{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "51d23b80-aed6-4ece-aeee-9d21a90f89eb",
          "code": "497-75-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=497-75-6",
          "code_system": "CAS",
          "references": [
            "33be9465-5e90-4e72-b8ca-fd6b203171a9",
            "93b51f14-2c44-468f-a600-1e17511ded3f"
          ]
        },
        {
          "uuid": "74a9d403-6d6a-4359-84df-009da5861858",
          "code": "C013508",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67013508",
          "code_system": "MESH",
          "references": [
            "33be9465-5e90-4e72-b8ca-fd6b203171a9"
          ]
        },
        {
          "uuid": "ec73cbfd-b725-4aff-93aa-b2607e5342ff",
          "code": "SUB07204MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "33be9465-5e90-4e72-b8ca-fd6b203171a9"
          ]
        },
        {
          "uuid": "0e57c472-1abf-4617-af1e-5fa22ac6da6a",
          "code": "479",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=479",
          "code_system": "INN",
          "references": [
            "33be9465-5e90-4e72-b8ca-fd6b203171a9"
          ]
        },
        {
          "uuid": "c8647221-51e1-406b-8201-fa2a8cbf89ba",
          "code": "207-849-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.137",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "33be9465-5e90-4e72-b8ca-fd6b203171a9"
          ]
        },
        {
          "uuid": "e9431f49-4217-4a45-aed0-b95e97ddeee2",
          "code": "C80878",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80878",
          "code_system": "NCI_THESAURUS",
          "references": [
            "33be9465-5e90-4e72-b8ca-fd6b203171a9"
          ]
        },
        {
          "uuid": "03d0c394-fe32-4cc3-8af8-6dc4d58dc700",
          "code": "m4601",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4601?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "33be9465-5e90-4e72-b8ca-fd6b203171a9"
          ]
        },
        {
          "uuid": "b3fd9d72-8d11-4944-b757-df079deb22e4",
          "code": "CHEMBL2110629",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110629",
          "code_system": "ChEMBL",
          "references": [
            "33be9465-5e90-4e72-b8ca-fd6b203171a9"
          ]
        },
        {
          "uuid": "b143c2cd-527f-4ccf-93f3-9f07cb8a014e",
          "code": "71632",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71632",
          "code_system": "PUBCHEM",
          "references": [
            "33be9465-5e90-4e72-b8ca-fd6b203171a9"
          ]
        },
        {
          "uuid": "eae0b5b6-08e9-7c10-ad21-dfeba587b9d1",
          "code": "C29707",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Vasodilating Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3bbd91c3-34ae-5cab-9183-5771421df9ad"
          ]
        },
        {
          "uuid": "83335222-d309-4447-94e0-31a316205466",
          "code": "82J92E653W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3fa6e452-bf68-d674-f1ff-1c576c78e1b0",
          "code": "914",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/914",
          "code_system": "DRUG CENTRAL",
          "references": [
            "3bbd91c3-34ae-5cab-9183-5771421df9ad"
          ]
        },
        {
          "uuid": "2a31e31b-c82e-85b3-890f-0cd165039cc7",
          "code": "100000082875",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6f769582-e636-a973-b19a-6cfd446b125e"
          ]
        },
        {
          "uuid": "68c42196-5c67-eb87-fbc9-998b6d0fc0ca",
          "code": "DTXSID00862044",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00862044",
          "code_system": "EPA CompTox",
          "references": [
            "3bbd91c3-34ae-5cab-9183-5771421df9ad"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "71417335-d127-44b7-8806-5c2e44a45b1a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "fa2e787f-a100-4df6-b0a2-e15c7274200c",
            "refuuid": "85924395-8f05-4547-b45d-2bbe8c192ee6",
            "name": "DIOXETHEDRIN",
            "unii": "82J92E653W",
            "linking_id": "82J92E653W",
            "ref_pname": "DIOXETHEDRIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a4cd7086-9384-469a-a3ea-32592954dfe1",
          "name": ".ALPHA.-(1-ETHYLAMINOETHYL)PROTOCATECHUYL ALCOHOL",
          "stdName": ".ALPHA.-(1-ETHYLAMINOETHYL)PROTOCATECHUYL ALCOHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aff778c3-fa1f-48ae-abfb-0e02500b3391"
          ],
          "display_name": false
        },
        {
          "uuid": "b4dd5407-3d55-4145-9775-3bcd6e50ccf3",
          "name": "1,2-BENZENEDIOL, 4-(2-(ETHYLAMINO)-1-HYDROXYPROPYL)-",
          "stdName": "1,2-BENZENEDIOL, 4-(2-(ETHYLAMINO)-1-HYDROXYPROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f17f1d09-afa1-400a-8481-5ec210ce7056",
            "5cd75fe9-b562-4834-865d-a62769ade350"
          ],
          "display_name": false
        },
        {
          "uuid": "7249b065-5dfa-46cc-bd3b-0fd0aadbf563",
          "name": "BENZYL ALCOHOL, .ALPHA.-(1-(ETHYLAMINO)ETHYL)-3,4-DIHYDROXY-",
          "stdName": "BENZYL ALCOHOL, .ALPHA.-(1-(ETHYLAMINO)ETHYL)-3,4-DIHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f17f1d09-afa1-400a-8481-5ec210ce7056",
            "5cd75fe9-b562-4834-865d-a62769ade350"
          ],
          "display_name": false
        },
        {
          "uuid": "ccecde0c-3ef4-4719-8e16-5eef78c00d2c",
          "name": "C-247",
          "stdName": "C-247",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d167e728-d72d-4bf5-9e16-5c30c508959c",
            "5cd75fe9-b562-4834-865d-a62769ade350"
          ],
          "display_name": false
        },
        {
          "uuid": "60d0c0ac-0a60-4ba9-ae76-cbea8bd5b0f5",
          "name": "DIOXETHEDRIN",
          "stdName": "DIOXETHEDRIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dba29721-73f2-429f-a4e4-0a44abaef612",
            "854fab57-d276-4720-9998-a97b9eb36aff",
            "72bd2470-d093-408d-b693-cba1a191e474",
            "5cd75fe9-b562-4834-865d-a62769ade350",
            "0741a746-d2a8-43fb-a8e6-bd0ad5afff0d",
            "aff778c3-fa1f-48ae-abfb-0e02500b3391"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a7940bc8-dd76-48a4-bdf1-97ea0f6c4507",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "517ce05b-8b49-4f82-91f0-2f342cb1a866",
          "name": "DIOXETHEDRINE",
          "stdName": "DIOXETHEDRINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d167e728-d72d-4bf5-9e16-5c30c508959c",
            "8ff35493-fc45-4c57-bd93-5e6b9f68231d",
            "5cd75fe9-b562-4834-865d-a62769ade350",
            "fcc515e5-bc15-44e7-9b2c-c1a91268260b"
          ],
          "display_name": false
        },
        {
          "uuid": "6484c028-94b4-420d-9a13-3e272a3031cd",
          "name": "DIOXETHEDRINE [MI]",
          "stdName": "DIOXETHEDRINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5cd75fe9-b562-4834-865d-a62769ade350",
            "fcc515e5-bc15-44e7-9b2c-c1a91268260b"
          ],
          "display_name": false
        },
        {
          "uuid": "5a9705e1-a561-866a-9be4-e6c13a8d3901",
          "name": "Dioxethedrin [WHO-DD]",
          "stdName": "DIOXETHEDRIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfb411e7-ec2b-8bb8-eec8-ca46d26cfe88"
          ],
          "display_name": false
        },
        {
          "uuid": "0443a03c-2896-43f5-a2ec-95abebf32e4f",
          "name": "dioxethedrin [INN]",
          "stdName": "DIOXETHEDRIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72bd2470-d093-408d-b693-cba1a191e474"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "aff778c3-fa1f-48ae-abfb-0e02500b3391",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "72bd2470-d093-408d-b693-cba1a191e474",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fcc515e5-bc15-44e7-9b2c-c1a91268260b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cd75fe9-b562-4834-865d-a62769ade350",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d167e728-d72d-4bf5-9e16-5c30c508959c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f17f1d09-afa1-400a-8481-5ec210ce7056",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "854fab57-d276-4720-9998-a97b9eb36aff",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33be9465-5e90-4e72-b8ca-fd6b203171a9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390824000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a6fc6a7-d9c5-4166-9049-e4700ee1a8f1",
          "citation": "SRS import [82J92E653W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=82J92E653W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390824000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dba29721-73f2-429f-a4e4-0a44abaef612",
          "citation": "DIOXETHEDRIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8ff35493-fc45-4c57-bd93-5e6b9f68231d",
          "citation": "DIOXETHEDRINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0741a746-d2a8-43fb-a8e6-bd0ad5afff0d",
          "citation": "DIOXETHEDRIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3bbd91c3-34ae-5cab-9183-5771421df9ad",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "93b51f14-2c44-468f-a600-1e17511ded3f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dfb411e7-ec2b-8bb8-eec8-ca46d26cfe88",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6f769582-e636-a973-b19a-6cfd446b125e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5b68c3cc-0f60-4b65-8c99-41ec9dd86d08",
          "id": "5b68c3cc-0f60-4b65-8c99-41ec9dd86d08",
          "molfile": "\n  Marvin  01132104442D          \n\n 15 15  0  0  0  0            999 V2000\n    8.7459    0.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0334   -0.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3209    0.0417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6084   -0.3708    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.6102   -1.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8959    0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.8936    0.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1842   -0.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1870   -1.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4706   -1.6194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7558   -1.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1667   -1.7875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7569   -0.3791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0375    0.0375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4688    0.0336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 15  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  1  0  0  0  0\nM  END",
          "smiles": "CCNC(C)C(c1ccc(c(c1)O)O)O",
          "formula": "C11H17NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5052d026-27fc-48a8-b70a-bf0c2c58e6f0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "211.258",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "85924395-8f05-4547-b45d-2bbe8c192ee6",
      "version": "9",
      "structure": {
        "id": "2f5e8cbe-df39-45f3-9b6c-4e57a24c3a05",
        "molfile": "\n  Marvin  01132102332D          \n\n 15 15  0  0  0  0            999 V2000\n    3.7569   -0.3791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7558   -1.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4706   -1.6194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1870   -1.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1842   -0.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4688    0.0336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8959    0.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6084   -0.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3209    0.0417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0334   -0.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7459    0.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8936    0.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0375    0.0375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1667   -1.7875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6102   -1.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  7  8  1  0  0  0  0\n  3  4  2  0  0  0  0\n  8  9  1  0  0  0  0\n  1  2  2  0  0  0  0\n  9 10  1  0  0  0  0\n  4  5  1  0  0  0  0\n 10 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1 13  1  0  0  0  0\n  6  1  1  0  0  0  0\n  2 14  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8 15  1  0  0  0  0\n  5  7  1  0  0  0  0\nM  END",
        "smiles": "CCNC(C)C(c1ccc(c(c1)O)O)O",
        "formula": "C11H17NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "UNKNOWN",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "211.258",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8a6fc6a7-d9c5-4166-9049-e4700ee1a8f1",
          "aff778c3-fa1f-48ae-abfb-0e02500b3391",
          "72bd2470-d093-408d-b693-cba1a191e474"
        ],
        "stereo_centers": 2
      },
      "unii": "82J92E653W"
    }
  ]
}