{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fe08a0f5-79e7-4ca1-8f20-d07678289d15",
          "code": "3081-61-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3081-61-6",
          "code_system": "CAS",
          "references": [
            "0fbf9313-81e0-4c6a-b34c-003a23bcd3d7",
            "744c12d1-10b2-41c3-90ab-8959ec9bf22d"
          ]
        },
        {
          "uuid": "442bc65a-cd94-4c0a-9787-ce94a5d13384",
          "code": "C87348",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87348",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0fbf9313-81e0-4c6a-b34c-003a23bcd3d7"
          ]
        },
        {
          "uuid": "40284409-21dc-478b-b6a6-a64ca280f617",
          "code": "C026166",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67026166",
          "code_system": "MESH",
          "references": [
            "0fbf9313-81e0-4c6a-b34c-003a23bcd3d7"
          ]
        },
        {
          "uuid": "903ef1d4-37b0-4891-8260-ad4d287ca3fb",
          "code": "THEANINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Theanine",
          "code_system": "WIKIPEDIA",
          "references": [
            "0fbf9313-81e0-4c6a-b34c-003a23bcd3d7"
          ]
        },
        {
          "uuid": "65ab755a-8339-4091-83bf-246f18facab8",
          "code": "38022",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/38022/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0fbf9313-81e0-4c6a-b34c-003a23bcd3d7"
          ]
        },
        {
          "uuid": "bfcb5526-288c-4d32-b01b-14e860687a95",
          "code": "m10694",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10694?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0fbf9313-81e0-4c6a-b34c-003a23bcd3d7"
          ]
        },
        {
          "uuid": "b8cfd14e-71e8-4aed-a4cc-89d0a462f910",
          "code": "SUB33407",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0fbf9313-81e0-4c6a-b34c-003a23bcd3d7"
          ]
        },
        {
          "uuid": "ddd65264-1779-44df-9b27-f2c747b6530f",
          "code": "SUB33692",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0fbf9313-81e0-4c6a-b34c-003a23bcd3d7"
          ]
        },
        {
          "uuid": "e87635af-1b5e-4269-9945-895f55fb5ea5",
          "code": "439378",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439378",
          "code_system": "PUBCHEM",
          "references": [
            "0fbf9313-81e0-4c6a-b34c-003a23bcd3d7"
          ]
        },
        {
          "uuid": "2e453978-219e-46b5-8c18-320d358c2e79",
          "code": "221-379-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.436",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0fbf9313-81e0-4c6a-b34c-003a23bcd3d7"
          ]
        },
        {
          "uuid": "d9004940-3539-ccc7-12b3-d81f41a19607",
          "code": "8166",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8166",
          "code_system": "HSDB",
          "references": [
            "e24c01b8-c4f3-fb13-1a68-3441bafd6ebe"
          ]
        },
        {
          "uuid": "5f45bc9f-4992-bc7f-c695-748f5100a73f",
          "code": "DTXSID80184817",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80184817",
          "code_system": "EPA CompTox",
          "references": [
            "41325eeb-d455-b9ea-4bc8-11037eae63ac"
          ]
        },
        {
          "uuid": "6cee1d09-595f-8777-c59d-00de8b8d1bf0",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4e3857f3-09a5-07fc-3e8f-e85903fad116"
          ]
        },
        {
          "uuid": "ff355dae-c564-fa9c-c873-03aefdc24959",
          "code": "DB12444",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12444",
          "code_system": "DRUG BANK",
          "references": [
            "4e3857f3-09a5-07fc-3e8f-e85903fad116"
          ]
        },
        {
          "uuid": "df5c2a50-367b-4756-84c2-65d402c7bc42",
          "code": "8021PR16QO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bf65e41b-2aec-411f-7dfd-2a0209fffc4a",
          "code": "607 (Number of products:983)",
          "comments": "Dietary Supplement Label Database|Amino Acid|Theanine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=607&item=Theanine",
          "code_system": "DSLD",
          "references": [
            "4e3857f3-09a5-07fc-3e8f-e85903fad116"
          ]
        },
        {
          "uuid": "f26ccb89-2fda-b47e-d2c6-450adefcfdcf",
          "code": "58128",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58128",
          "code_system": "CHEBI",
          "references": [
            "4e3857f3-09a5-07fc-3e8f-e85903fad116"
          ]
        },
        {
          "uuid": "6b73dd4b-1059-7d05-3d94-b4a846261f43",
          "code": "17394",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17394",
          "code_system": "CHEBI",
          "references": [
            "4e3857f3-09a5-07fc-3e8f-e85903fad116"
          ]
        },
        {
          "uuid": "8ce55ca1-10b3-6dd3-1b2f-62354c378d0c",
          "code": "1652704",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1652704",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "4e3857f3-09a5-07fc-3e8f-e85903fad116"
          ]
        },
        {
          "uuid": "c4445106-e771-14de-1fc6-f15c56152837",
          "code": "8021PR16QO",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8021PR16QO",
          "code_system": "DAILYMED",
          "references": [
            "0f4cd83d-0a9f-3a0e-4826-8e779b42fe44"
          ]
        },
        {
          "uuid": "31f1b659-4376-1143-14e9-f2e165c83c3b",
          "code": "100000126208",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "de393e17-e511-2e89-aa85-286ea7ed40e9"
          ]
        },
        {
          "uuid": "3a40207a-7ad0-31ba-e766-61b2fd5d7119",
          "code": "21308",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=21308",
          "code_system": "NSC",
          "references": [
            "1dd7a64d-7bf5-f1c6-c2ce-b196d75be4f5"
          ]
        },
        {
          "uuid": "cdd2dd3e-b7d9-2444-1dfd-3b3b5aab8633",
          "code": "209",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=209",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "4e3857f3-09a5-07fc-3e8f-e85903fad116"
          ]
        },
        {
          "uuid": "3683fcfe-7292-37ef-83b4-d8cd0603d0e2",
          "code": "338",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=338",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "4e3857f3-09a5-07fc-3e8f-e85903fad116"
          ]
        },
        {
          "uuid": "fbd4c2b7-ff5f-000a-10a2-ae4e6462a852",
          "code": "501",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=501",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "4e3857f3-09a5-07fc-3e8f-e85903fad116"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c93a588a-61f3-413e-91b5-485ef1d87974",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0104a397-cf61-4473-8823-1698ed2de01d",
            "refuuid": "b92e8e47-5633-47ac-820f-868c2dd55ddc",
            "name": "THEANINE",
            "unii": "8021PR16QO",
            "linking_id": "8021PR16QO",
            "ref_pname": "THEANINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8ff1a87d-2e88-4480-bc2d-6b18ee1da80b",
          "amount": {
            "uuid": "9f97b86d-46e6-4515-acf9-de5cf45e87b4"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "3304ec66-6eb7-4e9b-a97d-2ede876b53c5"
          ],
          "related_substance": {
            "uuid": "b6dc7dd7-e466-4c0e-85a8-27f0e4a3d0b6",
            "refuuid": "2cb38c01-b8ee-4205-9724-448d9b9fb8f8",
            "name": "AMPA-SELECTIVE GLUTAMATE RECEPTOR 2",
            "unii": "P6W5IXV8V9",
            "linking_id": "P6W5IXV8V9",
            "ref_pname": "AMPA-SELECTIVE GLUTAMATE RECEPTOR 2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b98233f1-38c1-42d4-9bc6-07d604f33f15",
          "amount": {
            "uuid": "cb2480ff-f5ca-4b36-802d-956ed5b9be61"
          },
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "46229b38-a388-408c-8aec-0be278c9b50f"
          ],
          "related_substance": {
            "uuid": "943ab95e-e944-4926-9c11-906dbd127334",
            "refuuid": "44cfdb9d-f504-42d8-ab9d-ab6eb8eebe03",
            "name": "GREEN TEA LEAF",
            "unii": "W2ZU1RY8B0",
            "linking_id": "W2ZU1RY8B0",
            "ref_pname": "GREEN TEA LEAF",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "febf384b-ee18-4e18-a7ba-76da7bac5efb",
          "name": "L-THEANINE",
          "stdName": "L-THEANINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4dada01b-eb34-43c4-bb67-1648488cb45d",
            "9cc8666b-2e7c-4b3f-bc8a-47a8713ba0d8",
            "52ffbc3d-f435-4f3c-8b5d-a9738c2dd6bc",
            "1a72d1da-886f-4acb-875d-fc5a06ac0fb9"
          ],
          "display_name": false
        },
        {
          "uuid": "436bbb70-614d-45aa-8c13-cc752afb1822",
          "name": "L-THEANINE [USP-RS]",
          "stdName": "L-THEANINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cc8666b-2e7c-4b3f-bc8a-47a8713ba0d8",
            "52ffbc3d-f435-4f3c-8b5d-a9738c2dd6bc"
          ],
          "display_name": false
        },
        {
          "uuid": "65da2e02-902f-4c33-a0cc-9514d2aeba41",
          "name": "N-ETHYL-L-GLUTAMINE",
          "stdName": "N-ETHYL-L-GLUTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cc8666b-2e7c-4b3f-bc8a-47a8713ba0d8",
            "e785ca6a-e420-4097-a749-b9b919aa0b44"
          ],
          "display_name": false
        },
        {
          "uuid": "c723ffcf-4a03-40c9-95a7-1b04381f6004",
          "name": "NSC-21308",
          "stdName": "NSC-21308",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4dada01b-eb34-43c4-bb67-1648488cb45d",
            "9cc8666b-2e7c-4b3f-bc8a-47a8713ba0d8"
          ],
          "display_name": false
        },
        {
          "uuid": "1e98599f-aeba-4589-a02d-26b80ef3de16",
          "name": "THEANINE",
          "stdName": "THEANINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27eb04cd-9739-4d74-803e-b28367a7b99a",
            "5becc323-1c47-4178-88fd-d30f87ec4e9c",
            "bb725205-1060-42cf-aae3-5539553174c0",
            "5e505fc5-6ebd-411f-b57f-947c62b747a0",
            "607bcc9f-e78c-4d8e-b4de-c275b2584aa9",
            "9cc8666b-2e7c-4b3f-bc8a-47a8713ba0d8",
            "e785ca6a-e420-4097-a749-b9b919aa0b44",
            "14d4440c-6a76-4ca6-9973-08bcf3ddf9e6",
            "e383f03e-a411-4ae4-87d7-dbfbe0d5fde9",
            "1d034990-ea7e-4c06-b57f-a1e9f2f4e6c6"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "cd8954f0-c395-4c19-8830-a42d175b3a1d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5736f711-535e-4b59-93a7-37fe962bc780",
          "name": "THEANINE [MI]",
          "stdName": "THEANINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "607bcc9f-e78c-4d8e-b4de-c275b2584aa9",
            "9cc8666b-2e7c-4b3f-bc8a-47a8713ba0d8"
          ],
          "display_name": false
        },
        {
          "uuid": "6be21384-982c-4c93-910f-6c5559b26fd5",
          "name": "THEANINE [VANDF]",
          "stdName": "THEANINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cc8666b-2e7c-4b3f-bc8a-47a8713ba0d8",
            "e383f03e-a411-4ae4-87d7-dbfbe0d5fde9"
          ],
          "display_name": false
        },
        {
          "uuid": "a983b03f-dc17-4200-ba52-fa6efddfab5d",
          "name": "THEANINE, L-",
          "stdName": "THEANINE, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cc8666b-2e7c-4b3f-bc8a-47a8713ba0d8",
            "2ed6b5ff-a339-4d54-8c92-c4be32fe862a"
          ],
          "display_name": false
        },
        {
          "uuid": "68b15d2b-5283-2ec3-ef16-495ba31bb656",
          "name": "Theanine [WHO-DD]",
          "stdName": "THEANINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b10ee5eb-97b3-b7ad-a838-983c9374b7fd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e785ca6a-e420-4097-a749-b9b919aa0b44",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9cc8666b-2e7c-4b3f-bc8a-47a8713ba0d8",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4dada01b-eb34-43c4-bb67-1648488cb45d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "607bcc9f-e78c-4d8e-b4de-c275b2584aa9",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5becc323-1c47-4178-88fd-d30f87ec4e9c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52ffbc3d-f435-4f3c-8b5d-a9738c2dd6bc",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27eb04cd-9739-4d74-803e-b28367a7b99a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e383f03e-a411-4ae4-87d7-dbfbe0d5fde9",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ed6b5ff-a339-4d54-8c92-c4be32fe862a",
          "citation": "cfsan",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0fbf9313-81e0-4c6a-b34c-003a23bcd3d7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390774000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2bf21b1-f448-4875-b71d-6035dd04bb64",
          "citation": "SRS import [8021PR16QO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8021PR16QO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390774000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e505fc5-6ebd-411f-b57f-947c62b747a0",
          "citation": "THEANINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1d034990-ea7e-4c06-b57f-a1e9f2f4e6c6",
          "citation": "THEANINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a72d1da-886f-4acb-875d-fc5a06ac0fb9",
          "citation": "L-THEANINE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bb725205-1060-42cf-aae3-5539553174c0",
          "citation": "THEANINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "14d4440c-6a76-4ca6-9973-08bcf3ddf9e6",
          "citation": "THEANINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e24c01b8-c4f3-fb13-1a68-3441bafd6ebe",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3081-61-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "41325eeb-d455-b9ea-4bc8-11037eae63ac",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3081-61-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4e3857f3-09a5-07fc-3e8f-e85903fad116",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3304ec66-6eb7-4e9b-a97d-2ede876b53c5",
          "citation": "https://en.wikipedia.org/wiki/AMPA_receptor",
          "url": "https://en.wikipedia.org/wiki/AMPA_receptor",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "744c12d1-10b2-41c3-90ab-8959ec9bf22d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "46229b38-a388-408c-8aec-0be278c9b50f",
          "citation": "Williams, Jackson L., et al. \"The effects of green tea amino acid L-theanine consumption on the ability to manage stress and anxiety levels: a systematic review.\" Plant Foods for Human Nutrition 75.1 (2020): 12-23.",
          "url": "https://link.springer.com/article/10.1007/s11130-019-00771-5",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "1dd7a64d-7bf5-f1c6-c2ce-b196d75be4f5",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0f4cd83d-0a9f-3a0e-4826-8e779b42fe44",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b10ee5eb-97b3-b7ad-a838-983c9374b7fd",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "de393e17-e511-2e89-aa85-286ea7ed40e9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "07d199fa-e8e0-436e-bd64-2de50a21e3a6",
          "id": "07d199fa-e8e0-436e-bd64-2de50a21e3a6",
          "molfile": "\n  Marvin  01132100412D          \n\n 12 11  0  0  1  0            999 V2000\n    8.9819   -5.2572    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.9819   -6.0822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2674   -4.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5529   -5.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8384   -4.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8384   -4.0197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1240   -5.2572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4095   -4.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6950   -5.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6965   -4.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6965   -4.0197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4110   -5.2572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  1 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
          "smiles": "CCNC(=O)CC[C@@H](C(=O)O)N",
          "formula": "C7H14N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "96cdeab3-9c78-4648-9a92-c51fc53c2e28"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "174.1979",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b92e8e47-5633-47ac-820f-868c2dd55ddc",
      "version": "25",
      "structure": {
        "id": "3e5160e7-a0c8-4bc5-8fe7-4093976c5661",
        "molfile": "\n  Marvin  01132103182D          \n\n 12 11  0  0  1  0            999 V2000\n    8.9819   -6.0822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9819   -5.2572    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.6965   -4.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6965   -4.0197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4110   -5.2572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2674   -4.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5529   -5.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8384   -4.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8384   -4.0197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1240   -5.2572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4095   -4.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6950   -5.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
        "smiles": "CCNC(=O)CC[C@@H](C(=O)O)N",
        "formula": "C7H14N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "174.1979",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e785ca6a-e420-4097-a749-b9b919aa0b44",
          "f2bf21b1-f448-4875-b71d-6035dd04bb64"
        ],
        "stereo_centers": 1
      },
      "unii": "8021PR16QO"
    }
  ]
}