{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "4606fed7-8ffe-4ed8-ad0f-c60af313c18f", "code": "820207-10-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=820207-10-1", "code_system": "CAS", "references": [ "7a7665d3-3aef-4129-a7bd-b728c96838cc", "c7784593-da7a-4704-aa9a-ee66e8a333cd" ] }, { "uuid": "f734a7a5-8c61-4c6a-bdbf-697fe445516f", "code": "71420565", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71420565", "code_system": "PUBCHEM", "references": [ "7a7665d3-3aef-4129-a7bd-b728c96838cc" ] }, { "uuid": "5738aed2-29ba-9682-7f71-b5371d9591b4", "code": "DTXSID40231518", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40231518", "code_system": "EPA CompTox", "references": [ "1f4574b4-02b9-d4c4-3c7f-3f6fd608752b" ] }, { "uuid": "9c3b0e22-dc24-47d3-b8b6-a1158d60df99", "code": "84246P91I5", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "c3a64020-5cd0-4009-a698-d44c8621f6d5", "name": "BIS-DIPHENYLETHYL DISILOXANE", "stdName": "BIS-DIPHENYLETHYL DISILOXANE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "753f6d45-9e28-41ba-93d3-d056d2530fd5", "51f78d55-d1ff-4569-a0c9-c193e70fe4d1", "fa7914ad-7e1b-43c2-b95e-bbdd1e322315" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "0d4e108b-d4ed-4400-85a2-597c5ffc2c68", "name_org": "INCI" } ] }, { "uuid": "f8f3a2f6-e699-42a6-8311-e9ce795e30a2", "name": "DISILOXANE, 1,3-BIS(2,2-DIPHENYLETHYL)-1,1,3,3-TETRAMETHYL-", "stdName": "DISILOXANE, 1,3-BIS(2,2-DIPHENYLETHYL)-1,1,3,3-TETRAMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2b788de3-1988-4521-baba-e699c933e2a5", "fa7914ad-7e1b-43c2-b95e-bbdd1e322315" ], "display_name": false } ], "references": [ { "uuid": "753f6d45-9e28-41ba-93d3-d056d2530fd5", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "fa7914ad-7e1b-43c2-b95e-bbdd1e322315", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2b788de3-1988-4521-baba-e699c933e2a5", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7a7665d3-3aef-4129-a7bd-b728c96838cc", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391419000, "tags": [ "NOMEN" ] }, { "uuid": "179dfdf4-a282-45d4-830b-34be8608935d", "citation": "SRS import [84246P91I5]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=84246P91I5", "doc_type": "SRS", "public_domain": true, "document_date": 1493391419000, "tags": [ "NOMEN" ] }, { "uuid": "51f78d55-d1ff-4569-a0c9-c193e70fe4d1", "citation": "BIS-DIPHENYLETHYL DISILOXANE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1f4574b4-02b9-d4c4-3c7f-3f6fd608752b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=820207-10-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c7784593-da7a-4704-aa9a-ee66e8a333cd", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a78d290e-ca7c-4410-ab40-06cc6d1739f4", "id": "a78d290e-ca7c-4410-ab40-06cc6d1739f4", "molfile": "\n Marvin 01132108422D \n\n 35 38 0 0 0 0 999 V2000\n 6.4552 -6.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2802 -6.6365 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8675 -7.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9946 -7.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7092 -6.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7095 -5.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4240 -5.3997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4243 -4.5747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7100 -4.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9954 -4.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9951 -5.3992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4235 -7.0497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4232 -7.8747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1376 -8.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8522 -7.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8525 -7.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1381 -6.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2805 -5.8115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5662 -5.3987 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1534 -6.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7412 -5.3984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5665 -4.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8521 -4.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1375 -4.5732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1372 -5.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4226 -5.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7083 -5.3977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7086 -4.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4232 -4.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8524 -3.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1380 -2.9232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1383 -2.0982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8530 -1.6860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5673 -2.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5670 -2.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 18 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 12 1 0 0 0 0\n 6 7 1 0 0 0 0\n 11 6 2 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 17 12 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 30 1 0 0 0 0\n 25 24 1 0 0 0 0\n 24 29 2 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 31 30 1 0 0 0 0\n 30 35 2 0 0 0 0\n 32 31 2 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 2 0 0 0 0\n 35 34 1 0 0 0 0\nM END", "smiles": "C[Si](C)(CC(c1ccccc1)c2ccccc2)O[Si](C)(C)CC(c3ccccc3)c4ccccc4", "formula": "C32H38OSi2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "879c0180-7595-421e-a939-e4aef4f12157" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "494.8155", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "79df1929-b0fa-4d08-b387-646992cd9226", "version": "4", "structure": { "id": "bf45bc43-2237-4954-8a06-5116cd2a8842", "molfile": "\n Marvin 01132109532D \n\n 35 38 0 0 0 0 999 V2000\n 7.2802 -6.6365 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4552 -6.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8675 -7.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9946 -7.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7092 -6.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7095 -5.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4240 -5.3997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4243 -4.5747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7100 -4.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9954 -4.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9951 -5.3992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4235 -7.0497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4232 -7.8747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1376 -8.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8522 -7.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8525 -7.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1381 -6.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2805 -5.8115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5662 -5.3987 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1534 -6.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7412 -5.3984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5665 -4.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1372 -5.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4226 -5.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7083 -5.3977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7086 -4.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4232 -4.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1375 -4.5732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1380 -2.9232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1383 -2.0982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8530 -1.6860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5673 -2.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5670 -2.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8524 -3.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8521 -4.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 6 2 0 0 0 0\n 5 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 12 2 0 0 0 0\n 18 1 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 23 28 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 2 0 0 0 0\n 28 27 1 0 0 0 0\n 35 28 1 0 0 0 0\n 29 34 2 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 2 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 35 22 1 0 0 0 0\nM END", "smiles": "C[Si](C)(CC(c1ccccc1)c2ccccc2)O[Si](C)(C)CC(c3ccccc3)c4ccccc4", "formula": "C32H38OSi2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "494.8155", "optical_activity": "NONE", "references": [ "179dfdf4-a282-45d4-830b-34be8608935d", "2b788de3-1988-4521-baba-e699c933e2a5" ], "stereo_centers": 0 }, "unii": "84246P91I5" } ] }