{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f8acf417-a6dc-4524-99a7-b342bd4037fc",
          "code": "13408-56-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13408-56-5",
          "code_system": "CAS",
          "references": [
            "c7320210-6353-47b2-8ce8-c5dde88ab8f0",
            "8e5018f6-4d85-4c98-b7c3-42e1bdaba209"
          ]
        },
        {
          "uuid": "81259487-eadb-4e4a-9314-014f3dd673ef",
          "code": "m8980",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8980?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c7320210-6353-47b2-8ce8-c5dde88ab8f0"
          ]
        },
        {
          "uuid": "228c5db2-c68a-41ce-9d8d-2da833bbac8a",
          "code": "115127",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/115127",
          "code_system": "PUBCHEM",
          "references": [
            "c7320210-6353-47b2-8ce8-c5dde88ab8f0"
          ]
        },
        {
          "uuid": "0121f9fe-deee-d7fa-77d4-723f40e93c3b",
          "code": "DTXSID0040595",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0040595",
          "code_system": "EPA CompTox",
          "references": [
            "09cc6dc1-fb17-3ed3-363e-315f3de33d1c"
          ]
        },
        {
          "uuid": "3df59634-b620-4b92-84c6-2c7a2ac82867",
          "code": "84986BG3NG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2303a491-2674-7ac6-6b4c-e563c5f802a1",
          "code": "28135",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28135",
          "code_system": "CHEBI"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c7ccddc5-e3aa-4b49-ab37-7b61aed1742d",
          "name": "25-DEOXYECDYSTERONE",
          "stdName": "25-DEOXYECDYSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ece9897-547d-44cb-9d23-e3ec1c58a18e"
          ],
          "display_name": false
        },
        {
          "uuid": "1c707ef5-91a6-42f9-b351-2b5609797be8",
          "name": "5.BETA.-CHOLEST-7-EN-6-ONE, 2.BETA.,3.BETA.,14,20,22-PENTAHYDROXY-, (22R)-",
          "stdName": "5.BETA.-CHOLEST-7-EN-6-ONE, 2.BETA.,3.BETA.,14,20,22-PENTAHYDROXY-, (22R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ece9897-547d-44cb-9d23-e3ec1c58a18e"
          ],
          "display_name": false
        },
        {
          "uuid": "c98f7ff9-7d36-463f-986a-3c6c2b738dc1",
          "name": "CHOLEST-7-EN-6-ONE, 2,3,14,20,22-PENTAHYDROXY-, (2.BETA.,3.BETA.,5.BETA.,22R)-",
          "stdName": "CHOLEST-7-EN-6-ONE, 2,3,14,20,22-PENTAHYDROXY-, (2.BETA.,3.BETA.,5.BETA.,22R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ece9897-547d-44cb-9d23-e3ec1c58a18e"
          ],
          "display_name": false
        },
        {
          "uuid": "04775aa3-75e1-4024-93de-1f848228fb76",
          "name": "PONASTERONE A",
          "stdName": "PONASTERONE A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34610a92-e756-4059-bb3e-2027e3b396ae",
            "c3ee6777-708b-409f-92d5-66541f1d446c",
            "25fafbbe-3059-48ce-847f-9fc93653faaf"
          ],
          "display_name": true
        },
        {
          "uuid": "a2b6efb5-64d0-43e3-b6a9-2db3474684d0",
          "name": "PONASTERONE A [MI]",
          "stdName": "PONASTERONE A [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34610a92-e756-4059-bb3e-2027e3b396ae"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c3ee6777-708b-409f-92d5-66541f1d446c",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "34610a92-e756-4059-bb3e-2027e3b396ae",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ece9897-547d-44cb-9d23-e3ec1c58a18e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7320210-6353-47b2-8ce8-c5dde88ab8f0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392090000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ba8c8f6-54da-471d-bdda-620500755b6d",
          "citation": "SRS import [84986BG3NG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=84986BG3NG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392090000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25fafbbe-3059-48ce-847f-9fc93653faaf",
          "citation": "PONASTERONE A [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09cc6dc1-fb17-3ed3-363e-315f3de33d1c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13408-56-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8e5018f6-4d85-4c98-b7c3-42e1bdaba209",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5579fb06-6bec-4742-8eaa-3f5eb08e1b03",
          "id": "5579fb06-6bec-4742-8eaa-3f5eb08e1b03",
          "molfile": "\n  Marvin  01132104272D          \n\n 33 36  0  0  1  0            999 V2000\n    5.7688   -0.7092    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7948    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5126   -1.1243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2132   -0.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9484   -1.0898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9657   -1.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6489   -0.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0855   -1.1503    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.9040   -0.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3418   -0.7611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0855   -1.9546    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.5699   -2.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0855   -3.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3158   -3.0358    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.3158   -3.8401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5980   -3.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5980   -4.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8801   -4.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8888   -5.4920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1449   -4.2639    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.4444   -4.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7178   -4.2639    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    0.0000   -4.6791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7178   -3.4423    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    0.0173   -3.0185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4444   -3.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1449   -3.4423    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.1449   -2.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8801   -3.0358    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.8801   -2.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5980   -1.7990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3158   -2.2055    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.3158   -1.3752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  8  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  1  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  1  0  0  0\n 11 32  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 32 14  1  0  0  0  0\n 16 17  2  0  0  0  0\n 29 16  1  1  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  6  0  0  0\n 20 27  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  1  0  0  0\n 24 22  1  0  0  0  0\n 24 25  1  1  0  0  0\n 26 24  1  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  1  1  0  0  0\n 27 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 31 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 32 33  1  1  0  0  0\nM  END",
          "smiles": "CC(C)CC[C@H]([C@@](C)([C@H]1CC[C@]2(C3=CC(=O)[C@@H]4C[C@H]([C@H](C[C@]4(C)[C@H]3CC[C@]12C)O)O)O)O)O",
          "formula": "C27H44O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "94264996-6b5f-4471-8207-7d4480e93f75"
          },
          "defined_stereo": 10,
          "ez_centers": 0,
          "molecular_weight": "464.6357",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 10
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2d455b68-7e1a-48bb-8e48-6d06c52c6ebd",
      "version": "6",
      "structure": {
        "id": "ac553c85-0daf-4ea9-ac22-f35da9c2657f",
        "molfile": "\n  Marvin  01132108562D          \n\n 36 39  0  0  1  0            999 V2000\n    3.5980   -3.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3158   -3.0358    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.1449   -3.4423    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3158   -2.2055    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.8801   -3.0358    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.5980   -4.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1449   -4.2639    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0855   -1.9546    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.8801   -4.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0855   -1.1503    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.4444   -3.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4444   -4.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0855   -3.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5980   -1.7990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8801   -2.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5699   -2.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7178   -3.4423    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.7178   -4.2639    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.8888   -5.4920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7688   -0.7092    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3158   -3.8401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5126   -1.1243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3418   -0.7611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1449   -2.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3158   -1.3752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.6791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0173   -3.0185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2132   -0.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9040   -0.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7948    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9484   -1.0898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9657   -1.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6489   -0.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1449   -5.0855    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8801   -3.8661    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0855   -2.7849    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  2  4  1  0  0  0  0\n  2 13  1  0  0  0  0\n  2 21  1  6  0  0  0\n  3  5  1  0  0  0  0\n  3 11  1  0  0  0  0\n  3 24  1  1  0  0  0\n  3  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  4 25  1  1  0  0  0\n  4 14  1  0  0  0  0\n  5 15  1  0  0  0  0\n  5 35  1  6  0  0  0\n  6  9  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 12  1  0  0  0  0\n  7 34  1  1  0  0  0\n  8 10  1  0  0  0  0\n  8 16  1  0  0  0  0\n  8 36  1  6  0  0  0\n  9 19  2  0  0  0  0\n 10 20  1  0  0  0  0\n 10 23  1  1  0  0  0\n 10 29  1  0  0  0  0\n 11 17  1  0  0  0  0\n 12 18  1  0  0  0  0\n 13 16  1  0  0  0  0\n 14 15  1  0  0  0  0\n 17 27  1  1  0  0  0\n 17 18  1  0  0  0  0\n 18 26  1  1  0  0  0\n 20 22  1  0  0  0  0\n 20 30  1  6  0  0  0\n 22 28  1  0  0  0  0\n 28 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CC[C@H]([C@@](C)([C@@]1([H])CC[C@]2(C3=CC(=O)[C@]4([H])C[C@H]([C@H](C[C@]4(C)[C@@]3([H])CC[C@]12C)O)O)O)O)O",
        "formula": "C27H44O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 0,
        "molecular_weight": "464.6357",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c3ee6777-708b-409f-92d5-66541f1d446c",
          "5ba8c8f6-54da-471d-bdda-620500755b6d"
        ],
        "stereo_centers": 10
      },
      "unii": "84986BG3NG"
    }
  ]
}