{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fc093604-c50a-4f71-8bd3-b68e3d1eb8b6",
          "code": "85765-48-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=85765-48-6",
          "code_system": "CAS",
          "references": [
            "2a220375-26b6-458f-912e-3d688efdffd3",
            "fce569b8-5e86-4d34-9001-f3a96a46cbb1"
          ]
        },
        {
          "uuid": "b277c821-8b08-40d1-8a87-5fe70c03eb7d",
          "code": "C99805",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C99805",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2a220375-26b6-458f-912e-3d688efdffd3"
          ]
        },
        {
          "uuid": "dcb99f4b-2a1a-41ad-823b-e6e4b4ec206e",
          "code": "21909551",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21909551",
          "code_system": "PUBCHEM",
          "references": [
            "2a220375-26b6-458f-912e-3d688efdffd3"
          ]
        },
        {
          "uuid": "f3992877-fda5-4170-5734-9ae36913e46f",
          "code": "DTXSID30235065",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30235065",
          "code_system": "EPA CompTox",
          "references": [
            "665cf282-b2bb-762f-30af-5a4d9f84b7f1"
          ]
        },
        {
          "uuid": "cbb2d788-6424-ed0f-f7ac-4dffacf1b1b6",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c53d0851-58e0-e6a5-07f4-e785635d66ac"
          ]
        },
        {
          "uuid": "ca89e6df-a3aa-40d1-9f39-91772bf7a2cc",
          "code": "86WS98470U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9f4ee64d-30b0-40f6-9bc4-58f1198aa026",
          "name": "2-(4-((2-AMINOETHYL)AMINO)-3-NITROPHENOXY)ETHANOL",
          "stdName": "2-(4-((2-AMINOETHYL)AMINO)-3-NITROPHENOXY)ETHANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b1d09e2-5a6e-4b48-8a1d-8228ac6ed192",
            "a41ceca3-2ff4-4c1a-9714-6325013c0882"
          ],
          "display_name": false
        },
        {
          "uuid": "5303fa40-ad50-4028-bb00-5f9c09887d3b",
          "name": "ETHANOL, 2-(4-((2-AMINOETHYL)AMINO)-3-NITROPHENOXY)-",
          "stdName": "ETHANOL, 2-(4-((2-AMINOETHYL)AMINO)-3-NITROPHENOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55d30a43-dd78-4b62-9496-f427d6f1dcce",
            "a41ceca3-2ff4-4c1a-9714-6325013c0882"
          ],
          "display_name": false
        },
        {
          "uuid": "24fb7212-0d65-47fc-b503-564ecf7e5971",
          "name": "HC ORANGE 2",
          "stdName": "HC ORANGE 2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55d30a43-dd78-4b62-9496-f427d6f1dcce",
            "a41ceca3-2ff4-4c1a-9714-6325013c0882"
          ],
          "display_name": false
        },
        {
          "uuid": "cb5f052d-fe0e-41f3-8c40-cfdbdd30a3f7",
          "name": "HC ORANGE NO. 2",
          "stdName": "HC ORANGE NO. 2",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b1d09e2-5a6e-4b48-8a1d-8228ac6ed192",
            "4c3ba008-a33f-420b-84ba-c6fa637eb76d",
            "a41ceca3-2ff4-4c1a-9714-6325013c0882"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c407d6bd-5748-4266-86f1-1492701e6fac",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9d9a5139-09d7-4ec8-88a0-f715298fa8fa",
          "name": "IMEXINE FAB",
          "stdName": "IMEXINE FAB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b1d09e2-5a6e-4b48-8a1d-8228ac6ed192",
            "a41ceca3-2ff4-4c1a-9714-6325013c0882"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9b1d09e2-5a6e-4b48-8a1d-8228ac6ed192",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a41ceca3-2ff4-4c1a-9714-6325013c0882",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55d30a43-dd78-4b62-9496-f427d6f1dcce",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a220375-26b6-458f-912e-3d688efdffd3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42a4e8c9-458e-417f-a7a0-40cf4ffaa3fe",
          "citation": "SRS import [86WS98470U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=86WS98470U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c3ba008-a33f-420b-84ba-c6fa637eb76d",
          "citation": "HC ORANGE NO. 2 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "665cf282-b2bb-762f-30af-5a4d9f84b7f1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=85765-48-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c53d0851-58e0-e6a5-07f4-e785635d66ac",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fce569b8-5e86-4d34-9001-f3a96a46cbb1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bc69c977-4bb9-4e09-8863-a6e489e3c321",
          "id": "bc69c977-4bb9-4e09-8863-a6e489e3c321",
          "molfile": "\n  Marvin  01132109452D          \n\n 17 17  0  0  0  0            999 V2000\n    5.6434   -2.4992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3579   -2.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3579   -3.7367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0723   -4.1492    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0723   -4.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3555   -5.3877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3555   -6.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0741   -6.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0741   -7.4515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7872   -7.8632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7872   -8.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5003   -9.0983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7864   -6.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7864   -5.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5009   -4.9749    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.5009   -4.1499    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.2153   -5.3874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 14  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\nM  CHG  2  15   1  16  -1\nM  END",
          "smiles": "c1cc(c(cc1OCCO)[N+](=O)[O-])NCCN",
          "formula": "C10H15N3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c376014a-3845-4850-bc0f-8a56d7f3ea02"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "241.2442",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "effbb636-18d9-4102-9cd3-b62e82637531",
      "version": "5",
      "structure": {
        "id": "44ca15e1-f34f-4bd8-8d11-d667fc57bd43",
        "molfile": "\n  Marvin  01132103372D          \n\n 17 17  0  0  0  0            999 V2000\n    6.3555   -5.3877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7864   -5.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0723   -4.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7864   -6.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3555   -6.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0741   -6.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0723   -4.1492    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3579   -3.7367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3579   -2.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6434   -2.4992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0741   -7.4515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7872   -7.8632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7872   -8.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5003   -9.0983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5009   -4.9749    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.5009   -4.1499    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.2153   -5.3874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  6  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  2  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  2  2  0  0  0  0\n  3  1  2  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  2 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\nM  CHG  2  15   1  16  -1\nM  END",
        "smiles": "c1cc(c(cc1OCCO)[N+](=O)[O-])NCCN",
        "formula": "C10H15N3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "241.2442",
        "optical_activity": "NONE",
        "references": [
          "55d30a43-dd78-4b62-9496-f427d6f1dcce",
          "42a4e8c9-458e-417f-a7a0-40cf4ffaa3fe"
        ],
        "stereo_centers": 0
      },
      "unii": "86WS98470U"
    }
  ]
}