{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "74518f6e-2303-40c2-839c-c998765a2f9a",
          "code": "2478-38-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2478-38-8",
          "code_system": "CAS",
          "references": [
            "33e32c7a-22bb-4f45-842a-9508b634562b",
            "d64a2ddb-58c6-40c4-becb-bf6ba0fda80f"
          ]
        },
        {
          "uuid": "50700ec4-7d4b-4d12-9403-299fb46a19c0",
          "code": "ACETOSYRINGONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Acetosyringone",
          "code_system": "WIKIPEDIA",
          "references": [
            "33e32c7a-22bb-4f45-842a-9508b634562b"
          ]
        },
        {
          "uuid": "8b6616bc-e5e9-4e74-9239-bf1a13b40511",
          "code": "17198",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17198",
          "code_system": "PUBCHEM",
          "references": [
            "33e32c7a-22bb-4f45-842a-9508b634562b"
          ]
        },
        {
          "uuid": "78315e34-fee4-408c-b880-550b59944229",
          "code": "219-610-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.828",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "33e32c7a-22bb-4f45-842a-9508b634562b"
          ]
        },
        {
          "uuid": "ada6ea0b-a493-7bd1-48c4-21eeae703f94",
          "code": "DTXSID2062454",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2062454",
          "code_system": "EPA CompTox",
          "references": [
            "88313398-96b2-c8e1-e7f5-211207fd92a8"
          ]
        },
        {
          "uuid": "cc9cb39f-1943-4a4d-84bc-ba97b12f3d3b",
          "code": "866P45Y84S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "37c3f267-c20f-0fe0-f503-2809fc501e70",
          "code": "2404",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2404",
          "code_system": "CHEBI",
          "references": [
            "7d974a07-fba3-abf4-a6bb-af5656816ddc"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "39dffd4a-b40e-41e8-b3b1-941833802425",
          "name": "4'-HYDROXY-3',5'-DIMETHOXYACETOPHENONE",
          "stdName": "4'-HYDROXY-3',5'-DIMETHOXYACETOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbd17fd2-1959-4e42-93c7-78e422c3f183"
          ],
          "display_name": false
        },
        {
          "uuid": "28aec75f-2d8d-4329-b3f0-f877850b5463",
          "name": "ACETOSYRINGENIN",
          "stdName": "ACETOSYRINGENIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbd17fd2-1959-4e42-93c7-78e422c3f183"
          ],
          "display_name": false
        },
        {
          "uuid": "9c4fc7f8-1ad7-4a86-96b6-4d36c3fbbb52",
          "name": "ACETOSYRINGONE",
          "stdName": "ACETOSYRINGONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ee8e057-8812-479e-9cd9-bf543c84d3ab",
            "7f9c5a73-acd4-4158-b97c-1e171f911f30"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "7f9c5a73-acd4-4158-b97c-1e171f911f30",
          "citation": "CHEMID 2011 Drugportal",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2ee8e057-8812-479e-9cd9-bf543c84d3ab",
          "citation": "DRUGPORTAL 2011",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbd17fd2-1959-4e42-93c7-78e422c3f183",
          "citation": "http://en.wikipedia.org/wiki/Acetosyringone",
          "url": "http://en.wikipedia.org/wiki/Acetosyringone",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33e32c7a-22bb-4f45-842a-9508b634562b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391086000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "870c94c4-8f60-4bed-9929-04a1b1154a5c",
          "citation": "SRS import [866P45Y84S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=866P45Y84S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391086000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "646a50fc-e659-4c15-a746-f27c92dc8d6f",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88313398-96b2-c8e1-e7f5-211207fd92a8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2478-38-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7d974a07-fba3-abf4-a6bb-af5656816ddc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d64a2ddb-58c6-40c4-becb-bf6ba0fda80f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "40844892-b881-45cd-950b-2fb8502ee471",
          "id": "40844892-b881-45cd-950b-2fb8502ee471",
          "molfile": "\n  Marvin  01132103252D          \n\n 14 14  0  0  0  0            999 V2000\n   -2.2006    0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4780    0.8725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7610    0.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0585    0.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6640    0.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6640   -0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0585   -0.7994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0585   -1.6115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6640   -2.0195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7610   -0.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4780   -0.8104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3811    0.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0890    0.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3866    1.6683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 10  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5 12  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n 10  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)c1cc(c(c(c1)OC)O)OC",
          "formula": "C10H12O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8fc4d6d8-e96e-4b15-8256-0f684e6c1023"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "196.2003",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "37539621-3768-4fcd-8673-86ca8c824ee5",
      "version": "4",
      "structure": {
        "id": "a495c451-7cc7-4a51-bfb0-d4b3db9c3df4",
        "molfile": "\n  Marvin  01132108332D          \n\n 14 14  0  0  0  0            999 V2000\n   -0.7610    0.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7610   -0.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0585    0.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4780    0.8725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0585   -0.7994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4780   -0.8104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6640    0.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2006    0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6640   -0.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0585   -1.6115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3811    0.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6640   -2.0195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0890    0.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3866    1.6683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  2  0  0  0  0\n  7  9  2  0  0  0  0\nM  END",
        "smiles": "CC(=O)c1cc(c(c(c1)OC)O)OC",
        "formula": "C10H12O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "196.2003",
        "optical_activity": "NONE",
        "references": [
          "646a50fc-e659-4c15-a746-f27c92dc8d6f",
          "870c94c4-8f60-4bed-9929-04a1b1154a5c"
        ],
        "stereo_centers": 0
      },
      "unii": "866P45Y84S"
    }
  ]
}