{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f7bcd959-97ab-4946-a445-457f168cd7ed",
          "code": "10254-57-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10254-57-6",
          "code_system": "CAS",
          "references": [
            "da010f67-cdd8-4440-a73d-c1a18355c235",
            "2a8f98c7-f8c9-46ad-8c77-51d12f9cce52"
          ]
        },
        {
          "uuid": "1ae8e40a-f08c-4424-9bd7-44d978da1e4d",
          "code": "FCN NO. 816",
          "comments": "FCN|ANTIOXIDANT|LUBRICANTS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=816",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "da010f67-cdd8-4440-a73d-c1a18355c235"
          ]
        },
        {
          "uuid": "90aa83b7-afbc-49b8-b6ed-04dc1dcb2752",
          "code": "233-593-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.526",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "da010f67-cdd8-4440-a73d-c1a18355c235"
          ]
        },
        {
          "uuid": "a5165aaa-1df3-4188-a564-69f07fc1a584",
          "code": "82496",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82496",
          "code_system": "PUBCHEM",
          "references": [
            "da010f67-cdd8-4440-a73d-c1a18355c235"
          ]
        },
        {
          "uuid": "c8fa306a-2aae-31a5-0f47-8a171b6656bc",
          "code": "DTXSID5029718",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5029718",
          "code_system": "EPA CompTox",
          "references": [
            "adf806c3-ba3e-3bc9-3444-52f6e6d1fb19"
          ]
        },
        {
          "uuid": "8302bbe0-102b-4664-a470-30bd201d4e5b",
          "code": "8074XM58IX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "94fdbe4f-a6ad-762c-7129-4994e6bfffbb",
          "code": "Methylenebis(dibutyldithiocarbamate)",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Methylenebis(dibutyldithiocarbamate)",
          "code_system": "WIKIPEDIA",
          "references": [
            "ad9578ba-1fad-fabe-2366-3cb710974495"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1b3d4a95-9564-44dd-8c7c-48d587ef20f7",
          "name": "4,4'-METHYLENE BIS(DIBUTYLDITHIOCARBAMATE)",
          "stdName": "4,4'-METHYLENE BIS(DIBUTYLDITHIOCARBAMATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db7273e3-291b-46fa-8fa7-6df6efceb54f"
          ],
          "display_name": false
        },
        {
          "uuid": "b6deef28-56c6-4139-81d6-82dde1b8f2b6",
          "name": "BIS(DI-N-BUTYLTHIOCARBAMOYLTHIO)METHANE",
          "stdName": "BIS(DI-N-BUTYLTHIOCARBAMOYLTHIO)METHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db7273e3-291b-46fa-8fa7-6df6efceb54f"
          ],
          "display_name": false
        },
        {
          "uuid": "9ae9c1ff-21c3-4f03-a865-7fcdc8caec77",
          "name": "CARBAMODITHIOIC ACID, DIBUTYL-, METHYLENE ESTER",
          "stdName": "CARBAMODITHIOIC ACID, DIBUTYL-, METHYLENE ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db7273e3-291b-46fa-8fa7-6df6efceb54f"
          ],
          "display_name": false
        },
        {
          "uuid": "814e9f78-073c-4cc8-85b4-31b17bb92596",
          "name": "CARBAMODITHIOIC ACID, N,N-DIBUTYL-, C,C'-METHYLENE ESTER",
          "stdName": "CARBAMODITHIOIC ACID, N,N-DIBUTYL-, C,C'-METHYLENE ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db7273e3-291b-46fa-8fa7-6df6efceb54f"
          ],
          "display_name": false
        },
        {
          "uuid": "75a7ea8e-a4bc-4def-8d70-a3d0cdec5652",
          "name": "DIBUTYL-CARBAMODITHIOIC ACID, METHYLENE ESTER",
          "stdName": "DIBUTYL-CARBAMODITHIOIC ACID, METHYLENE ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7358f477-4403-4ce0-966d-20c58fd40931"
          ],
          "display_name": true
        },
        {
          "uuid": "439f62be-d322-4c72-8f72-596ac45c771c",
          "name": "METHYLENE DIBUTYLDITHIOCARBAMATE",
          "stdName": "METHYLENE DIBUTYLDITHIOCARBAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db7273e3-291b-46fa-8fa7-6df6efceb54f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7358f477-4403-4ce0-966d-20c58fd40931",
          "citation": "CEDI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "db7273e3-291b-46fa-8fa7-6df6efceb54f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da010f67-cdd8-4440-a73d-c1a18355c235",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390315000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98d37d82-f103-495c-95d2-9d689f57fd38",
          "citation": "SRS import [8074XM58IX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8074XM58IX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390315000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "adf806c3-ba3e-3bc9-3444-52f6e6d1fb19",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10254-57-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ad9578ba-1fad-fabe-2366-3cb710974495",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "2a8f98c7-f8c9-46ad-8c77-51d12f9cce52",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a257c4cd-c2b4-f750-d9f5-7036375c28c9",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9e8d5475-3144-4a9f-8386-3cb5e560006f",
          "id": "9e8d5475-3144-4a9f-8386-3cb5e560006f",
          "molfile": "\n  Marvin  01132108142D          \n\n 25 24  0  0  0  0            999 V2000\n   -5.0013    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.2868    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5724    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434    0.6188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5724   -1.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    1.8563    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    0.6188    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.6188    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    1.8563    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    0.6188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579   -0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724   -1.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "CCCCN(CCCC)C(=S)SCSC(=S)N(CCCC)CCCC",
          "formula": "C19H38N2S4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "50117e64-3470-48d2-8fb1-fef311ab1e11"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "422.7835",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fe60a043-a03c-47de-948e-e584228788d2",
      "version": "6",
      "structure": {
        "id": "96e23aa2-731b-4b3e-b932-90f41a472cc2",
        "molfile": "\n  Marvin  01132107502D          \n\n 25 24  0  0  0  0            999 V2000\n    0.0000    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    0.6188    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434    0.6188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    1.8563    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5724    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.2868    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0013    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5724   -1.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.6188    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    0.6188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    1.8563    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579   -0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724   -1.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  4  6  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  4 10  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1  2  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 16 18  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 16 22  1  0  0  0  0\n 14 15  1  0  0  0  0\n  1 14  1  0  0  0  0\nM  END",
        "smiles": "CCCCN(CCCC)C(=S)SCSC(=S)N(CCCC)CCCC",
        "formula": "C19H38N2S4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "422.7835",
        "optical_activity": "NONE",
        "references": [
          "98d37d82-f103-495c-95d2-9d689f57fd38",
          "db7273e3-291b-46fa-8fa7-6df6efceb54f"
        ],
        "stereo_centers": 0
      },
      "unii": "8074XM58IX"
    }
  ]
}