{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2da4a8f9-f45c-42d8-bfa4-c48aa1c00e31",
          "code": "16517-75-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16517-75-2",
          "code_system": "CAS",
          "references": [
            "a4abc267-e155-4ef7-9c7f-1998e40895e3",
            "03d642b4-6099-4c27-9421-caadc219261f"
          ]
        },
        {
          "uuid": "0254aeb5-6e1f-4d52-9da0-a0246f3b5500",
          "code": "71587004",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587004",
          "code_system": "PUBCHEM",
          "references": [
            "a4abc267-e155-4ef7-9c7f-1998e40895e3"
          ]
        },
        {
          "uuid": "84170484-50b0-9adb-5106-c0e59536ca60",
          "code": "DTXSID70167851",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70167851",
          "code_system": "EPA CompTox",
          "references": [
            "d093682d-6edb-7dda-3b02-7dd7737606d2"
          ]
        },
        {
          "uuid": "c6a5cace-80a0-432e-8dd0-ac2938313f47",
          "code": "8432OLU48W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "011008ee-e8c7-4d0b-96c9-b17f256a5d5e",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "33d43b91-394d-4051-ae4a-adfa609a3954",
            "refuuid": "22046ece-3b8d-4bd0-ad05-091841fc459e",
            "name": "Methyl sulfate",
            "unii": "R24I7CLU7K",
            "linking_id": "R24I7CLU7K",
            "ref_pname": "Methyl sulfate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "babae3f2-dcd3-40a9-b6b7-cdb8e6693907",
          "name": "1-PROPANAMINIUM, 3-((4-AMINO-9,10-DIHYDRO-3-METHYL-9,10-DIOXO-1-ANTHRACENYL)AMINO)-N,N,N-TRIMETHYL-, METHYL SULFATE (1:1)",
          "stdName": "1-PROPANAMINIUM, 3-((4-AMINO-9,10-DIHYDRO-3-METHYL-9,10-DIOXO-1-ANTHRACENYL)AMINO)-N,N,N-TRIMETHYL-, METHYL SULFATE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8faaf25c-e659-45f8-8461-526d88055b0b",
            "f09ac211-859a-42ab-a4c6-831c89829d56"
          ],
          "display_name": false
        },
        {
          "uuid": "fc4a4761-a53b-4b36-aa0f-fa5799f3e70c",
          "name": "AMMONIUM, (3-((4-AMINO-3-METHYL-1-ANTHRAQUINONYL)AMINO)PROPYL)TRIMETHYL-, METHYL SULFATE",
          "stdName": "AMMONIUM, (3-((4-AMINO-3-METHYL-1-ANTHRAQUINONYL)AMINO)PROPYL)TRIMETHYL-, METHYL SULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8faaf25c-e659-45f8-8461-526d88055b0b",
            "f09ac211-859a-42ab-a4c6-831c89829d56"
          ],
          "display_name": false
        },
        {
          "uuid": "af9f4407-d32b-4b80-a8aa-3daf794d4738",
          "name": "CATIONIC BLUE 0347 LIQUID",
          "stdName": "CATIONIC BLUE 0347 LIQUID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8faaf25c-e659-45f8-8461-526d88055b0b",
            "1d7955b6-a896-4e1c-bc22-b17cb1318738"
          ],
          "display_name": false
        },
        {
          "uuid": "5fb99eed-a226-4475-9bb6-53f19c7f186f",
          "name": "HC BLUE NO. 17",
          "stdName": "HC BLUE NO. 17",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8faaf25c-e659-45f8-8461-526d88055b0b",
            "581fff55-522c-4f63-9c7f-e3c77a5917a6",
            "1d7955b6-a896-4e1c-bc22-b17cb1318738"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "67a99455-2163-4347-ad95-a046a8a3bbbd",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "1d7955b6-a896-4e1c-bc22-b17cb1318738",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8faaf25c-e659-45f8-8461-526d88055b0b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f09ac211-859a-42ab-a4c6-831c89829d56",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4abc267-e155-4ef7-9c7f-1998e40895e3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c56eea04-f276-4765-b20f-383f5d6a8e88",
          "citation": "SRS import [8432OLU48W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8432OLU48W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "581fff55-522c-4f63-9c7f-e3c77a5917a6",
          "citation": "HC BLUE NO. 17 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d093682d-6edb-7dda-3b02-7dd7737606d2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16517-75-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "03d642b4-6099-4c27-9421-caadc219261f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2182db23-ff39-4728-85d5-d92e77cc01de",
          "id": "2182db23-ff39-4728-85d5-d92e77cc01de",
          "molfile": "\n  Marvin  01132101532D          \n\n  6  5  0  0  0  0            999 V2000\n   16.4904   -3.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7759   -3.5121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0614   -3.0996    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3469   -2.6871    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   15.7759   -2.6871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0614   -3.9246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  3  6  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "COS(=O)(=O)[O-]",
          "formula": "CH3O4S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7df9fa3d-413f-4bc5-bc1e-cfbf501df9c1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "111.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "7d17af7f-3741-4cd8-ad49-6c4330c6837e",
          "id": "7d17af7f-3741-4cd8-ad49-6c4330c6837e",
          "molfile": "\n  Marvin  01132106292D          \n\n 26 28  0  0  0  0            999 V2000\n    6.7957   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9391   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -5.8972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3680   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0825   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7969   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5114   -5.8972    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n   13.2259   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5114   -6.7222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2259   -6.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9391   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -4.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3681   -4.6596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -3.4221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3709   -3.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3659   -2.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6541   -1.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9396   -2.1871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9391   -3.0096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -3.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -3.0096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -4.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7957   -4.2472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 25  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4 13  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 24 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\nM  CHG  1   9   1\nM  END",
          "smiles": "Cc1cc(c2c(c1N)C(=O)c3ccccc3C2=O)NCCC[N+](C)(C)C",
          "formula": "C21H26N3O2",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d9ff7d35-bb31-46a7-b0b8-c3605f347a12"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "352.4508",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "265530c8-019b-4170-b943-231db7c75b6c",
      "version": "5",
      "structure": {
        "id": "acad6774-ab54-44fc-9eae-e13276f17708",
        "molfile": "\n  Marvin  01132108572D          \n\n 32 33  0  0  0  0            999 V2000\n   10.3681   -4.6596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -3.0096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3659   -2.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3709   -3.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6541   -1.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9396   -2.1871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -3.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9391   -3.0096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -3.4221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -4.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5114   -5.8972    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   11.7969   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0825   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3680   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6536   -5.8972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9391   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7957   -4.2472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5101   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2246   -4.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9391   -4.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2259   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5114   -6.7222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2259   -6.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0614   -3.0996    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7759   -2.6871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0614   -3.9246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3469   -2.6871    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   15.7759   -3.5121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4904   -3.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7957   -5.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 21 22  1  0  0  0  0\n 20 21  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 18  1  0  0  0  0\n 18 17  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 22  2  0  0  0  0\n 15 16  1  0  0  0  0\n 14 15  1  0  0  0  0\n 13 14  1  0  0  0  0\n 12 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 22 10  1  0  0  0  0\n 21  7  1  0  0  0  0\n  3  5  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  9  4  2  0  0  0  0\n  8  6  2  0  0  0  0\n  7  2  2  0  0  0  0\n 10  1  2  0  0  0  0\n 11 23  1  0  0  0  0\n 11 24  1  0  0  0  0\n 11 25  1  0  0  0  0\n 26 27  2  0  0  0  0\n 26 28  2  0  0  0  0\n 26 29  1  0  0  0  0\n 26 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 18 32  1  0  0  0  0\nM  CHG  2  11   1  29  -1\nM  END",
        "smiles": "Cc1cc(c2c(c1N)C(=O)c3ccccc3C2=O)NCCC[N+](C)(C)C.COS(=O)(=O)[O-]",
        "formula": "C21H26N3O2.CH3O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "463.5491",
        "optical_activity": "NONE",
        "references": [
          "f09ac211-859a-42ab-a4c6-831c89829d56",
          "c56eea04-f276-4765-b20f-383f5d6a8e88"
        ],
        "stereo_centers": 0
      },
      "unii": "8432OLU48W"
    }
  ]
}