{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "715aa23d-7598-49de-a54c-ccdc48e27792",
          "code": "INS-1504(II)",
          "comments": "Codex Alimentarius|Functional Classification|Carrier",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=412",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "fbe1433a-a831-43e5-8c50-d7a6b0518fce"
          ]
        },
        {
          "uuid": "4e7920d1-6609-442a-b833-e3315cdc5b47",
          "code": "INS-1504(II)",
          "comments": "JECFA Evaluation|Functional Classification|CARRIER|STABILIZER",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=5637",
          "code_system": "JECFA EVALUATION",
          "references": [
            "fbe1433a-a831-43e5-8c50-d7a6b0518fce"
          ]
        },
        {
          "uuid": "248ed68f-16ed-477d-891b-64b19df59f83",
          "code": "INS-1504(I)",
          "comments": "Codex Alimentarius|Functional Classification|Carrier|Glazing agent",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=411",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "fbe1433a-a831-43e5-8c50-d7a6b0518fce"
          ]
        },
        {
          "uuid": "893aa77a-1114-4605-997b-751f7067cbd8",
          "code": "INS-1504(I)",
          "comments": "JECFA Evaluation|Functional Classification|Carrier|Glazing agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=5636",
          "code_system": "JECFA EVALUATION",
          "references": [
            "fbe1433a-a831-43e5-8c50-d7a6b0518fce"
          ]
        },
        {
          "uuid": "5a37f6c6-ebab-4151-a29d-d5ccf9369dec",
          "code": "159640-28-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=159640-28-5",
          "code_system": "CAS",
          "references": [
            "fbe1433a-a831-43e5-8c50-d7a6b0518fce",
            "5cf0598e-4227-452f-9e8f-7ae24a987aac"
          ]
        },
        {
          "uuid": "53624454-d25a-46ba-b45b-6eaba2d38848",
          "code": "11686063",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11686063",
          "code_system": "PUBCHEM",
          "references": [
            "fbe1433a-a831-43e5-8c50-d7a6b0518fce"
          ]
        },
        {
          "uuid": "b26c2949-0c75-ce4c-34c3-566e188a0106",
          "code": "DTXSID70166703",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70166703",
          "code_system": "EPA CompTox",
          "references": [
            "bd331334-781c-4d80-5162-67ec3ee772e1"
          ]
        },
        {
          "uuid": "fb56e62e-eb56-4ed9-955d-3aef1b1fb456",
          "code": "80AS740C52",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "37e8905c-3a2c-4433-ba63-30803aa232d4",
          "name": ".ALPHA.-D-GLUCOPYRANOSE, O-.ALPHA.-D-GLUCOPYRANOSYL-(1-3)-O-.ALPHA.-D-GLUCOPYRANOSYL-(1-6)-O-.ALPHA.-D-GLUCOPYRANOSYL-(1-3)-, CYCLIC 1,6'''-ANHYDRIDE",
          "stdName": ".ALPHA.-D-GLUCOPYRANOSE, O-.ALPHA.-D-GLUCOPYRANOSYL-(1-3)-O-.ALPHA.-D-GLUCOPYRANOSYL-(1-6)-O-.ALPHA.-D-GLUCOPYRANOSYL-(1-3)-, CYCLIC 1,6'''-ANHYDRIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "659ff039-aaa5-4a79-a8b4-95678e9d25b2",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "bf0780e0-fcda-4e6b-95dc-af6c895a51dd",
          "name": "CT-11",
          "stdName": "CT-11",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "099e6c21-c0c8-42cb-834b-00f7f18ddbba",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "7c1a175c-0304-4556-9a3d-49ac769dccc5",
          "name": "CYCLIC NIGEROSYL-(1->6)-NIGEROSE",
          "stdName": "CYCLIC NIGEROSYL-(1->6)-NIGEROSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "0bada165-ea9a-4507-bff9-5cfeb792e5e8",
          "name": "CYCLIC NIGEROSYL-(1->6)-NIGEROSE SYRUP",
          "stdName": "CYCLIC NIGEROSYL-(1->6)-NIGEROSE SYRUP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "b57fe897-73a7-4162-8f73-e55a2568f7e6",
          "name": "CYCLIC NIGEROSYLNIGEROSE",
          "stdName": "CYCLIC NIGEROSYLNIGEROSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "659ff039-aaa5-4a79-a8b4-95678e9d25b2",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "947401cd-1d1a-4fc7-af27-39f07d948241",
          "name": "CYCLOALTERNAN",
          "stdName": "CYCLOALTERNAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "9ec7baca-dd9e-461e-830b-056b1ffa9747",
          "name": "CYCLOALTERNAN SYRUP",
          "stdName": "CYCLOALTERNAN SYRUP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "c1b5cbcf-daa0-4fd9-958c-5d957da8855b",
          "name": "CYCLOALTERNANOTETRAOSE",
          "stdName": "CYCLOALTERNANOTETRAOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "6e675db6-1ddc-4470-8078-2acea47f6230",
          "name": "CYCLOALTERNANOTETRAOSE SYRUP",
          "stdName": "CYCLOALTERNANOTETRAOSE SYRUP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "f60a835b-4515-432b-b78f-7816cd1403af",
          "name": "CYCLOTETRAGLUCOSE",
          "stdName": "CYCLOTETRAGLUCOSE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "099e6c21-c0c8-42cb-834b-00f7f18ddbba",
            "7c134e4f-43d6-4030-83e5-8def7aa15b9d",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3d082fb9-e65e-435d-8212-b431a98a714b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a00e34d5-7ac8-49a4-b99f-69d88af02235",
          "name": "CYCLOTETRAGLUCOSE SYRUP",
          "stdName": "CYCLOTETRAGLUCOSE SYRUP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "b9d32718-54e2-4aaa-87d2-b5b544601906",
          "name": "CYCLOTETRAOSE",
          "stdName": "CYCLOTETRAOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "06ff7f2a-e2d3-4d71-aa77-acf797100730",
          "name": "E-1504(I)",
          "stdName": "E-1504(I)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "b87bcc2b-778d-4be7-8f86-8cce26aabfe0",
          "name": "E-1504(II)",
          "stdName": "E-1504(II)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "d5481430-0fef-4a83-a108-96290af7c59e",
          "name": "INS NO.1504(I)",
          "stdName": "INS NO.1504(I)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "ae2860e7-7254-4d71-bfcf-89e6260c321b",
          "name": "INS NO.1504(II)",
          "stdName": "INS NO.1504(II)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "407b6523-d47b-4baa-b302-8ff0292d008e",
          "name": "INS-1504(I)",
          "stdName": "INS-1504(I)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        },
        {
          "uuid": "b742cee9-d1bd-4876-8651-46091d781355",
          "name": "INS-1504(II)",
          "stdName": "INS-1504(II)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383b64-2974-442f-a069-79e8ecf670d1",
            "2c83bd71-a5eb-46b0-9382-75076d7e1800"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "099e6c21-c0c8-42cb-834b-00f7f18ddbba",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2c83bd71-a5eb-46b0-9382-75076d7e1800",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "659ff039-aaa5-4a79-a8b4-95678e9d25b2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33383b64-2974-442f-a069-79e8ecf670d1",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fbe1433a-a831-43e5-8c50-d7a6b0518fce",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391927000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f432b54b-21b5-4545-a78f-0e9ee6980646",
          "citation": "SRS import [80AS740C52]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=80AS740C52",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391927000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c134e4f-43d6-4030-83e5-8def7aa15b9d",
          "citation": "CYCLOTETRAGLUCOSE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bd331334-781c-4d80-5162-67ec3ee772e1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=159640-28-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5cf0598e-4227-452f-9e8f-7ae24a987aac",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4b6c002c-417d-4892-9605-73860ada0b19",
          "id": "4b6c002c-417d-4892-9605-73860ada0b19",
          "molfile": "\n  Marvin  01132103562D          \n\n 44 48  0  0  1  0            999 V2000\n   10.4871   -7.6389    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.5769   -8.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3321   -8.7912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7391   -7.2909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5025   -6.4885    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.7863   -6.0828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9613   -6.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2486   -6.4985    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.5324   -6.0891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7489   -6.3475    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.2611   -5.6822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7431   -5.0126    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.6019   -4.1998    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.8335   -3.8995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2568   -3.6982    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.1670   -2.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4118   -2.5459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0048   -4.0461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2414   -4.8485    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.9577   -5.2578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7827   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4953   -4.8386    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.2116   -5.2479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9951   -4.9895    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.4829   -5.6548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0009   -6.3244    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   11.1421   -7.1372    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.9104   -7.4375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2152   -6.0729    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.9290   -5.5584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9305   -4.1555    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.6538   -3.7589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2712   -3.6596    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.3538   -2.8388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4953   -4.0142    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.8371   -3.5607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5288   -5.2641    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.7714   -5.7786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8135   -7.1815    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.0902   -7.5782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4728   -7.6774    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.3902   -8.4982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2486   -7.3228    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.9069   -7.7764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 27  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5  4  1  6  0  0  0\n  5  6  1  0  0  0  0\n 29  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  6  0  0  0\n 43  8  1  0  0  0  0\n 10  9  1  1  0  0  0\n 10 11  1  0  0  0  0\n 39 10  1  0  0  0  0\n 12 11  1  1  0  0  0\n 12 13  1  0  0  0  0\n 37 12  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  1  0  0  0\n 15 18  1  0  0  0  0\n 16 17  1  0  0  0  0\n 19 18  1  6  0  0  0\n 19 20  1  0  0  0  0\n 19 37  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  6  0  0  0\n 22 35  1  0  0  0  0\n 24 23  1  1  0  0  0\n 24 25  1  0  0  0  0\n 31 24  1  0  0  0  0\n 26 25  1  1  0  0  0\n 26 27  1  0  0  0  0\n 29 26  1  0  0  0  0\n 27 28  1  6  0  0  0\n 29 30  1  6  0  0  0\n 31 32  1  1  0  0  0\n 33 31  1  0  0  0  0\n 33 34  1  6  0  0  0\n 35 33  1  0  0  0  0\n 35 36  1  1  0  0  0\n 37 38  1  6  0  0  0\n 39 40  1  1  0  0  0\n 41 39  1  0  0  0  0\n 41 42  1  6  0  0  0\n 41 43  1  0  0  0  0\n 43 44  1  1  0  0  0\nM  END",
          "smiles": "C([C@@H]1[C@H]([C@H]2[C@H]([C@@H](OC[C@@H]3[C@H]([C@@H]([C@H]([C@H](O3)O[C@H]4[C@@H]([C@@H](CO)O[C@@H]([C@@H]4O)OC[C@@H]5[C@H]([C@@H]([C@H]([C@H](O5)O2)O)O)O)O)O)O)O)O1)O)O)O",
          "formula": "C24H40O20",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b0f2ee3a-4606-45ab-98a5-571bf9a498a4"
          },
          "defined_stereo": 20,
          "ez_centers": 0,
          "molecular_weight": "648.5634",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 20
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "80989b84-2c7e-44c2-8b31-3b52717bcc72",
      "version": "6",
      "structure": {
        "id": "c3a0c04b-3cb7-4198-9495-05475c661862",
        "molfile": "\n  Marvin  01132110072D          \n\n 44 48  0  0  1  0            999 V2000\n    8.7827   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9577   -5.2578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2414   -4.8485    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.5288   -5.2641    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.7714   -5.7786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7431   -5.0126    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.2611   -5.6822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7489   -6.3475    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.8135   -7.1815    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4728   -7.6774    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.2486   -7.3228    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.2486   -6.4985    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.9613   -6.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7863   -6.0828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5025   -6.4885    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.7391   -7.2909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4871   -7.6389    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.5769   -8.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3321   -8.7912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1421   -7.1372    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.9104   -7.4375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0009   -6.3244    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.4829   -5.6548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9951   -4.9895    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.2116   -5.2479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4953   -4.8386    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.4953   -4.0142    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.2712   -3.6596    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.9305   -4.1555    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.6538   -3.7589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3538   -2.8388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8371   -3.5607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2152   -6.0729    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.9290   -5.5584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5324   -6.0891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9069   -7.7764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3902   -8.4982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0902   -7.5782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6019   -4.1998    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.8335   -3.8995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2568   -3.6982    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0048   -4.0461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1670   -2.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4118   -2.5459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  6  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  7  1  1  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  6  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  6  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 18 19  1  0  0  0  0\n 20 17  1  0  0  0  0\n 20 21  1  6  0  0  0\n 22 20  1  0  0  0  0\n 22 23  1  1  0  0  0\n 24 23  1  1  0  0  0\n 24 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26  1  1  6  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 29 24  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  1  0  0  0\n 28 31  1  6  0  0  0\n 27 32  1  1  0  0  0\n 33 22  1  0  0  0  0\n 15 33  1  0  0  0  0\n 33 34  1  6  0  0  0\n  8 35  1  0  0  0  0\n 12 35  1  0  0  0  0\n 11 36  1  1  0  0  0\n 10 37  1  6  0  0  0\n  9 38  1  1  0  0  0\n  6 39  1  0  0  0  0\n 39 40  1  6  0  0  0\n 39 41  1  0  0  0  0\n 41 42  1  0  0  0  0\n  3 42  1  0  0  0  0\n 41 43  1  1  0  0  0\n 43 44  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]1[C@H]([C@H]2[C@H]([C@@H](OC[C@@H]3[C@H]([C@@H]([C@H]([C@H](O3)O[C@H]4[C@@H]([C@@H](CO)O[C@@H]([C@@H]4O)OC[C@@H]5[C@H]([C@@H]([C@H]([C@H](O5)O2)O)O)O)O)O)O)O)O1)O)O)O",
        "formula": "C24H40O20",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 20,
        "ez_centers": 0,
        "molecular_weight": "648.5634",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "659ff039-aaa5-4a79-a8b4-95678e9d25b2",
          "f432b54b-21b5-4545-a78f-0e9ee6980646"
        ],
        "stereo_centers": 20
      },
      "unii": "80AS740C52"
    }
  ]
}