{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0135019b-14cc-4320-a4bc-d93736e20ea5", "code": "3520-42-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3520-42-1", "code_system": "CAS", "references": [ "a1d5cc73-a9a9-4558-a2ea-8b9da9cc9ae2", "1ca105c5-2857-46c4-bdb8-3d5c0b58760e" ] }, { "uuid": "78d8555b-fb6a-4c7d-8574-1ee280862709", "code": "222-529-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.482", "code_system": "ECHA (EC/EINECS)", "references": [ "a1d5cc73-a9a9-4558-a2ea-8b9da9cc9ae2" ] }, { "uuid": "46da7383-444f-4b31-abd1-48dd36f50456", "code": "9916275", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9916275", "code_system": "PUBCHEM", "references": [ "a1d5cc73-a9a9-4558-a2ea-8b9da9cc9ae2" ] }, { "uuid": "7ff0305a-1a89-f62e-4b60-f17a5bd569fa", "code": "DTXSID7021235", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7021235", "code_system": "EPA CompTox", "references": [ "1eb6bb65-e708-09ff-23a1-c3d6714f0cbc" ] }, { "uuid": "bae0d7a1-6d11-4859-adc3-9615e23d0db0", "code": "821LWZ3R6R", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b726ebba-c34a-932b-4514-a7d9af44596b", "code": "52101", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:52101", "code_system": "CHEBI", "references": [ "d2809ce9-36b9-ee1c-9edb-3224e102c6e6" ] }, { "uuid": "24543ccd-6928-738f-29f3-5f95d298a6d0", "code": "Sulforhodamine B", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Sulforhodamine_B", "code_system": "WIKIPEDIA", "references": [ "64d71b34-2d53-7a68-f040-41e9d0b62701" ] } ], "relationships": [ { "uuid": "1a311e85-b4cd-4182-9641-dc4450c49bd5", "amount": { "uuid": "7326b00a-af42-4423-9b0d-ded9a6799aca" }, "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "6beced0b-bf6f-4b44-bec4-df9bc4c9bba7", "refuuid": "0c53f025-4afb-43ed-b99f-9477ca050fca", "name": "ACID RED 52 FREE ACID", "unii": "T8JX3GT4UR", "linking_id": "T8JX3GT4UR", "ref_pname": "ACID RED 52 FREE ACID", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "a3db1573-02f2-4ce9-8daf-0c9749d395b7", "name": "ACID RED 52", "stdName": "ACID RED 52", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "c990e886-3b7c-4552-a396-5c6c7ae52215", "153ccc2c-488b-44ca-9cb9-074bd0a58d01", "719d0ef2-3497-4343-b6b5-bacdb1be5c8c", "6745b41e-80f1-4f0c-bcb9-a2128f507bf0" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "9cf0942d-6df7-4ed4-84a5-328f60cae51d", "name_org": "INCI" } ] }, { "uuid": "d62261c3-dc17-4263-8fc3-b836ad91e325", "name": "AMMONIUM, (6-(DIETHYLAMINO)-9-(2,4-DISULFOPHENYL)-3H-XANTHEN-3-YLIDENE)DIETHYL-, HYDROXIDE, INNER SALT, SODIUM SALT", "stdName": "AMMONIUM, (6-(DIETHYLAMINO)-9-(2,4-DISULFOPHENYL)-3H-XANTHEN-3-YLIDENE)DIETHYL-, HYDROXIDE, INNER SALT, SODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "153ccc2c-488b-44ca-9cb9-074bd0a58d01", "6745b41e-80f1-4f0c-bcb9-a2128f507bf0" ], "display_name": false }, { "uuid": "be323377-105b-463f-9b4a-bc6aa54e85f5", "name": "C.I. ACID RED 52", "stdName": "C.I. ACID RED 52", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "246a2c66-0389-4274-a5cc-123c383b632e", "153ccc2c-488b-44ca-9cb9-074bd0a58d01" ], "display_name": false }, { "uuid": "4a5d276c-aaa9-4ce7-be45-edc3cfd69794", "name": "CI 45100", "stdName": "CI 45100", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "b4ab354d-9fb0-4bd7-b015-bb0883aac5e1", "153ccc2c-488b-44ca-9cb9-074bd0a58d01", "6745b41e-80f1-4f0c-bcb9-a2128f507bf0" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "303c1f90-561a-484b-92cc-abeac0ee06d5", "name_org": "INCI" } ] }, { "uuid": "fc934c41-dcf4-4f60-8c7f-d9a2a9a20369", "name": "CI ACID RED 52", "stdName": "CI ACID RED 52", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "69bb522f-88a8-4772-b493-6e461124b775" ], "display_name": false }, { "uuid": "1e15bc4a-520b-401f-bf95-a1c95707e15c", "name": "COVACAP ROSE W 4102", "stdName": "COVACAP ROSE W 4102", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "c990e886-3b7c-4552-a396-5c6c7ae52215", "153ccc2c-488b-44ca-9cb9-074bd0a58d01" ], "display_name": false }, { "uuid": "d1272323-c54b-45f4-b9f4-44eca1a8d45c", "name": "ETHANAMINIUM, N-(6-(DIETHYLAMINO)-9-(2,4-DISULFOPHENYL)-3H-XANTHEN-3-YLIDENE)-N-ETHYL-, HYDROXIDE, INNER SALT, SODIUM SALT", "stdName": "ETHANAMINIUM, N-(6-(DIETHYLAMINO)-9-(2,4-DISULFOPHENYL)-3H-XANTHEN-3-YLIDENE)-N-ETHYL-, HYDROXIDE, INNER SALT, SODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "153ccc2c-488b-44ca-9cb9-074bd0a58d01", "6745b41e-80f1-4f0c-bcb9-a2128f507bf0" ], "display_name": false }, { "uuid": "e115cc41-1d94-4b41-abc6-a0af4b71dcf5", "name": "FOOD COLOR RED NO. 106", "stdName": "FOOD COLOR RED NO. 106", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dba0956a-da70-4f76-9c9b-b546f49b3020", "153ccc2c-488b-44ca-9cb9-074bd0a58d01" ], "display_name": false }, { "uuid": "e932850f-ccf3-4d91-b71d-4c8a9a335d82", "name": "JAPAN RED 106", "stdName": "JAPAN RED 106", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "153ccc2c-488b-44ca-9cb9-074bd0a58d01", "6745b41e-80f1-4f0c-bcb9-a2128f507bf0" ], "display_name": false }, { "uuid": "5bcdb949-cefb-4f75-9c9c-35199273aa8d", "name": "N-(6-(DIETHYLAMINO)-9-(2,4-DISULFOPHENYL)-3H-XANTHEN-3-YLIDENE)-N-ETHYL ETHANAMINIUM, HYDROXIDE, INNER SALT, SODIUM SALT", "stdName": "N-(6-(DIETHYLAMINO)-9-(2,4-DISULFOPHENYL)-3H-XANTHEN-3-YLIDENE)-N-ETHYL ETHANAMINIUM, HYDROXIDE, INNER SALT, SODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "153ccc2c-488b-44ca-9cb9-074bd0a58d01", "6745b41e-80f1-4f0c-bcb9-a2128f507bf0" ], "display_name": false }, { "uuid": "a327e4cc-abde-4720-8818-4cb61ad6de9d", "name": "PHLOXINE RHODAMINE", "stdName": "PHLOXINE RHODAMINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "153ccc2c-488b-44ca-9cb9-074bd0a58d01", "6745b41e-80f1-4f0c-bcb9-a2128f507bf0" ], "display_name": false }, { "uuid": "c0a27393-7187-4abe-b99c-c3a859c71650", "name": "RED NO. 106", "stdName": "RED NO. 106", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "153ccc2c-488b-44ca-9cb9-074bd0a58d01", "6745b41e-80f1-4f0c-bcb9-a2128f507bf0" ], "display_name": false }, { "uuid": "746bf802-e90e-4336-ab16-55da98049bc9", "name": "VIBRACOLOR RED ARE52", "stdName": "VIBRACOLOR RED ARE52", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "c990e886-3b7c-4552-a396-5c6c7ae52215", "153ccc2c-488b-44ca-9cb9-074bd0a58d01" ], "display_name": false }, { "uuid": "9e326e43-1e85-4a42-b9f7-0fcbe5a70621", "name": "XANTHYLIUM, 3,6-BIS(DIETHYLAMINO)-9-(2,4-DISULFOPHENYL)-, HYDROXIDE, INNER SALT, SODIUM SALT", "stdName": "XANTHYLIUM, 3,6-BIS(DIETHYLAMINO)-9-(2,4-DISULFOPHENYL)-, HYDROXIDE, INNER SALT, SODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "153ccc2c-488b-44ca-9cb9-074bd0a58d01", "6745b41e-80f1-4f0c-bcb9-a2128f507bf0" ], "display_name": false } ], "references": [ { "uuid": "69bb522f-88a8-4772-b493-6e461124b775", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "6745b41e-80f1-4f0c-bcb9-a2128f507bf0", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "153ccc2c-488b-44ca-9cb9-074bd0a58d01", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "246a2c66-0389-4274-a5cc-123c383b632e", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c990e886-3b7c-4552-a396-5c6c7ae52215", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dba0956a-da70-4f76-9c9b-b546f49b3020", "citation": "http://www.sciencedirect.com/science/article/pii/S0021967301916322?np=y", "url": "http://www.sciencedirect.com/science/article/pii/S0021967301916322?np=y", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a1d5cc73-a9a9-4558-a2ea-8b9da9cc9ae2", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391927000, "tags": [ "NOMEN" ] }, { "uuid": "9842e375-8fc9-453b-bd92-4686fed6c7ab", "citation": "SRS import [821LWZ3R6R]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=821LWZ3R6R", "doc_type": "SRS", "public_domain": true, "document_date": 1493391927000, "tags": [ "NOMEN" ] }, { "uuid": "90f0b982-d45e-44d1-bcac-b1c9ed12e4d7", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "719d0ef2-3497-4343-b6b5-bacdb1be5c8c", "citation": "ACID RED 52 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b4ab354d-9fb0-4bd7-b015-bb0883aac5e1", "citation": "CI 45100 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1eb6bb65-e708-09ff-23a1-c3d6714f0cbc", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3520-42-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "64d71b34-2d53-7a68-f040-41e9d0b62701", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "d2809ce9-36b9-ee1c-9edb-3224e102c6e6", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "1ca105c5-2857-46c4-bdb8-3d5c0b58760e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "086c8e80-3939-4d5d-b60a-96c45f8caa92", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "86385d73-696d-4562-bcf8-8374dbf9eac0", "id": "86385d73-696d-4562-bcf8-8374dbf9eac0", "molfile": "\n Marvin 01132106582D \n\n 1 0 0 0 0 0 999 V2000\n -0.8077 -7.2251 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "afe432c8-6c48-4f13-b887-d4744ab8d276" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "bf8e48c0-84f2-4f77-a5a3-97e4fd411129", "id": "bf8e48c0-84f2-4f77-a5a3-97e4fd411129", "molfile": "\n Marvin 01132109542D \n\n 38 41 0 0 0 0 999 V2000\n 1.3434 -2.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0578 -3.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0578 -4.1966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3434 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6289 -4.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7723 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7723 -5.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4868 -5.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2013 -5.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -5.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -7.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6302 -7.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6302 -8.4453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -8.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2013 -8.4453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2013 -7.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4868 -7.2078 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0743 -7.9223 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 3.8993 -6.4934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7723 -6.7953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -9.6828 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7408 -9.6829 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.0908 -9.6828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -10.5078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6302 -5.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3447 -5.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0592 -5.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0592 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3447 -4.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6302 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -4.1966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2013 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4868 -4.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7736 -4.1966 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 8.4881 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2026 -4.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7736 -3.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4881 -2.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 6 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 33 2 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 32 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 25 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 11 16 2 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 14 21 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 17 20 2 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 21 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 25 30 1 0 0 0 0\n 27 26 2 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 28 34 2 0 0 0 0\n 30 29 2 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 37 1 0 0 0 0\n 35 36 1 0 0 0 0\n 37 38 1 0 0 0 0\nM CHG 3 18 -1 22 -1 34 1\nM END", "smiles": "CCN(CC)c1ccc2c(c1)oc-3cc(=[N+](CC)CC)ccc3c2-c4ccc(cc4S(=O)(=O)[O-])S(=O)(=O)[O-]", "formula": "C27H29N2O7S2", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fc3e61c3-33f7-4fb6-a056-3b94589194a1" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "557.6616", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "9e3bb3db-7d85-4840-af08-a2be601e658b", "version": "9", "structure": { "id": "3ccf1bff-db56-4e8d-aa1c-1e89d818fb3d", "molfile": "\n Marvin 01132103132D \n\n 39 41 0 0 0 0 999 V2000\n -0.8077 -7.2251 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 4.9158 -4.1966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6302 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6302 -5.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3447 -5.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0592 -5.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0592 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7736 -4.1966 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 8.4881 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2026 -4.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7736 -3.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4881 -2.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3447 -4.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -5.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -7.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6302 -7.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6302 -8.4453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -8.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -9.6828 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0908 -9.6828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -10.5078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7408 -9.6829 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.2013 -8.4453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2013 -7.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4868 -7.2078 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8993 -6.4934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7723 -6.7953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0743 -7.9223 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.2013 -5.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4868 -5.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7723 -5.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7723 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0578 -4.1966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0578 -3.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3434 -2.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3434 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6289 -4.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4868 -4.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2013 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 8 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 7 1 0 0 0 0\n 3 13 2 0 0 0 0\n 4 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 21 2 0 0 0 0\n 19 22 1 0 0 0 0\n 23 18 2 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 2 0 0 0 0\n 25 28 1 0 0 0 0\n 15 24 2 0 0 0 0\n 14 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 33 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 32 38 2 0 0 0 0\n 38 39 1 0 0 0 0\n 39 29 2 0 0 0 0\n 39 2 1 0 0 0 0\nM CHG 4 1 1 8 1 22 -1 28 -1\nM END", "smiles": "CC[N+](=c1ccc2-c(c1)oc3cc(ccc3c2-c4ccc(cc4S(=O)(=O)[O-])S(=O)(=O)[O-])N(CC)CC)CC.[Na+]", "formula": "C27H29N2O7S2.Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "580.6513", "optical_activity": "NONE", "references": [ "9842e375-8fc9-453b-bd92-4686fed6c7ab", "90f0b982-d45e-44d1-bcac-b1c9ed12e4d7" ], "stereo_centers": 0 }, "unii": "821LWZ3R6R" } ] }