{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "94ec7b40-ee9e-4ae0-962b-b9212053db94",
          "code": "126139-79-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=126139-79-5",
          "code_system": "CAS",
          "references": [
            "4ae997f8-a014-4191-a161-bdd3ef99d68e",
            "566611e4-59cb-4def-9a4e-5e868d76dee4"
          ]
        },
        {
          "uuid": "28c0c0d2-516a-4950-b414-4ff158de8230",
          "code": "71587464",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587464",
          "code_system": "PUBCHEM",
          "references": [
            "4ae997f8-a014-4191-a161-bdd3ef99d68e"
          ]
        },
        {
          "uuid": "fa633049-b239-94cb-603a-c2831ef9b941",
          "code": "DTXSID80155087",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80155087",
          "code_system": "EPA CompTox",
          "references": [
            "74bd4a81-ae51-066c-b764-7f2ac86722b3"
          ]
        },
        {
          "uuid": "0c56354b-66da-4e4e-aede-0a8e00b3e10e",
          "code": "865390F26I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "025fe33f-2461-411e-a0f6-cefa2b02c899",
          "name": "DISODIUM MALYL TYROSINATE",
          "stdName": "DISODIUM MALYL TYROSINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eae5a18c-ee3d-4126-860a-cbc517a0634a",
            "cfe6b000-62f9-40de-bb6b-aa3eb36e975b",
            "17418060-63c9-40ff-9a7d-49aedfaedc0b",
            "803051c1-4f77-458c-8527-affccd7971ac"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "62b51925-b1d4-4619-94e6-901d022344aa",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "cb878942-1098-4001-a056-b6efd308658a",
          "name": "L-TYROSINE, N-((2S)-3-CARBOXY-2-HYDROXY-1-OXOPROPYL)-, DISODIUM SALT",
          "stdName": "L-TYROSINE, N-((2S)-3-CARBOXY-2-HYDROXY-1-OXOPROPYL)-, DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26111e55-ce4a-4b77-b14a-93f654721c50",
            "17418060-63c9-40ff-9a7d-49aedfaedc0b"
          ],
          "display_name": false
        },
        {
          "uuid": "db63d0c6-bb8e-4875-9d3c-423e5d3766a5",
          "name": "L-TYROSINE, N-((2S)-3-CARBOXY-2-HYDROXY-1-OXOPROPYL)-, SODIUM SALT (1:2)",
          "stdName": "L-TYROSINE, N-((2S)-3-CARBOXY-2-HYDROXY-1-OXOPROPYL)-, SODIUM SALT (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26111e55-ce4a-4b77-b14a-93f654721c50",
            "17418060-63c9-40ff-9a7d-49aedfaedc0b"
          ],
          "display_name": false
        },
        {
          "uuid": "11db9408-f903-4364-a6e7-b2a5f720b0d3",
          "name": "L-TYROSINE, N-(3-CARBOXY-2-HYDROXY-1-OXOPROPYL)-, DISODIUM SALT, (S)-",
          "stdName": "L-TYROSINE, N-(3-CARBOXY-2-HYDROXY-1-OXOPROPYL)-, DISODIUM SALT, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26111e55-ce4a-4b77-b14a-93f654721c50",
            "17418060-63c9-40ff-9a7d-49aedfaedc0b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "eae5a18c-ee3d-4126-860a-cbc517a0634a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cfe6b000-62f9-40de-bb6b-aa3eb36e975b",
          "citation": "CTFA DL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17418060-63c9-40ff-9a7d-49aedfaedc0b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26111e55-ce4a-4b77-b14a-93f654721c50",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ae997f8-a014-4191-a161-bdd3ef99d68e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390466000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b5e9490-9548-40ca-a879-74008a492904",
          "citation": "SRS import [865390F26I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=865390F26I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390466000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "803051c1-4f77-458c-8527-affccd7971ac",
          "citation": "DISODIUM MALYL TYROSINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74bd4a81-ae51-066c-b764-7f2ac86722b3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=126139-79-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "566611e4-59cb-4def-9a4e-5e868d76dee4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f283b962-7323-4aff-b1e9-035475e250e9",
          "id": "f283b962-7323-4aff-b1e9-035475e250e9",
          "molfile": "\n  Marvin  01132112352D          \n\n  1  0  0  0  1  0            999 V2000\n   11.0284   -3.9022    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "979ac221-dafb-4221-89fb-808ec3dbf812"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "6b79ef63-c29a-4207-9b5f-60e1bcb2b5a9",
          "id": "6b79ef63-c29a-4207-9b5f-60e1bcb2b5a9",
          "molfile": "\n  Marvin  01132105352D          \n\n 21 21  0  0  1  0            999 V2000\n   10.0413   -5.9791    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.6137   -6.6846    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.8661   -5.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2633   -6.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8357   -7.4253    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.0881   -6.7198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6442   -5.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0718   -4.5504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8193   -5.2559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5538   -4.4573    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.7445   -4.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2009   -4.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4665   -5.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9228   -6.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1135   -6.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5699   -6.7789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8480   -5.3773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3917   -4.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0974   -3.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8318   -3.0557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9067   -3.9973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  1  0  0  0\n 10 11  1  0  0  0  0\n 19 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 18 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  2  0  0  0  0\nM  CHG  2   2  -1   5  -1\nM  END",
          "smiles": "c1cc(ccc1C[C@@H](C(=O)O)NC(=O)[C@H](CC(=O)[O-])[O-])O",
          "formula": "C13H13NO7",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "36698661-fbd1-4cb3-8881-a29389c8438c"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "295.2453",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3de9f1e0-a729-4036-8041-3814219b526d",
      "version": "4",
      "structure": {
        "id": "91e1822e-4153-44df-9bae-5985fa7b41e7",
        "molfile": "\n  Marvin  01132107342D          \n\n 23 21  0  0  1  0            999 V2000\n   11.0284   -3.9022    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n   11.2205   -8.1761    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    9.6442   -5.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8193   -5.2559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5538   -4.4573    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.0974   -3.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8318   -3.0557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9067   -3.9973    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.7445   -4.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2009   -4.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4665   -5.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9228   -6.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1135   -6.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5699   -6.7789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8480   -5.3773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3917   -4.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0413   -5.9791    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.8661   -5.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2633   -6.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8357   -7.4253    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.0881   -6.7198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6137   -6.6846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0718   -4.5504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  5  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 10  2  0  0  0  0\n 17  3  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  2  0  0  0  0\n 17 22  1  6  0  0  0\n 23  3  2  0  0  0  0\nM  CHG  4   1   1   2   1   8  -1  20  -1\nM  END",
        "smiles": "c1cc(ccc1C[C@@H](C(=O)[O-])NC(=O)[C@H](CC(=O)[O-])O)O.[Na+].[Na+]",
        "formula": "C13H13NO7.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "341.2249",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "26111e55-ce4a-4b77-b14a-93f654721c50",
          "6b5e9490-9548-40ca-a879-74008a492904"
        ],
        "stereo_centers": 2
      },
      "unii": "865390F26I"
    }
  ]
}