{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "43074ed5-887b-4e0f-84ff-da28584c01e0",
          "code": "482-53-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=482-53-1",
          "code_system": "CAS",
          "references": [
            "8481a5ae-7033-4b62-947a-63561951e48f",
            "2e7426cb-8002-4c49-9ff0-9614685ad979"
          ]
        },
        {
          "uuid": "76f2acc4-a7a5-4b7e-8984-f2ce77c77994",
          "code": "C485800",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67485800",
          "code_system": "MESH",
          "references": [
            "8481a5ae-7033-4b62-947a-63561951e48f"
          ]
        },
        {
          "uuid": "a9edb003-1819-4227-ad83-152a51277c63",
          "code": "m860",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m860?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8481a5ae-7033-4b62-947a-63561951e48f"
          ]
        },
        {
          "uuid": "b30bf03c-582f-4ad5-9d0f-bbc4caa99766",
          "code": "95168",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/95168",
          "code_system": "PUBCHEM",
          "references": [
            "8481a5ae-7033-4b62-947a-63561951e48f"
          ]
        },
        {
          "uuid": "7ea1fde7-9c86-4633-8239-f80759b36f4d",
          "code": "83R5N9X74B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fe06fc5d-e0a7-be32-513d-01d7458902af",
          "code": "DTXSID10964028",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10964028",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "00d3bf67-badd-3ef6-534d-b971b4aff4a0",
          "code": "21565",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=21565",
          "code_system": "NSC",
          "references": [
            "7e82f57c-9d8c-5c48-27dc-41f5e35876c4"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2b1cbd75-1552-4954-86f8-172077d47375",
          "name": "3'-DEOXYPOMIFERIN",
          "stdName": "3'-DEOXYPOMIFERIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "458a419e-9868-4c4f-af6a-63d6a225e013",
            "33f2997d-dd96-497f-bf6b-238e27a90c6b"
          ],
          "display_name": false
        },
        {
          "uuid": "9c4e7b77-7e53-4ba4-bfaa-9b9f4e93b79f",
          "name": "4H,8H-BENZO(1,2-B:3,4-B')DIPYRAN-4-ONE, 5-HYDROXY-3-(4-HYDROXYPHENYL)-8,8-DIMETHYL-6-(3-METHYL-2-BUTEN-1-YL)-",
          "stdName": "4H,8H-BENZO(1,2-B:3,4-B')DIPYRAN-4-ONE, 5-HYDROXY-3-(4-HYDROXYPHENYL)-8,8-DIMETHYL-6-(3-METHYL-2-BUTEN-1-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "458a419e-9868-4c4f-af6a-63d6a225e013",
            "33f2997d-dd96-497f-bf6b-238e27a90c6b"
          ],
          "display_name": false
        },
        {
          "uuid": "aa31dcd4-9a69-445b-869a-3de55471667f",
          "name": "4H,8H-BENZO(1,2-B:3,4-B')DIPYRAN-4-ONE, 5-HYDROXY-3-(4-HYDROXYPHENYL)-8,8-DIMETHYL-6-(3-METHYL-2-BUTENYL)-",
          "stdName": "4H,8H-BENZO(1,2-B:3,4-B')DIPYRAN-4-ONE, 5-HYDROXY-3-(4-HYDROXYPHENYL)-8,8-DIMETHYL-6-(3-METHYL-2-BUTENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "458a419e-9868-4c4f-af6a-63d6a225e013",
            "33f2997d-dd96-497f-bf6b-238e27a90c6b"
          ],
          "display_name": false
        },
        {
          "uuid": "8d684030-e9a5-4827-8a5e-1f0da0c7ab2e",
          "name": "4H,8H-BENZO(1,2-B:3,4-B')DIPYRAN-4-ONE, 5-HYDROXY-3-(P-HYDROXYPHENYL)-8,8-DIMETHYL-6-(3-METHYL-2-BUTENYL)-",
          "stdName": "4H,8H-BENZO(1,2-B:3,4-B')DIPYRAN-4-ONE, 5-HYDROXY-3-(P-HYDROXYPHENYL)-8,8-DIMETHYL-6-(3-METHYL-2-BUTENYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "458a419e-9868-4c4f-af6a-63d6a225e013",
            "33f2997d-dd96-497f-bf6b-238e27a90c6b"
          ],
          "display_name": false
        },
        {
          "uuid": "d6202f18-53d8-4b41-bb00-bd19e3c90da6",
          "name": "4H,8H-BENZO(1,2-B:3,4-B)DIPYRAN-4-ONE, 5-HYDROXY-3-(P-HYDROXYPHENYL)-8,8-DIMETHYL-6-(3-METHYL-2-BUTENYL)-",
          "stdName": "4H,8H-BENZO(1,2-B:3,4-B)DIPYRAN-4-ONE, 5-HYDROXY-3-(P-HYDROXYPHENYL)-8,8-DIMETHYL-6-(3-METHYL-2-BUTENYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "458a419e-9868-4c4f-af6a-63d6a225e013",
            "33f2997d-dd96-497f-bf6b-238e27a90c6b"
          ],
          "display_name": false
        },
        {
          "uuid": "628ec7a3-e246-407a-8e43-a4acb6276365",
          "name": "5'-O-DEMETHYLSCANDINONE",
          "stdName": "5'-O-DEMETHYLSCANDINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "458a419e-9868-4c4f-af6a-63d6a225e013",
            "33f2997d-dd96-497f-bf6b-238e27a90c6b"
          ],
          "display_name": false
        },
        {
          "uuid": "d4deb221-ea43-4c07-86e3-1a74611eb60d",
          "name": "NSC-21565",
          "stdName": "NSC-21565",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "458a419e-9868-4c4f-af6a-63d6a225e013",
            "33f2997d-dd96-497f-bf6b-238e27a90c6b"
          ],
          "display_name": false
        },
        {
          "uuid": "460cc366-102a-4953-b08b-d630b28e794c",
          "name": "OSAJIN",
          "stdName": "OSAJIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4bc4fcb4-ed86-4097-abe4-41b7e6645906",
            "f2cb15b3-0331-4b15-8635-2f4eea7eaee5",
            "0a32db55-bd64-40b5-aa31-06a3301fe42f",
            "33f2997d-dd96-497f-bf6b-238e27a90c6b",
            "2bdbf4e8-0343-40b7-ba15-d892f5bf8eff"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b88097d1-537e-4c32-a490-c6fb1ddd10e7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9334c7b9-ee86-4ca4-9dc0-e6b30065128b",
          "name": "OSAJIN [MI]",
          "stdName": "OSAJIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f2cb15b3-0331-4b15-8635-2f4eea7eaee5",
            "33f2997d-dd96-497f-bf6b-238e27a90c6b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0a32db55-bd64-40b5-aa31-06a3301fe42f",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "458a419e-9868-4c4f-af6a-63d6a225e013",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33f2997d-dd96-497f-bf6b-238e27a90c6b",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2cb15b3-0331-4b15-8635-2f4eea7eaee5",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8481a5ae-7033-4b62-947a-63561951e48f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391041000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b67c248-c98f-42c2-a8b7-9576d8112d34",
          "citation": "SRS import [83R5N9X74B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=83R5N9X74B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391041000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e063e187-4add-4d48-9925-05d4ab0c5674",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bc4fcb4-ed86-4097-abe4-41b7e6645906",
          "citation": "OSAJIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2bdbf4e8-0343-40b7-ba15-d892f5bf8eff",
          "citation": "OSAJIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2e7426cb-8002-4c49-9ff0-9614685ad979",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7e82f57c-9d8c-5c48-27dc-41f5e35876c4",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5ff3dbcb-1448-4c7e-ba79-b2fba61e60e5",
          "id": "5ff3dbcb-1448-4c7e-ba79-b2fba61e60e5",
          "molfile": "\n  Marvin  01132104582D          \n\n 30 33  0  0  0  0            999 V2000\n    8.9956   -2.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2804   -2.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2804   -1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5654   -2.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5654   -3.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8549   -3.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8549   -4.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5745   -4.9353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1444   -4.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4248   -4.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7189   -4.9490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7189   -5.7741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4385   -6.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4385   -7.0072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7326   -7.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7326   -8.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4477   -8.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4477   -9.4778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1627   -8.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1627   -7.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1444   -5.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8596   -6.1775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4248   -3.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7144   -3.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7144   -2.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4248   -2.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9564   -1.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8930   -1.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1444   -2.4646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1444   -3.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 30  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 21  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 23 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 21  1  0  0  0  0\n 15 14  1  0  0  0  0\n 20 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 24 23  1  0  0  0  0\n 23 30  1  0  0  0  0\n 25 24  2  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 26  1  0  0  0  0\n 26 29  1  0  0  0  0\n 29 30  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCc1c(c2c(=O)c(coc2c3C=CC(C)(C)Oc13)-c4ccc(cc4)O)O)C",
          "formula": "C25H24O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "54611dc8-8fed-49d9-9205-d63a8a973d82"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "404.456",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b5ff081d-2653-4f5f-8f1a-6af0760e6e96",
      "version": "5",
      "structure": {
        "id": "502b237e-5748-45e2-bb9b-a47dea940f11",
        "molfile": "\n  Marvin  01132104112D          \n\n 30 33  0  0  0  0            999 V2000\n    6.1444   -4.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4248   -4.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4248   -3.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7144   -3.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7144   -2.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4248   -2.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1444   -2.4646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1444   -3.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8549   -3.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8549   -4.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5745   -4.9353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5654   -3.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5654   -2.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2804   -2.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9956   -2.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2804   -1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9564   -1.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8930   -1.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7189   -4.9490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7189   -5.7741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4385   -6.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1444   -5.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8596   -6.1775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4385   -7.0072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7326   -7.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7326   -8.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4477   -8.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1627   -8.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1627   -7.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4477   -9.4778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10  1  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n  3  8  1  0  0  0  0\n 17  6  1  0  0  0  0\n 18  6  1  0  0  0  0\n 19  2  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22  1  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 21  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  2  0  0  0  0\n 29 24  1  0  0  0  0\n 30 27  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCc1c(c2c(=O)c(coc2c3C=CC(C)(C)Oc13)-c4ccc(cc4)O)O)C",
        "formula": "C25H24O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "404.456",
        "optical_activity": "NONE",
        "references": [
          "4b67c248-c98f-42c2-a8b7-9576d8112d34",
          "e063e187-4add-4d48-9925-05d4ab0c5674"
        ],
        "stereo_centers": 0
      },
      "unii": "83R5N9X74B"
    }
  ]
}