4997    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5 19  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13  2  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15  1  1  0  0  0  0\n  1 16  1  1  0  0  0\n  9 17  1  6  0  0  0\n 18 17  1  0  0  0  0\n 19 26  1  0  0  0  0\n 20 22  1  0  0  0  0\n 21 15  1  0  0  0  0\n 22 16  1  0  0  0  0\n 23 13  2  0  0  0  0\n 24 18  2  0  0  0  0\n 25  6  1  0  0  0  0\n 26 18  1  0  0  0  0\n 12 27  1  1  0  0  0\n  3 28  1  6  0  0  0\n 11 29  1  1  0  0  0\n 11 30  1  6  0  0  0\n 10 31  1  6  0  0  0\n 20 32  1  1  0  0  0\n 33 29  1  0  0  0  0\n 21 13  1  0  0  0  0\n 20  3  1  0  0  0  0\n 14  9  1  0  0  0  0\n  8  6  2  0  0  0  0\n  2 34  1  6  0  0  0\nM  END",
        "smiles": "CC[C@]1(C)C[C@H]([C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@@]23[H])[C@@H](C)[C@@H]1O)OC(=O)CSc4[nH]c(N)nn4",
        "formula": "C24H38N4O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "478.6499",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "28d2e303-5a6d-4a26-8eaf-4ba9e5a95faa",
          "90e999cd-5506-4fec-acf0-eb805fde9e34",
          "1be9a038-736f-4cf2-95f6-957b022c6dab"
        ],
        "stereo_centers": 8
      },
      "unii": "875AQ866X1"
    }
  ]
}