{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "26880b75-0244-4b59-ba7d-60b7031ecf9b",
          "code": "10465-78-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10465-78-8",
          "code_system": "CAS",
          "references": [
            "4c6a0554-95d4-4aca-87f5-a5c68d44f181",
            "567318af-f74a-446c-94da-b7c1886760a9"
          ]
        },
        {
          "uuid": "fde258d1-1b8e-4724-9e86-41b99eba163d",
          "code": "D003958",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68003958",
          "code_system": "MESH",
          "references": [
            "4c6a0554-95d4-4aca-87f5-a5c68d44f181"
          ]
        },
        {
          "uuid": "687d0220-ad79-4b75-82cd-5a39e472431e",
          "code": "233-951-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.852",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4c6a0554-95d4-4aca-87f5-a5c68d44f181"
          ]
        },
        {
          "uuid": "47507195-1b73-4b91-802d-2dfba5959f18",
          "code": "5353800",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5353800",
          "code_system": "PUBCHEM",
          "references": [
            "4c6a0554-95d4-4aca-87f5-a5c68d44f181"
          ]
        },
        {
          "uuid": "8c4d224f-ac13-9a4c-92db-e1a9b9c25b26",
          "code": "DTXSID6040456",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6040456",
          "code_system": "EPA CompTox",
          "references": [
            "045b5f20-de20-4d30-0cd3-e98e98ee3e40"
          ]
        },
        {
          "uuid": "d012b3fd-9914-40fb-a5f9-1cc47983cc98",
          "code": "86EQC90W32",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "80d37c83-8a79-b13e-ec70-b3c2da486dc7",
          "code": "48958",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:48958",
          "code_system": "CHEBI",
          "references": [
            "da50f421-4028-6328-b867-903a37d4b127"
          ]
        },
        {
          "uuid": "d568cb21-5c05-6d18-9bb6-3ca3776154ec",
          "code": "Tetramethylazodicarboxamide",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tetramethylazodicarboxamide",
          "code_system": "WIKIPEDIA",
          "references": [
            "2ddcb6c4-3717-ebc6-59e8-d462816aa48f"
          ]
        },
        {
          "uuid": "792ec37e-d611-c5b3-d5e3-60178e51c38e",
          "code": "143013",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=143013",
          "code_system": "NSC",
          "references": [
            "7e72c02d-ee54-124a-4903-e6f56cd8921d"
          ]
        },
        {
          "uuid": "1730ef28-1aa3-fa4a-a665-2b7d7e5a703e",
          "code": "300000023398",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "64fb447d-24f6-e801-0939-3ae28ef3520e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7e06717d-9b05-4f94-b43c-8c06cc3bb2d8",
          "name": "1,1'-AZOBIS(N,N-DIMETHYLFORMAMIDE)",
          "stdName": "1,1'-AZOBIS(N,N-DIMETHYLFORMAMIDE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f000fd7-9842-44e0-95c4-9117432b92af",
            "899ffd49-115f-4d68-95ca-0a5783b3ebda"
          ],
          "display_name": false
        },
        {
          "uuid": "eec6f02d-e52b-48a7-908e-0558143e90ca",
          "name": "DIAMIDE",
          "stdName": "DIAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb29537c-9cd9-455b-90fe-90c8a6221571",
            "29bbfc15-e9a4-4359-ab26-8eb8d818115b"
          ],
          "display_name": true
        },
        {
          "uuid": "3d6378ce-c375-47d0-9ff8-dad7c4615ef9",
          "name": "N,N,N',N'-TETRAMETHYLAZODICARBOXAMIDE",
          "stdName": "N,N,N',N'-TETRAMETHYLAZODICARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f000fd7-9842-44e0-95c4-9117432b92af",
            "899ffd49-115f-4d68-95ca-0a5783b3ebda"
          ],
          "display_name": false
        },
        {
          "uuid": "4ee3181e-fa88-4496-9ea9-242bbe7ea1be",
          "name": "NSC-143013",
          "stdName": "NSC-143013",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91d1435c-76a1-4dbd-94c7-2f856d27f1a4",
            "8f000fd7-9842-44e0-95c4-9117432b92af"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cb29537c-9cd9-455b-90fe-90c8a6221571",
          "citation": "CHEMID 2011 Drugportal",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "29bbfc15-e9a4-4359-ab26-8eb8d818115b",
          "citation": "DRUGPORTAL 2011",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "899ffd49-115f-4d68-95ca-0a5783b3ebda",
          "citation": "sigma",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f000fd7-9842-44e0-95c4-9117432b92af",
          "citation": "SIGMA-ALDRICH",
          "doc_type": "SIGMA-ALDRICH",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91d1435c-76a1-4dbd-94c7-2f856d27f1a4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c6a0554-95d4-4aca-87f5-a5c68d44f181",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391082000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23635534-f020-4dde-98d9-9b8e23a2077a",
          "citation": "SRS import [86EQC90W32]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=86EQC90W32",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391082000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aaed1325-28d2-456b-ba20-65eb1d93ace8",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "045b5f20-de20-4d30-0cd3-e98e98ee3e40",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10465-78-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2ddcb6c4-3717-ebc6-59e8-d462816aa48f",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "da50f421-4028-6328-b867-903a37d4b127",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "567318af-f74a-446c-94da-b7c1886760a9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7e72c02d-ee54-124a-4903-e6f56cd8921d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "64fb447d-24f6-e801-0939-3ae28ef3520e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1fd3ce87-c636-435e-80aa-76937e7591c3",
          "id": "1fd3ce87-c636-435e-80aa-76937e7591c3",
          "molfile": "\n  Marvin  01132101492D          \n\n 12 11  0  0  0  0            999 V2000\n   -2.4984   -0.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7865    0.2004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7865    1.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0712   -0.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0678   -1.0367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3559    0.2038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3559   -0.2038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0712    0.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0678    1.0367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7865   -0.2004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4984    0.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7865   -1.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\nM  END",
          "smiles": "CN(C)C(=O)/N=N/C(=O)N(C)C",
          "formula": "C6H12N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f4e64881-cf7a-4a69-b00f-7d49a5825f1a"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "172.1853",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c25a2066-8c38-4831-a1e5-e56078d0152e",
      "version": "7",
      "structure": {
        "id": "3092dc7c-00fd-4951-a222-a24058eccd8d",
        "molfile": "\n  Marvin  01132102362D          \n\n 12 11  0  0  0  0            999 V2000\n   -1.0712   -0.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7865    0.2004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3559    0.2038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0678   -1.0367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4984   -0.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7865    1.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3559   -0.2038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0712    0.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7865   -0.2004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0678    1.0367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4984    0.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7865   -1.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\nM  END",
        "smiles": "CN(C)C(=O)/N=N/C(=O)N(C)C",
        "formula": "C6H12N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "172.1853",
        "optical_activity": "NONE",
        "references": [
          "23635534-f020-4dde-98d9-9b8e23a2077a",
          "aaed1325-28d2-456b-ba20-65eb1d93ace8"
        ],
        "stereo_centers": 0
      },
      "unii": "86EQC90W32"
    }
  ]
}