{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3759340a-c1de-4f48-a314-67dae67bd668",
          "code": "64808-48-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=64808-48-6",
          "code_system": "CAS",
          "references": [
            "44fe0b18-7c1e-4758-b489-e301339b72ad",
            "965d86a4-fde8-4b4d-b6c7-0a602be256a5"
          ]
        },
        {
          "uuid": "a8e344cd-fdf8-4daa-a1a3-574448fe09b4",
          "code": "C72817",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72817",
          "code_system": "NCI_THESAURUS",
          "references": [
            "44fe0b18-7c1e-4758-b489-e301339b72ad"
          ]
        },
        {
          "uuid": "05e59c93-88db-470e-ac91-51ffb7bf60a7",
          "code": "m6880",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6880?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "44fe0b18-7c1e-4758-b489-e301339b72ad"
          ]
        },
        {
          "uuid": "9c87633f-48c4-4d32-9512-350f18cb661e",
          "code": "SUB02963MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "44fe0b18-7c1e-4758-b489-e301339b72ad"
          ]
        },
        {
          "uuid": "b00aa2cf-c1f9-4277-8d87-772398112058",
          "code": "CHEMBL1986706",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1986706",
          "code_system": "ChEMBL",
          "references": [
            "44fe0b18-7c1e-4758-b489-e301339b72ad"
          ]
        },
        {
          "uuid": "a4d217cf-a1cb-6c36-3f9c-aabdf99b95f0",
          "code": "DTXSID8048606",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8048606",
          "code_system": "EPA CompTox",
          "references": [
            "cf09b8de-487c-3ec4-e066-764f9e3b6038"
          ]
        },
        {
          "uuid": "7002e80f-4853-216e-4275-8d5cc7a93990",
          "code": "C257",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257",
          "code_system": "NCI_THESAURUS",
          "references": [
            "23a811d1-912a-7fe2-7442-bb8587b26770"
          ]
        },
        {
          "uuid": "8dbfdc4c-8018-7dda-6f54-f0224184d642",
          "code": "47462",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/47462",
          "code_system": "PUBCHEM",
          "references": [
            "37ecbf92-cc90-f894-a35b-89cdfe9f3928"
          ]
        },
        {
          "uuid": "5f606885-d810-479b-8401-86f304418c0f",
          "code": "7Z9SP74BXF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dc698521-5c8f-b153-b904-d5dcc4ec3ab1",
          "code": "W-112",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/W-112/relevant/1/",
          "code_system": "USAN",
          "references": [
            "e97b1272-002b-2db3-50c2-622a5356077b"
          ]
        },
        {
          "uuid": "57733fdd-73d9-5438-6c25-2d1e5030dabf",
          "code": "100000086151",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4b52432c-21e1-ef79-9dd6-6d58a3e31dea"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d9c403c4-1cfa-4b9f-8e44-38edf036e82a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f8ccf218-15aa-4dc6-833d-68bf69628d24",
            "refuuid": "87d913c7-f720-4dd5-a815-8c1782a3ee59",
            "name": "LOBENZARIT",
            "unii": "915EE91P39",
            "linking_id": "915EE91P39",
            "ref_pname": "LOBENZARIT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "491d4748-5fcc-4301-8b6d-1fc23a68f5d8",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "24b83443-1332-4484-b3f7-066b6c26f742",
            "refuuid": "87d913c7-f720-4dd5-a815-8c1782a3ee59",
            "name": "LOBENZARIT",
            "unii": "915EE91P39",
            "linking_id": "915EE91P39",
            "ref_pname": "LOBENZARIT",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "239262d6-f7f9-464a-8808-b684860a09c3",
          "name": "BENZOIC ACID, 2-((2-CARBOXYPHENYL)AMINO)-4-CHLORO-, DISODIUM SALT",
          "stdName": "BENZOIC ACID, 2-((2-CARBOXYPHENYL)AMINO)-4-CHLORO-, DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6679ce1a-d63d-4076-81ae-7345df4cf6fe"
          ],
          "display_name": false
        },
        {
          "uuid": "768927eb-afe9-4bc6-91e4-43365435ab52",
          "name": "CARFENIL",
          "stdName": "CARFENIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff9e24d4-a2d9-4a7d-9340-a49693b6ba32",
            "4c8cee4e-dd92-4cd9-ba99-46b9b2631852"
          ],
          "display_name": false
        },
        {
          "uuid": "cfe58d2a-11ed-46a5-815b-62ed823db92a",
          "name": "DISODIUM 4-CHLORO-2,2'-IMINODIBENZOATE",
          "stdName": "DISODIUM 4-CHLORO-2,2'-IMINODIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6679ce1a-d63d-4076-81ae-7345df4cf6fe"
          ],
          "display_name": false
        },
        {
          "uuid": "159be509-169a-469e-93d4-fef541ecc5f9",
          "name": "LOBENZARIT DISODIUM",
          "stdName": "LOBENZARIT DISODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f673e367-a3e6-472c-8bfb-fbebe7c999a1",
            "a888e0c7-5bde-400b-ae77-8a51936a15d8"
          ],
          "display_name": false
        },
        {
          "uuid": "155dcb4d-d281-4679-b2c3-2ae74b211e8f",
          "name": "LOBENZARIT DISODIUM SALT",
          "stdName": "LOBENZARIT DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "086797cb-1ca4-4063-ab36-857172edca6b",
            "a6916d09-6dda-47a8-a7a8-ad10a6623c09"
          ],
          "display_name": false
        },
        {
          "uuid": "f3b0fa77-e9c2-4144-ad86-a1e2aedc2e31",
          "name": "LOBENZARIT DISODIUM SALT [MI]",
          "stdName": "LOBENZARIT DISODIUM SALT [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6916d09-6dda-47a8-a7a8-ad10a6623c09"
          ],
          "display_name": false
        },
        {
          "uuid": "7bbae8c4-038b-4c84-9bb3-f4fbcf417eb1",
          "name": "LOBENZARIT SODIUM",
          "stdName": "LOBENZARIT SODIUM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e446c5d-5b77-432f-a629-b72113551e1f",
            "68675c07-1c00-40a1-9833-bbe9870ba494",
            "2daf0442-6faa-493f-854b-91e76acded1f",
            "cd243f60-0f5e-4a53-9636-5268c9c0484e",
            "6679ce1a-d63d-4076-81ae-7345df4cf6fe",
            "5f9e3fd9-3980-4c86-a7f8-56aefa7ee4c2",
            "e0c330d7-56f6-457a-96c9-207d97f3bbe1"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "4e7940fa-9aaa-47c1-a21e-3b37b2ffb4e1",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "89547c9a-f1e1-4745-aeaf-214b5f2510b3",
          "name": "LOBENZARIT SODIUM [JAN]",
          "stdName": "LOBENZARIT SODIUM [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f673e367-a3e6-472c-8bfb-fbebe7c999a1"
          ],
          "display_name": false
        },
        {
          "uuid": "2d1d7121-183b-468b-a234-330b6917475a",
          "name": "LOBENZARIT SODIUM [MART.]",
          "stdName": "LOBENZARIT SODIUM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68675c07-1c00-40a1-9833-bbe9870ba494"
          ],
          "display_name": false
        },
        {
          "uuid": "0c7e10e4-6121-44ce-a611-681b149c5ca7",
          "name": "LOBENZARIT SODIUM [USAN]",
          "stdName": "LOBENZARIT SODIUM [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e446c5d-5b77-432f-a629-b72113551e1f"
          ],
          "display_name": false
        },
        {
          "uuid": "9daf3c1f-3f0e-9d9b-c57d-81512f6bb7d0",
          "name": "Lobenzarit sodium [WHO-DD]",
          "stdName": "LOBENZARIT SODIUM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4af3a682-6493-cec6-0b28-540fd6b8cdc0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6679ce1a-d63d-4076-81ae-7345df4cf6fe",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0e446c5d-5b77-432f-a629-b72113551e1f",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68675c07-1c00-40a1-9833-bbe9870ba494",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff9e24d4-a2d9-4a7d-9340-a49693b6ba32",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c8cee4e-dd92-4cd9-ba99-46b9b2631852",
          "citation": "D01808",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6916d09-6dda-47a8-a7a8-ad10a6623c09",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f9e3fd9-3980-4c86-a7f8-56aefa7ee4c2",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f673e367-a3e6-472c-8bfb-fbebe7c999a1",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44fe0b18-7c1e-4758-b489-e301339b72ad",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390468000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0b25b38-34f8-4c78-a7af-cd0ca55e1cef",
          "citation": "SRS import [7Z9SP74BXF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7Z9SP74BXF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390468000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0c330d7-56f6-457a-96c9-207d97f3bbe1",
          "citation": "LOBENZARIT SODIUM [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2daf0442-6faa-493f-854b-91e76acded1f",
          "citation": "LOBENZARIT SODIUM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "086797cb-1ca4-4063-ab36-857172edca6b",
          "citation": "LOBENZARIT DISODIUM SALT [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd243f60-0f5e-4a53-9636-5268c9c0484e",
          "citation": "LOBENZARIT SODIUM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a888e0c7-5bde-400b-ae77-8a51936a15d8",
          "citation": "LOBENZARIT DISODIUM [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cf09b8de-487c-3ec4-e066-764f9e3b6038",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=64808-48-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4b52432c-21e1-ef79-9dd6-6d58a3e31dea",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "23a811d1-912a-7fe2-7442-bb8587b26770",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e97b1272-002b-2db3-50c2-622a5356077b",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "965d86a4-fde8-4b4d-b6c7-0a602be256a5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "37ecbf92-cc90-f894-a35b-89cdfe9f3928",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "4af3a682-6493-cec6-0b28-540fd6b8cdc0",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b8a49a51-5a1f-422c-98f2-18f579558464",
          "id": "b8a49a51-5a1f-422c-98f2-18f579558464",
          "molfile": "\n  Marvin  01132109332D          \n\n  1  0  0  0  0  0            999 V2000\n    2.8153   -0.7657    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "2c490286-1ac2-4651-ae66-710cd6b9f6f9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "d288326e-faa0-4a3a-8ccc-bd3d193a37c8",
          "id": "d288326e-faa0-4a3a-8ccc-bd3d193a37c8",
          "molfile": "\n  Marvin  01132110532D          \n\n 20 21  0  0  0  0            999 V2000\n    2.8722   -0.0181    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.5761   -0.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3031   -0.0464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5684   -1.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2799   -1.6888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2722   -2.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5452   -2.9109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8335   -2.4778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8490   -1.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1684   -1.2556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4464   -1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4335   -2.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7039   -2.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6962   -3.6921    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7271   -1.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7349   -0.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4464    0.0000    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.0258    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 17  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  2  0  0  0  0\nM  CHG  2   1  -1  19  -1\nM  END",
          "smiles": "c1ccc(c(c1)C(=O)[O-])Nc2cc(ccc2C(=O)[O-])Cl",
          "formula": "C14H8ClNO4",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "95b28cee-6d26-4d95-b413-a050d1858e50"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "289.6711",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1b303fb9-8f71-4063-b8b7-3b82b0c90b17",
      "version": "16",
      "structure": {
        "id": "f64686b7-a6e2-46eb-8594-6ea1f37b5cc1",
        "molfile": "\n  Marvin  01132112462D          \n\n 22 21  0  0  0  0            999 V2000\n    0.7271   -1.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4464   -1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5684   -1.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1684   -1.2556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7349   -0.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8490   -1.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5761   -0.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4335   -2.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8722   -0.0181    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.4464    0.0000    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.3031   -0.0464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0258    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7039   -2.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6962   -3.6921    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2799   -1.6888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8335   -2.4778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2722   -2.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5452   -2.9109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8155   -0.7658    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    1.3949   -0.7658    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  6  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12  7  2  0  0  0  0\n 13  5  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15  9  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17  3  1  0  0  0  0\n 18  6  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 18  2  0  0  0  0\n 14  8  2  0  0  0  0\n 19 17  2  0  0  0  0\nM  CHG  4  10  -1  11  -1  21   1  22   1\nM  END",
        "smiles": "c1ccc(c(c1)C(=O)[O-])Nc2cc(ccc2C(=O)[O-])Cl.[Na+].[Na+]",
        "formula": "C14H8ClNO4.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "335.6506",
        "optical_activity": "NONE",
        "references": [
          "d0b25b38-34f8-4c78-a7af-cd0ca55e1cef",
          "6679ce1a-d63d-4076-81ae-7345df4cf6fe"
        ],
        "stereo_centers": 0
      },
      "unii": "7Z9SP74BXF"
    }
  ]
}