{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "36bfa3fd-0a2d-45fa-bc59-48e8fbc9336c",
          "code": "A01AB12",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|STOMATOLOGICAL PREPARATIONS|STOMATOLOGICAL PREPARATIONS|Antiinfectives and antiseptics for local oral treatment|hexetidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A01AB12&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "b68c6da2-5824-456b-a5bb-743511b7ba17",
          "code": "QA01AB12",
          "comments": "VATC|STOMATOLOGICAL PREPARATIONS|STOMATOLOGICAL PREPARATIONS|Antiinfectives and antiseptics for local oral treatment|hexetidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA01AB12&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "6fb22249-0bce-4844-83ff-aaaddd847abb",
          "code": "141-94-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=141-94-6",
          "code_system": "CAS",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7",
            "4d7fd9d2-d734-4329-89c1-2cb227de22fd"
          ]
        },
        {
          "uuid": "37630b6e-fd44-44f9-bf2b-ce3c6197fd90",
          "code": "C77049",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77049",
          "code_system": "NCI_THESAURUS",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "271b386b-6c80-4ad6-ab9d-4ccbeaf1d46b",
          "code": "D006590",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68006590",
          "code_system": "MESH",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "de72c484-ed2d-466e-ae96-3b0dd3d490b1",
          "code": "SUB08037MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "ad4bfec4-c536-43ef-8d82-736d2ba74218",
          "code": "522",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=522",
          "code_system": "INN",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "6c87d387-cf9a-44d9-966d-7a7608b62782",
          "code": "205-513-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.012",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "39c7e7db-afb0-4e62-ae3c-ec015bf06568",
          "code": "5301",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/5301/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "1019422f-b9a5-4e0a-946d-709fe4d72c40",
          "code": "m6009",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6009?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "ad3f0b94-e468-471e-83ed-5003cb749955",
          "code": "DB08958",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB08958",
          "code_system": "DRUG BANK",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "f065203d-1cb3-4c48-9d32-fe2f157688eb",
          "code": "CHEMBL144673",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL144673",
          "code_system": "ChEMBL",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "38b69d73-4060-4d11-b051-83c33eb545d5",
          "code": "G01AX16",
          "comments": "ATC|GENITO URINARY SYSTEM AND SEX HORMONES|GYNECOLOGICAL ANTIINFECTIVES AND ANTISEPTICS|ANTIINFECTIVES AND ANTISEPTICS, EXCL. COMBINATIONS WITH CORTICOSTEROIDS|Other antiinfectives and antiseptics|hexetidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=G01AX16&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "98559109-584c-4d27-94b3-9d9bb6b732dd",
          "code": "3607",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3607",
          "code_system": "PUBCHEM",
          "references": [
            "69c5edc7-ad01-481f-85fd-92f15d93a5d7"
          ]
        },
        {
          "uuid": "71532395-ecf9-6f14-5575-63ba10ac507b",
          "code": "Hexetidine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hexetidine",
          "code_system": "WIKIPEDIA",
          "references": [
            "4c121fde-8887-6d98-6553-eb3e2697da52"
          ]
        },
        {
          "uuid": "d7c81a5e-d62a-e6c5-373a-bb2623987a17",
          "code": "7828",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7828",
          "code_system": "HSDB",
          "references": [
            "b623a873-72e2-5a9b-a28b-1dbd2b668db2"
          ]
        },
        {
          "uuid": "ac4790d5-e243-50e9-18d9-38d9afdcf30f",
          "code": "DTXSID1045297",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1045297",
          "code_system": "EPA CompTox",
          "references": [
            "a63a1bca-59cf-9b75-5d30-b11369acfe4d"
          ]
        },
        {
          "uuid": "117c54ea-a484-0e9c-1c3f-f0fc964cb9cf",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "13c6c6f2-5057-744f-9123-7096cfe1b80c"
          ]
        },
        {
          "uuid": "93822c93-f3d2-459f-b5ef-8096ad116a4c",
          "code": "852A84Y8LS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a9fa3792-b46a-41fb-0b22-50a28e683908",
          "code": "3277",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3277",
          "code_system": "DRUG CENTRAL",
          "references": [
            "13c6c6f2-5057-744f-9123-7096cfe1b80c"
          ]
        },
        {
          "uuid": "209b6a0a-ee90-0426-5747-fa3d4fc45a18",
          "code": "100000092531",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "60cfd58b-47ae-cd51-a5b3-5a5a1a50abac"
          ]
        },
        {
          "uuid": "e2bdfeb0-db2c-72a8-2679-e6192230a703",
          "code": "17764",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=17764",
          "code_system": "NSC",
          "references": [
            "2cf066f0-23ad-6cba-41fd-96c081e4679d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "df32554e-c966-4afa-8031-0e4c4afeaf11",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b2f7517b-5836-4023-8e32-81772629abda",
            "refuuid": "b7805240-f29f-41df-8567-bcbd758334e8",
            "name": "HEXETIDINE",
            "unii": "852A84Y8LS",
            "linking_id": "852A84Y8LS",
            "ref_pname": "HEXETIDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "aa6eac14-63e7-40d9-a863-cc94a7e0b255",
          "amount": {
            "uuid": "c7b80f12-7ba8-4a44-9054-d21d3b2cd0ef"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "d8ee11c8-c979-45d1-a418-cbe9bd73797e"
          ],
          "related_substance": {
            "uuid": "7ae1074b-7f5f-49c9-b1a8-49bcb17673b2",
            "refuuid": "d20a030e-600c-4c05-8d17-73e2adc5e705",
            "name": "Dehydrohexetidine",
            "unii": "UVU7K3N47B",
            "linking_id": "UVU7K3N47B",
            "ref_pname": "Dehydrohexetidine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b2325eb9-635b-4023-af25-79483b8dd687",
          "amount": {
            "uuid": "1c5f6ddf-8aad-4331-9120-140dbbae1bd5"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "f1bd69be-4a4b-4fb0-8924-9b3df8549a56"
          ],
          "related_substance": {
            "uuid": "d02c5079-18d1-4078-8959-53d4eb9a3535",
            "refuuid": "345d60c7-ab2f-49e1-acdd-be3708f60823",
            "name": "HEXEDINE",
            "unii": "LRE2528Y9E",
            "linking_id": "LRE2528Y9E",
            "ref_pname": "HEXEDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d0bd23b7-b44b-4755-b5bf-d145d9e3fe6a",
          "amount": {
            "uuid": "a1efe9df-7aab-4284-a3e0-bd715cff2941"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "6d8b19e8-d919-45b0-a4ce-ca66726ee7ec"
          ],
          "related_substance": {
            "uuid": "202cbd5e-6980-4acb-885a-9b8efedb8a52",
            "refuuid": "2907ed31-c8f1-44c5-8a0b-1f77b557cee6",
            "name": "1,5-NAPHTHALENEDISULFONIC ACID",
            "unii": "E8FPK78470",
            "linking_id": "E8FPK78470",
            "ref_pname": "1,5-NAPHTHALENEDISULFONIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "45abe1f4-4bcd-4893-8b32-7788b4af21e4",
          "amount": {
            "uuid": "a64d8659-c73d-4eb7-85b5-fe2f937fd6e3"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "9826cbf6-d7d0-4a50-9489-ba21ca166b2d"
          ],
          "related_substance": {
            "uuid": "50fd012f-4ab3-4805-a97c-13b8085bf208",
            "refuuid": "3d8ea336-63dc-4d64-82fd-e2932dba4a97",
            "name": "Propoctamine",
            "unii": "ES8LGA4CLQ",
            "linking_id": "ES8LGA4CLQ",
            "ref_pname": "Propoctamine",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e7c9a6d1-367a-4f99-9826-9cbaee3a2269",
          "name": "5-AMINO-1,3-BIS(2-ETHYLHEXYL)HEXAHYDRO-5-METHYLPYRIMIDINE",
          "stdName": "5-AMINO-1,3-BIS(2-ETHYLHEXYL)HEXAHYDRO-5-METHYLPYRIMIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de28344b-445d-4f11-9f44-e2814912f1b9"
          ],
          "display_name": false
        },
        {
          "uuid": "58be9d57-6d35-498e-a5f0-490273a4631e",
          "name": "HEXETIDINE",
          "stdName": "HEXETIDINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de28344b-445d-4f11-9f44-e2814912f1b9",
            "8babd898-0971-4a29-994b-ec2ed7595a1e",
            "3d3be2be-ff40-4ad0-b9d1-38daaf5b821f",
            "3e5e406d-d557-465f-b01c-70073f2fd1a7",
            "3cc5c082-efec-47e0-a31c-22bf1ef77daf",
            "3cecfdf2-0ee3-4e67-93f5-c5923b5ee01a",
            "0609d005-c1f2-40ff-81cc-48da70620013",
            "4965b014-d2be-4d0e-a5a8-f6e18bbb00b3",
            "502f6481-6fed-4eb5-851e-46d26580afd5",
            "884c6312-69eb-4116-99c0-618135626d4c",
            "b0ff7cd0-252c-4170-a563-143c96f1ffee",
            "d670bf0c-d785-4065-8c71-8d30f8b341ec",
            "de61aaeb-ddfa-420c-b4d8-074ab046b9cf",
            "3632823d-86c0-4cae-9ac9-8b2927300543",
            "7febc2d5-39f2-46c3-acd5-1b848e192b21"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "53d9e1d5-17b6-406a-9327-9323c4140d58",
              "name_org": "INN"
            },
            {
              "uuid": "62d3dca8-db6a-4d43-8ed0-a9845ab9fc70",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "700d5e4c-1795-95a7-0a6f-a79ffa8b06c2",
          "name": "HEXETIDINE [EP MONOGRAPH]",
          "stdName": "HEXETIDINE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c39d1fc-e3a0-b3bb-9c14-292249ac1561"
          ],
          "display_name": false
        },
        {
          "uuid": "bdddb90d-42a3-4d70-8e7c-b3df57950d42",
          "name": "HEXETIDINE [HSDB]",
          "stdName": "HEXETIDINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cecfdf2-0ee3-4e67-93f5-c5923b5ee01a"
          ],
          "display_name": false
        },
        {
          "uuid": "17567cbf-8870-41c3-bc45-a46f111a0c2d",
          "name": "HEXETIDINE [MART.]",
          "stdName": "HEXETIDINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e5e406d-d557-465f-b01c-70073f2fd1a7"
          ],
          "display_name": false
        },
        {
          "uuid": "e215ff72-1148-43b5-9c80-2d433508e5e2",
          "name": "HEXETIDINE [MI]",
          "stdName": "HEXETIDINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7febc2d5-39f2-46c3-acd5-1b848e192b21"
          ],
          "display_name": false
        },
        {
          "uuid": "d691abd5-34fd-d4bb-16f5-c038e8f238c1",
          "name": "Hexetidine [WHO-DD]",
          "stdName": "HEXETIDINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66c62793-6950-e37a-c061-e235fb30d6e2"
          ],
          "display_name": false
        },
        {
          "uuid": "7d890bf8-b332-4f25-bc7c-9baeaa5da9ab",
          "name": "NSC-17764",
          "stdName": "NSC-17764",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fde6f996-df13-47af-930c-576528b2f936"
          ],
          "display_name": false
        },
        {
          "uuid": "5d3c5aa9-d3c5-44b6-8846-8ac79897fead",
          "name": "STERISIL",
          "stdName": "STERISIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de28344b-445d-4f11-9f44-e2814912f1b9"
          ],
          "display_name": false
        },
        {
          "uuid": "e03345fa-67ed-4f32-b3bd-3b859c6090f2",
          "name": "hexetidine [INN]",
          "stdName": "HEXETIDINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8babd898-0971-4a29-994b-ec2ed7595a1e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "de28344b-445d-4f11-9f44-e2814912f1b9",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8babd898-0971-4a29-994b-ec2ed7595a1e",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0609d005-c1f2-40ff-81cc-48da70620013",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e5e406d-d557-465f-b01c-70073f2fd1a7",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7febc2d5-39f2-46c3-acd5-1b848e192b21",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cc5c082-efec-47e0-a31c-22bf1ef77daf",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cecfdf2-0ee3-4e67-93f5-c5923b5ee01a",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d670bf0c-d785-4065-8c71-8d30f8b341ec",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fde6f996-df13-47af-930c-576528b2f936",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69c5edc7-ad01-481f-85fd-92f15d93a5d7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390816000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ed8b6a4-9f93-4ed3-bb4e-f2512a8d1f3b",
          "citation": "SRS import [852A84Y8LS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=852A84Y8LS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390816000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0ff7cd0-252c-4170-a563-143c96f1ffee",
          "citation": "HEXETIDINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3d3be2be-ff40-4ad0-b9d1-38daaf5b821f",
          "citation": "HEXETIDINE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "502f6481-6fed-4eb5-851e-46d26580afd5",
          "citation": "HEXETIDINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3632823d-86c0-4cae-9ac9-8b2927300543",
          "citation": "HEXETIDINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "de61aaeb-ddfa-420c-b4d8-074ab046b9cf",
          "citation": "HEXETIDINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4965b014-d2be-4d0e-a5a8-f6e18bbb00b3",
          "citation": "HEXETIDINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "884c6312-69eb-4116-99c0-618135626d4c",
          "citation": "HEXETIDINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4c121fde-8887-6d98-6553-eb3e2697da52",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Hexetidine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b623a873-72e2-5a9b-a28b-1dbd2b668db2",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+141-94-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a63a1bca-59cf-9b75-5d30-b11369acfe4d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=141-94-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "60cfd58b-47ae-cd51-a5b3-5a5a1a50abac",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "13c6c6f2-5057-744f-9123-7096cfe1b80c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4d7fd9d2-d734-4329-89c1-2cb227de22fd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4c39d1fc-e3a0-b3bb-9c14-292249ac1561",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "f1bd69be-4a4b-4fb0-8924-9b3df8549a56",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6d8b19e8-d919-45b0-a4ce-ca66726ee7ec",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d8ee11c8-c979-45d1-a418-cbe9bd73797e",
          "citation": "EP",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "9826cbf6-d7d0-4a50-9489-ba21ca166b2d",
          "citation": "EP",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "2cf066f0-23ad-6cba-41fd-96c081e4679d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4324a3e5-8027-e0a3-b826-8712382e2801",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "66c62793-6950-e37a-c061-e235fb30d6e2",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "11737cef-d46c-456d-baf1-4fa45a614d2e",
          "id": "11737cef-d46c-456d-baf1-4fa45a614d2e",
          "molfile": "\n  Marvin  01132101082D          \n\n 24 24  0  0  0  0            999 V2000\n   -1.4349   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7316   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0206   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6878   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4143   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.4143   -2.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6878   -1.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1330   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8312   -2.9496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5473   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2532   -2.9496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9642   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6803   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.6803   -2.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3990   -1.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3990   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1127   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8133   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5295   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2532   -2.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5473   -1.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0089   -1.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0754   -1.0974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8312   -2.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 24  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 20  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 16 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  1  0  0  0  0\n 21 24  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)CN1CC(C)(CN(CC(CC)CCCC)C1)N",
          "formula": "C21H45N3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0f0d0a71-6780-405a-9a2d-ba11b4075f63"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "339.6029",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b7805240-f29f-41df-8567-bcbd758334e8",
      "version": "22",
      "structure": {
        "id": "70e8c591-c401-4c3b-8eca-f81a0fe73e6e",
        "molfile": "\n  Marvin  01132105512D          \n\n 24 24  0  0  0  0            999 V2000\n    2.8312   -2.9496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2532   -2.9496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5473   -1.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5473   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2532   -2.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8312   -2.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1330   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9642   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0754   -1.0974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0089   -1.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4143   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6803   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4143   -2.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6803   -2.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3990   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6878   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8133   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7316   -3.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0206   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1127   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6878   -1.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3990   -1.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4349   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5295   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  8  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 20  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 16  1  0  0  0  0\n 20 15  1  0  0  0  0\n 21 13  1  0  0  0  0\n 22 14  1  0  0  0  0\n 23 18  1  0  0  0  0\n 24 17  1  0  0  0  0\n  2  5  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)CN1CC(C)(CN(CC(CC)CCCC)C1)N",
        "formula": "C21H45N3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "339.6029",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "de28344b-445d-4f11-9f44-e2814912f1b9",
          "7ed8b6a4-9f93-4ed3-bb4e-f2512a8d1f3b",
          "8babd898-0971-4a29-994b-ec2ed7595a1e"
        ],
        "stereo_centers": 2
      },
      "unii": "852A84Y8LS"
    }
  ]
}