{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "51b5fb59-1e22-4af2-b517-a06bfd15c8f2",
          "code": "970-74-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=970-74-1",
          "code_system": "CAS",
          "references": [
            "faa44563-e1d9-40b3-bb6b-22c582edaf46",
            "0f4eda69-62cd-4d62-9940-b57ca6e4f8cb"
          ]
        },
        {
          "uuid": "f71a6417-3ac9-4d1c-9ba3-5995b68ac9ec",
          "code": "C68453",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68453",
          "code_system": "NCI_THESAURUS",
          "references": [
            "faa44563-e1d9-40b3-bb6b-22c582edaf46"
          ]
        },
        {
          "uuid": "e4b8c75b-42a1-4f69-96ef-28d45a3e5cdb",
          "code": "SUB77259",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "faa44563-e1d9-40b3-bb6b-22c582edaf46"
          ]
        },
        {
          "uuid": "b935ab3b-b21a-4830-af65-4b5803c2cfaa",
          "code": "72277",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72277",
          "code_system": "PUBCHEM",
          "references": [
            "faa44563-e1d9-40b3-bb6b-22c582edaf46"
          ]
        },
        {
          "uuid": "af253844-f1e8-0255-ee83-7266a806237d",
          "code": "C63651",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Polyphenol[C70553]|Dietary Flavonoid[C70554]|Flavanol[C68450]|Cianidanol[C63654]|L-Epicatechin",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C63651",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6efd0437-3b2b-d650-aef4-e0c13079160e"
          ]
        },
        {
          "uuid": "4adccd97-2ced-4704-7b5a-a7c3e0ddab1e",
          "code": "DB03823",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03823",
          "code_system": "DRUG BANK",
          "references": [
            "6efd0437-3b2b-d650-aef4-e0c13079160e"
          ]
        },
        {
          "uuid": "df563174-e1ed-4785-9602-af2c98cc70dc",
          "code": "7Z197MG6QL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "08bd8ed3-f69f-3a58-a96c-9213a0445f01",
          "code": "42255",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:42255",
          "code_system": "CHEBI",
          "references": [
            "6efd0437-3b2b-d650-aef4-e0c13079160e"
          ]
        },
        {
          "uuid": "18f0b8ef-b411-acda-7c19-329623f7439e",
          "code": "100000137992",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e01139a7-2fd7-97cf-1419-4bd16056d8a0"
          ]
        },
        {
          "uuid": "986f6be1-16ad-607b-81f7-9d5e9cc451c9",
          "code": "DTXSID40891550",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40891550",
          "code_system": "EPA CompTox",
          "references": [
            "9663f790-0708-9650-2a88-b0d75ad74d67"
          ]
        },
        {
          "uuid": "7e0b8a74-fc5b-03c0-02fa-a69f2dbdaef2",
          "code": "674039",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=674039",
          "code_system": "NSC",
          "references": [
            "cc7eb8e1-4294-e82e-ab51-a98bb9460c23"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b72698ed-fe31-4c3a-a671-883e4f26e129",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "12be4d57-cda7-4037-a654-47a21dd7d4cf"
          ],
          "related_substance": {
            "uuid": "2effdc12-3b43-4196-a21b-4a70abfc205f",
            "refuuid": "b086b80a-6c93-479e-95ff-b7b0abb78be3",
            "name": "PRIMULA VERIS ROOT",
            "unii": "TA94NTR55X",
            "linking_id": "TA94NTR55X",
            "ref_pname": "PRIMULA VERIS ROOT",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "449f1d78-c44e-4299-9180-b46cdc6fa36f",
          "name": "(-)-EPI-GALLOCATECHIN",
          "stdName": "(-)-EPI-GALLOCATECHIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2aed9e2-5026-451b-bcc3-48fb68243f43",
            "134896e3-2b55-4af8-bd50-240e6f136328"
          ],
          "display_name": false
        },
        {
          "uuid": "54dde5a8-2c63-4ddf-b380-778b4e4fd39f",
          "name": "(-)-EPIGALLOCATECHIN",
          "stdName": "(-)-EPIGALLOCATECHIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "134896e3-2b55-4af8-bd50-240e6f136328",
            "b695e04a-7985-4aad-b1df-d449a50bea30"
          ],
          "display_name": false
        },
        {
          "uuid": "fb2f8bc5-a4b9-4b43-83d9-50f863b90065",
          "name": "(-)-EPIGALLOCATECHIN(EGC) (CONSTITUENT OF POWDERED DECAFFEINATED GREEN TEA EXTRACT) [DSC]",
          "stdName": "(-)-EPIGALLOCATECHIN(EGC) (CONSTITUENT OF POWDERED DECAFFEINATED GREEN TEA EXTRACT) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "134896e3-2b55-4af8-bd50-240e6f136328",
            "b695e04a-7985-4aad-b1df-d449a50bea30"
          ],
          "display_name": false
        },
        {
          "uuid": "29cd6c7e-4956-4e91-b43d-47a81be62d29",
          "name": "(-)-EPIGALLOCATECHOL",
          "stdName": "(-)-EPIGALLOCATECHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2aed9e2-5026-451b-bcc3-48fb68243f43",
            "134896e3-2b55-4af8-bd50-240e6f136328"
          ],
          "display_name": false
        },
        {
          "uuid": "3daadd50-a4ee-4f7d-aa81-25c29c5be928",
          "name": "2H-1-BENZOPYRAN-3,5,7-TRIOL, 3,4-DIHYDRO-2-(3,4,5-TRIHYDROXYPHENYL)-, (2R,3R)-",
          "stdName": "2H-1-BENZOPYRAN-3,5,7-TRIOL, 3,4-DIHYDRO-2-(3,4,5-TRIHYDROXYPHENYL)-, (2R,3R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2aed9e2-5026-451b-bcc3-48fb68243f43",
            "134896e3-2b55-4af8-bd50-240e6f136328"
          ],
          "display_name": false
        },
        {
          "uuid": "f2f9d46b-477b-4d85-afe4-930610e6067a",
          "name": "3,3',4',5,5',7-FLAVANHEXOL",
          "stdName": "3,3',4',5,5',7-FLAVANHEXOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "134896e3-2b55-4af8-bd50-240e6f136328",
            "5632edf8-3450-40eb-9072-00981e89045a"
          ],
          "display_name": false
        },
        {
          "uuid": "be617db2-b537-481b-8f7c-30b0b2f3e28c",
          "name": "ANTISCURVY FACTOR C2",
          "stdName": "ANTISCURVY FACTOR C2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "134896e3-2b55-4af8-bd50-240e6f136328",
            "5632edf8-3450-40eb-9072-00981e89045a"
          ],
          "display_name": false
        },
        {
          "uuid": "02634d58-1960-466d-8167-c59cae69cffd",
          "name": "EGC",
          "stdName": "EGC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2aed9e2-5026-451b-bcc3-48fb68243f43",
            "134896e3-2b55-4af8-bd50-240e6f136328"
          ],
          "display_name": false
        },
        {
          "uuid": "7b73a730-9fc9-4955-9bae-7a00276eb706",
          "name": "EPI-GALLOCATECHIN",
          "stdName": "EPI-GALLOCATECHIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "134896e3-2b55-4af8-bd50-240e6f136328",
            "5632edf8-3450-40eb-9072-00981e89045a"
          ],
          "display_name": false
        },
        {
          "uuid": "8d25fb03-5b4b-4178-aed9-22adb4e382ac",
          "name": "EPIGALLOCATECHIN",
          "stdName": "EPIGALLOCATECHIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2aed9e2-5026-451b-bcc3-48fb68243f43"
          ],
          "display_name": true
        },
        {
          "uuid": "3a8023b8-5582-444e-90e3-c7de26524c51",
          "name": "EPIGALLOCATECHOL",
          "stdName": "EPIGALLOCATECHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "134896e3-2b55-4af8-bd50-240e6f136328",
            "0cefd212-869a-45ce-8fb2-ea78d4cee721"
          ],
          "display_name": false
        },
        {
          "uuid": "3e2543dd-118c-4253-ac0b-c46b9169ff07",
          "name": "GALLOEPICATECHIN",
          "stdName": "GALLOEPICATECHIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c0522f3-a38c-4202-bdb2-1c4e71f3f036",
            "134896e3-2b55-4af8-bd50-240e6f136328"
          ],
          "display_name": false
        },
        {
          "uuid": "7d04b647-5f98-430f-9365-fd72fa8e4907",
          "name": "L-EPIGALLOCATECHIN",
          "stdName": "L-EPIGALLOCATECHIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c0522f3-a38c-4202-bdb2-1c4e71f3f036",
            "134896e3-2b55-4af8-bd50-240e6f136328"
          ],
          "display_name": false
        },
        {
          "uuid": "6f9b130d-032b-45d3-bfc3-e1337688bccb",
          "name": "NSC-674039",
          "stdName": "NSC-674039",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2aed9e2-5026-451b-bcc3-48fb68243f43",
            "134896e3-2b55-4af8-bd50-240e6f136328"
          ],
          "display_name": false
        },
        {
          "uuid": "6fa5bf20-a2fc-4c8e-990f-043e0116dbb0",
          "name": "SUNPHENON EGC",
          "stdName": "SUNPHENON EGC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "134896e3-2b55-4af8-bd50-240e6f136328",
            "5632edf8-3450-40eb-9072-00981e89045a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e2aed9e2-5026-451b-bcc3-48fb68243f43",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "134896e3-2b55-4af8-bd50-240e6f136328",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b695e04a-7985-4aad-b1df-d449a50bea30",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0cefd212-869a-45ce-8fb2-ea78d4cee721",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5632edf8-3450-40eb-9072-00981e89045a",
          "citation": "YES",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c0522f3-a38c-4202-bdb2-1c4e71f3f036",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "faa44563-e1d9-40b3-bb6b-22c582edaf46",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390591000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "255ce8e1-8615-4c4e-a621-1a2326889c83",
          "citation": "MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ea0f446-6e3f-4024-8477-3e4f2fd78938",
          "citation": "RAVINDRANATH M, EVID BASED COMPLEMENT ALTERNATE MED, 3,237(2006)",
          "url": "http://www.ncbi.nlm.nih.gov/pmc/articles/PMC1475929/",
          "doc_type": "LEUNGS ENCYLOPEDIA OF COMMON NATURAL INGREDIENTS 3RD ED.",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12be4d57-cda7-4037-a654-47a21dd7d4cf",
          "citation": "HERBAL MEDICINES 4TH ED",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "463dfc55-ac3f-4ef2-a496-d7f29148e25a",
          "citation": "SRS import [7Z197MG6QL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7Z197MG6QL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390591000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e01139a7-2fd7-97cf-1419-4bd16056d8a0",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "6efd0437-3b2b-d650-aef4-e0c13079160e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0f4eda69-62cd-4d62-9940-b57ca6e4f8cb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cc7eb8e1-4294-e82e-ab51-a98bb9460c23",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ca1e6ea5-da54-a23e-50cd-de97bcc4ddb5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "9663f790-0708-9650-2a88-b0d75ad74d67",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0c337c5e-e7e1-4882-89cd-8f1d7d8d26b3",
          "id": "0c337c5e-e7e1-4882-89cd-8f1d7d8d26b3",
          "molfile": "\n  Marvin  01132100532D          \n\n 22 24  0  0  1  0            999 V2000\n   14.5203  -10.3388    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   15.2820  -10.7787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7530  -10.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9865  -10.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2760  -10.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2760  -11.6263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5662  -10.3293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5662   -9.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7992   -9.0602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2760   -9.0886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9865   -9.5101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7624   -9.0086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5203   -9.4580    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   15.2916   -9.0176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0109   -9.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6929   -9.0176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4546   -9.4580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6929   -8.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4594   -7.7916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9683   -7.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9683   -6.9539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2916   -8.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 13  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 11  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  6  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 22 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
          "smiles": "c1c(cc(c(c1O)O)O)[C@@H]2[C@@H](Cc3c(cc(cc3O2)O)O)O",
          "formula": "C15H14O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d42efc98-31d3-484d-877b-a60675f6dcf5"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "306.268",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "53d98e02-cd90-4b89-bf72-e31dc1392811",
      "version": "16",
      "structure": {
        "id": "5a478702-c2c6-44e3-bdb4-48a7fec714bc",
        "molfile": "\n  Marvin  01132104412D          \n\n 22 24  0  0  1  0            999 V2000\n   13.7634   -9.0092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9874   -9.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9874  -10.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2769  -10.7463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2769  -11.6271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5670  -10.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5670   -9.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2769   -9.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8000   -9.0609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7540  -10.7795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5213  -10.3395    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.5213   -9.4587    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.2927   -9.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0121   -9.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6941   -9.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4559   -9.4587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6941   -8.2326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9695   -7.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2927   -8.2326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9695   -6.9544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4607   -7.7922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2831  -10.7795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  2  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  3  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  1  1  0  0  0  0\n 12 13  1  6  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 13  2  0  0  0  0\n 20 18  1  0  0  0  0\n 21 17  1  0  0  0  0\n 11 22  1  6  0  0  0\nM  END",
        "smiles": "c1c(cc(c(c1O)O)O)[C@@H]2[C@@H](Cc3c(cc(cc3O2)O)O)O",
        "formula": "C15H14O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "306.268",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e2aed9e2-5026-451b-bcc3-48fb68243f43",
          "463dfc55-ac3f-4ef2-a496-d7f29148e25a"
        ],
        "stereo_centers": 2
      },
      "unii": "7Z197MG6QL"
    }
  ]
}