{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c6cf1c11-7c13-4c5b-92d3-7c1e23f1d78c", "code": "6252-76-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6252-76-2", "code_system": "CAS", "references": [ "d984f3b5-aa17-4397-ade3-84049a0e8843", "5f252ed9-f42d-45c5-aa5f-46e4565b039b" ] }, { "uuid": "13446f22-dd43-43af-bb0c-0e562d12bab7", "code": "C035103", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67035103", "code_system": "MESH", "references": [ "d984f3b5-aa17-4397-ade3-84049a0e8843" ] }, { "uuid": "79eadaf6-b9bd-4e0c-8bc0-d2cde673e478", "code": "228-377-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.025.798", "code_system": "ECHA (EC/EINECS)", "references": [ "d984f3b5-aa17-4397-ade3-84049a0e8843" ] }, { "uuid": "ed84415a-f5bf-b0b9-6464-340db35a1400", "code": "DTXSID3044968", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3044968", "code_system": "EPA CompTox", "references": [ "ef4da91d-3b27-5e1e-7305-278cd0f256e6" ] }, { "uuid": "eb0f3d89-2f4e-646c-692d-d8548865218c", "code": "76968456", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76968456", "code_system": "PUBCHEM", "references": [ "c50353e1-318e-26c2-675f-bf52377f2ae5" ] }, { "uuid": "6bdadc50-a64b-610b-9cbb-9532fa2d49e2", "code": "2367763", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2367763/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "9d9f5946-eeb3-64d2-6e18-f0f43e9fe624" ] }, { "uuid": "63651050-bd2c-400f-95c0-0b6431c4ae3f", "code": "824V98947A", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "88915a84-264f-4a23-a7df-1ba9b1c2f64c", "name": "9-(2-CARBOXYPHENYL)-3-((2-METHYLPHENYL)AMINO)-6-((2-METHYL-4-SULFOPHENYL)AMINO)XANTHYLIUM, HYDROXIDE, INNER SALT, MONOSODIUM SALT", "stdName": "9-(2-CARBOXYPHENYL)-3-((2-METHYLPHENYL)AMINO)-6-((2-METHYL-4-SULFOPHENYL)AMINO)XANTHYLIUM, HYDROXIDE, INNER SALT, MONOSODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "58a49b46-9570-49e2-981c-bf9227519923", "886f35fe-6d2d-441b-967a-568e124c1f33" ], "display_name": false }, { "uuid": "32e74499-76cf-42a2-9430-b086087a024c", "name": "ACID VIOLET 9", "stdName": "ACID VIOLET 9", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "58a49b46-9570-49e2-981c-bf9227519923", "d2345417-2792-48e4-8cf2-93ae9ba489a4", "886f35fe-6d2d-441b-967a-568e124c1f33" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "d8a32399-5484-4bfc-9484-192dd852eabe", "name_org": "INCI" } ] }, { "uuid": "bfe278f6-d491-41b8-ba49-9bd40b5cf25f", "name": "AKA401", "stdName": "AKA401", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "58a49b46-9570-49e2-981c-bf9227519923", "e175ec68-7866-49f9-813c-beb3c5d6a2b2", "886f35fe-6d2d-441b-967a-568e124c1f33" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "fe0841c9-52a1-41f7-ba74-c586aff48307", "name_org": "INCI" } ] }, { "uuid": "a71fa9aa-2929-4a8a-9961-405cf9102a8b", "name": "BENZOIC ACID, O-(3-((4-SULFO-O-TOLYL)IMINO)-6-O-TOLUIDINO-3H-XANTHEN-9-YL)-, MONOSODIUM SALT", "stdName": "BENZOIC ACID, O-(3-((4-SULFO-O-TOLYL)IMINO)-6-O-TOLUIDINO-3H-XANTHEN-9-YL)-, MONOSODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "58a49b46-9570-49e2-981c-bf9227519923", "886f35fe-6d2d-441b-967a-568e124c1f33" ], "display_name": false }, { "uuid": "21c6aaf1-c66f-4b26-a498-3ab58027f19a", "name": "C.I. ACID VIOLET 9", "stdName": "C.I. ACID VIOLET 9", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "58a49b46-9570-49e2-981c-bf9227519923", "e27a8633-fa12-49ab-a5e3-f97dce4e87e3" ], "display_name": false }, { "uuid": "1f7858c8-2b71-4bbc-95a0-a5038668fe45", "name": "CI 45190", "stdName": "CI 45190", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "58a49b46-9570-49e2-981c-bf9227519923", "00613f5d-9886-4076-9083-e71f0494fb73", "886f35fe-6d2d-441b-967a-568e124c1f33" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "0d5bf47a-56e8-4bcc-979e-8ec2ed53fb15", "name_org": "INCI" } ] }, { "uuid": "9e33c677-4bc3-4f8e-aaf7-303360d295fa", "name": "VIOLAMINE R", "stdName": "VIOLAMINE R", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "58a49b46-9570-49e2-981c-bf9227519923", "886f35fe-6d2d-441b-967a-568e124c1f33" ], "display_name": false }, { "uuid": "26ffcf42-2155-49b6-accf-98d94427eecf", "name": "XANTHYLIUM, 9-(2-CARBOXYPHENYL)-3-((2-METHYLPHENYL)AMINO)-6-((2-METHYL-4-SULFOPHENYL)AMINO)-, HYDROXIDE, INNER SALT, MONOSODIUM SALT", "stdName": "XANTHYLIUM, 9-(2-CARBOXYPHENYL)-3-((2-METHYLPHENYL)AMINO)-6-((2-METHYL-4-SULFOPHENYL)AMINO)-, HYDROXIDE, INNER SALT, MONOSODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "58a49b46-9570-49e2-981c-bf9227519923", "886f35fe-6d2d-441b-967a-568e124c1f33" ], "display_name": false } ], "references": [ { "uuid": "886f35fe-6d2d-441b-967a-568e124c1f33", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "58a49b46-9570-49e2-981c-bf9227519923", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e27a8633-fa12-49ab-a5e3-f97dce4e87e3", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d984f3b5-aa17-4397-ade3-84049a0e8843", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391404000, "tags": [ "NOMEN" ] }, { "uuid": "45213579-2fdc-473c-bc1b-b2d6681347ed", "citation": "SRS import [824V98947A]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=824V98947A", "doc_type": "SRS", "public_domain": true, "document_date": 1493391404000, "tags": [ "NOMEN" ] }, { "uuid": "e175ec68-7866-49f9-813c-beb3c5d6a2b2", "citation": "AKA401 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d2345417-2792-48e4-8cf2-93ae9ba489a4", "citation": "ACID VIOLET 9 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "00613f5d-9886-4076-9083-e71f0494fb73", "citation": "CI 45190 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ef4da91d-3b27-5e1e-7305-278cd0f256e6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6252-76-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c50353e1-318e-26c2-675f-bf52377f2ae5", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "5f252ed9-f42d-45c5-aa5f-46e4565b039b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "9d9f5946-eeb3-64d2-6e18-f0f43e9fe624", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "9e064b88-27c1-3ddf-7484-2c696dd3b64a", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4eacd12d-d176-4fcc-a959-d304436b5bd5", "id": "4eacd12d-d176-4fcc-a959-d304436b5bd5", "molfile": "\n Marvin 01132104062D \n\n 1 0 0 0 0 0 999 V2000\n 12.6000 -4.9614 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1d7e195f-5aa4-4a2e-8b20-23e37a832f8a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "1086b608-b21d-4fe6-a5d4-ba502315de34", "id": "1086b608-b21d-4fe6-a5d4-ba502315de34", "molfile": "\n Marvin 01132101052D \n\n 43 48 0 0 0 0 999 V2000\n 3.8008 -3.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1708 -2.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3196 -1.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6894 -1.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9152 -1.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7666 -2.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3966 -2.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2480 -3.5694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9587 -3.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9587 -4.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6724 -5.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3849 -4.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1003 -5.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1003 -6.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8094 -6.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8094 -7.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0860 -7.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3816 -7.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3816 -6.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6069 -6.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5070 -5.6105 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.9688 -6.7106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8175 -4.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5283 -5.2402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2517 -4.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2517 -4.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5362 -3.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8175 -3.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1084 -3.5821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3849 -3.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6759 -3.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9689 -3.5948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6796 -4.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6796 -4.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3887 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1059 -4.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1059 -4.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3967 -3.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3967 -2.7752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8166 -5.2593 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4033 -4.6816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4467 -5.7917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3405 -5.9340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 31 9 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 30 2 0 0 0 0\n 13 14 1 0 0 0 0\n 13 23 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 19 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 2 0 0 0 0\n 23 24 1 0 0 0 0\n 23 28 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 32 2 3 0 0 0\n 28 27 2 0 0 0 0\n 28 29 1 0 0 0 0\n 30 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 38 33 2 0 0 0 0\n 34 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 2 0 0 0 0\n 36 40 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 40 42 2 0 0 0 0\n 40 43 2 0 0 0 0\nM CHG 1 21 -1\nM END", "smiles": "Cc1ccccc1Nc2ccc3c(c2)oc-4cc(=Nc5ccc(cc5C)S(=O)(=O)O)ccc4c3-c6ccccc6C(=O)[O-]", "formula": "C34H25N2O6S", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "dc4fdf36-97f6-4da5-8f53-89b94ed8a3a7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "589.6395", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "b6e8a857-abcf-4f4d-a9f9-5d3db85ea2cc", "version": "10", "structure": { "id": "e18eb0e2-2fdf-4803-b434-1e8190d8eda9", "molfile": "\n Marvin 01132111412D \n\n 44 48 0 0 0 0 999 V2000\n 12.6000 -4.9614 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 1.9152 -1.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7666 -2.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3966 -2.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2480 -3.5694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9587 -3.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9587 -4.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6724 -5.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3849 -4.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1003 -5.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1003 -6.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8094 -6.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8094 -7.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0860 -7.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3816 -7.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3816 -6.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6069 -6.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5070 -5.6105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9688 -6.7106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8175 -4.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5283 -5.2402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2517 -4.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2517 -4.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9689 -3.5948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6796 -4.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6796 -4.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3887 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1059 -4.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8166 -5.2593 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4033 -4.6816 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 11.4467 -5.7917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3405 -5.9340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1059 -4.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3967 -3.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3967 -2.7752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5362 -3.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8175 -3.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1084 -3.5821 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0\n 4.3849 -3.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6759 -3.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1708 -2.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8008 -3.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3196 -1.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6894 -1.1336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 11 16 2 0 0 0 0\n 10 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 2 0 0 0 0\n 29 32 2 0 0 0 0\n 28 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 25 2 0 0 0 0\n 23 36 2 0 0 0 0\n 37 36 1 0 0 0 0\n 37 38 2 0 0 0 0\n 39 38 1 0 0 0 0\n 9 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 6 2 0 0 0 0\n 20 37 1 0 0 0 0\n 4 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 41 43 2 0 0 0 0\n 43 44 1 0 0 0 0\n 44 2 2 0 0 0 0\nM CHG 3 1 1 30 -1 38 1\nM END", "smiles": "Cc1ccccc1Nc2ccc3c(c2)[o+]c4cc(ccc4c3-c5ccccc5C(=O)O)Nc6ccc(cc6C)S(=O)(=O)[O-].[Na+]", "formula": "C34H26N2O6S.Na", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "613.6372", "optical_activity": "NONE", "references": [ "45213579-2fdc-473c-bc1b-b2d6681347ed", "886f35fe-6d2d-441b-967a-568e124c1f33" ], "stereo_centers": 0 }, "unii": "824V98947A" } ] }