{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "090c4256-b457-4ed9-abb3-02cf60da74ef",
          "code": "1082892-39-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1082892-39-4",
          "code_system": "CAS",
          "references": [
            "e2741d22-afbe-4bbe-b6da-9b5c3436de8c",
            "405f2808-8cf2-4ac3-b738-c6234542a7c9"
          ]
        },
        {
          "uuid": "895ad86b-16ca-4bac-8a8a-99a527cd2bae",
          "code": "11989802",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11989802",
          "code_system": "PUBCHEM",
          "references": [
            "e2741d22-afbe-4bbe-b6da-9b5c3436de8c"
          ]
        },
        {
          "uuid": "ed9fa5c5-3af9-463c-9f8b-6d50a9399533",
          "code": "8595S3630V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "955f1bb9-fbe6-41fc-aaac-85331eea3d63",
          "name": "(±)-DIACETYLRESVERATRYL THIOCTATE",
          "stdName": "(+/-)-DIACETYLRESVERATRYL THIOCTATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "444967ef-7980-4384-88b9-107c7b10d558",
            "e913ab24-4ab2-4fe1-93da-168d686d5a0f"
          ],
          "display_name": false
        },
        {
          "uuid": "f3c740e2-92a8-4548-b83c-0286c68fba60",
          "name": "1,2-DITHIOLANE-3-PENTANOIC ACID, 4-((1E)-2-(3,5-BIS(ACETYLOXY)PHENYL)ETHENYL)PHENYL ESTER",
          "stdName": "1,2-DITHIOLANE-3-PENTANOIC ACID, 4-((1E)-2-(3,5-BIS(ACETYLOXY)PHENYL)ETHENYL)PHENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "444967ef-7980-4384-88b9-107c7b10d558",
            "ef952750-a4f5-4a41-97ee-36c51c939d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "a7f0f33a-cf74-4e95-bdc9-1d61218a7db8",
          "name": "3,5-O-DIACETYLRESVERATROL-4'-LIPOATE",
          "stdName": "3,5-O-DIACETYLRESVERATROL-4'-LIPOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "444967ef-7980-4384-88b9-107c7b10d558",
            "ef952750-a4f5-4a41-97ee-36c51c939d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "9c6e69e3-8ae1-4fe9-838b-730e8509a53c",
          "name": "DIACETYL LIPOYLRESVERATROL",
          "stdName": "DIACETYL LIPOYLRESVERATROL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "444967ef-7980-4384-88b9-107c7b10d558",
            "b00d973e-d549-415e-9b9b-791d28ffbbe1"
          ],
          "display_name": false
        },
        {
          "uuid": "ce72e4a2-6c38-4a42-9408-f15f4d37944d",
          "name": "DIACETYLRESVERATRYL THIOCTATE",
          "stdName": "DIACETYLRESVERATRYL THIOCTATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "444967ef-7980-4384-88b9-107c7b10d558",
            "b00d973e-d549-415e-9b9b-791d28ffbbe1",
            "9577e7e4-9af4-4a04-b592-149f53c384a1"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4d3b9409-b28f-413a-b1c7-37b6ddcb8878",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c12d6380-740e-4741-ba93-d018dddbee70",
          "name": "DIACETYLRESVERATRYL THIOCTATE, (±)-",
          "stdName": "DIACETYLRESVERATRYL THIOCTATE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "444967ef-7980-4384-88b9-107c7b10d558",
            "e913ab24-4ab2-4fe1-93da-168d686d5a0f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b00d973e-d549-415e-9b9b-791d28ffbbe1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "444967ef-7980-4384-88b9-107c7b10d558",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef952750-a4f5-4a41-97ee-36c51c939d3a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e913ab24-4ab2-4fe1-93da-168d686d5a0f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2741d22-afbe-4bbe-b6da-9b5c3436de8c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb0dd2ae-8906-4a94-9e2e-fcce03896420",
          "citation": "SRS import [8595S3630V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8595S3630V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9577e7e4-9af4-4a04-b592-149f53c384a1",
          "citation": "DIACETYLRESVERATRYL THIOCTATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "405f2808-8cf2-4ac3-b738-c6234542a7c9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "074b4a75-c745-49ff-971f-820f2d37b32d",
          "id": "074b4a75-c745-49ff-971f-820f2d37b32d",
          "molfile": "\n  Marvin  01132100392D          \n\n 34 36  0  0  0  0            999 V2000\n    3.7280   -3.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1341   -4.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7235   -5.1604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9553   -4.4545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3613   -5.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9553   -5.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3613   -6.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9553   -7.3122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3704   -8.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9643   -8.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1916   -8.0208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1889   -6.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6027   -5.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4303   -5.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8363   -5.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6639   -5.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0828   -4.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9078   -4.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3164   -5.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1414   -5.1682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5539   -4.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1414   -3.7393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3790   -4.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7915   -3.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6165   -3.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0290   -3.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6936   -2.2715    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   12.8874   -2.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8012   -1.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5542   -0.9452    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1056   -1.5578    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9078   -5.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0828   -5.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1889   -5.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 34  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 34 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 33 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 32 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 31 27  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 32 33  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)Oc1cc(/C=C/c2ccc(cc2)OC(=O)CCCCC3CCSS3)cc(c1)OC(=O)C",
          "formula": "C26H28O6S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8de00a0e-c986-4834-8bb4-d17f699e70f6"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "500.6301",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "374f2112-ac0e-4dc0-8396-c45d76be7593",
      "version": "5",
      "structure": {
        "id": "c4899f91-9881-486c-b989-9519a76ccab8",
        "molfile": "\n  Marvin  01132110102D          \n\n 34 36  0  0  0  0            999 V2000\n   11.1414   -5.1682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9078   -4.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9078   -5.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0828   -4.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0828   -5.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9553   -7.3122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9553   -4.4545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3164   -5.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1889   -5.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1889   -6.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6639   -5.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3613   -6.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3613   -5.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9553   -5.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6027   -5.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8363   -5.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4303   -5.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1341   -4.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7280   -3.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3704   -8.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9643   -8.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5539   -4.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3790   -4.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7915   -3.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6165   -3.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0290   -3.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6936   -2.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1916   -8.0208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7235   -5.1604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1414   -3.7393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8874   -2.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8012   -1.2805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5542   -0.9452    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1056   -1.5578    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  3  8  1  0  0  0  0\n 14 12  1  0  0  0  0\n  1  8  1  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  4 11  2  0  0  0  0\n  5 11  1  0  0  0  0\n  6 12  1  0  0  0  0\n  7 13  1  0  0  0  0\n  8  2  2  0  0  0  0\n  9 15  2  0  0  0  0\n 10 15  1  0  0  0  0\n 11 16  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13  9  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 17  1  0  0  0  0\n 16 17  2  0  0  0  0\n  7 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n  6 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n  1 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 20 28  2  0  0  0  0\n 18 29  2  0  0  0  0\n 22 30  2  0  0  0  0\n 33 34  1  0  0  0  0\n 32 33  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 27  1  0  0  0  0\n 34 27  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)Oc1cc(/C=C/c2ccc(cc2)OC(=O)CCCCC3CCSS3)cc(c1)OC(=O)C",
        "formula": "C26H28O6S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "500.6301",
        "optical_activity": "( + / - )",
        "references": [
          "bb0dd2ae-8906-4a94-9e2e-fcce03896420",
          "ef952750-a4f5-4a41-97ee-36c51c939d3a"
        ],
        "stereo_centers": 1
      },
      "unii": "8595S3630V"
    }
  ]
}