{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "26ce4043-df72-4b3c-a416-c2b9ceaf973c",
          "code": "24880-43-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=24880-43-1",
          "code_system": "CAS",
          "references": [
            "945a0e1a-fe68-413e-8a60-e2a5a11d8427",
            "a1090f26-ee99-46be-a8bb-b50cd67b8d19"
          ]
        },
        {
          "uuid": "79f5c76a-f33a-40c9-b58c-6d1c9452706b",
          "code": "m7246",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7246?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "945a0e1a-fe68-413e-8a60-e2a5a11d8427"
          ]
        },
        {
          "uuid": "8f3b4af0-a42f-4d18-9c53-81fc356117de",
          "code": "394162",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/394162",
          "code_system": "PUBCHEM",
          "references": [
            "945a0e1a-fe68-413e-8a60-e2a5a11d8427"
          ]
        },
        {
          "uuid": "fe936bf7-d5c2-4b01-92ce-6b3d3f7b2813",
          "code": "86E2ZU4ETY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b5b15ce0-4df9-a30b-5903-f981d998488e",
          "code": "DTXSID50947774",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50947774",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "e38add51-3dab-4be9-9cdb-40fbd4bc63cd",
          "amount": {
            "uuid": "b7422e68-b654-4de7-bafc-0f7367faa774"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "54b1ae0f-642c-4b96-a2dc-1823aecb593d",
            "refuuid": "6fb160a4-a1eb-41ed-b239-92ea1b108de7",
            "name": "MESEMBRINE",
            "unii": "86E2ZU4ETY",
            "linking_id": "86E2ZU4ETY",
            "ref_pname": "MESEMBRINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "85926aa0-b809-498c-a06b-fd6c1c085fd9",
          "name": "(-)-MESEMBRANONE",
          "stdName": "(-)-MESEMBRANONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dede1d1-7518-4dd7-9cb6-4f63ca2635f1"
          ],
          "display_name": false
        },
        {
          "uuid": "8cd489c0-3ad0-49d8-aa42-2d94f687701e",
          "name": "(-)-MESEMBRINE",
          "stdName": "(-)-MESEMBRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dede1d1-7518-4dd7-9cb6-4f63ca2635f1"
          ],
          "display_name": false
        },
        {
          "uuid": "9b419c98-1d12-48ba-9313-d30c2898278b",
          "name": "4.ALPHA.,9.ALPHA.-MESEMBRINE",
          "stdName": "4.ALPHA.,9.ALPHA.-MESEMBRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dede1d1-7518-4dd7-9cb6-4f63ca2635f1"
          ],
          "display_name": false
        },
        {
          "uuid": "530e6c9b-fdef-40c5-b2fa-d4aad8e656c3",
          "name": "6H-INDOL-6-ONE, 3A-(3,4-DIMETHOXYPHENYL)OCTAHYDRO-1-METHYL-, (3AS,7AS)-",
          "stdName": "6H-INDOL-6-ONE, 3A-(3,4-DIMETHOXYPHENYL)OCTAHYDRO-1-METHYL-, (3AS,7AS)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dede1d1-7518-4dd7-9cb6-4f63ca2635f1"
          ],
          "display_name": false
        },
        {
          "uuid": "1d2afd03-b3c6-41c1-885d-d943c89eff7d",
          "name": "6H-INDOL-6-ONE, 3A-(3,4-DIMETHOXYPHENYL)OCTAHYDRO-1-METHYL-, (3AS-CIS)-",
          "stdName": "6H-INDOL-6-ONE, 3A-(3,4-DIMETHOXYPHENYL)OCTAHYDRO-1-METHYL-, (3AS-CIS)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dede1d1-7518-4dd7-9cb6-4f63ca2635f1"
          ],
          "display_name": false
        },
        {
          "uuid": "8f583b9e-9f01-4b0d-8733-416fac63166f",
          "name": "MESEMBRANONE",
          "stdName": "MESEMBRANONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dede1d1-7518-4dd7-9cb6-4f63ca2635f1"
          ],
          "display_name": false
        },
        {
          "uuid": "2cd171f5-a800-4dc2-8cef-3e2ca8a0b523",
          "name": "MESEMBRIN",
          "stdName": "MESEMBRIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dede1d1-7518-4dd7-9cb6-4f63ca2635f1"
          ],
          "display_name": false
        },
        {
          "uuid": "d9f2d9ad-82f9-4c20-82cb-de2d1737a10f",
          "name": "MESEMBRINE",
          "stdName": "MESEMBRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b3bc466-420d-4b00-8432-637e31531a8a",
            "f7f1a298-714c-475a-8466-5500f7bfd200",
            "577b28c0-35e5-4d5a-9665-01649911e541"
          ],
          "display_name": true
        },
        {
          "uuid": "cd70b1f6-3416-4c75-915e-d0d60ac9e6b1",
          "name": "MESEMBRINE [MI]",
          "stdName": "MESEMBRINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "577b28c0-35e5-4d5a-9665-01649911e541"
          ],
          "display_name": false
        },
        {
          "uuid": "64c1b90e-b04f-4a5e-8761-5f96aaaa3814",
          "name": "MESEMBRINE, (-)-",
          "stdName": "MESEMBRINE, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dede1d1-7518-4dd7-9cb6-4f63ca2635f1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7b3bc466-420d-4b00-8432-637e31531a8a",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1dede1d1-7518-4dd7-9cb6-4f63ca2635f1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "577b28c0-35e5-4d5a-9665-01649911e541",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "945a0e1a-fe68-413e-8a60-e2a5a11d8427",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392257000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8944fc55-4283-4107-a6c9-6e46559b476c",
          "citation": "SRS import [86E2ZU4ETY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=86E2ZU4ETY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392257000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7f1a298-714c-475a-8466-5500f7bfd200",
          "citation": "MESEMBRINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a1090f26-ee99-46be-a8bb-b50cd67b8d19",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a3e97d59-7a71-4c36-8be9-fea62c477ac6",
          "id": "a3e97d59-7a71-4c36-8be9-fea62c477ac6",
          "molfile": "\n  Marvin  01132108312D          \n\n 21 23  0  0  1  0            999 V2000\n   13.1561  -11.4503    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   13.8706  -11.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5851  -11.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2995  -11.8628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5851  -10.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8706  -10.2128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1561  -10.6253    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.3715  -10.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8866  -11.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3715  -11.7052    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n   12.1166  -12.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0699   -9.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7373   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6511   -8.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8974   -8.1638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8112   -7.3433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0575   -7.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2300   -8.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4763   -8.3132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8089   -8.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3162   -9.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  0  0  0  0\n  1 10  1  6  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7 12  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 21  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 18 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 18  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CN1CC[C@@]2(CCC(=O)C[C@@H]21)c3ccc(c(c3)OC)OC",
          "formula": "C17H23NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7f8c8c43-add8-4b35-8c95-20010deb9323"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "289.3701",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6fb160a4-a1eb-41ed-b239-92ea1b108de7",
      "version": "6",
      "structure": {
        "id": "fb0b9c69-60ed-46dd-9726-f4fba911dc22",
        "molfile": "\n  Marvin  01132113002D          \n\n 22 24  0  0  1  0            999 V2000\n   12.3715  -11.7052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8866  -11.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3715  -10.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1561  -10.6253    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.8706  -10.2128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5851  -10.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5851  -11.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8706  -11.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1561  -11.4503    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.2995  -11.8628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1166  -12.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0699   -9.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3162   -9.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2300   -8.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8974   -8.1638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6511   -8.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7373   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8112   -7.3433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0575   -7.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4763   -8.3132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8089   -8.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0699  -12.2707    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  9  1  0  0  0  0\n  7 10  2  0  0  0  0\n  1 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 12 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 15 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 14 20  1  0  0  0  0\n  4 12  1  1  0  0  0\n  9 22  1  1  0  0  0\nM  END",
        "smiles": "CN1CC[C@@]2(CCC(=O)C[C@@]21[H])c3ccc(c(c3)OC)OC",
        "formula": "C17H23NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "289.3701",
        "optical_activity": "( - )",
        "references": [
          "8944fc55-4283-4107-a6c9-6e46559b476c",
          "1dede1d1-7518-4dd7-9cb6-4f63ca2635f1"
        ],
        "stereo_centers": 2
      },
      "unii": "86E2ZU4ETY"
    }
  ]
}