{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f763e5ad-a0b8-47eb-b832-f362e370e66d",
          "code": "1882-26-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1882-26-4",
          "code_system": "CAS",
          "references": [
            "12cec136-1e08-4534-8a3d-9cee9a5eef79",
            "24720a62-5a60-4441-bf6b-ee2e5a03ab48"
          ]
        },
        {
          "uuid": "c4bb46ee-25db-483d-be61-d09a7ccf795b",
          "code": "D011727",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68011727",
          "code_system": "MESH",
          "references": [
            "12cec136-1e08-4534-8a3d-9cee9a5eef79"
          ]
        },
        {
          "uuid": "149aa920-2002-48d8-9e15-714509628d1f",
          "code": "SUB10164MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "12cec136-1e08-4534-8a3d-9cee9a5eef79"
          ]
        },
        {
          "uuid": "2bdbd010-c807-4f12-8939-7b23d36fccfa",
          "code": "5011",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5011",
          "code_system": "INN",
          "references": [
            "12cec136-1e08-4534-8a3d-9cee9a5eef79"
          ]
        },
        {
          "uuid": "fa4a22c6-60fe-4985-a890-bf22d9fc8e9f",
          "code": "8997",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/8997/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "12cec136-1e08-4534-8a3d-9cee9a5eef79"
          ]
        },
        {
          "uuid": "ddba4519-6d2f-4a66-958e-ba53735f3629",
          "code": "m9358",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9358?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "12cec136-1e08-4534-8a3d-9cee9a5eef79"
          ]
        },
        {
          "uuid": "be74faf8-b6d1-4f43-afcc-6ec89288513e",
          "code": "CHEMBL1620144",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1620144",
          "code_system": "ChEMBL",
          "references": [
            "12cec136-1e08-4534-8a3d-9cee9a5eef79"
          ]
        },
        {
          "uuid": "8baf32c8-6cab-4089-ab44-90583e8cf126",
          "code": "217-538-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.945",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "12cec136-1e08-4534-8a3d-9cee9a5eef79"
          ]
        },
        {
          "uuid": "a81e422a-b629-4c95-b402-e51050368c4e",
          "code": "4990",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4990",
          "code_system": "PUBCHEM",
          "references": [
            "12cec136-1e08-4534-8a3d-9cee9a5eef79"
          ]
        },
        {
          "uuid": "e190d1b6-5757-5d79-ecfd-beb2fd778359",
          "code": "DTXSID5045708",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5045708",
          "code_system": "EPA CompTox",
          "references": [
            "24a87102-cfd6-a599-29c9-bd219f24c3d9"
          ]
        },
        {
          "uuid": "5b553700-9c57-44f5-23f6-cadf6f133ba5",
          "code": "C152114",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152114",
          "code_system": "NCI_THESAURUS",
          "references": [
            "63706ac7-fc43-99fe-72aa-5b93e7dc1875"
          ]
        },
        {
          "uuid": "8ffe008f-b95e-79d8-176d-3e9c4b0b901a",
          "code": "C29703",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Antilipidemic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29703",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2fbf5396-e4ae-b7ea-deb0-6369dbfb0763"
          ]
        },
        {
          "uuid": "f4708dbd-3b11-4ccb-a78b-58d445891d8a",
          "code": "81R511UV73",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e94173bd-c7c6-4e76-ac4d-45966100cb7d",
          "code": "2329",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2329",
          "code_system": "DRUG CENTRAL",
          "references": [
            "2fbf5396-e4ae-b7ea-deb0-6369dbfb0763"
          ]
        },
        {
          "uuid": "79cf1218-f904-7f53-b660-82985d2b11cd",
          "code": "100000080866",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8620511c-b8c6-e919-7253-92057c26202b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4768190d-eef8-4c33-b44d-9a6be3fdc083",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f2e88280-23f9-4b25-afea-98f49b0b343d",
            "refuuid": "a9218781-f112-4c1b-8f6e-74db5ca4b59b",
            "name": "PYRICARBATE",
            "unii": "81R511UV73",
            "linking_id": "81R511UV73",
            "ref_pname": "PYRICARBATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5e9100e2-6a1e-41ab-9204-eadd956d0fc8",
          "name": "2,6-PYRIDINEDIMETHANOL BIS(METHYLCARBAMATE) (ESTER)",
          "stdName": "2,6-PYRIDINEDIMETHANOL BIS(METHYLCARBAMATE) (ESTER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "60ebc5b3-6bce-446a-b6c3-f0f59953b301",
          "name": "2,6-PYRIDINEDIYLDIMETHYLENE BIS(METHYLCARBAMATE)",
          "stdName": "2,6-PYRIDINEDIYLDIMETHYLENE BIS(METHYLCARBAMATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa428560-e52a-4aef-b2ea-f09b58e8b4da",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "81940e36-e022-405d-a548-b45fdbb394d2",
          "name": "2,6-PYRIDINYLENEBIS(METHYL-N-METHYLCARBAMATE)",
          "stdName": "2,6-PYRIDINYLENEBIS(METHYL-N-METHYLCARBAMATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "969711ba-0190-4694-9c07-470cbfd240d7",
          "name": "ANGININ",
          "stdName": "ANGININ",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "8a456423-9a96-41d0-abc2-084978d04d0b",
          "name": "ANGIOXINE",
          "stdName": "ANGIOXINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "5003c300-b316-48b3-8254-98f7e71fd2a5",
          "name": "ATEROSAN",
          "stdName": "ATEROSAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "d529cb2b-847b-46a6-8134-616dfeb389ad",
          "name": "ATOVER",
          "stdName": "ATOVER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "02fa937a-9aec-48a6-a365-0fb53fbe3891",
          "name": "CICLOVEN",
          "stdName": "CICLOVEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "019d2c6f-11ad-4ba9-83b6-e304b3b3903b",
          "name": "COLESTERINEX",
          "stdName": "COLESTERINEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "ca24c86f-c0a5-4446-bc61-b84c0f2da626",
          "name": "DUVALINE",
          "stdName": "DUVALINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "5820943c-d700-4407-9ecd-ffa4372177ef",
          "name": "H-3749",
          "stdName": "H-3749",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "767a69ee-e820-4c1b-b537-c5c1f1ebdb7d",
          "name": "MOVECIL",
          "stdName": "MOVECIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "dd717998-eaef-4b66-8637-78a7e598ce33",
          "name": "PRODECTIN",
          "stdName": "PRODECTIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "74302505-ed1c-43c0-a59b-bacb3a673e5f",
          "name": "PYRICARBATE",
          "stdName": "PYRICARBATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7401d402-3692-4c6c-b396-1681beedcde9",
            "a37a35ce-c60f-496d-81e7-6d182921a984",
            "edc7a6ae-d8c3-44a6-885f-7eea74d08026",
            "60964a2c-b5dc-4042-a3e8-7eecca90f180",
            "af49ae7d-44df-495d-89fa-c12b3a848f13",
            "2935fe9d-297d-447d-8ddf-c637522aa006",
            "39e698aa-703f-45c4-bc38-dc74f312156f",
            "3f53eec3-e913-4f5f-ac2e-f5d0677231dd",
            "44c35328-284a-4d75-98b4-1a3a0fc1dcf0",
            "981a232b-2671-4ca0-b0bc-f25293a598af"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d5f85f35-5f47-4e91-a754-388d0bb884ce",
              "name_org": "INN"
            },
            {
              "uuid": "1aa85ae2-998c-4437-805d-c17ebdb95f0b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "313ee062-1bdf-4560-8286-c7d44e016e2d",
          "name": "PYRICARBATE [MART.]",
          "stdName": "PYRICARBATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edc7a6ae-d8c3-44a6-885f-7eea74d08026"
          ],
          "display_name": false
        },
        {
          "uuid": "eafcf9d1-00cf-471d-a680-39cac54d4658",
          "name": "PYRIDINOL CARBAMATE",
          "stdName": "PYRIDINOL CARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa428560-e52a-4aef-b2ea-f09b58e8b4da",
            "c2ee95b1-4e16-46f8-9616-aa15cf91cb77",
            "59af6465-09d9-40e1-b8b4-68bc5f255b71",
            "2935fe9d-297d-447d-8ddf-c637522aa006",
            "ddf9b17f-219f-4918-92e6-a5acde7aad21",
            "b7228783-ff83-4fb8-bc11-59dff1ec24c0"
          ],
          "display_name": false
        },
        {
          "uuid": "5f36d894-3175-4ccd-a184-18a8513e97fd",
          "name": "PYRIDINOL CARBAMATE [JAN]",
          "stdName": "PYRIDINOL CARBAMATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2ee95b1-4e16-46f8-9616-aa15cf91cb77",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "682f8644-c700-4766-bb8c-79a87fc12bcf",
          "name": "PYRIDINOL CARBAMATE [MI]",
          "stdName": "PYRIDINOL CARBAMATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59af6465-09d9-40e1-b8b4-68bc5f255b71",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "55482b7b-834e-4a81-8bf6-219dc561287f",
          "name": "PYRIDINOLCARBAMATE",
          "stdName": "PYRIDINOLCARBAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9af44e8b-f3b6-4553-b2e7-2b68be48657f",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "fa65967d-2fdc-c8fe-f9d5-04dbb96fea8a",
          "name": "Pyricarbate [WHO-DD]",
          "stdName": "PYRICARBATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84a4dc73-5f62-7807-818e-686ef7c491a5"
          ],
          "display_name": false
        },
        {
          "uuid": "863d9fdb-8633-4d3b-9413-411bec40862b",
          "name": "RAVENIL",
          "stdName": "RAVENIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "5ce421c7-0ffb-4757-84a5-08191668f0c4",
          "name": "SOSPITAN",
          "stdName": "SOSPITAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "ff69b266-d390-4d6a-9f89-0cefeacb6149",
          "name": "VASAGIN",
          "stdName": "VASAGIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "8f4fcc86-deba-4e32-b4fb-f8a8f0e2dd70",
          "name": "VASOCIL",
          "stdName": "VASOCIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "7c47fa15-a751-44b1-bb54-5b6420de6f1f",
          "name": "VASOVERIN",
          "stdName": "VASOVERIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
            "2935fe9d-297d-447d-8ddf-c637522aa006"
          ],
          "display_name": false
        },
        {
          "uuid": "9fe49762-91da-4495-b1d9-40a3d9dca06a",
          "name": "pyricarbate [INN]",
          "stdName": "PYRICARBATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60964a2c-b5dc-4042-a3e8-7eecca90f180"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9af44e8b-f3b6-4553-b2e7-2b68be48657f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2935fe9d-297d-447d-8ddf-c637522aa006",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa428560-e52a-4aef-b2ea-f09b58e8b4da",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2ab2385-75f8-4e5d-ad00-82f5ba6d72bc",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60964a2c-b5dc-4042-a3e8-7eecca90f180",
          "citation": "INN Proposed List 45",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL45.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c2ee95b1-4e16-46f8-9616-aa15cf91cb77",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "edc7a6ae-d8c3-44a6-885f-7eea74d08026",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59af6465-09d9-40e1-b8b4-68bc5f255b71",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44c35328-284a-4d75-98b4-1a3a0fc1dcf0",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7401d402-3692-4c6c-b396-1681beedcde9",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f53eec3-e913-4f5f-ac2e-f5d0677231dd",
          "citation": "USP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12cec136-1e08-4534-8a3d-9cee9a5eef79",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390887000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f30a799a-86d1-4f6d-b58c-7e4bd97da68e",
          "citation": "SRS import [81R511UV73]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=81R511UV73",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390887000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a37a35ce-c60f-496d-81e7-6d182921a984",
          "citation": "PYRICARBATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b7228783-ff83-4fb8-bc11-59dff1ec24c0",
          "citation": "PYRIDINOL CARBAMATE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "39e698aa-703f-45c4-bc38-dc74f312156f",
          "citation": "PYRICARBATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ddf9b17f-219f-4918-92e6-a5acde7aad21",
          "citation": "PYRIDINOL CARBAMATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "af49ae7d-44df-495d-89fa-c12b3a848f13",
          "citation": "PYRICARBATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "981a232b-2671-4ca0-b0bc-f25293a598af",
          "citation": "PYRICARBATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "24a87102-cfd6-a599-29c9-bd219f24c3d9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1882-26-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8620511c-b8c6-e919-7253-92057c26202b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "63706ac7-fc43-99fe-72aa-5b93e7dc1875",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2fbf5396-e4ae-b7ea-deb0-6369dbfb0763",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "24720a62-5a60-4441-bf6b-ee2e5a03ab48",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "84a4dc73-5f62-7807-818e-686ef7c491a5",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "37a936dd-f60d-42b1-a363-7554ae2f0e6f",
          "id": "37a936dd-f60d-42b1-a363-7554ae2f0e6f",
          "molfile": "\n  Marvin  01132102582D          \n\n 18 18  0  0  0  0            999 V2000\n    8.5963   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8929   -1.2362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1610   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1610   -2.4749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4395   -1.2362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7335   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0042   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0042   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2982    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5922   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5922   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8629   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1568   -1.2362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -2.4749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7009   -1.2362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2982   -1.6474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 18  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 18  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "CNC(=O)OCc1cccc(COC(=O)NC)n1",
          "formula": "C11H15N3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "266690c4-8089-4d77-a975-93a969150039"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "253.2549",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a9218781-f112-4c1b-8f6e-74db5ca4b59b",
      "version": "11",
      "structure": {
        "id": "1cadecde-cdef-4cb3-b15a-624d66389b5c",
        "molfile": "\n  Marvin  01132101402D          \n\n 18 18  0  0  0  0            999 V2000\n    7.1610   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2982   -1.6474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1610   -2.4749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -2.4749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1568   -1.2362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4395   -1.2362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7009   -1.2362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8929   -1.2362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0042   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5922   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8629   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7335   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2982    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5922   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0042   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5963   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  1  0  0  0  0\n  3 10  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  2  2  0  0  0  0\n  6 12  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11  3  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 10  2  0  0  0  0\n 17  9  1  0  0  0  0\n 18  8  1  0  0  0  0\n 15 11  1  0  0  0  0\nM  END",
        "smiles": "CNC(=O)OCc1cccc(COC(=O)NC)n1",
        "formula": "C11H15N3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "253.2549",
        "optical_activity": "NONE",
        "references": [
          "fa428560-e52a-4aef-b2ea-f09b58e8b4da",
          "f30a799a-86d1-4f6d-b58c-7e4bd97da68e",
          "60964a2c-b5dc-4042-a3e8-7eecca90f180"
        ],
        "stereo_centers": 0
      },
      "unii": "81R511UV73"
    }
  ]
}