{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "05f7f77f-e61a-41d8-93d2-be5b5b6f7ce5",
          "code": "606-68-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=606-68-8",
          "code_system": "CAS",
          "references": [
            "9d877b4c-68ba-4e77-8cb2-3dc371623d98",
            "0f6c131f-95ef-4230-92db-f825101d0062"
          ]
        },
        {
          "uuid": "0d8f30b2-76c9-45bf-aff7-8315cffe8c85",
          "code": "210-123-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.204",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9d877b4c-68ba-4e77-8cb2-3dc371623d98"
          ]
        },
        {
          "uuid": "5bca068d-25f4-4002-90f9-4818e3cd03e3",
          "code": "1716102",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1716102/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9d877b4c-68ba-4e77-8cb2-3dc371623d98"
          ]
        },
        {
          "uuid": "46c5051b-5a2b-3865-9efa-b569ba5b1ae9",
          "code": "2724710",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2724710",
          "code_system": "PUBCHEM",
          "references": [
            "c821ef32-7e5c-b3e7-9753-8b1795082ba4"
          ]
        },
        {
          "uuid": "1f4d7759-f040-4375-bcff-4a0161bd3749",
          "code": "8295030YNC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7857c9a6-c734-c93c-1d4a-2a89b9283a2d",
          "code": "DTXSID901014657",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901014657",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "82e62358-fb43-3ff4-4a01-651c848dbe2b",
          "code": "8295030YNC",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8295030YNC",
          "code_system": "DAILYMED",
          "references": [
            "ea5a75b8-508b-257d-b5d1-c15f8b9ccb66"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d3adfef1-e32d-4d25-8478-63ea939e4c81",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "cf81e38c-f475-4787-bae2-15e83977521c",
            "refuuid": "ebb949c8-bea6-4284-9dd0-d9291f2537c9",
            "name": "NADH",
            "unii": "4J24DQ0916",
            "linking_id": "4J24DQ0916",
            "ref_pname": "NADH",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7a0b33fb-7d6a-41a4-a988-46675c0f8919",
          "name": ".BETA.-NICOTINAMIDE ADENINE DINUCLEOTIDE DISODIUM SALT",
          "stdName": ".BETA.-NICOTINAMIDE ADENINE DINUCLEOTIDE DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b16eec61-8996-405d-b86b-0ba716d932c3"
          ],
          "display_name": false
        },
        {
          "uuid": "fc4edf11-aad1-4c95-b765-53e3a784a6f1",
          "name": "DISODIUM NADH",
          "stdName": "DISODIUM NADH",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "f12eab5c-f07b-4a51-a952-47f30c546b78",
            "e9420ebf-967e-4942-9e72-b2b30161139d"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "60f71097-c413-4681-9433-5ec7bbb198d0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "40fa3825-e817-44e9-af38-3115d90a516a",
          "name": "DISODIUM NICOTINAMIDE ADENINE DINUCLEOTIDE",
          "stdName": "DISODIUM NICOTINAMIDE ADENINE DINUCLEOTIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efce126e-e2e3-4ab1-ab02-af04285ec31e"
          ],
          "display_name": true
        },
        {
          "uuid": "51a561ec-1059-4d4a-8b84-223218415709",
          "name": "DISODIUM NICOTINAMIDE ADENINE DINUCLEOTIDE REDUCED",
          "stdName": "DISODIUM NICOTINAMIDE ADENINE DINUCLEOTIDE REDUCED",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efce126e-e2e3-4ab1-ab02-af04285ec31e"
          ],
          "display_name": false
        },
        {
          "uuid": "ebf56e9d-5881-43ba-a3ac-173790bc936f",
          "name": "NADH DISODIUM SALT",
          "stdName": "NADH DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "740990b1-6af0-476d-9780-0053d816ed42"
          ],
          "display_name": false
        },
        {
          "uuid": "5d7a6dd7-4d1f-4b6d-8017-4b0295fa4d4d",
          "name": "NICOTINAMIDE ADENINE DINUCLEOTIDE DISODIUM",
          "stdName": "NICOTINAMIDE ADENINE DINUCLEOTIDE DISODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efce126e-e2e3-4ab1-ab02-af04285ec31e"
          ],
          "display_name": false
        },
        {
          "uuid": "298df2f5-b565-417e-9f5e-54e68b2a393c",
          "name": "NICOTINAMIDE ADENINE DINUCLEOTIDE DISODIUM REDUCED",
          "stdName": "NICOTINAMIDE ADENINE DINUCLEOTIDE DISODIUM REDUCED",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efce126e-e2e3-4ab1-ab02-af04285ec31e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "efce126e-e2e3-4ab1-ab02-af04285ec31e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f12eab5c-f07b-4a51-a952-47f30c546b78",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b16eec61-8996-405d-b86b-0ba716d932c3",
          "citation": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB1709159.htm",
          "url": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB1709159.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "740990b1-6af0-476d-9780-0053d816ed42",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d877b4c-68ba-4e77-8cb2-3dc371623d98",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389712000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5a7b3e0-51f3-4145-b35c-780f7c086b1a",
          "citation": "SRS import [8295030YNC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8295030YNC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389712000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9420ebf-967e-4942-9e72-b2b30161139d",
          "citation": "DISODIUM NADH [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c821ef32-7e5c-b3e7-9753-8b1795082ba4",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "0f6c131f-95ef-4230-92db-f825101d0062",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ea5a75b8-508b-257d-b5d1-c15f8b9ccb66",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dc7ac104-7c83-4d39-be56-9e216eac2685",
          "id": "dc7ac104-7c83-4d39-be56-9e216eac2685",
          "molfile": "\n  Marvin  01132111262D          \n\n  1  0  0  0  1  0            999 V2000\n   -3.2923   -8.1891    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "1cd40496-60cd-4b53-aff4-7c5e58a63857"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2e559234-08fd-42e6-b647-479b64866cb5",
          "id": "2e559234-08fd-42e6-b647-479b64866cb5",
          "molfile": "\n  Marvin  01132102302D          \n\n 44 48  0  0  1  0            999 V2000\n   10.9209   -9.0638    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.2270   -8.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5087   -9.0101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5363   -9.0101    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5363   -9.9777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5363   -8.0425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5637   -9.0101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5912   -9.0101    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5912   -9.9777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5912   -8.0425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6286   -9.0101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7537   -8.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0550   -9.0687    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.3904   -8.5849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7161   -9.0785    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.0074   -8.6680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4912   -7.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0025   -7.3339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2255   -7.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -7.0993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -6.2149    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2895   -7.5391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2895   -8.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -8.8536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2255   -8.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9602   -9.8456    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.2664  -10.3539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7911   -9.8456    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.6610  -10.4175    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.5855   -8.5800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2599   -9.0687    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   13.0116   -8.1577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6567   -7.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1206   -6.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9396   -6.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2898   -7.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8209   -8.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1049   -7.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4571   -8.3430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5687   -6.9226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0204   -9.8408    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.7145  -10.3490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1897   -9.8408    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.3150  -10.4126    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 30  1  0  0  0  0\n 43  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  4  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  6  0  0  0\n 13 14  1  0  0  0  0\n 13 28  1  0  0  0  0\n 15 14  1  6  0  0  0\n 15 16  1  0  0  0  0\n 26 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 25 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 25  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 27  1  1  0  0  0\n 28 26  1  0  0  0  0\n 28 29  1  1  0  0  0\n 31 30  1  1  0  0  0\n 31 32  1  0  0  0  0\n 41 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 37 32  1  0  0  0  0\n 34 33  2  0  0  0  0\n 35 34  1  0  0  0  0\n 35 36  1  0  0  0  0\n 36 37  2  0  0  0  0\n 38 36  1  0  0  0  0\n 39 38  1  0  0  0  0\n 40 38  2  0  0  0  0\n 41 42  1  6  0  0  0\n 41 43  1  0  0  0  0\n 43 44  1  6  0  0  0\nM  CHG  2  29  -1  44  -1\nM  END",
          "smiles": "C1=CN(C=C(C1)C(=O)N)[C@H]2[C@@H]([C@@H]([C@@H](COP(=O)(O)OP(=O)(O)OC[C@@H]3[C@H]([C@H]([C@H](n4cnc5c(N)ncnc54)O3)O)[O-])O2)[O-])O",
          "formula": "C21H27N7O14P2",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "37da1113-3b4f-47c3-8ff5-d0c350f2336a"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "663.426",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c0e28dcf-720e-4322-828b-f6e50ed4d3b3",
      "version": "6",
      "structure": {
        "id": "bb2823cd-438b-4d2b-91f8-90efa17c72d8",
        "molfile": "\n  Marvin  01132109412D          \n\n 46 48  0  0  1  0            999 V2000\n    2.0074   -8.6680    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    2.4912   -7.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0025   -7.3339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2255   -7.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -7.0993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2895   -7.5391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2895   -8.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -8.8536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2255   -8.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4730   -6.2149    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7161   -9.0785    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.3904   -8.5849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0550   -9.0687    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7537   -8.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6286   -9.0101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5912   -9.0101    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5912   -8.0425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5912   -9.9777    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.5637   -9.0101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5363   -9.0101    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5363   -8.0425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5363   -9.9777    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.5087   -9.0101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2270   -8.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9209   -9.0638    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.1897   -9.8408    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.3150  -10.4126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0204   -9.8408    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.7145  -10.3490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2599   -9.0687    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.0116   -8.1577    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n   12.6567   -7.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1206   -6.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9396   -6.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2898   -7.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1049   -7.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4571   -8.3430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5687   -6.9226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8209   -8.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5855   -8.5800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7911   -9.8456    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6610  -10.4175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9602   -9.8456    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.2664  -10.3539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2923   -8.1891    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n   -3.2923   -8.1891    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  4  9  2  0  0  0  0\n  9  1  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  1  1  6  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  6  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 16  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 20  1  0  0  0  0\n 23 20  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  1  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  6  0  0  0\n 28 26  1  0  0  0  0\n 28 29  1  6  0  0  0\n 28 30  1  0  0  0  0\n 30 31  1  1  0  0  0\n 32 31  1  0  0  0  0\n 33 32  2  0  0  0  0\n 34 33  1  0  0  0  0\n 34 35  1  0  0  0  0\n 36 35  1  0  0  0  0\n 37 36  1  0  0  0  0\n 38 36  2  0  0  0  0\n 35 39  2  0  0  0  0\n 39 31  1  0  0  0  0\n 30 40  1  0  0  0  0\n 40 25  1  0  0  0  0\n 41 13  1  0  0  0  0\n 41 42  1  1  0  0  0\n 41 43  1  0  0  0  0\n 43 11  1  0  0  0  0\n 43 44  1  1  0  0  0\n  2  1  1  0  0  0  0\nM  CHG  4  18  -1  22  -1  45   1  46   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  45  46\nM  SPA   1  1  45\nM  SDI   1  4   -3.7123   -8.6091   -3.7123   -7.7691\nM  SDI   1  4   -2.8723   -7.7691   -2.8723   -8.6091\nM  SMT   1 2\nM  END",
        "smiles": "C1=CN(C=C(C1)C(=O)N)[C@H]2[C@@H]([C@@H]([C@@H](COP(=O)([O-])OP(=O)([O-])OC[C@@H]3[C@H]([C@H]([C@H](n4cnc5c(N)ncnc54)O3)O)O)O2)O)O.[Na+].[Na+]",
        "formula": "C21H27N7O14P2.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "709.4055",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f12eab5c-f07b-4a51-a952-47f30c546b78",
          "b5a7b3e0-51f3-4145-b35c-780f7c086b1a"
        ],
        "stereo_centers": 8
      },
      "unii": "8295030YNC"
    }
  ]
}