{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1edc2a03-6156-43ea-ac8d-f29b7c707238", "code": "1050517-23-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1050517-23-1", "code_system": "CAS", "references": [ "a4a81e7a-16a2-42f3-b58c-8112bc6008c5", "5961d56d-4605-4ad3-9710-a716556a3673" ] }, { "uuid": "55dd9dde-80f9-4640-8474-9530c89a79bd", "code": "9886258", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9886258", "code_system": "PUBCHEM", "references": [ "a4a81e7a-16a2-42f3-b58c-8112bc6008c5" ] }, { "uuid": "f49f41f4-ccd0-18a8-bd20-2ed0fe0e12d5", "code": "DTXSID40146931", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40146931", "code_system": "EPA CompTox", "references": [ "f0c8fee1-d8ea-ae22-9a6a-2512037c61ee" ] }, { "uuid": "50af101c-88fc-4dd7-aa12-8da5ae771b99", "code": "7YWI9T8733", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "56173cf3-94a1-4c27-08f0-3ba7489bf9ee", "code": "7YWI9T8733", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(7YWI9T8733)", "code_system": "DAILYMED", "references": [ "8b327725-2dea-1a2b-5a60-b0a6776f5edd" ] } ], "substance_class": "chemical", "names": [ { "uuid": "db941b53-3c15-4311-a5c2-e32279b3f080", "name": "TETRAMETHYLCHROMANOL GLUCOSIDE", "stdName": "TETRAMETHYLCHROMANOL GLUCOSIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "e7c975e0-39d5-4d5b-814d-73b90f71493d", "ad9d7dd7-37f7-41ea-a491-869bc978d1ce", "b74dbf21-4c71-470b-a61b-f18758274f58" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "4e2f45e8-d577-4a17-8fd4-58dab4e670f3", "name_org": "INCI" } ] }, { "uuid": "ed2d16c9-217d-4ece-8554-91fe93f6ce3d", "name": "TMG", "stdName": "TMG", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1a2dc759-1eda-4085-a29e-24e399d4ca20", "b74dbf21-4c71-470b-a61b-f18758274f58" ], "display_name": false }, { "uuid": "43d3c675-38bd-4e11-a863-fdf3db7d9303", "name": "WATER SOLUBLE VITAMIN E DERIVATIVE", "stdName": "WATER SOLUBLE VITAMIN E DERIVATIVE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "ad9d7dd7-37f7-41ea-a491-869bc978d1ce", "b74dbf21-4c71-470b-a61b-f18758274f58" ], "display_name": false } ], "references": [ { "uuid": "ad9d7dd7-37f7-41ea-a491-869bc978d1ce", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "b74dbf21-4c71-470b-a61b-f18758274f58", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a2dc759-1eda-4085-a29e-24e399d4ca20", "citation": "http://journals.lww.com/shockjournal/fulltext/2002/12000/a_novel_water_soluble_vitamin_e_derivative,", "url": "http://journals.lww.com/shockjournal/fulltext/2002/12000/a_novel_water_soluble_vitamin_e_derivative,", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a4a81e7a-16a2-42f3-b58c-8112bc6008c5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391616000, "tags": [ "NOMEN" ] }, { "uuid": "ebf708c4-7c32-4f7d-8204-183973479405", "citation": "SRS import [7YWI9T8733]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7YWI9T8733", "doc_type": "SRS", "public_domain": true, "document_date": 1493391616000, "tags": [ "NOMEN" ] }, { "uuid": "78098e27-f21b-44e0-9a77-3011af7d6b0f", "citation": "http://www.springerlink.com/content/34p5802p03h71384/", "url": "http://www.springerlink.com/content/34p5802p03h71384/", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e7c975e0-39d5-4d5b-814d-73b90f71493d", "citation": "TETRAMETHYLCHROMANOL GLUCOSIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f0c8fee1-d8ea-ae22-9a6a-2512037c61ee", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1050517-23-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5961d56d-4605-4ad3-9710-a716556a3673", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "8b327725-2dea-1a2b-5a60-b0a6776f5edd", "citation": "DAILYMED", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5cc5ced8-4719-46b6-a9b9-fa6b13ef0d0b", "id": "5cc5ced8-4719-46b6-a9b9-fa6b13ef0d0b", "molfile": "\n Marvin 01132104482D \n\n 27 29 0 0 1 0 999 V2000\n 6.1208 -4.5763 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.4062 -4.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6916 -4.5763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8355 -4.1640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5501 -4.5763 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.2647 -4.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9518 -4.5763 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.9518 -3.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9518 -5.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6664 -5.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3811 -5.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0957 -5.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0957 -6.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8103 -5.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5250 -5.8132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8103 -4.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5250 -4.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0957 -4.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0957 -3.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3811 -4.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6664 -4.1640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5501 -5.4009 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.2647 -5.8132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8355 -5.8132 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.8355 -6.6377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1208 -5.4009 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.4062 -5.8132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 4 1 0 0 0 0\n 26 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 6 0 0 0\n 22 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 21 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 20 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 6 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 1 0 0 0\n 24 26 1 0 0 0 0\n 26 27 1 6 0 0 0\nM END", "smiles": "Cc1c(C)c2c(CCC(C)(C[C@@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O2)c(C)c1O", "formula": "C20H30O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "EPIMERIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "72b556dc-f156-4075-8b6e-80f5a088e466" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "382.4488", "optical_activity": "UNSPECIFIED", "stereo_centers": 6 } ], "definition_level": "COMPLETE", "uuid": "181cd5bf-57df-4a5a-8408-37d8d88fffae", "version": "6", "structure": { "id": "7eb2b205-f23b-44d0-a79b-2b7f75c2ef74", "molfile": "\n Marvin 01132106352D \n\n 27 29 0 0 1 0 999 V2000\n 4.6916 -4.5763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4062 -4.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8355 -4.1640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1208 -4.5763 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.4062 -5.8132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1208 -5.4009 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.8355 -6.6377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8355 -5.8132 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.2647 -5.8132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5501 -5.4009 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.5501 -4.5763 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.2647 -4.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9518 -3.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0957 -6.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5250 -4.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0957 -3.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5250 -5.8132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6664 -4.1640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3811 -4.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0957 -4.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8103 -4.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8103 -5.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0957 -5.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3811 -5.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6664 -5.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9518 -5.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9518 -4.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27 12 1 0 0 0 0\n 11 12 1 6 0 0 0\n 11 3 1 0 0 0 0\n 2 1 1 0 0 0 0\n 4 2 1 1 0 0 0\n 4 3 1 0 0 0 0\n 6 4 1 0 0 0 0\n 6 5 1 6 0 0 0\n 8 6 1 0 0 0 0\n 8 7 1 1 0 0 0\n 10 8 1 0 0 0 0\n 10 9 1 6 0 0 0\n 11 10 1 0 0 0 0\n 27 13 1 0 0 0 0\n 23 14 1 0 0 0 0\n 21 15 1 0 0 0 0\n 20 16 1 0 0 0 0\n 22 17 1 0 0 0 0\n 27 18 1 0 0 0 0\n 19 18 1 0 0 0 0\n 24 19 2 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\nM END", "smiles": "Cc1c(C)c2c(CCC(C)(C[C@@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O2)c(C)c1O", "formula": "C20H30O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "EPIMERIC", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "382.4488", "optical_activity": "UNSPECIFIED", "references": [ "78098e27-f21b-44e0-9a77-3011af7d6b0f", "ebf708c4-7c32-4f7d-8204-183973479405" ], "stereo_centers": 6 }, "unii": "7YWI9T8733" } ] }