{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e415e514-e4bf-48d3-9b87-d1839d63ab87",
          "code": "121199-28-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=121199-28-8",
          "code_system": "CAS",
          "references": [
            "44a8b4ec-e0a8-4554-9b4d-5df1a3a5b0f2",
            "e7708ce1-24a9-4328-baf6-699fa0aa590f"
          ]
        },
        {
          "uuid": "6494dc26-569c-4513-8d97-c0f6fb34ae14",
          "code": "71587448",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587448",
          "code_system": "PUBCHEM",
          "references": [
            "44a8b4ec-e0a8-4554-9b4d-5df1a3a5b0f2"
          ]
        },
        {
          "uuid": "8bd58913-5d4e-4099-9e48-d6ee6af9b1db",
          "code": "85A0D4PKKX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "add31de9-855d-6131-5230-4a309eccf272",
          "code": "DTXSID10923711",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10923711",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "688403b6-9918-5381-483c-193923fee681",
          "code": "1879",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1879/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "a26baeb6-f94a-1a3e-4360-95434b3d7b4e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "475b154a-cec3-410e-857d-bbe588fb3663",
          "name": "(±)-PERILLALDEHYDE PROPYLENEGLYCOL ACETAL",
          "stdName": "(+/-)-PERILLALDEHYDE PROPYLENEGLYCOL ACETAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5167de66-2873-423e-9e5b-096de91c2a14",
            "dc8ea112-087a-4919-aafe-0fe581ba6510"
          ],
          "display_name": false
        },
        {
          "uuid": "8c1c6610-0c11-4b51-a5ea-9006add61ead",
          "name": "1,3-DIOXOLANE, 4-METHYL-2-(4-(1-METHYLETHENYL)-1-CYCLOHEXEN-1-YL)-",
          "stdName": "1,3-DIOXOLANE, 4-METHYL-2-(4-(1-METHYLETHENYL)-1-CYCLOHEXEN-1-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5167de66-2873-423e-9e5b-096de91c2a14",
            "d122c6f7-24dd-4060-a93e-2234d68f4f29"
          ],
          "display_name": false
        },
        {
          "uuid": "e529e12e-4576-4cd4-b6aa-61da35527772",
          "name": "4-METHYL-2-(4-(1-METHYLETHENYL)- 1-CYCLOHEXEN-1-YL)-1,3-DIOXOLANE",
          "stdName": "4-METHYL-2-(4-(1-METHYLETHENYL)- 1-CYCLOHEXEN-1-YL)-1,3-DIOXOLANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5167de66-2873-423e-9e5b-096de91c2a14",
            "8977ce47-6a15-404c-b23e-2e45454ee32a"
          ],
          "display_name": false
        },
        {
          "uuid": "2f66bf33-c0a7-4623-8969-77d934231c62",
          "name": "FEMA NO. 4530",
          "stdName": "FEMA NO. 4530",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e43fb73-d9d2-4eee-a519-a5228479dd40",
            "5167de66-2873-423e-9e5b-096de91c2a14"
          ],
          "display_name": false
        },
        {
          "uuid": "81157890-92e6-4a27-b086-1b8395e4fbf1",
          "name": "PERILLALDEHYDE PROPYLENE GLYCOL ACETAL",
          "stdName": "PERILLALDEHYDE PROPYLENE GLYCOL ACETAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5167de66-2873-423e-9e5b-096de91c2a14",
            "29c87056-75a0-4935-857e-1b70f0390fa0"
          ],
          "display_name": false
        },
        {
          "uuid": "edc373c5-0054-4b26-8c33-bd551a7c63dc",
          "name": "PERILLALDEHYDE PROPYLENEGLYCOL ACETAL",
          "stdName": "PERILLALDEHYDE PROPYLENEGLYCOL ACETAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e43fb73-d9d2-4eee-a519-a5228479dd40",
            "5167de66-2873-423e-9e5b-096de91c2a14"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "5e43fb73-d9d2-4eee-a519-a5228479dd40",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5167de66-2873-423e-9e5b-096de91c2a14",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d122c6f7-24dd-4060-a93e-2234d68f4f29",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8977ce47-6a15-404c-b23e-2e45454ee32a",
          "citation": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "url": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc8ea112-087a-4919-aafe-0fe581ba6510",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29c87056-75a0-4935-857e-1b70f0390fa0",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44a8b4ec-e0a8-4554-9b4d-5df1a3a5b0f2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391421000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6631524a-e014-45fd-851f-69e7654b787d",
          "citation": "SRS import [85A0D4PKKX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=85A0D4PKKX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391421000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7708ce1-24a9-4328-baf6-699fa0aa590f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a26baeb6-f94a-1a3e-4360-95434b3d7b4e",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a8a9a98e-9f97-4969-b3b9-76a18b387821",
          "id": "a8a9a98e-9f97-4969-b3b9-76a18b387821",
          "molfile": "\n  Marvin  01132108452D          \n\n 15 16  0  0  0  0            999 V2000\n    3.0842   -4.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4967   -5.1759    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.2418   -5.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9092   -6.4455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5766   -5.9606    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.3217   -5.1759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3735   -6.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5870   -6.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3839   -7.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9672   -6.6011    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.7537   -5.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9569   -5.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7641   -6.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9776   -7.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3474   -6.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  6  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n 12  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\nM  END",
          "smiles": "C=C(C)C1CC=C(CC1)C2OCC(C)O2",
          "formula": "C13H20O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "10deb97e-3d60-4450-a2aa-add8fae24db0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "208.2972",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "562b6586-4bd9-4317-836b-80437b5455b8",
      "version": "4",
      "structure": {
        "id": "a000a336-29c7-4c57-8b1e-0da13cc8feb3",
        "molfile": "\n  Marvin  01132108192D          \n\n 15 16  0  0  0  0            999 V2000\n    3.9092   -6.4455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2418   -5.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4967   -5.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3217   -5.1759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5766   -5.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0842   -4.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3735   -6.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5870   -6.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3839   -7.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9672   -6.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7537   -5.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9569   -5.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7641   -6.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3474   -6.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9776   -7.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  5  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n 11 12  1  0  0  0  0\n 10 11  1  0  0  0  0\n  9 10  1  0  0  0  0\n  8  9  1  0  0  0  0\n 12  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\nM  END",
        "smiles": "C=C(C)C1CC=C(CC1)C2OCC(C)O2",
        "formula": "C13H20O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "208.2972",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6631524a-e014-45fd-851f-69e7654b787d",
          "d122c6f7-24dd-4060-a93e-2234d68f4f29"
        ],
        "stereo_centers": 3
      },
      "unii": "85A0D4PKKX"
    }
  ]
}