{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "87d71133-04bc-452f-ba04-3c4dc2a73e21",
          "code": "910463-51-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=910463-51-3",
          "code_system": "CAS",
          "references": [
            "ef6dc91e-c417-4f6a-a35a-0b7e2a7c544c",
            "9a94f7c0-2408-4de6-b67e-52485a880c80"
          ]
        },
        {
          "uuid": "fff04c4e-2a02-4d3d-9860-9825921e43d1",
          "code": "71587861",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587861",
          "code_system": "PUBCHEM",
          "references": [
            "ef6dc91e-c417-4f6a-a35a-0b7e2a7c544c"
          ]
        },
        {
          "uuid": "7f5e363c-3a05-f51a-0aa0-6772c9a750da",
          "code": "DTXSID30238394",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30238394",
          "code_system": "EPA CompTox",
          "references": [
            "254f74b4-9a95-3964-1ce2-bdd030fe0c65"
          ]
        },
        {
          "uuid": "69bd14ee-2ffd-46bc-81d8-26f92c5ff322",
          "code": "83ZYM95HPE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b4e249a9-1907-45fe-87fa-8c6354bcfab3",
          "name": "COLOREX HCB11",
          "stdName": "COLOREX HCB11",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "578bda32-494f-40b5-bb01-b978c7f722cd",
            "98f5bdb2-1a2d-403b-a2d3-6f86aa8049b8"
          ],
          "display_name": false
        },
        {
          "uuid": "f5aa6bf0-5eb0-450d-9657-70a3a13c1e4b",
          "name": "ETHANOL, 2,2'-((4-((2-METHOXYETHYL)AMINO)-3-NITROPHENYL)IMINO)BIS-, MONOHYDROCHLORIDE",
          "stdName": "ETHANOL, 2,2'-((4-((2-METHOXYETHYL)AMINO)-3-NITROPHENYL)IMINO)BIS-, MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "578bda32-494f-40b5-bb01-b978c7f722cd",
            "b4711e82-5adf-45a8-b416-faf3837099f9"
          ],
          "display_name": false
        },
        {
          "uuid": "d4f665e7-6b60-4ae2-bb8e-25a9510f3b72",
          "name": "HC BLUE 11",
          "stdName": "HC BLUE 11",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "578bda32-494f-40b5-bb01-b978c7f722cd",
            "b4711e82-5adf-45a8-b416-faf3837099f9"
          ],
          "display_name": false
        },
        {
          "uuid": "cda9c117-4777-4a74-b857-641b3a08726e",
          "name": "HC BLUE NO. 11",
          "stdName": "HC BLUE NO. 11",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "578bda32-494f-40b5-bb01-b978c7f722cd",
            "b629ba91-bcfc-4892-b61c-b07ffc2b9ea9",
            "98f5bdb2-1a2d-403b-a2d3-6f86aa8049b8"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2a9a8316-ae27-45d5-827c-70b18f75ece1",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "98f5bdb2-1a2d-403b-a2d3-6f86aa8049b8",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "578bda32-494f-40b5-bb01-b978c7f722cd",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4711e82-5adf-45a8-b416-faf3837099f9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef6dc91e-c417-4f6a-a35a-0b7e2a7c544c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d13e7f32-ec28-422a-8d5e-85b5c94f942d",
          "citation": "SRS import [83ZYM95HPE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=83ZYM95HPE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b629ba91-bcfc-4892-b61c-b07ffc2b9ea9",
          "citation": "HC BLUE NO. 11 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "254f74b4-9a95-3964-1ce2-bdd030fe0c65",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=910463-51-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9a94f7c0-2408-4de6-b67e-52485a880c80",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a5d02cae-712d-484a-986b-f6d55c756a43",
          "id": "a5d02cae-712d-484a-986b-f6d55c756a43",
          "molfile": "\n  Marvin  01132108372D          \n\n  1  0  0  0  0  0            999 V2000\n    7.5015   -7.4146    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d3846ce9-51f2-4f99-befb-cb5f53594a6e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "338e596b-c90d-4fc4-aed2-758394ef621c",
          "id": "338e596b-c90d-4fc4-aed2-758394ef621c",
          "molfile": "\n  Marvin  01132102452D          \n\n 21 21  0  0  0  0            999 V2000\n   12.4586   -5.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7565   -5.4723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0544   -5.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3347   -5.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6150   -5.8760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9041   -5.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1932   -5.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4823   -5.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4823   -4.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1932   -4.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9041   -4.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6150   -4.2260    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.6150   -3.4010    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.3347   -4.6385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7714   -4.2260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0516   -4.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3320   -4.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6298   -4.6297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7714   -3.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0516   -2.9797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3320   -3.3922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 11  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 15  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\n 16 15  1  0  0  0  0\n 19 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\nM  CHG  2  12   1  13  -1\nM  END",
          "smiles": "COCCNc1ccc(cc1[N+](=O)[O-])N(CCO)CCO",
          "formula": "C13H21N3O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "04d285c2-10a6-4810-98e1-10e24bf4d122"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "299.3235",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9948b292-668f-4091-9de4-aaea01f26fa7",
      "version": "6",
      "structure": {
        "id": "d09cc065-6811-4ddb-9c43-9438c4aed429",
        "molfile": "\n  Marvin  01132110472D          \n\n 22 21  0  0  0  0            999 V2000\n   12.4586   -5.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0544   -5.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3320   -4.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0516   -2.9797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3347   -5.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0516   -4.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7714   -3.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7565   -5.4723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6298   -4.6297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3320   -3.3922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6150   -5.8760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1932   -5.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4823   -5.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7714   -4.2260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6150   -3.4010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3347   -4.6385    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.9041   -5.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4823   -4.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1932   -4.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6150   -4.2260    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.9041   -4.6385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5015   -7.4146    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n 18 13  1  0  0  0  0\n  1  8  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6 14  1  0  0  0  0\n  7 14  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  4  1  0  0  0  0\n 11 17  1  0  0  0  0\n 12 17  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 18  1  0  0  0  0\n 15 20  2  0  0  0  0\n 16 20  1  0  0  0  0\n 17 21  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 21  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  CHG  2  16  -1  20   1\nM  END",
        "smiles": "COCCNc1ccc(cc1[N+](=O)[O-])N(CCO)CCO.Cl",
        "formula": "C13H21N3O5.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "335.7843",
        "optical_activity": "NONE",
        "references": [
          "d13e7f32-ec28-422a-8d5e-85b5c94f942d",
          "b4711e82-5adf-45a8-b416-faf3837099f9"
        ],
        "stereo_centers": 0
      },
      "unii": "83ZYM95HPE"
    }
  ]
}