{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9a5e5477-2cd4-4fcc-90d6-1f4651f866cb",
          "code": "N01BB05",
          "comments": "ATC|NERVOUS SYSTEM|ANESTHETICS|ANESTHETICS, LOCAL|Amides|butanilicaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N01BB05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7"
          ]
        },
        {
          "uuid": "63f0aea5-9f94-4e0e-9450-a9fcde233301",
          "code": "QN01BB05",
          "comments": "VATC|ANESTHETICS|ANESTHETICS, LOCAL|Amides|butanilicaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN01BB05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7"
          ]
        },
        {
          "uuid": "4594a92e-8793-49e0-bc1e-c789d5ce1fe0",
          "code": "3785-21-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3785-21-5",
          "code_system": "CAS",
          "references": [
            "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7",
            "92101e5c-f7a4-469c-963c-4fdac573ab3f"
          ]
        },
        {
          "uuid": "b41b3bd8-5929-4a7f-9145-c326a2a1647b",
          "code": "C96327",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C96327",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7"
          ]
        },
        {
          "uuid": "bdc0053b-d882-41c4-b3ee-e35dd63b21c6",
          "code": "C008337",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67008337",
          "code_system": "MESH",
          "references": [
            "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7"
          ]
        },
        {
          "uuid": "acbc50f6-939e-40a1-993d-de03aad4b96d",
          "code": "BUTANILICAINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Butanilicaine",
          "code_system": "WIKIPEDIA",
          "references": [
            "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7"
          ]
        },
        {
          "uuid": "bd158857-4844-4954-9684-51c5cf71e925",
          "code": "SUB06003MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7"
          ]
        },
        {
          "uuid": "7cf74e53-be6b-472e-b169-604017fd1c02",
          "code": "2115",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2115",
          "code_system": "INN",
          "references": [
            "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7"
          ]
        },
        {
          "uuid": "368ce1ae-0823-4eaa-984e-439d7c3d93c4",
          "code": "m600",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m600?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7"
          ]
        },
        {
          "uuid": "4d6669bd-34e5-4926-a060-bebdee2242f4",
          "code": "CHEMBL2104238",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104238",
          "code_system": "ChEMBL",
          "references": [
            "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7"
          ]
        },
        {
          "uuid": "7ba04af6-6acd-434e-a3c1-83ed6ae27ba8",
          "code": "22379",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22379",
          "code_system": "PUBCHEM",
          "references": [
            "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7"
          ]
        },
        {
          "uuid": "dcd96067-7fcb-cfdd-fad0-4d0018aaf285",
          "code": "DTXSID90191279",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90191279",
          "code_system": "EPA CompTox",
          "references": [
            "75817aeb-c887-1850-0281-c2ce67b28705"
          ]
        },
        {
          "uuid": "4a6f5555-58eb-6ebf-9831-dcc177d8a809",
          "code": "C245",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anesthetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C245",
          "code_system": "NCI_THESAURUS",
          "references": [
            "aa4fc245-e197-9edd-e579-1210253af2fe"
          ]
        },
        {
          "uuid": "79e66872-5e76-4a9d-b2f9-753e7e2bb8c6",
          "code": "7X3WV51F4N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "43c9f5bc-3d70-22de-ac80-5124940492b9",
          "code": "3691",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3691",
          "code_system": "DRUG CENTRAL",
          "references": [
            "aa4fc245-e197-9edd-e579-1210253af2fe"
          ]
        },
        {
          "uuid": "3d36f4a4-394c-cd89-2656-93597475c28b",
          "code": "DB13328",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB13328",
          "code_system": "DRUG BANK",
          "references": [
            "aa4fc245-e197-9edd-e579-1210253af2fe"
          ]
        },
        {
          "uuid": "cf1e4e29-ee30-2749-a146-1b3cfb908b8e",
          "code": "55518",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:55518",
          "code_system": "CHEBI",
          "references": [
            "aa4fc245-e197-9edd-e579-1210253af2fe"
          ]
        },
        {
          "uuid": "aec94f4f-c3ab-cc13-a294-cb2c2aaa60e1",
          "code": "100000088495",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2a6f1e1c-f4a4-844d-375a-9ba0b7d78c0d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3955c27d-867a-4344-a9c2-058d59c25ee2",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "814cb776-a4d9-4889-a63e-04e73ce1083e",
            "refuuid": "69719c7f-11dd-4af8-ae17-40ec0bfd5be3",
            "name": "BUTANILICAINE",
            "unii": "7X3WV51F4N",
            "linking_id": "7X3WV51F4N",
            "ref_pname": "BUTANILICAINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3f74a34f-cd54-4d21-bcfb-73b61d06e0df",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "6ec9e36e-257f-48da-b76a-b6b3a8540283",
            "refuuid": "b4e8fa7d-26ac-4777-85dd-8e0f203b5c35",
            "name": "BUTANILICAINE HYDROCHLORIDE",
            "unii": "025O9D1EB7",
            "linking_id": "025O9D1EB7",
            "ref_pname": "BUTANILICAINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1dfb8dd4-a151-46f1-b283-fd35053d8701",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "ebd8b293-79ab-430c-a57c-04362f290c5a",
            "refuuid": "5b3f2e02-cfa3-443a-9d84-d9b4e712827f",
            "name": "BUTANILICAINE PHOSPHATE",
            "unii": "JOZ20TRV0N",
            "linking_id": "JOZ20TRV0N",
            "ref_pname": "BUTANILICAINE PHOSPHATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3cb589a8-1233-4236-87e2-135fcb76be84",
          "name": "2-(BUTYLAMINO)-6'-CHLORO-O-ACETOLUIDIDE",
          "stdName": "2-(BUTYLAMINO)-6'-CHLORO-O-ACETOLUIDIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9401107-8353-42dd-b40c-1bd1b4488d83"
          ],
          "display_name": false
        },
        {
          "uuid": "8ab04955-91f5-45cb-aaa5-94364844a0be",
          "name": "BUTANILICAINE",
          "stdName": "BUTANILICAINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d704940b-1c19-4ea8-81ff-160198c29958",
            "30e025bd-0174-411c-95e8-060403a94bfa",
            "993b7c7e-7d14-49ab-bcfe-59efb9221384",
            "b4ae82b4-496c-4bb5-81f1-1e3c9c3ed5cc",
            "e9ea0de7-92d2-490f-9463-82642669ebdb",
            "d9401107-8353-42dd-b40c-1bd1b4488d83",
            "457824df-7c6a-4a01-a81a-d651d51b102f",
            "c9956ea0-38a0-4bc0-ac0f-5833c839d217"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "5fb7c421-89a5-42c5-ab51-c0e2d2a10fc5",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "26116975-9d64-4681-8ccd-6541c2a27be2",
          "name": "BUTANILICAINE [MI]",
          "stdName": "BUTANILICAINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9ea0de7-92d2-490f-9463-82642669ebdb",
            "c9956ea0-38a0-4bc0-ac0f-5833c839d217"
          ],
          "display_name": false
        },
        {
          "uuid": "800ead87-3e78-f093-e3ea-36d17b7d06d6",
          "name": "Butanilicaine [WHO-DD]",
          "stdName": "BUTANILICAINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22158cc8-0c1b-9dca-a95c-fd6c58174d6a"
          ],
          "display_name": false
        },
        {
          "uuid": "b20d8fe2-3653-4bf3-b2bf-17f58fca36d1",
          "name": "butanilicaine [INN]",
          "stdName": "BUTANILICAINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "993b7c7e-7d14-49ab-bcfe-59efb9221384"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d9401107-8353-42dd-b40c-1bd1b4488d83",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "993b7c7e-7d14-49ab-bcfe-59efb9221384",
          "citation": "INN Proposed List 16",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL16.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d704940b-1c19-4ea8-81ff-160198c29958",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9ea0de7-92d2-490f-9463-82642669ebdb",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9956ea0-38a0-4bc0-ac0f-5833c839d217",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd40e9d7-3890-4c0b-8b8e-c1dc9247e1b7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e112664-2c57-4432-aae5-03a2ce9e2cfe",
          "citation": "SRS import [7X3WV51F4N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7X3WV51F4N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "457824df-7c6a-4a01-a81a-d651d51b102f",
          "citation": "BUTANILICAINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b4ae82b4-496c-4bb5-81f1-1e3c9c3ed5cc",
          "citation": "BUTANILICAINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "30e025bd-0174-411c-95e8-060403a94bfa",
          "citation": "BUTANILICAINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "75817aeb-c887-1850-0281-c2ce67b28705",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3785-21-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2a6f1e1c-f4a4-844d-375a-9ba0b7d78c0d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "aa4fc245-e197-9edd-e579-1210253af2fe",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "92101e5c-f7a4-469c-963c-4fdac573ab3f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "22158cc8-0c1b-9dca-a95c-fd6c58174d6a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8bb2df65-9997-41b7-9768-b756bf627dc3",
          "id": "8bb2df65-9997-41b7-9768-b756bf627dc3",
          "molfile": "\n  Marvin  01132107152D          \n\n 17 17  0  0  0  0            999 V2000\n    6.8007   -0.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0927   -0.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3839   -0.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6610   -0.3245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9497   -0.7321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2419   -0.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5180   -0.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5226   -1.5579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8096   -0.3162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0909   -0.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0909   -1.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8135   -1.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3871   -1.9651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3362   -1.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3326   -0.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3882   -0.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3866    0.4999    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 16 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "CCCCNCC(=O)Nc1c(C)cccc1Cl",
          "formula": "C13H19ClN2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d27a6473-6ed1-4f77-95e7-a1dc03f4f9e4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "254.7562",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "69719c7f-11dd-4af8-ae17-40ec0bfd5be3",
      "version": "11",
      "structure": {
        "id": "52c787f7-09e1-4047-91ff-2d40daa105dd",
        "molfile": "\n  Marvin  01132104192D          \n\n 17 17  0  0  0  0            999 V2000\n    1.0909   -0.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8096   -0.3162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5180   -0.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3882   -0.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0909   -1.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5226   -1.5579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3866    0.4999    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.9497   -0.7321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2419   -0.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3362   -1.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3326   -0.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3871   -1.9651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8135   -1.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6610   -0.3245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3839   -0.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0927   -0.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8007   -0.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  3  2  0  0  0  0\n  7  4  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  5  2  0  0  0  0\n 13  5  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 11 10  2  0  0  0  0\nM  END",
        "smiles": "CCCCNCC(=O)Nc1c(C)cccc1Cl",
        "formula": "C13H19ClN2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "254.7562",
        "optical_activity": "NONE",
        "references": [
          "1e112664-2c57-4432-aae5-03a2ce9e2cfe",
          "d9401107-8353-42dd-b40c-1bd1b4488d83",
          "993b7c7e-7d14-49ab-bcfe-59efb9221384"
        ],
        "stereo_centers": 0
      },
      "unii": "7X3WV51F4N"
    }
  ]
}