{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8a3fcc00-e8e3-4177-9e36-e1516835d0d3",
          "code": "552-30-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=552-30-7",
          "code_system": "CAS",
          "references": [
            "90762892-8a5f-4481-8742-67b59aab81a9",
            "81b58f19-3a60-410d-987a-e392ffdec3ec"
          ]
        },
        {
          "uuid": "29de25b9-b1c2-445b-807d-94a081d49d55",
          "code": "C015559",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67015559",
          "code_system": "MESH",
          "references": [
            "90762892-8a5f-4481-8742-67b59aab81a9"
          ]
        },
        {
          "uuid": "8dd35857-9042-4a37-bde9-ac751b51dc73",
          "code": "FCN NO. 1041",
          "comments": "FCN|COMPONENT|FOOD CONTACT ARTICLES",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=1041",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "90762892-8a5f-4481-8742-67b59aab81a9"
          ]
        },
        {
          "uuid": "5e070d81-5a9e-4d43-9cba-c1fdc30d731b",
          "code": "FCN NO. 729",
          "comments": "FCN|COMPONENT|FOOD CONTACT ARTICLES",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=729",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "90762892-8a5f-4481-8742-67b59aab81a9"
          ]
        },
        {
          "uuid": "fbe82960-bf3b-4522-adff-b04f49b69f69",
          "code": "209-008-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.190",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "90762892-8a5f-4481-8742-67b59aab81a9"
          ]
        },
        {
          "uuid": "2b722ac3-0492-4858-a173-ed6f245aa520",
          "code": "m11142",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11142?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "90762892-8a5f-4481-8742-67b59aab81a9"
          ]
        },
        {
          "uuid": "f1d1708d-a7f4-4a42-8207-bad581cc632c",
          "code": "11089",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11089",
          "code_system": "PUBCHEM",
          "references": [
            "90762892-8a5f-4481-8742-67b59aab81a9"
          ]
        },
        {
          "uuid": "7877e76e-178a-3972-e55a-ddd6156369ac",
          "code": "Trimellitic anhydride",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Trimellitic_anhydride",
          "code_system": "WIKIPEDIA",
          "references": [
            "7e5d7c38-4ecd-1016-c7f3-ff6ea7f8ee99"
          ]
        },
        {
          "uuid": "17deca12-68a7-1ce8-243e-b734f23a0c41",
          "code": "4299",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4299",
          "code_system": "HSDB",
          "references": [
            "d97a1f39-176a-a471-5a9d-a1ee75f869fd"
          ]
        },
        {
          "uuid": "f2324759-4224-bad1-a266-9c80faa5206b",
          "code": "DTXSID7026235",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7026235",
          "code_system": "EPA CompTox",
          "references": [
            "1f2776a4-f665-09e5-4958-780f5d30ac8a"
          ]
        },
        {
          "uuid": "65c122d4-19aa-46a1-9fb7-544d0f0fe467",
          "code": "80T61EUU7H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9b5e9b4d-42f2-a481-fc84-72a2402b4c9b",
          "code": "53050",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:53050",
          "code_system": "CHEBI",
          "references": [
            "a608e002-52d4-6b81-de24-28902a12e9d0"
          ]
        },
        {
          "uuid": "e90f4c1a-a3b8-08a2-be92-df1f1b892c3e",
          "code": "60252",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=60252",
          "code_system": "NSC",
          "references": [
            "08b8608e-9095-3005-7286-cf5fd6c04c0b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5a9ff4da-b7b9-43e9-8e6e-9257b9c1b82f",
          "name": "1,3-DIHYDRO-1,3-DIOXO-5-ISOBENZOFURANCARBOXYLIC ACID",
          "stdName": "1,3-DIHYDRO-1,3-DIOXO-5-ISOBENZOFURANCARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "917aed84-7dae-4136-ba39-c0616957d6e8",
            "63b27f1d-515b-4024-923c-914c60b18d5e"
          ],
          "display_name": false
        },
        {
          "uuid": "8459f49f-f4a6-49c9-a109-f9d5ac87f313",
          "name": "NSC-60252",
          "stdName": "NSC-60252",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01e86710-c6e1-4269-b603-42a2e3c18ff5",
            "917aed84-7dae-4136-ba39-c0616957d6e8"
          ],
          "display_name": false
        },
        {
          "uuid": "9c6811f2-f166-4524-915d-17135c6d40cf",
          "name": "TRIMELLITIC ACID 1,2-ANHYDRIDE",
          "stdName": "TRIMELLITIC ACID 1,2-ANHYDRIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "917aed84-7dae-4136-ba39-c0616957d6e8",
            "63b27f1d-515b-4024-923c-914c60b18d5e"
          ],
          "display_name": false
        },
        {
          "uuid": "6964c27d-1dc7-4535-9159-167789313605",
          "name": "TRIMELLITIC ANHYDRIDE",
          "stdName": "TRIMELLITIC ANHYDRIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6c27ecb-8a51-49bd-9a11-af039b90a43d",
            "917aed84-7dae-4136-ba39-c0616957d6e8",
            "859f658d-f8a4-4cd3-b799-b0db651899da",
            "20284c4f-133f-4e7f-b489-9491009d8fd8",
            "d9825b4d-f3f6-4a10-8d02-2e474b22b36d",
            "6e254f7f-2944-4a1f-86a5-dfb4d190fcde"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "fbd91af0-f467-4609-8c2b-080c2cbe1c44",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c993bc30-1426-4371-8e2e-82b9f9a718f7",
          "name": "TRIMELLITIC ANHYDRIDE [HSDB]",
          "stdName": "TRIMELLITIC ANHYDRIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "917aed84-7dae-4136-ba39-c0616957d6e8",
            "d9825b4d-f3f6-4a10-8d02-2e474b22b36d"
          ],
          "display_name": false
        },
        {
          "uuid": "01586014-db89-4716-a6bd-34054c93b34d",
          "name": "TRIMELLITIC ANHYDRIDE [MI]",
          "stdName": "TRIMELLITIC ANHYDRIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "917aed84-7dae-4136-ba39-c0616957d6e8",
            "859f658d-f8a4-4cd3-b799-b0db651899da"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "859f658d-f8a4-4cd3-b799-b0db651899da",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "917aed84-7dae-4136-ba39-c0616957d6e8",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63b27f1d-515b-4024-923c-914c60b18d5e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9825b4d-f3f6-4a10-8d02-2e474b22b36d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01e86710-c6e1-4269-b603-42a2e3c18ff5",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90762892-8a5f-4481-8742-67b59aab81a9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390929000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d139c701-c552-48f5-9b8d-9e83ff0ddc3e",
          "citation": "SRS import [80T61EUU7H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=80T61EUU7H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390929000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf5cc808-c9d0-4c05-828d-6ab77662c2f1",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e254f7f-2944-4a1f-86a5-dfb4d190fcde",
          "citation": "TRIMELLITIC ANHYDRIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "20284c4f-133f-4e7f-b489-9491009d8fd8",
          "citation": "TRIMELLITIC ANHYDRIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d6c27ecb-8a51-49bd-9a11-af039b90a43d",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7e5d7c38-4ecd-1016-c7f3-ff6ea7f8ee99",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Trimellitic_anhydride",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d97a1f39-176a-a471-5a9d-a1ee75f869fd",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+552-30-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1f2776a4-f665-09e5-4958-780f5d30ac8a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=552-30-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f05fb99f-ba96-035a-b182-7c6d47d008a3",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "81b58f19-3a60-410d-987a-e392ffdec3ec",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a608e002-52d4-6b81-de24-28902a12e9d0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "08b8608e-9095-3005-7286-cf5fd6c04c0b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c688b947-414c-45ef-b127-177d2ca02ecd",
          "id": "c688b947-414c-45ef-b127-177d2ca02ecd",
          "molfile": "\n  Marvin  01132110162D          \n\n 14 15  0  0  0  0            999 V2000\n    8.2699   -6.6955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2699   -5.8675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9736   -5.4306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5387   -5.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5387   -4.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7890   -4.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1082   -4.7085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2848   -4.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9997   -3.7057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8295   -5.1593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3354   -5.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1101   -6.6126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1082   -5.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8395   -5.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n 14  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 13  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "c1cc2c(cc1C(=O)O)C(=O)OC2=O",
          "formula": "C9H4O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0ac27418-fe81-4e80-a969-ed735bdff0e9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "192.1254",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "da78ab2f-150a-4f3a-87bd-4a4b9e0a14e2",
      "version": "9",
      "structure": {
        "id": "a6a74183-e981-4275-9604-b19f6c5458bc",
        "molfile": "\n  Marvin  01132108392D          \n\n 14 15  0  0  0  0            999 V2000\n    6.1082   -5.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1082   -4.7085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2848   -4.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9997   -3.7057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8295   -5.1593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3354   -5.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1101   -6.6126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7890   -4.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5387   -4.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5387   -5.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8395   -5.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2699   -5.8675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2699   -6.6955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9736   -5.4306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  2  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n  1 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
        "smiles": "c1cc2c(cc1C(=O)O)C(=O)OC2=O",
        "formula": "C9H4O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "192.1254",
        "optical_activity": "NONE",
        "references": [
          "bf5cc808-c9d0-4c05-828d-6ab77662c2f1",
          "d139c701-c552-48f5-9b8d-9e83ff0ddc3e"
        ],
        "stereo_centers": 0
      },
      "unii": "80T61EUU7H"
    }
  ]
}