{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e948ec25-5d78-4499-977f-151f8e10f798",
          "code": "3380-30-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3380-30-1",
          "code_system": "CAS",
          "references": [
            "3c41df93-74f0-4caa-8407-9071f08645f1",
            "28675932-0c1b-4d43-8ef9-3ceeb95c4fa4"
          ]
        },
        {
          "uuid": "2aeeaba6-5e8d-4ae5-81c2-fd441cb534ec",
          "code": "7997",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7997",
          "code_system": "INN",
          "references": [
            "3c41df93-74f0-4caa-8407-9071f08645f1"
          ]
        },
        {
          "uuid": "dc0ff0c5-bd7c-4a33-8038-56826ef2e85c",
          "code": "CHEMBL1232142",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1232142",
          "code_system": "ChEMBL",
          "references": [
            "3c41df93-74f0-4caa-8407-9071f08645f1"
          ]
        },
        {
          "uuid": "c329d01a-2ad4-4643-ad43-27a77e60442c",
          "code": "18807",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18807",
          "code_system": "PUBCHEM",
          "references": [
            "3c41df93-74f0-4caa-8407-9071f08645f1"
          ]
        },
        {
          "uuid": "c6bcf7b6-c2f2-c77c-76bf-b54d84cd03a8",
          "code": "DTXSID80187464",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80187464",
          "code_system": "EPA CompTox",
          "references": [
            "604d126e-114f-932e-8024-9e17c51d278b"
          ]
        },
        {
          "uuid": "6e8c7167-4250-8569-722c-30bdc203da1c",
          "code": "C152404",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152404",
          "code_system": "NCI_THESAURUS",
          "references": [
            "63310213-55cf-9796-2cd1-3604bbe1851e"
          ]
        },
        {
          "uuid": "6b3905e2-9bf7-a1be-c0e3-a7199be94f74",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "99177d0e-af02-1dd5-a794-b92042bbbf43"
          ]
        },
        {
          "uuid": "f10c4fb4-f874-4f3e-b727-1a50b30c7b18",
          "code": "814H7B74XK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "666e6439-7a2b-3700-74c1-8b426aa61892",
          "code": "DB04393",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04393",
          "code_system": "DRUG BANK",
          "references": [
            "99177d0e-af02-1dd5-a794-b92042bbbf43"
          ]
        },
        {
          "uuid": "f0a1cfcc-a038-1431-8f4c-5d35d035b3b3",
          "code": "300000036982",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "dc4c499e-bde4-c697-615c-d22d5b335476"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c20c95d7-55f0-402a-b7a8-38b1a45be709",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a43e6039-0393-4205-80fa-586631f515ce",
            "refuuid": "a2100097-6a5a-4e79-a6ed-bf02db855c13",
            "name": "SONECLOSAN",
            "unii": "814H7B74XK",
            "linking_id": "814H7B74XK",
            "ref_pname": "SONECLOSAN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c3de603c-f3fa-4935-8050-0aa722e55c7c",
          "name": "5-CHLORO-2-(P-CHLOROPHENOXY)PHENOL",
          "stdName": "5-CHLORO-2-(P-CHLOROPHENOXY)PHENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4658b9b-6d19-40f5-93e9-223325d22ad7"
          ],
          "display_name": false
        },
        {
          "uuid": "05fdd5bf-cd2d-4c9d-9a73-bb634329a062",
          "name": "HYDROXYDICHLORODIPHENYL ETHER",
          "stdName": "HYDROXYDICHLORODIPHENYL ETHER",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "50aec74c-2f95-4e63-8abc-9d138a069945",
            "c6ae4e7b-6feb-41bc-90b7-53ffa4843c6f",
            "e0137566-cc67-4255-b013-548d9e8c871b"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "325728f7-1d8d-48b2-b973-0edd6ed66e4d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9e8ddca2-6e61-4f1d-8da4-9001aed9e5d9",
          "name": "SONECLOSAN",
          "stdName": "SONECLOSAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac012c9e-7a53-468a-b9d1-e4531910e189",
            "41564939-19e0-43c6-9f07-46330507f2bc"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ee6dfccf-bc85-4550-8fad-5a8e6db06cb1",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "d2d64fba-87db-4bf1-b498-6bf60b78dc44",
          "name": "TINOSAN HP100",
          "stdName": "TINOSAN HP100",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50aec74c-2f95-4e63-8abc-9d138a069945"
          ],
          "display_name": false
        },
        {
          "uuid": "4b33453e-0b9c-41f4-a06f-90ddf98ca6c3",
          "name": "soneclosan [INN]",
          "stdName": "SONECLOSAN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac012c9e-7a53-468a-b9d1-e4531910e189"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ac012c9e-7a53-468a-b9d1-e4531910e189",
          "citation": "INN Proposed List 84",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL84.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e4658b9b-6d19-40f5-93e9-223325d22ad7",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50aec74c-2f95-4e63-8abc-9d138a069945",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0137566-cc67-4255-b013-548d9e8c871b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c41df93-74f0-4caa-8407-9071f08645f1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389660000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c6288c8-b721-49a6-a821-7061761a8ba3",
          "citation": "SRS import [814H7B74XK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=814H7B74XK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389660000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e403165e-62f6-4ea7-8000-9d5852927139",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41564939-19e0-43c6-9f07-46330507f2bc",
          "citation": "SONECLOSAN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c6ae4e7b-6feb-41bc-90b7-53ffa4843c6f",
          "citation": "HYDROXYDICHLORODIPHENYL ETHER [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "604d126e-114f-932e-8024-9e17c51d278b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3380-30-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "63310213-55cf-9796-2cd1-3604bbe1851e",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "99177d0e-af02-1dd5-a794-b92042bbbf43",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "28675932-0c1b-4d43-8ef9-3ceeb95c4fa4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dc4c499e-bde4-c697-615c-d22d5b335476",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0f79b7c9-8a0e-4d2b-a2be-300cb36fc826",
          "id": "0f79b7c9-8a0e-4d2b-a2be-300cb36fc826",
          "molfile": "\n  Marvin  01132101022D          \n\n 16 17  0  0  0  0            999 V2000\n    1.8454   -1.2565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1224   -1.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4081   -1.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3119   -1.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0408   -1.2827    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3119   -2.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4082   -2.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1224   -2.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8454   -2.9212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5685   -2.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5743   -1.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2885   -1.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0086   -1.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7375   -1.2799    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.0028   -2.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2827   -2.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 16 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1Cl)Oc2ccc(cc2O)Cl",
          "formula": "C12H8Cl2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a96272dc-eb4c-4f73-a257-19d2ba15946f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "255.097",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a2100097-6a5a-4e79-a6ed-bf02db855c13",
      "version": "9",
      "structure": {
        "id": "7dce2ad0-046a-4754-b251-94bdb7fe1e33",
        "molfile": "\n  Marvin  01132106322D          \n\n 16 17  0  0  0  0            999 V2000\n    1.1224   -2.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1224   -1.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4081   -1.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8454   -2.9212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4082   -2.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3119   -1.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5685   -2.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0086   -1.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8454   -1.2565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3119   -2.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0408   -1.2827    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7375   -1.2799    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.2827   -2.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5743   -1.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2885   -1.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0028   -2.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8 15  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  6  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13  7  2  0  0  0  0\n 14  7  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 13  1  0  0  0  0\n  6  3  2  0  0  0  0\n 16  8  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1Cl)Oc2ccc(cc2O)Cl",
        "formula": "C12H8Cl2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "255.097",
        "optical_activity": "NONE",
        "references": [
          "1c6288c8-b721-49a6-a821-7061761a8ba3",
          "e403165e-62f6-4ea7-8000-9d5852927139",
          "ac012c9e-7a53-468a-b9d1-e4531910e189"
        ],
        "stereo_centers": 0
      },
      "unii": "814H7B74XK"
    }
  ]
}