{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e3366a58-e9a0-4892-9f87-f2dd5d87fc43",
          "code": "68239-84-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68239-84-9",
          "code_system": "CAS",
          "references": [
            "e7a4759d-4f29-498c-b5d5-5b825ccd208c",
            "bb5f9bae-32b2-41d0-a907-827035d00b52"
          ]
        },
        {
          "uuid": "ce0cd72b-d53b-44ff-a0ec-ffefa17c32bc",
          "code": "269-478-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.063.143",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e7a4759d-4f29-498c-b5d5-5b825ccd208c"
          ]
        },
        {
          "uuid": "e4ade9cf-1f02-da10-816c-e361a99ef155",
          "code": "DTXSID4071342",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4071342",
          "code_system": "EPA CompTox",
          "references": [
            "77ce9c79-40b1-d8c0-9620-8e0d11df7002"
          ]
        },
        {
          "uuid": "2a2da8f3-c695-6a76-ef6d-85b9504d065b",
          "code": "109926",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/109926",
          "code_system": "PUBCHEM",
          "references": [
            "7f3a0008-d1e3-4278-7c4b-92a37d1172f1"
          ]
        },
        {
          "uuid": "4fe82fd0-5fc7-466a-b7fe-5ed47a888fc2",
          "code": "844LWH5BJD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "227c7744-ffbd-4763-a8fe-bdf11eff38c7",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "f6885f7d-211d-4334-95a2-df325e7faf9d",
            "refuuid": "8d3d06c5-7071-4cba-ad91-0795c302bbe7",
            "name": "N,N-DIETHYL-M-AMINOPHENOL",
            "unii": "BQY98Q7YU5",
            "linking_id": "BQY98Q7YU5",
            "ref_pname": "N,N-DIETHYL-M-AMINOPHENOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "56ed222e-ef58-44a8-9625-47778e038d8c",
          "name": "3-(DIMETHYLAMINO)PHENOL SULFATE",
          "stdName": "3-(DIMETHYLAMINO)PHENOL SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d327149-afb3-4719-8c69-ed285f0a1845",
            "9e9d2108-f1b9-424d-8f43-831231f6963e"
          ],
          "display_name": false
        },
        {
          "uuid": "410cdfbc-913b-460f-97a6-5d0afea67de0",
          "name": "BIS((DIETHYLHYDROXYPHENYL)AMMONIUM) SULPHATE",
          "stdName": "BIS((DIETHYLHYDROXYPHENYL)AMMONIUM) SULPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d327149-afb3-4719-8c69-ed285f0a1845",
            "9e9d2108-f1b9-424d-8f43-831231f6963e"
          ],
          "display_name": false
        },
        {
          "uuid": "8288add4-2312-4989-8681-bc934f7c949f",
          "name": "N,N-DIETHYL-M-AMINOPHENOL SULFATE",
          "stdName": "N,N-DIETHYL-M-AMINOPHENOL SULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25d6e32a-519c-4ce7-91b8-1e1ca79d21da",
            "8d327149-afb3-4719-8c69-ed285f0a1845",
            "d3647b8e-ba3d-474a-8a3d-ac0dd8d473f3"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c8d693d6-df87-4b5d-bd0f-eb56c6a6bff9",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6bcde819-9b66-4988-a677-ea0a1a694514",
          "name": "PHENOL, 3-(DIETHYLAMINO)-, SULFATE (2:1)",
          "stdName": "PHENOL, 3-(DIETHYLAMINO)-, SULFATE (2:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db0945b3-3bdd-488e-99bc-a7ebb13d6759",
            "8d327149-afb3-4719-8c69-ed285f0a1845"
          ],
          "display_name": false
        },
        {
          "uuid": "724350ae-c0f3-4fbc-abfe-348213778be9",
          "name": "PHENOL, 3-(DIETHYLAMINO)-, SULFATE (2:1) (SALT)",
          "stdName": "PHENOL, 3-(DIETHYLAMINO)-, SULFATE (2:1) (SALT)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db0945b3-3bdd-488e-99bc-a7ebb13d6759",
            "8d327149-afb3-4719-8c69-ed285f0a1845"
          ],
          "display_name": false
        },
        {
          "uuid": "11231cf7-681b-4a19-9174-f5a091d77000",
          "name": "RODOL DEMAPS",
          "stdName": "RODOL DEMAPS",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d327149-afb3-4719-8c69-ed285f0a1845",
            "d3647b8e-ba3d-474a-8a3d-ac0dd8d473f3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d3647b8e-ba3d-474a-8a3d-ac0dd8d473f3",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8d327149-afb3-4719-8c69-ed285f0a1845",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db0945b3-3bdd-488e-99bc-a7ebb13d6759",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e9d2108-f1b9-424d-8f43-831231f6963e",
          "citation": "http://www.chemindustry.com/chemicals/01354817.html",
          "url": "http://www.chemindustry.com/chemicals/01354817.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7a4759d-4f29-498c-b5d5-5b825ccd208c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391545000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bc2db4b-8f5a-4f2f-9f70-a5ee5da8f6be",
          "citation": "SRS import [844LWH5BJD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=844LWH5BJD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391545000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25d6e32a-519c-4ce7-91b8-1e1ca79d21da",
          "citation": "N,N-DIETHYL-M-AMINOPHENOL SULFATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "77ce9c79-40b1-d8c0-9620-8e0d11df7002",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68239-84-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7f3a0008-d1e3-4278-7c4b-92a37d1172f1",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "bb5f9bae-32b2-41d0-a907-827035d00b52",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2bdd76a1-213c-4450-92cf-94b61ec39cb3",
          "id": "2bdd76a1-213c-4450-92cf-94b61ec39cb3",
          "molfile": "\n  Marvin  01132102222D          \n\n  5  4  0  0  0  0            999 V2000\n   10.9447   -4.6945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9447   -3.8694    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9447   -3.0445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7698   -3.8694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1198   -3.8694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bd0556f8-73e3-4abb-8fed-3a6cc769fbfb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "3e415635-861b-419e-a1cd-3d0c960c6ac2",
          "id": "3e415635-861b-419e-a1cd-3d0c960c6ac2",
          "molfile": "\n  Marvin  01132103182D          \n\n 12 12  0  0  0  0            999 V2000\n    6.1818   -2.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4696   -3.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4696   -4.1166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7583   -4.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0430   -4.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1847   -4.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1847   -5.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8999   -5.7648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6152   -5.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6152   -4.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3304   -4.1166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8999   -4.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 12  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)c1cccc(c1)O",
          "formula": "C10H15NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "af2b82de-a3d7-4d26-815d-64588ebb111e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "165.2326",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cf86c95b-34bb-4668-a61f-6525abb08aae",
      "version": "5",
      "structure": {
        "id": "1f92650a-9dcd-4300-b390-51b90419e09d",
        "molfile": "\n  Marvin  01132101482D          \n\n 29 28  0  0  0  0            999 V2000\n   10.9308   -3.8645    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7548   -3.8645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1069   -3.8645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9308   -4.6885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9308   -3.0406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3304   -4.1166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6152   -4.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6152   -5.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8999   -5.7648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1847   -5.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1847   -4.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4696   -4.1166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4696   -3.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1818   -2.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7583   -4.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0430   -4.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8999   -4.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3304   -4.1166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6152   -4.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6152   -5.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8999   -5.7648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1847   -5.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1847   -4.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4696   -4.1166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4696   -3.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1818   -2.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7583   -4.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0430   -4.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8999   -4.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 15 12  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 11  1  0  0  0  0\n  7 17  2  0  0  0  0\n  1  5  1  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 29  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 29 23  1  0  0  0  0\n 24 23  1  0  0  0  0\n 27 24  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 28  1  0  0  0  0\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   6   7   8   9  10  11  12  13  14  15  16  17  18  19  20\nM  SAL   1  9  21  22  23  24  25  26  27  28  29\nM  SPA   1 12   6   7   8   9  10  11  12  13  14  15  16  17\nM  SDI   1  4    3.6230   -6.1848    3.6230   -2.4551\nM  SDI   1  4    8.7504   -2.4551    8.7504   -6.1848\nM  SMT   1 2\nM  END",
        "smiles": "CCN(CC)c1cccc(c1)O.CCN(CC)c1cccc(c1)O.OS(=O)(=O)O",
        "formula": "2C10H15NO.H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "428.5447",
        "optical_activity": "NONE",
        "references": [
          "db0945b3-3bdd-488e-99bc-a7ebb13d6759",
          "0bc2db4b-8f5a-4f2f-9f70-a5ee5da8f6be"
        ],
        "stereo_centers": 0
      },
      "unii": "844LWH5BJD"
    }
  ]
}