{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f65f7b33-a48a-446b-a8be-f84e9c2dfb11",
          "code": "56265-06-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=56265-06-6",
          "code_system": "CAS",
          "references": [
            "48b951f3-04c9-4265-b895-ab24180f1c77",
            "80e47398-c40a-4be5-b536-631882a131cd"
          ]
        },
        {
          "uuid": "b88b01fa-23be-4f91-abfc-1cd98b76dbb8",
          "code": "1482633",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1482633/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "48b951f3-04c9-4265-b895-ab24180f1c77"
          ]
        },
        {
          "uuid": "d511505b-6aab-4ff0-814e-5962931b1d4e",
          "code": "SUB23582",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "48b951f3-04c9-4265-b895-ab24180f1c77"
          ]
        },
        {
          "uuid": "6c8a5f7d-ef92-4515-9ffb-b697bb5a3a9b",
          "code": "260-081-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.054.601",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "48b951f3-04c9-4265-b895-ab24180f1c77"
          ]
        },
        {
          "uuid": "f5d00c8f-8aad-4d36-9965-f501e135239b",
          "code": "198346",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/198346",
          "code_system": "PUBCHEM",
          "references": [
            "48b951f3-04c9-4265-b895-ab24180f1c77"
          ]
        },
        {
          "uuid": "76a0c122-228d-a0c1-b50a-753a3117dca6",
          "code": "L-Arginine L-pyroglutamate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/L-Arginine_L-pyroglutamate",
          "code_system": "WIKIPEDIA",
          "references": [
            "9ea6fb5a-fd81-1355-2431-f92466f1a6d6"
          ]
        },
        {
          "uuid": "94806245-0586-53ab-9a45-c0deaae9a928",
          "code": "3271 (Number of products:37)",
          "comments": "Dietary Supplement Label Database|chemical|Arginine pyroglutamate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3271&item=Arginine pyroglutamate",
          "code_system": "DSLD",
          "references": [
            "cbbb5508-0b7e-8748-5b21-43744b209f98"
          ]
        },
        {
          "uuid": "67ed9b8e-90d5-46b4-a02e-0fc09c7b86d1",
          "code": "808T94CEU6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "615f61a6-ffc1-d87d-71a7-424e254b8bc8",
          "code": "100000089102",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7401bf6f-5cae-59bc-7d40-67e6c28a68a1"
          ]
        },
        {
          "uuid": "1476904c-dc77-98d5-90e7-6e990f50e8d9",
          "code": "808T94CEU6",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=808T94CEU6",
          "code_system": "DAILYMED",
          "references": [
            "682074f7-49b7-0a82-3b32-4938da25d72b"
          ]
        },
        {
          "uuid": "99555691-9978-94fe-fda4-501fe0d191e6",
          "code": "DTXSID50971695",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50971695",
          "code_system": "EPA CompTox",
          "references": [
            "cbbb5508-0b7e-8748-5b21-43744b209f98"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "edcbbab3-9628-4ceb-9b42-e49ccfddf9a5",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a6bb7e7d-1472-4625-8cdd-0fa5157c75e7",
            "refuuid": "24d940bc-1e16-44c1-841a-40740861e06f",
            "name": "ARGININE",
            "unii": "94ZLA3W45F",
            "linking_id": "94ZLA3W45F",
            "ref_pname": "ARGININE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "20af15c3-6622-41f7-8d4c-81d9e887253f",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "6d14e64d-334b-480c-81de-68d3e0e55bfe",
            "refuuid": "24d940bc-1e16-44c1-841a-40740861e06f",
            "name": "ARGININE",
            "unii": "94ZLA3W45F",
            "linking_id": "94ZLA3W45F",
            "ref_pname": "ARGININE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6ac5e349-e64f-4a8e-b91d-6e4054cb45c2",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "ff3989b7-baaa-4416-bc6a-884de9f714af",
            "refuuid": "b4015ea9-cdb5-43db-87a3-91407212b35b",
            "name": "PIDOLIC ACID",
            "unii": "SZB83O1W42",
            "linking_id": "SZB83O1W42",
            "ref_pname": "PIDOLIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9fb8a3b7-4e09-46d6-a434-49a7a015458d",
          "name": "ARGIDONE",
          "stdName": "ARGIDONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "686684ec-5af9-48fa-ad33-df9914c37c8d",
            "e974c6bb-c85a-49dd-ac16-23b983225e98"
          ],
          "display_name": false
        },
        {
          "uuid": "466bd8aa-b8e5-46f0-bc9d-6035148e8db8",
          "name": "ARGININE L-PYROGLUTAMATE",
          "stdName": "ARGININE L-PYROGLUTAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "686684ec-5af9-48fa-ad33-df9914c37c8d",
            "94c42a73-b2ce-4e24-8c94-c3fc2fa5f07e"
          ],
          "display_name": false
        },
        {
          "uuid": "0ccae6cb-c914-4ac1-b6e0-7b20056ff2ad",
          "name": "ARGININE PCA",
          "stdName": "ARGININE PCA",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "686684ec-5af9-48fa-ad33-df9914c37c8d",
            "2f7dde12-07d7-4a76-9919-e56c6ad3e376",
            "cd69774d-240d-4ffd-8840-1d3abd08379f",
            "e974c6bb-c85a-49dd-ac16-23b983225e98"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "77ef4ad4-26f5-4e5f-b63f-332c6ce43c0d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5a622d46-d009-4346-a7c6-f7da59e33ca6",
          "name": "ARGININE PIDOLATE",
          "stdName": "ARGININE PIDOLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "686684ec-5af9-48fa-ad33-df9914c37c8d",
            "ee1aa9d8-41ca-4009-826e-193895385a97"
          ],
          "display_name": true
        },
        {
          "uuid": "8c58f7bb-c595-4ead-adeb-7875bd7b9c76",
          "name": "ARGININE PYROGLUTAMATE",
          "stdName": "ARGININE PYROGLUTAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "686684ec-5af9-48fa-ad33-df9914c37c8d",
            "2f7dde12-07d7-4a76-9919-e56c6ad3e376",
            "09a6362d-c75c-425f-b347-c0094e08de05",
            "2c730232-2f09-4c27-a2e7-80d9dc52763d"
          ],
          "display_name": false
        },
        {
          "uuid": "fd540fcc-dd06-8ee5-a4b6-9c9a4cfbe494",
          "name": "Arginine pyroglutamate [WHO-DD]",
          "stdName": "ARGININE PYROGLUTAMATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0233dde3-1319-ecd8-8756-aaba584b338b"
          ],
          "display_name": false
        },
        {
          "uuid": "81cde67c-61d5-4029-91c9-e6a6e52d4277",
          "name": "L-ARGININE L-2 PYRROLIDONE-5-CARBOXYLATE",
          "stdName": "L-ARGININE L-2 PYRROLIDONE-5-CARBOXYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "686684ec-5af9-48fa-ad33-df9914c37c8d",
            "a7319057-7dd4-472f-a733-e0bfdd0510ac"
          ],
          "display_name": false
        },
        {
          "uuid": "f6d63115-c685-40b3-9d5c-12d22a2e0f7a",
          "name": "L-PROLINE, 5-OXO-, COMPD. WITH L-ARGININE (1:1)",
          "stdName": "L-PROLINE, 5-OXO-, COMPD. WITH L-ARGININE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "686684ec-5af9-48fa-ad33-df9914c37c8d",
            "2f7dde12-07d7-4a76-9919-e56c6ad3e376"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2f7dde12-07d7-4a76-9919-e56c6ad3e376",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "686684ec-5af9-48fa-ad33-df9914c37c8d",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7319057-7dd4-472f-a733-e0bfdd0510ac",
          "citation": "EVMPD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94c42a73-b2ce-4e24-8c94-c3fc2fa5f07e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09a6362d-c75c-425f-b347-c0094e08de05",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e974c6bb-c85a-49dd-ac16-23b983225e98",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee1aa9d8-41ca-4009-826e-193895385a97",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48b951f3-04c9-4265-b895-ab24180f1c77",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391121000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd309948-ed24-405f-a9d6-135dd28af5ac",
          "citation": "SRS import [808T94CEU6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=808T94CEU6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391121000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c730232-2f09-4c27-a2e7-80d9dc52763d",
          "citation": "ARGININE PYROGLUTAMATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd69774d-240d-4ffd-8840-1d3abd08379f",
          "citation": "ARGININE PCA [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ea6fb5a-fd81-1355-2431-f92466f1a6d6",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/L-Arginine_L-pyroglutamate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cbbb5508-0b7e-8748-5b21-43744b209f98",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "80e47398-c40a-4be5-b536-631882a131cd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "682074f7-49b7-0a82-3b32-4938da25d72b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "0233dde3-1319-ecd8-8756-aaba584b338b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7401bf6f-5cae-59bc-7d40-67e6c28a68a1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "627641c2-a2d5-4446-abaa-60ba1788df0c",
          "id": "627641c2-a2d5-4446-abaa-60ba1788df0c",
          "molfile": "\n  Marvin  01132105062D          \n\n  9  9  0  0  1  0            999 V2000\n   13.9207   -3.9387    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   13.1603   -3.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6318   -4.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0493   -4.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6367   -5.6529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8550   -4.7608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6272   -3.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6272   -2.6645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3389   -3.9298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  1  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\nM  END",
          "smiles": "C1CC(=O)N[C@@H]1C(=O)O",
          "formula": "C5H7NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7bfe6ebf-e778-452b-ae64-a52cbddac706"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "129.1142",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "40404737-3726-476d-80dc-04ea8bb74adc",
          "id": "40404737-3726-476d-80dc-04ea8bb74adc",
          "molfile": "\n  Marvin  01132103242D          \n\n 12 11  0  0  1  0            999 V2000\n    7.4883   -6.5020    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.4883   -7.3243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7716   -6.0864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0597   -6.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3475   -6.0864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6309   -6.5020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9186   -6.0864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9186   -5.2641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2048   -6.5020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2052   -6.0864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2052   -5.2613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9197   -6.4988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  1 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
          "smiles": "C(C[C@@H](C(=O)O)N)CNC(=N)N",
          "formula": "C6H14N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5574919c-ecd8-494e-b2e1-22ef96b1310e"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "174.2012",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1f01e7d3-1f48-435c-b88b-75b2f23f2931",
      "version": "11",
      "structure": {
        "id": "754d73d7-3575-4bde-8bc5-adbdce9c2923",
        "molfile": "\n  Marvin  01132106052D          \n\n 21 20  0  0  1  0            999 V2000\n    7.4883   -7.3243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4883   -6.5020    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2052   -6.0864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2052   -5.2613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9197   -6.4988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7716   -6.0864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0597   -6.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3475   -6.0864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6309   -6.5020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9186   -6.0864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9186   -5.2641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2048   -6.5020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8550   -4.7608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0493   -4.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6318   -4.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1603   -3.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9207   -3.9387    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.6272   -3.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6272   -2.6645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3389   -3.9298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6367   -5.6529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  2  6  1  1  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 17 13  1  0  0  0  0\n 14 21  2  0  0  0  0\nM  END",
        "smiles": "C(C[C@@H](C(=O)O)N)CNC(=N)N.C1CC(=O)N[C@@H]1C(=O)O",
        "formula": "C6H14N4O2.C5H7NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "303.3154",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bd309948-ed24-405f-a9d6-135dd28af5ac",
          "2f7dde12-07d7-4a76-9919-e56c6ad3e376"
        ],
        "stereo_centers": 2
      },
      "unii": "808T94CEU6"
    }
  ]
}