{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "93bb1d72-bd26-4e04-a95d-df94b93805e8",
          "code": "67306-00-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=67306-00-7",
          "code_system": "CAS",
          "references": [
            "0668e54a-fe2b-44ea-99d4-17a1057e1729",
            "44a46c84-c0d9-423d-bb1c-6c0ebfff3761"
          ]
        },
        {
          "uuid": "baecba13-c933-41e5-84c2-bb719a920aa4",
          "code": "m5290",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5290?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0668e54a-fe2b-44ea-99d4-17a1057e1729"
          ]
        },
        {
          "uuid": "4ca66a75-d484-4335-bcbd-e4132d88d742",
          "code": "91694",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91694",
          "code_system": "PUBCHEM",
          "references": [
            "0668e54a-fe2b-44ea-99d4-17a1057e1729"
          ]
        },
        {
          "uuid": "ac50ac29-4464-830a-6fad-6d68f23b2d22",
          "code": "DTXSID9058157",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9058157",
          "code_system": "EPA CompTox",
          "references": [
            "eec0ff13-5ede-3c22-eae2-eadb948c115b"
          ]
        },
        {
          "uuid": "bba3df23-5ff2-e1c6-c2e2-5464265f8b79",
          "code": "DB12728",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12728",
          "code_system": "DRUG BANK",
          "references": [
            "b3c7ebb2-b24f-a6e5-18d7-262db0247fb1"
          ]
        },
        {
          "uuid": "627f20a9-bd5f-4e99-9337-c7b332237036",
          "code": "845XW54F31",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "994fdb90-7082-bc18-faf7-cb24e7b94f54",
          "code": "81917",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81917",
          "code_system": "CHEBI",
          "references": [
            "b3c7ebb2-b24f-a6e5-18d7-262db0247fb1"
          ]
        },
        {
          "uuid": "8b030615-e74a-e7bf-e346-76755575a245",
          "code": "fenpropidin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenpropidin.html",
          "code_system": "ALANWOOD",
          "references": [
            "5df4ead6-f11b-62f9-a03f-bc01ac3e2428"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0f9a9a20-8dd1-49f0-bbd0-e92e08fdd03e",
          "name": "FENPROPIDIN",
          "stdName": "FENPROPIDIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25cf7a16-8bb2-4fe0-b227-653b71f362be",
            "0427fadc-e7f9-4fda-bef1-f1f6e00ef6c8",
            "7116d0ef-a18c-48ef-853c-be1fdf5685c6",
            "73349479-eee1-4906-9271-63b0026ab233",
            "ee000648-7713-4d86-8f8a-4dd1cb669a73",
            "b3ad3916-4ef0-4753-85dc-43e810b379a9"
          ],
          "display_name": true
        },
        {
          "uuid": "b305328e-b049-4d5a-9089-acf47bd25b08",
          "name": "FENPROPIDIN [ISO]",
          "stdName": "FENPROPIDIN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0427fadc-e7f9-4fda-bef1-f1f6e00ef6c8",
            "73349479-eee1-4906-9271-63b0026ab233"
          ],
          "display_name": false
        },
        {
          "uuid": "e5b66bd2-85ce-4465-bbe7-7f4020b130c3",
          "name": "FENPROPIDIN [MI]",
          "stdName": "FENPROPIDIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0427fadc-e7f9-4fda-bef1-f1f6e00ef6c8",
            "b3ad3916-4ef0-4753-85dc-43e810b379a9"
          ],
          "display_name": false
        },
        {
          "uuid": "aaca3686-be13-435f-95fe-ed06ac8121ef",
          "name": "PATROL",
          "stdName": "PATROL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0427fadc-e7f9-4fda-bef1-f1f6e00ef6c8",
            "848a7137-444a-4b3a-9b07-8d87c04fb89f"
          ],
          "display_name": false
        },
        {
          "uuid": "ec2cde40-7f9a-4e3b-a6c5-db74f46ca23c",
          "name": "PIPERIDINE, 1-(3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2-METHYLPROPYL)-",
          "stdName": "PIPERIDINE, 1-(3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2-METHYLPROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0427fadc-e7f9-4fda-bef1-f1f6e00ef6c8",
            "848a7137-444a-4b3a-9b07-8d87c04fb89f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "73349479-eee1-4906-9271-63b0026ab233",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0427fadc-e7f9-4fda-bef1-f1f6e00ef6c8",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "848a7137-444a-4b3a-9b07-8d87c04fb89f",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25cf7a16-8bb2-4fe0-b227-653b71f362be",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3ad3916-4ef0-4753-85dc-43e810b379a9",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0668e54a-fe2b-44ea-99d4-17a1057e1729",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392071000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02fc2920-396e-4bb8-9172-fdf769a8eb1d",
          "citation": "SRS import [845XW54F31]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=845XW54F31",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392071000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee000648-7713-4d86-8f8a-4dd1cb669a73",
          "citation": "FENPROPIDIN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7116d0ef-a18c-48ef-853c-be1fdf5685c6",
          "citation": "FENPROPIDIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eec0ff13-5ede-3c22-eae2-eadb948c115b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=67306-00-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5df4ead6-f11b-62f9-a03f-bc01ac3e2428",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "b3c7ebb2-b24f-a6e5-18d7-262db0247fb1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "44a46c84-c0d9-423d-bb1c-6c0ebfff3761",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3b3983a3-7650-4c58-9fb5-7f595474e297",
          "id": "3b3983a3-7650-4c58-9fb5-7f595474e297",
          "molfile": "\n  Marvin  01132103082D          \n\n 20 21  0  0  0  0            999 V2000\n    2.8583    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4470   -0.7041    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.6383   -0.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2200   -1.4152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6383   -2.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2200   -2.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3904   -2.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3904   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8583   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6949   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0784   -2.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9149   -2.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3333   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9149   -0.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0784   -0.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1350   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1350   -0.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9715   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1350   -2.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 10  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 17 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\nM  END",
          "smiles": "CC(Cc1ccc(cc1)C(C)(C)C)CN2CCCCC2",
          "formula": "C19H31N",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bea95bf2-e8e8-4a55-84a7-c7a319665358"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "273.4568",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7de6d7b9-ad48-42c1-83a9-ef51a6c18dd9",
      "version": "6",
      "structure": {
        "id": "e626f730-a467-42b6-9336-597da0eef725",
        "molfile": "\n  Marvin  01132111552D          \n\n 20 21  0  0  0  0            999 V2000\n    1.2200   -1.4152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1350   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3333   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6383   -0.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9149   -2.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9149   -0.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6949   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8583   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4470   -0.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0784   -2.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0784   -0.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6383   -2.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3904   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1350   -0.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9715   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1350   -2.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8583    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2200   -2.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3904   -2.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  4  1  0  0  0  0\n  1 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 14  1  0  0  0  0\n  2 15  1  0  0  0  0\n  2 16  1  0  0  0  0\n  3  6  2  0  0  0  0\n  3  5  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6 11  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 10  1  0  0  0  0\n  7 11  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 17  1  0  0  0  0\n 12 18  1  0  0  0  0\n 13 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
        "smiles": "CC(Cc1ccc(cc1)C(C)(C)C)CN2CCCCC2",
        "formula": "C19H31N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "273.4568",
        "optical_activity": "( + / - )",
        "references": [
          "25cf7a16-8bb2-4fe0-b227-653b71f362be",
          "02fc2920-396e-4bb8-9172-fdf769a8eb1d"
        ],
        "stereo_centers": 1
      },
      "unii": "845XW54F31"
    }
  ]
}