{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7052b9ac-326c-4849-8481-5c0cfb7ae087", "code": "1801837-96-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1801837-96-6", "code_system": "CAS", "references": [ "586f468b-a783-409e-9919-a34efcfc9105", "13477d2b-71cd-4778-803f-f7633e3e1e2c" ] }, { "uuid": "ab0c1a3c-e9a1-4e44-8be7-7fa54d4a016a", "code": "33713", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/33713", "code_system": "PUBCHEM", "references": [ "586f468b-a783-409e-9919-a34efcfc9105" ] }, { "uuid": "9f4f29da-d839-472a-8e4e-f187f253bec5", "code": "86Q2Q17N4V", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "607d9ab0-baf1-f87f-e3ec-d54d7434a2b3", "code": "DTXSID801347215", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801347215", "code_system": "EPA CompTox", "references": [ "810c5a55-5885-a5cf-931a-c1c616c161ae" ] } ], "substance_class": "chemical", "names": [ { "uuid": "932de79f-9937-420f-b13a-572498b2338f", "name": "1-PROPANOL, 2,2'-OXYBIS-, 1,1'-DIBENZOATE", "stdName": "1-PROPANOL, 2,2'-OXYBIS-, 1,1'-DIBENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ea0d774f-a0ee-4e05-a396-b72ef5e79e01" ], "display_name": false }, { "uuid": "31aae021-c63c-4ee8-a813-5220ac3a7e4e", "name": "2,2'-OXYBIS-1-PROPANOL DIBENZOATE", "stdName": "2,2'-OXYBIS-1-PROPANOL DIBENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7daa0e89-287b-4e9e-bf2e-5cd04c561a86" ], "display_name": true }, { "uuid": "379f458a-311f-4839-8850-d6321563c0e0", "name": "DI(1,2-PROPYLENE GLYCOL) DIBENZOATE, HEAD TO HEAD-", "stdName": "DI(1,2-PROPYLENE GLYCOL) DIBENZOATE, HEAD TO HEAD-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7daa0e89-287b-4e9e-bf2e-5cd04c561a86" ], "display_name": false } ], "references": [ { "uuid": "7daa0e89-287b-4e9e-bf2e-5cd04c561a86", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ea0d774f-a0ee-4e05-a396-b72ef5e79e01", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "586f468b-a783-409e-9919-a34efcfc9105", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393056000, "tags": [ "NOMEN" ] }, { "uuid": "16e95eed-3a28-45bc-bc5e-43ad8bde6c72", "citation": "SRS import [86Q2Q17N4V]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=86Q2Q17N4V", "doc_type": "SRS", "public_domain": true, "document_date": 1493393056000, "tags": [ "NOMEN" ] }, { "uuid": "13477d2b-71cd-4778-803f-f7633e3e1e2c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "810c5a55-5885-a5cf-931a-c1c616c161ae", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d47e8b3c-8817-4aac-afb2-de41c0a6ae50", "id": "d47e8b3c-8817-4aac-afb2-de41c0a6ae50", "molfile": "\n Marvin 01132111012D \n\n 25 26 0 0 0 0 999 V2000\n 9.7332 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7332 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 10.4476 -5.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1621 -5.9410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8766 -5.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8766 -4.7036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5910 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3055 -5.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0200 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0200 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3055 -7.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5910 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0187 -5.5286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3042 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.3042 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5898 -5.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8753 -5.9410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1608 -5.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1608 -4.7036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4464 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7319 -5.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0174 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0174 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7319 -7.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4464 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 13 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 12 2 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 25 2 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\nM END", "smiles": "CC(COC(=O)c1ccccc1)OC(C)COC(=O)c2ccccc2", "formula": "C20H22O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d3b61dce-d6d4-471e-a244-0e992272304f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "342.3864", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "ddc66e86-90d3-4a22-8684-a1d48cf97b6f", "version": "4", "structure": { "id": "e62173fe-570b-4d22-bf38-703b65b59701", "molfile": "\n Marvin 01132111552D \n\n 25 26 0 0 0 0 999 V2000\n 13.3055 -5.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0200 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0200 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3055 -7.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5910 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5910 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8766 -5.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1621 -5.9410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4476 -5.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7332 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7332 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0187 -5.5286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3042 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3042 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5898 -5.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8753 -5.9410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1608 -5.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1608 -4.7036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4464 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7319 -5.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0174 -5.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0174 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7319 -7.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4464 -6.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8766 -4.7036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 1 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 19 24 1 0 0 0 0\n 24 23 2 0 0 0 0\n 7 25 2 0 0 0 0\nM END", "smiles": "CC(COC(=O)c1ccccc1)OC(C)COC(=O)c2ccccc2", "formula": "C20H22O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "342.3864", "optical_activity": "UNSPECIFIED", "references": [ "ea0d774f-a0ee-4e05-a396-b72ef5e79e01", "16e95eed-3a28-45bc-bc5e-43ad8bde6c72" ], "stereo_centers": 2 }, "unii": "86Q2Q17N4V" } ] }