{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "90c51b4f-b453-4860-bb6d-9b7b0b42ce5d",
          "code": "M05BX01",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|DRUGS FOR TREATMENT OF BONE DISEASES|DRUGS AFFECTING BONE STRUCTURE AND MINERALIZATION|Other drugs affecting bone structure and mineralization|ipriflavone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M05BX01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f"
          ]
        },
        {
          "uuid": "545e4213-1e6a-4b79-a22f-9d19bd8b9696",
          "code": "QM05BX01",
          "comments": "VATC|DRUGS FOR TREATMENT OF BONE DISEASES|DRUGS AFFECTING BONE STRUCTURE AND MINERALIZATION|Other drugs affecting bone structure and mineralization|ipriflavone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM05BX01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f"
          ]
        },
        {
          "uuid": "8269e976-db0e-4d6f-b6c8-ac389e01702f",
          "code": "35212-22-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=35212-22-7",
          "code_system": "CAS",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f",
            "f88da739-3932-40ed-8141-cc0b11ec4cd5"
          ]
        },
        {
          "uuid": "f7031e53-f13a-4887-b4a1-0f4cb55a8819",
          "code": "C63694",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C63694",
          "code_system": "NCI_THESAURUS",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f"
          ]
        },
        {
          "uuid": "d4cb016c-103e-4837-8ab0-7252477abd21",
          "code": "C018986",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67018986",
          "code_system": "MESH",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f"
          ]
        },
        {
          "uuid": "dcf4d8a8-bca5-4e15-97e3-747927fa3a08",
          "code": "IPRIFLAVONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ipriflavone",
          "code_system": "WIKIPEDIA",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f"
          ]
        },
        {
          "uuid": "25c36d9d-1927-4ae3-b6be-cb2e16c17dd5",
          "code": "SUB08278MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f"
          ]
        },
        {
          "uuid": "4ddbe511-4daf-4e0a-8be5-a234516a8fae",
          "code": "3521",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3521",
          "code_system": "INN",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f"
          ]
        },
        {
          "uuid": "1dc91e92-f624-4eb1-8960-46935ca2a56b",
          "code": "51487",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/51487/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f"
          ]
        },
        {
          "uuid": "801e39b6-b2be-49b6-b12b-3475d06b98e0",
          "code": "m6388",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6388?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f"
          ]
        },
        {
          "uuid": "6816b51a-d9e4-45e4-8101-9bd14a1f4a14",
          "code": "CHEMBL165790",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL165790",
          "code_system": "ChEMBL",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f"
          ]
        },
        {
          "uuid": "3e5a1726-4d21-4171-8149-cdd784cc84d0",
          "code": "3747",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3747",
          "code_system": "PUBCHEM",
          "references": [
            "29031992-5d63-4a9c-8caf-b931e0bf889f"
          ]
        },
        {
          "uuid": "71ca9416-b85b-cddd-3583-757f64a74e99",
          "code": "DTXSID5040679",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5040679",
          "code_system": "EPA CompTox",
          "references": [
            "ee948190-0d77-9def-f469-693580e97f82"
          ]
        },
        {
          "uuid": "77e64c6f-4ab6-4072-20d0-f0fdbcf0bdec",
          "code": "C1745",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Polyphenol[C28203]|Flavonoid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1745",
          "code_system": "NCI_THESAURUS",
          "references": [
            "600b7411-e656-5e53-6132-312502b56d3c"
          ]
        },
        {
          "uuid": "a4a5baf8-7ccc-0e95-59cc-8d8161b6d505",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "600b7411-e656-5e53-6132-312502b56d3c"
          ]
        },
        {
          "uuid": "2fd0e088-3f64-4214-a2df-8386f4f071b9",
          "code": "80BJ7WN25Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ec2f8b00-24b4-ab27-b59a-0a298c5ac446",
          "code": "479 (Number of products:64)",
          "comments": "Dietary Supplement Label Database|Other|Ipriflavone",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=479&item=Ipriflavone",
          "code_system": "DSLD",
          "references": [
            "600b7411-e656-5e53-6132-312502b56d3c"
          ]
        },
        {
          "uuid": "a6d7baec-ced7-07dd-16cb-5306f0b7333e",
          "code": "1477",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1477",
          "code_system": "DRUG CENTRAL",
          "references": [
            "600b7411-e656-5e53-6132-312502b56d3c"
          ]
        },
        {
          "uuid": "4eae484a-0c72-afcf-eb9c-2a216847646e",
          "code": "DB13618",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13618",
          "code_system": "DRUG BANK",
          "references": [
            "600b7411-e656-5e53-6132-312502b56d3c"
          ]
        },
        {
          "uuid": "baecd3e7-6827-7ee3-a988-a95355038696",
          "code": "31719",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31719",
          "code_system": "CHEBI",
          "references": [
            "600b7411-e656-5e53-6132-312502b56d3c"
          ]
        },
        {
          "uuid": "7df5e577-2bba-0669-22cc-000b4d6ab793",
          "code": "100000083142",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4e29a740-053e-e3a8-53c4-850580f5f476"
          ]
        },
        {
          "uuid": "3dd31541-95ef-7d8a-c1c8-84f9f80c4f47",
          "code": "80BJ7WN25Z",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=80BJ7WN25Z",
          "code_system": "DAILYMED",
          "references": [
            "047ebb92-064d-287c-d54e-70b546e0b42c"
          ]
        },
        {
          "uuid": "82628018-c71a-05f5-5926-a5e522bf7259",
          "code": "755888",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=755888",
          "code_system": "NSC",
          "references": [
            "dbc16f39-3567-5f73-7580-59270fa14c3e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6477063f-80e7-4274-ba1b-d8297e108dc2",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "225982cb-ee19-4461-bed7-095dfa8a2cf3",
            "refuuid": "bd052533-3092-4dab-a9ad-b2b0de75ef50",
            "name": "IPRIFLAVONE",
            "unii": "80BJ7WN25Z",
            "linking_id": "80BJ7WN25Z",
            "ref_pname": "IPRIFLAVONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "31ae1edc-d5fb-43bf-96c0-a1a4d6240b6e",
          "amount": {
            "uuid": "14aa05c7-8712-4415-96b1-d99a28dcbeac"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "5dd351f2-67f6-4370-8e6d-882033f595d0"
          ],
          "related_substance": {
            "uuid": "692e6ac6-4fb2-4c05-a8d7-05326c94c58d",
            "refuuid": "4f380788-d668-43a5-8ea0-982acaea96b8",
            "name": "7-(1-Methylethoxy)-3-phenyl-4H-1-benzopyran-4-one hydrofluoride",
            "unii": "QMY8UPG2Q9",
            "linking_id": "QMY8UPG2Q9",
            "ref_pname": "7-(1-Methylethoxy)-3-phenyl-4H-1-benzopyran-4-one hydrofluoride"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "300ff115-4b43-45e4-bbad-dcea7a0ce069",
          "name": "7-ISOPROPOXYISOFLAVONE",
          "stdName": "7-ISOPROPOXYISOFLAVONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb7adfbd-b964-495b-aa02-6e565c65e34a"
          ],
          "display_name": false
        },
        {
          "uuid": "d49fcdf5-9068-4f90-ac93-93b85a653442",
          "name": "IPRIFLAVONE",
          "stdName": "IPRIFLAVONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d43081da-ff1e-4723-93a4-9bb95893f393",
            "ec933596-36d0-4898-b7b6-be869a8bb680",
            "f31d868f-1108-4270-b347-fe0b34ff2769",
            "e6e44bcd-44c0-425c-b4c0-61839465be1a",
            "b720b748-1b72-4012-8885-7bd2cbb90be6",
            "abce046b-8a3b-4a0d-a330-b5cba60a7f87",
            "3a420ffc-897e-4d5a-be7c-637a0d107fe1",
            "b6e5bc43-be68-4b2f-b6d0-bb786f3d57b3",
            "7d0c9c9b-f514-4955-a45e-4c5af288654b",
            "e9bf67e5-96b2-4d2f-ba7c-c3091f546b70",
            "2a601c2d-b3e5-4ac8-a6c6-edd7d2e4094a",
            "fe5ff2f8-c588-4d56-968c-dcb72084421d",
            "ca66f9e8-d7c5-48e1-8ca7-85cbfdc4109f",
            "567d0d9a-2d2f-4902-978b-8ccaa6d1474b"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "05322077-a585-4122-bdce-e5dc130ea50a",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "9794b17d-5b87-4799-a4bf-7c5c020176ee",
          "name": "IPRIFLAVONE [JAN]",
          "stdName": "IPRIFLAVONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a420ffc-897e-4d5a-be7c-637a0d107fe1",
            "b6e5bc43-be68-4b2f-b6d0-bb786f3d57b3"
          ],
          "display_name": false
        },
        {
          "uuid": "55d8fe43-fb60-4438-a27a-d80c1f2f14b2",
          "name": "IPRIFLAVONE [MART.]",
          "stdName": "IPRIFLAVONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec933596-36d0-4898-b7b6-be869a8bb680"
          ],
          "display_name": false
        },
        {
          "uuid": "7e69cace-d128-4914-8fc7-fe0cb4b49b92",
          "name": "IPRIFLAVONE [MI]",
          "stdName": "IPRIFLAVONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6e5bc43-be68-4b2f-b6d0-bb786f3d57b3",
            "ca66f9e8-d7c5-48e1-8ca7-85cbfdc4109f"
          ],
          "display_name": false
        },
        {
          "uuid": "5f28dd23-413a-4dd4-9cb5-ce5280e0c1de",
          "name": "IPRIFLAVONE [VANDF]",
          "stdName": "IPRIFLAVONE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6e44bcd-44c0-425c-b4c0-61839465be1a",
            "b6e5bc43-be68-4b2f-b6d0-bb786f3d57b3"
          ],
          "display_name": false
        },
        {
          "uuid": "faadb2c9-927e-431b-35f4-0730dfcc32ad",
          "name": "Ipriflavone [WHO-DD]",
          "stdName": "IPRIFLAVONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0661336e-b678-44f9-8b38-e67ad200ef77"
          ],
          "display_name": false
        },
        {
          "uuid": "7282c809-9530-9077-9aaf-650f5320c7c8",
          "name": "NSC-755888",
          "stdName": "NSC-755888",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbc16f39-3567-5f73-7580-59270fa14c3e"
          ],
          "display_name": false
        },
        {
          "uuid": "7386bc3a-ad1b-4068-96c7-482f069b2a9f",
          "name": "OSTEN",
          "stdName": "OSTEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a4b0a87-e5e1-4964-bf14-eec9d387c277",
            "3a420ffc-897e-4d5a-be7c-637a0d107fe1"
          ],
          "display_name": false
        },
        {
          "uuid": "6ea6391f-2898-4119-b284-6cd256c95ef5",
          "name": "OSTIVONE",
          "stdName": "OSTIVONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "229a0550-e8bb-4b3e-b19d-376bc7fb4d18",
            "b6e5bc43-be68-4b2f-b6d0-bb786f3d57b3"
          ],
          "display_name": false
        },
        {
          "uuid": "8183ea1c-1d4d-4c90-b38b-4911332c2bf3",
          "name": "ipriflavone [INN]",
          "stdName": "IPRIFLAVONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe5ff2f8-c588-4d56-968c-dcb72084421d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7d0c9c9b-f514-4955-a45e-4c5af288654b",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "eb7adfbd-b964-495b-aa02-6e565c65e34a",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe5ff2f8-c588-4d56-968c-dcb72084421d",
          "citation": "INN Proposed List 31",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL31.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3a420ffc-897e-4d5a-be7c-637a0d107fe1",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6e5bc43-be68-4b2f-b6d0-bb786f3d57b3",
          "citation": "KEGG",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec933596-36d0-4898-b7b6-be869a8bb680",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca66f9e8-d7c5-48e1-8ca7-85cbfdc4109f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a4b0a87-e5e1-4964-bf14-eec9d387c277",
          "citation": "D01338",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9bf67e5-96b2-4d2f-ba7c-c3091f546b70",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6e44bcd-44c0-425c-b4c0-61839465be1a",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "229a0550-e8bb-4b3e-b19d-376bc7fb4d18",
          "citation": "http://www.vitabase.com/articles/joint-bone-health/ostivone-bone-health.aspx",
          "url": "http://www.vitabase.com/articles/joint-bone-health/ostivone-bone-health.aspx",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29031992-5d63-4a9c-8caf-b931e0bf889f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390479000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93cfe6e7-b069-4720-8456-14670252be09",
          "citation": "SRS import [80BJ7WN25Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=80BJ7WN25Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390479000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d43081da-ff1e-4723-93a4-9bb95893f393",
          "citation": "IPRIFLAVONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "567d0d9a-2d2f-4902-978b-8ccaa6d1474b",
          "citation": "IPRIFLAVONE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "abce046b-8a3b-4a0d-a330-b5cba60a7f87",
          "citation": "IPRIFLAVONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b720b748-1b72-4012-8885-7bd2cbb90be6",
          "citation": "IPRIFLAVONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f31d868f-1108-4270-b347-fe0b34ff2769",
          "citation": "IPRIFLAVONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2a601c2d-b3e5-4ac8-a6c6-edd7d2e4094a",
          "citation": "IPRIFLAVONE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ee948190-0d77-9def-f469-693580e97f82",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=35212-22-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "600b7411-e656-5e53-6132-312502b56d3c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f88da739-3932-40ed-8141-cc0b11ec4cd5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dbc16f39-3567-5f73-7580-59270fa14c3e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5dd351f2-67f6-4370-8e6d-882033f595d0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0661336e-b678-44f9-8b38-e67ad200ef77",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "047ebb92-064d-287c-d54e-70b546e0b42c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "4e29a740-053e-e3a8-53c4-850580f5f476",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0d05d6a0-6aa6-4bf2-92c7-70cd65989cc1",
          "id": "0d05d6a0-6aa6-4bf2-92c7-70cd65989cc1",
          "molfile": "\n  Marvin  01132100552D          \n\n 21 23  0  0  0  0            999 V2000\n    0.0000   -2.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7060   -2.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6982   -1.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4197   -2.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1334   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1334   -1.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8472   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5609   -1.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5609   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8472   -2.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2746   -2.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9884   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9884   -1.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7047   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7047   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4184    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1373   -0.3983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1373   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4184   -1.6395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2746   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2746   -0.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 20  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 20 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  2  0  0  0  0\nM  END",
          "smiles": "CC(C)Oc1ccc2c(c1)occ(-c3ccccc3)c2=O",
          "formula": "C18H16O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0eb3ac94-9bf2-40f9-b098-48f456406cc0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "280.3185",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bd052533-3092-4dab-a9ad-b2b0de75ef50",
      "version": "17",
      "structure": {
        "id": "f12736c5-7b2a-4af1-a15e-3218eabd9c4e",
        "molfile": "\n  Marvin  01132112312D          \n\n 21 23  0  0  0  0            999 V2000\n    4.9884   -1.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2746   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5609   -1.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9884   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5609   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2746   -2.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8472   -2.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8472   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7047   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2746   -0.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1334   -2.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4197   -2.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1334   -1.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7060   -2.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4184   -1.6395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7047   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6982   -1.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4184    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1373   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1373   -0.3983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  3  2  0  0  0  0\n  9  1  1  0  0  0  0\n 10  2  2  0  0  0  0\n 11  7  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15  9  2  0  0  0  0\n 16  9  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 14  1  0  0  0  0\n 19 16  2  0  0  0  0\n 20 15  1  0  0  0  0\n 21 19  1  0  0  0  0\n  5  3  1  0  0  0  0\n 21 20  2  0  0  0  0\n 13 11  2  0  0  0  0\nM  END",
        "smiles": "CC(C)Oc1ccc2c(c1)occ(-c3ccccc3)c2=O",
        "formula": "C18H16O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "280.3185",
        "optical_activity": "NONE",
        "references": [
          "7d0c9c9b-f514-4955-a45e-4c5af288654b",
          "93cfe6e7-b069-4720-8456-14670252be09",
          "fe5ff2f8-c588-4d56-968c-dcb72084421d"
        ],
        "stereo_centers": 0
      },
      "unii": "80BJ7WN25Z"
    }
  ]
}