{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "23ce1f80-3dd3-47e9-8c7b-0f7b3591677b",
          "code": "m5480",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5480?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d407bd19-9756-425b-82b8-5a06382176eb"
          ]
        },
        {
          "uuid": "b9ccf834-a88b-4b16-be65-93eda2334cd4",
          "code": "CHEMBL283552",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL283552",
          "code_system": "ChEMBL",
          "references": [
            "d407bd19-9756-425b-82b8-5a06382176eb"
          ]
        },
        {
          "uuid": "77896810-4354-4332-8815-afd9ad66bef4",
          "code": "20906",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20906",
          "code_system": "PUBCHEM",
          "references": [
            "d407bd19-9756-425b-82b8-5a06382176eb"
          ]
        },
        {
          "uuid": "5723fec1-3a2d-4938-be6f-53a87f277908",
          "code": "4776-06-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4776-06-1",
          "code_system": "CAS",
          "references": [
            "d407bd19-9756-425b-82b8-5a06382176eb",
            "862ec54f-ed92-4601-9532-df6f3175b001"
          ]
        },
        {
          "uuid": "938d07e7-681d-4cf6-be40-31c10374c774",
          "code": "C82318",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C82318",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d407bd19-9756-425b-82b8-5a06382176eb"
          ]
        },
        {
          "uuid": "097ea08f-caeb-45b7-8668-cd42440fb4f2",
          "code": "SUB07752MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d407bd19-9756-425b-82b8-5a06382176eb"
          ]
        },
        {
          "uuid": "9f874e06-e142-41bf-adf0-853215eee161",
          "code": "27601",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:677",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "d407bd19-9756-425b-82b8-5a06382176eb"
          ]
        },
        {
          "uuid": "0bf2368d-1c42-49bf-ad62-528ed96e916c",
          "code": "2141",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2141",
          "code_system": "INN",
          "references": [
            "d407bd19-9756-425b-82b8-5a06382176eb"
          ]
        },
        {
          "uuid": "db57fe88-c958-4d24-a48c-403e6d5cfa36",
          "code": "225-322-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.020",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d407bd19-9756-425b-82b8-5a06382176eb"
          ]
        },
        {
          "uuid": "04597348-8574-c3f1-e37e-3d3ed411593b",
          "code": "DTXSID0041985",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0041985",
          "code_system": "EPA CompTox",
          "references": [
            "23c0db6c-49f9-6b9b-d5a9-19a2cfcd67fe"
          ]
        },
        {
          "uuid": "3f720089-2643-6cd2-6f68-13cb7c118128",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "34363596-622c-9b35-ee2f-17ba060769f2"
          ]
        },
        {
          "uuid": "eb15db91-674d-4e87-8c56-8ba3efe5ce8f",
          "code": "80OFG3WPYD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e687f459-8ee2-e694-96de-5c9901ab9200",
          "code": "3236",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3236",
          "code_system": "DRUG CENTRAL",
          "references": [
            "34363596-622c-9b35-ee2f-17ba060769f2"
          ]
        },
        {
          "uuid": "e68e784d-1bcc-1159-a623-5de32e284094",
          "code": "166520",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=166520",
          "code_system": "NSC",
          "references": [
            "ec1122f2-f393-e596-79da-8a7100abde01"
          ]
        },
        {
          "uuid": "c800f63f-673d-f596-1fef-471104161051",
          "code": "100000080953",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9ba9cd4f-a261-d754-a17c-2d027513f1a3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d0ab7361-42d1-4224-8dc9-31408791e2f4",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "206033b2-5b27-45e4-b24f-0d5bf5002218",
            "refuuid": "e1daee6b-813c-499b-b1df-3ff16c44a0b4",
            "name": "FLUOROSALAN",
            "unii": "80OFG3WPYD",
            "linking_id": "80OFG3WPYD",
            "ref_pname": "FLUOROSALAN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "65b0f9c4-ac40-42b5-99c9-79f16d40fe25",
          "name": "3,5-DIBROMO-.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-M-SALICYLOTOLUIDIDE",
          "stdName": "3,5-DIBROMO-.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-M-SALICYLOTOLUIDIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61118a0d-d76b-4c23-a426-db1b6f59a45e",
            "1c223388-5b25-422c-ab15-985e0fff8799"
          ],
          "display_name": false
        },
        {
          "uuid": "09940ef8-0231-41ae-94b8-d5f410e55b82",
          "name": "3,5-DIBROMO-3'-(TRIFLUOROMETHYL)SALICYLANILIDE",
          "stdName": "3,5-DIBROMO-3'-(TRIFLUOROMETHYL)SALICYLANILIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61118a0d-d76b-4c23-a426-db1b6f59a45e",
            "1c223388-5b25-422c-ab15-985e0fff8799"
          ],
          "display_name": false
        },
        {
          "uuid": "dc8fd65a-220e-4ab3-addc-0a794d96cb7c",
          "name": "BENZAMIDE, 3,5-DIBROMO-2-HYDROXY-N-(3-(TRIFLUOROMETHYL)PHENYL)-",
          "stdName": "BENZAMIDE, 3,5-DIBROMO-2-HYDROXY-N-(3-(TRIFLUOROMETHYL)PHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61118a0d-d76b-4c23-a426-db1b6f59a45e",
            "1c223388-5b25-422c-ab15-985e0fff8799"
          ],
          "display_name": false
        },
        {
          "uuid": "16746f79-ad59-4213-8f71-da3f008076ac",
          "name": "FLUOROSALAN",
          "stdName": "FLUOROSALAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eae9d159-0305-46f4-8a5c-420b4e8b03e5",
            "61118a0d-d76b-4c23-a426-db1b6f59a45e",
            "6f623862-7013-4b5f-a85e-73f414a0955a",
            "e70fb96e-2b0a-4243-b2b7-e1f6882c116f",
            "44591adc-6bff-4b29-93db-ff6c44ef50ad",
            "70206773-309c-4b1a-af37-ad74fbd5a649",
            "47258387-8eee-4c35-ae8e-57601cec05b7",
            "1c223388-5b25-422c-ab15-985e0fff8799"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7f5f98e2-d657-4330-a05d-6519352d036e",
              "name_org": "USAN"
            },
            {
              "uuid": "c9c93c1a-6a34-4681-ae9f-20dd18d86c2e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "51e28991-23d7-48e8-b613-b8dcf4dd9729",
          "name": "FLUOROSALAN [MI]",
          "stdName": "FLUOROSALAN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eae9d159-0305-46f4-8a5c-420b4e8b03e5",
            "61118a0d-d76b-4c23-a426-db1b6f59a45e"
          ],
          "display_name": false
        },
        {
          "uuid": "dcdc4db3-9b50-400e-9a88-a0491db11580",
          "name": "FLUOROSALAN [USAN]",
          "stdName": "FLUOROSALAN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70206773-309c-4b1a-af37-ad74fbd5a649"
          ],
          "display_name": false
        },
        {
          "uuid": "08e6beb0-8d40-43c8-8ea4-a62e880d78ca",
          "name": "FLUSALAN",
          "stdName": "FLUSALAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "904a304a-175a-4d71-85fe-39ea85707e99",
            "61118a0d-d76b-4c23-a426-db1b6f59a45e",
            "1c223388-5b25-422c-ab15-985e0fff8799",
            "43f5c826-4890-4101-82ab-fc9e83d749a8"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "51764ee8-7d6c-48c7-b496-072d261f07db",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "8d0a134c-e123-40bb-a470-f1d8d6a150e5",
          "name": "NSC-166520",
          "stdName": "NSC-166520",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61118a0d-d76b-4c23-a426-db1b6f59a45e",
            "e24168ad-7bd2-4a78-851b-017456ac0373"
          ],
          "display_name": false
        },
        {
          "uuid": "44b96aa4-2f4d-48fe-a5cd-d782015b3a43",
          "name": "flusalan [INN]",
          "stdName": "FLUSALAN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43f5c826-4890-4101-82ab-fc9e83d749a8",
            "eef77a26-bbb8-4869-a866-f39f3fde5ccb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1c223388-5b25-422c-ab15-985e0fff8799",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "61118a0d-d76b-4c23-a426-db1b6f59a45e",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43f5c826-4890-4101-82ab-fc9e83d749a8",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70206773-309c-4b1a-af37-ad74fbd5a649",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eae9d159-0305-46f4-8a5c-420b4e8b03e5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47258387-8eee-4c35-ae8e-57601cec05b7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e24168ad-7bd2-4a78-851b-017456ac0373",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d407bd19-9756-425b-82b8-5a06382176eb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389676000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53c5365f-0b63-4932-9554-53a1d4b7de75",
          "citation": "SRS import [80OFG3WPYD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=80OFG3WPYD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389676000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "904a304a-175a-4d71-85fe-39ea85707e99",
          "citation": "FLUSALAN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6f623862-7013-4b5f-a85e-73f414a0955a",
          "citation": "FLUOROSALAN [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "44591adc-6bff-4b29-93db-ff6c44ef50ad",
          "citation": "FLUOROSALAN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e70fb96e-2b0a-4243-b2b7-e1f6882c116f",
          "citation": "FLUOROSALAN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "23c0db6c-49f9-6b9b-d5a9-19a2cfcd67fe",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4776-06-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "34363596-622c-9b35-ee2f-17ba060769f2",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "eef77a26-bbb8-4869-a866-f39f3fde5ccb",
          "citation": "INN Proposed List 16",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL16.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "862ec54f-ed92-4601-9532-df6f3175b001",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ec1122f2-f393-e596-79da-8a7100abde01",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9ba9cd4f-a261-d754-a17c-2d027513f1a3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4384ef32-8210-4ade-8082-5706004a292f",
          "id": "4384ef32-8210-4ade-8082-5706004a292f",
          "molfile": "\n  Marvin  01132103332D          \n\n 22 23  0  0  0  0            999 V2000\n    1.4237   -0.4120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4237   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7104   -1.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2538    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7104   -2.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4237   -2.8677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4237   -3.6943    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1341   -2.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1315   -1.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8677   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8651   -0.4094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5630   -1.6478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2657   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2657   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9970    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7100   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7100   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9970   -1.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4049   -1.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9998   -1.0761    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9417   -2.3041    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0538   -2.1573    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  9  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\n 22 19  1  0  0  0  0\nM  END",
          "smiles": "c1cc(cc(c1)NC(=O)c2cc(cc(c2O)Br)Br)C(F)(F)F",
          "formula": "C14H8Br2F3NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cc00652e-bc2c-4d8c-80fc-1fc6cecdbabe"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "439.0216",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e1daee6b-813c-499b-b1df-3ff16c44a0b4",
      "version": "9",
      "structure": {
        "id": "357eb694-30bc-4b37-abd6-e55d1e7c7c85",
        "molfile": "\n  Marvin  01132102512D          \n\n 22 23  0  0  0  0            999 V2000\n    2.1315   -1.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8677   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4049   -1.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4237   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7104   -1.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5630   -1.6478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7100   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7104   -2.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1341   -2.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4237   -2.8677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8651   -0.4094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2657   -1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9970   -1.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9998   -1.0761    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9417   -2.3041    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0538   -2.1573    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2538    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4237   -0.4120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4237   -3.6943    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7100   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9970    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2657   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7 13  2  0  0  0  0\n  8 10  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  2  2  0  0  0  0\n 12  6  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15  3  1  0  0  0  0\n 16  3  1  0  0  0  0\n 17  5  1  0  0  0  0\n 18  4  1  0  0  0  0\n 19 10  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 12  2  0  0  0  0\n  8  5  2  0  0  0  0\n 20  7  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cc(c1)NC(=O)c2cc(cc(c2O)Br)Br)C(F)(F)F",
        "formula": "C14H8Br2F3NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "439.0216",
        "optical_activity": "NONE",
        "references": [
          "53c5365f-0b63-4932-9554-53a1d4b7de75",
          "1c223388-5b25-422c-ab15-985e0fff8799",
          "eef77a26-bbb8-4869-a866-f39f3fde5ccb"
        ],
        "stereo_centers": 0
      },
      "unii": "80OFG3WPYD"
    }
  ]
}