{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8bbded4c-c074-4e29-bdc4-c5dcbbf0c4e5",
          "code": "500-34-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=500-34-5",
          "code_system": "CAS",
          "references": [
            "61f55d08-e73c-4f72-922d-7ea71f036c31",
            "66f1599f-44b4-4810-8041-f9776d0642ea"
          ]
        },
        {
          "uuid": "f9de29bc-db3a-479a-b389-08582d83bb03",
          "code": "C83706",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83706",
          "code_system": "NCI_THESAURUS",
          "references": [
            "61f55d08-e73c-4f72-922d-7ea71f036c31"
          ]
        },
        {
          "uuid": "0ac61920-b816-4e93-97f3-8032e5080ca7",
          "code": "m5207",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5207?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "61f55d08-e73c-4f72-922d-7ea71f036c31"
          ]
        },
        {
          "uuid": "b8813a43-a6b9-4563-aa15-c2aa4666a29a",
          "code": "808817",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/808817",
          "code_system": "PUBCHEM",
          "references": [
            "61f55d08-e73c-4f72-922d-7ea71f036c31"
          ]
        },
        {
          "uuid": "2aeec0d9-9ed2-bbae-a8cf-39cb7d0aa843",
          "code": "C245",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anesthetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C245",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e7719c68-8cec-8282-f59d-a273d4ed1ff3"
          ]
        },
        {
          "uuid": "6d481a6f-b72b-45a8-87e9-e3604162dee9",
          "code": "SUB193746",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "261fbd16-65d6-33dd-312b-1e285d6e7889"
          ]
        },
        {
          "uuid": "0cdec831-ce8c-ebac-d67c-3bfe5039fec2",
          "code": "Eucaine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Eucaine",
          "code_system": "WIKIPEDIA",
          "references": [
            "d2e380bc-9f15-2270-8603-f265fc21ee85"
          ]
        },
        {
          "uuid": "1f0afeec-f2ea-4ee2-8a95-dbe7af368d7c",
          "code": "7X49L994AY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e7b11a30-ac7a-9797-214e-9b2263dbbd42",
          "code": "49860",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=49860",
          "code_system": "NSC",
          "references": [
            "5a9edec3-12cb-36a7-2cab-214197120c6d"
          ]
        },
        {
          "uuid": "ac9482ce-9198-c4d8-c5b7-1101bc622e3d",
          "code": "100000178145",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "fbd525d0-f701-0495-530a-351cdedb0ad3"
          ]
        },
        {
          "uuid": "93fd89cf-9d90-b7bb-284e-7e4d5c8224f9",
          "code": "DTXSID70862056",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70862056",
          "code_system": "EPA CompTox",
          "references": [
            "6d28051c-3a7e-0509-b708-acfc9bbf3ce0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "dbabb0b0-fdf8-4c57-b4c8-b5e658cc5f44",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "4f2e22f1-32f3-4795-bcf4-c231d6cea506",
            "refuuid": "41a238b7-3be9-4998-9b1b-96b38fd5cd61",
            "name": "EUCAINE HYDROCHLORIDE",
            "unii": "73NDV3S9Y7",
            "linking_id": "73NDV3S9Y7",
            "ref_pname": "EUCAINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "df54a264-a407-4c00-b74f-cd48175be550",
          "name": ".ALPHA.-4-BENZOYLOXY-2,2,6-TRIMETHYLPIPERIDINE",
          "stdName": ".ALPHA.-4-BENZOYLOXY-2,2,6-TRIMETHYLPIPERIDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a510570-3bde-48b2-bbaa-eba7f2b40ff3"
          ],
          "display_name": false
        },
        {
          "uuid": "7559a2af-b3d4-47fc-81bc-d7a4a8279b4b",
          "name": ".ALPHA.-VINYLDIACETONALKAMINE BENZOATE",
          "stdName": ".ALPHA.-VINYLDIACETONALKAMINE BENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a510570-3bde-48b2-bbaa-eba7f2b40ff3"
          ],
          "display_name": false
        },
        {
          "uuid": "db322833-5cef-4e48-95c1-747ceb926c5b",
          "name": ".BETA.-EUCAINE",
          "stdName": ".BETA.-EUCAINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f89daf59-6fa5-444b-9180-1baa709a771c",
            "16906248-acff-49ea-9a6b-95a596d6073b",
            "3b7f679a-0278-4598-a5d3-aa3343d454a6"
          ],
          "display_name": false
        },
        {
          "uuid": "8466dddb-c5b8-4ae2-9603-46c46a480d59",
          "name": ".BETA.-EUCAINE [MI]",
          "stdName": ".BETA.-EUCAINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16906248-acff-49ea-9a6b-95a596d6073b"
          ],
          "display_name": false
        },
        {
          "uuid": "2099ed90-1928-4b06-883b-161b414b98f3",
          "name": "4-PIPERIDINOL, 2,2,6-TRIMETHYL-, BENZOATE (ESTER)",
          "stdName": "4-PIPERIDINOL, 2,2,6-TRIMETHYL-, BENZOATE (ESTER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9b96321-e128-463c-941e-055b8c86f86b"
          ],
          "display_name": false
        },
        {
          "uuid": "78b0c99e-60cb-4233-a480-bc302adfe549",
          "name": "BENZAMINE",
          "stdName": "BENZAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a510570-3bde-48b2-bbaa-eba7f2b40ff3"
          ],
          "display_name": false
        },
        {
          "uuid": "06f07d62-97ed-4e59-86f4-8796de3a03c9",
          "name": "BETACAINE",
          "stdName": "BETACAINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a510570-3bde-48b2-bbaa-eba7f2b40ff3"
          ],
          "display_name": false
        },
        {
          "uuid": "328bf69e-5ff8-458e-9a5a-3ea8ed987dd4",
          "name": "BETAEUCAINE",
          "stdName": "BETAEUCAINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f89daf59-6fa5-444b-9180-1baa709a771c"
          ],
          "display_name": false
        },
        {
          "uuid": "b6c914e9-9de2-4b58-9a2e-3cc3077b8ee7",
          "name": "EUCAINE",
          "stdName": "EUCAINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f8545d1-e58d-40bc-a8d2-848d306b4573"
          ],
          "display_name": true
        },
        {
          "uuid": "6b7414af-abe5-4323-aafb-67497bb4013c",
          "name": "EUCAINE B",
          "stdName": "EUCAINE B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a510570-3bde-48b2-bbaa-eba7f2b40ff3"
          ],
          "display_name": false
        },
        {
          "uuid": "8d8c7225-f44b-43ae-a66b-7bdf047bd432",
          "name": "NSC-49860",
          "stdName": "NSC-49860",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3b8bcc8-3977-44bf-86b0-f99717d048ad"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f89daf59-6fa5-444b-9180-1baa709a771c",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3a510570-3bde-48b2-bbaa-eba7f2b40ff3",
          "citation": "Merck 14.3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f8545d1-e58d-40bc-a8d2-848d306b4573",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9b96321-e128-463c-941e-055b8c86f86b",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16906248-acff-49ea-9a6b-95a596d6073b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3b8bcc8-3977-44bf-86b0-f99717d048ad",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61f55d08-e73c-4f72-922d-7ea71f036c31",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390817000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7ec834b-c0d3-4a20-98cd-b2ea0c08b986",
          "citation": "SRS import [7X49L994AY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7X49L994AY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390817000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4aa006c0-775a-411b-a0e3-9df4c5886f0f",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b7f679a-0278-4598-a5d3-aa3343d454a6",
          "citation": ".BETA.-EUCAINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fbd525d0-f701-0495-530a-351cdedb0ad3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e7719c68-8cec-8282-f59d-a273d4ed1ff3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "261fbd16-65d6-33dd-312b-1e285d6e7889",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "66f1599f-44b4-4810-8041-f9776d0642ea",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d2e380bc-9f15-2270-8603-f265fc21ee85",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "5a9edec3-12cb-36a7-2cab-214197120c6d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6d28051c-3a7e-0509-b708-acfc9bbf3ce0",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3e4e1bf4-6011-4d5e-b80b-bdf754fa53e9",
          "id": "3e4e1bf4-6011-4d5e-b80b-bdf754fa53e9",
          "molfile": "\n  Marvin  01132103182D          \n\n 18 19  0  0  0  0            999 V2000\n    4.2000   -0.9334    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.1917   -0.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9125   -1.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9125   -2.1792    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.2000   -2.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4917   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6667   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0750   -2.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4917   -1.3542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6208   -2.5917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3375   -2.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3292   -1.3459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0500   -2.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7583   -2.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4667   -2.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4708   -3.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7542   -3.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0458   -3.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  9  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 10  1  1  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  6  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "C[C@H]1C[C@H](CC(C)(C)N1)OC(=O)c2ccccc2",
          "formula": "C15H21NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "44e0826e-92b8-4bac-98a4-a8038c946cf3"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "247.3333",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dd79cc74-945f-42e8-8492-a814348f1a14",
      "version": "10",
      "structure": {
        "id": "bf80e509-1e58-4d2a-bc8b-a95371133eeb",
        "molfile": "\n  Marvin  01132109542D          \n\n 18 19  0  0  0  0            999 V2000\n    6.3375   -2.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4917   -1.3542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4917   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6208   -2.5917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9125   -2.1792    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.2000   -2.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9125   -1.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3292   -1.3459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2000   -0.9334    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0500   -2.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6667   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0750   -2.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0458   -3.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7583   -2.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1917   -0.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4667   -2.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7542   -3.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4708   -3.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  9  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  1  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13 10  2  0  0  0  0\n 14 10  1  0  0  0  0\n  9 15  1  1  0  0  0\n 16 14  2  0  0  0  0\n 17 13  1  0  0  0  0\n 18 16  1  0  0  0  0\n  3  2  1  0  0  0  0\n 18 17  2  0  0  0  0\nM  END",
        "smiles": "C[C@H]1C[C@H](CC(C)(C)N1)OC(=O)c2ccccc2",
        "formula": "C15H21NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "247.3333",
        "optical_activity": "( + / - )",
        "references": [
          "4aa006c0-775a-411b-a0e3-9df4c5886f0f",
          "f7ec834b-c0d3-4a20-98cd-b2ea0c08b986"
        ],
        "stereo_centers": 2
      },
      "unii": "7X49L994AY"
    }
  ]
}