{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "88ea1764-e4a7-4ce1-95b8-58aba0a28310",
          "code": "32061-14-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=32061-14-6",
          "code_system": "CAS",
          "references": [
            "6cc14dcf-57b4-4602-95f0-aa3b720544ee",
            "e2bffc50-5c9c-4f5d-82a1-80904ef1739d"
          ]
        },
        {
          "uuid": "d237f39f-e57b-4073-b3a7-dd6cff538c2c",
          "code": "36055",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/36055",
          "code_system": "PUBCHEM",
          "references": [
            "6cc14dcf-57b4-4602-95f0-aa3b720544ee"
          ]
        },
        {
          "uuid": "0e3138ef-868e-5b73-4f1c-b272ec0b7941",
          "code": "DTXSID701031316",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701031316",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "67d9bf4f-74c9-aefe-f35e-bd9e93856f59",
          "code": "685533",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=685533",
          "code_system": "NSC",
          "references": [
            "83ab1994-6e8d-3539-a57e-06a47071bb29"
          ]
        },
        {
          "uuid": "d2a3fc8a-6c69-494d-97d3-b9efbb797909",
          "code": "83YTM64MXH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "22017b41-1ed6-4224-a591-045fc8c6f738",
          "name": "1,2-Dihydro-4-[[(4-methoxyphenyl)methylene]amino]-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one",
          "stdName": "1,2-DIHYDRO-4-(((4-METHOXYPHENYL)METHYLENE)AMINO)-1,5-DIMETHYL-2-PHENYL-3H-PYRAZOL-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2bffc50-5c9c-4f5d-82a1-80904ef1739d"
          ],
          "display_name": false
        },
        {
          "uuid": "d4708abc-0f0f-4361-bd5c-4aa0422eff2e",
          "name": "2,3-Dimethyl-4-((p-methoxybenzylidene)amino)-1-phenyl-3-pyrazolin-5-one",
          "stdName": "2,3-DIMETHYL-4-((P-METHOXYBENZYLIDENE)AMINO)-1-PHENYL-3-PYRAZOLIN-5-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de6552bc-cab9-4c90-9999-61456a7bc555"
          ],
          "display_name": false
        },
        {
          "uuid": "d6d463bb-2ecc-4b91-adf9-2f725d564fc0",
          "name": "3-Pyrazolin-5-one, 2,3-dimethyl-4-((p-methoxybenzylidene)amino)-1-phenyl-",
          "stdName": "3-PYRAZOLIN-5-ONE, 2,3-DIMETHYL-4-((P-METHOXYBENZYLIDENE)AMINO)-1-PHENYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de6552bc-cab9-4c90-9999-61456a7bc555"
          ],
          "display_name": false
        },
        {
          "uuid": "de49f34c-a17e-4aa8-961e-d0e6080aa193",
          "name": "3H-Pyrazol-3-one, 1,2-dihydro-1,5-dimethyl-4-(((4-methoxyphenyl)methylene)amino)-2-phenyl-",
          "stdName": "3H-PYRAZOL-3-ONE, 1,2-DIHYDRO-1,5-DIMETHYL-4-(((4-METHOXYPHENYL)METHYLENE)AMINO)-2-PHENYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de6552bc-cab9-4c90-9999-61456a7bc555"
          ],
          "display_name": false
        },
        {
          "uuid": "2a4b58b1-5eb8-4337-aca9-734065d2b856",
          "name": "3H-Pyrazol-3-one, 1,2-dihydro-4-(((4-methoxyphenyl)methylene)amino)-1,5-dimethyl-2-phenyl-",
          "stdName": "3H-PYRAZOL-3-ONE, 1,2-DIHYDRO-4-(((4-METHOXYPHENYL)METHYLENE)AMINO)-1,5-DIMETHYL-2-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de6552bc-cab9-4c90-9999-61456a7bc555"
          ],
          "display_name": false
        },
        {
          "uuid": "de101cc0-5ff5-4c93-bd47-62610aeafd22",
          "name": "4-((p-Methoxybenzylidene)amino)antipyrine",
          "stdName": "4-((P-METHOXYBENZYLIDENE)AMINO)ANTIPYRINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de6552bc-cab9-4c90-9999-61456a7bc555"
          ],
          "display_name": true
        },
        {
          "uuid": "7c77ecc0-87b2-4f00-aefb-84052d57cb19",
          "name": "4-(Anisylideneamino)antipyrine",
          "stdName": "4-(ANISYLIDENEAMINO)ANTIPYRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de6552bc-cab9-4c90-9999-61456a7bc555"
          ],
          "display_name": false
        },
        {
          "uuid": "a25302e8-e25e-4f32-a941-7262e0bd751e",
          "name": "4-Anisilidino-amino-antipyrine",
          "stdName": "4-ANISILIDINO-AMINO-ANTIPYRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de6552bc-cab9-4c90-9999-61456a7bc555"
          ],
          "display_name": false
        },
        {
          "uuid": "624dfbd6-077a-481c-b463-63c3533658d6",
          "name": "4-Anisylidino-(aminoantipyrine)",
          "stdName": "4-ANISYLIDINO-(AMINOANTIPYRINE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de6552bc-cab9-4c90-9999-61456a7bc555"
          ],
          "display_name": false
        },
        {
          "uuid": "cb7d3f75-df9a-4253-b2db-f2ad196b8e19",
          "name": "4-[(4-methoxyphenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one",
          "stdName": "4-((4-METHOXYPHENYL)METHYLIDENEAMINO)-1,5-DIMETHYL-2-PHENYLPYRAZOL-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16259679-540f-4245-be97-d663745b2350"
          ],
          "display_name": false
        },
        {
          "uuid": "bede309e-968a-4acf-8501-07ff60b3f0f2",
          "name": "Antipyrine, 4-((p-methoxybenzylidene)amino)-",
          "stdName": "ANTIPYRINE, 4-((P-METHOXYBENZYLIDENE)AMINO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a03bae0-b9b5-4c6a-b68e-aa971a9ec973",
            "de6552bc-cab9-4c90-9999-61456a7bc555"
          ],
          "display_name": false
        },
        {
          "uuid": "1922a707-e5c5-4967-a247-adcfd8e91bd9",
          "name": "IS-4",
          "stdName": "IS-4",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2bffc50-5c9c-4f5d-82a1-80904ef1739d",
            "de6552bc-cab9-4c90-9999-61456a7bc555"
          ],
          "display_name": false
        },
        {
          "uuid": "aba00468-9df6-4e9b-bb1c-47c139492b41",
          "name": "NSC-685533",
          "stdName": "NSC-685533",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a03bae0-b9b5-4c6a-b68e-aa971a9ec973",
            "de6552bc-cab9-4c90-9999-61456a7bc555"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7a03bae0-b9b5-4c6a-b68e-aa971a9ec973",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de6552bc-cab9-4c90-9999-61456a7bc555",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cc14dcf-57b4-4602-95f0-aa3b720544ee",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394232000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2bffc50-5c9c-4f5d-82a1-80904ef1739d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "16259679-540f-4245-be97-d663745b2350",
          "citation": "PUBCHEM",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/36055",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "83ab1994-6e8d-3539-a57e-06a47071bb29",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "03a44b01-5f5a-4694-b8ed-3619a115e097",
          "id": "03a44b01-5f5a-4694-b8ed-3619a115e097",
          "molfile": "\n  Marvin  01132100302D          \n\n 24 26  0  0  0  0            999 V2000\n    3.0154    1.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6798    0.5110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1648   -0.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8292   -0.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3141   -1.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1346   -1.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6196   -2.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2840   -2.9125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7689   -3.5799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5939   -3.5799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0788   -2.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8489   -4.3645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6334   -4.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1814   -4.8495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1814   -5.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8959   -6.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8959   -6.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1814   -7.3245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4669   -6.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4669   -6.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5140   -4.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7293   -4.6195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4702   -0.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9852   -0.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n 24  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 23  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 21  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 21  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 22  2  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "Cc1c(c(=O)n(-c2ccccc2)n1C)/N=C/c3ccc(cc3)OC",
          "formula": "C19H19N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b5990c3c-3028-40ae-9803-ac8c4bd54c3e"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "321.3738",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bec39878-140f-41ce-bcf6-306095829fda",
      "version": "6",
      "structure": {
        "id": "e9be4498-fb9c-4a05-acd9-abf29aafef75",
        "molfile": "\n  Marvin  01132112062D          \n\n 24 26  0  0  0  0            999 V2000\n    5.1814   -4.8495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1814   -5.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5140   -4.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8489   -4.3645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8959   -6.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4669   -6.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7689   -3.5799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7293   -4.6195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5939   -3.5799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6334   -4.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8959   -6.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4669   -6.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2840   -2.9125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0788   -2.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1814   -7.3245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6196   -2.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1346   -1.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3141   -1.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4702   -0.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8292   -0.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9852   -0.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1648   -0.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6798    0.5110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0154    1.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  2  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  2  0  0  0  0\n  4  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6 12  1  0  0  0  0\n  7 13  1  0  0  0  0\n  9 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 13 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n  7  9  2  0  0  0  0\n 12 15  2  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
        "smiles": "Cc1c(c(=O)n(-c2ccccc2)n1C)/N=C/c3ccc(cc3)OC",
        "formula": "C19H19N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "321.3738",
        "optical_activity": "NONE",
        "references": [
          "7a03bae0-b9b5-4c6a-b68e-aa971a9ec973"
        ],
        "stereo_centers": 0
      },
      "unii": "83YTM64MXH"
    }
  ]
}