{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "632fe336-9022-49d4-b3b6-410b4c83123b",
          "code": "54896-72-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54896-72-9",
          "code_system": "CAS",
          "references": [
            "1544913c-aa8a-42e4-95c3-016dfce22aab"
          ]
        },
        {
          "uuid": "95951367-f7a8-d69a-c6f3-3a4b675af7ed",
          "code": "448880",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/448880",
          "code_system": "PUBCHEM",
          "references": [
            "1038016e-2d92-8b03-9e88-0d358af3aa90"
          ]
        },
        {
          "uuid": "aa9c8bb9-2cbf-49de-843b-fc1991f56fa4",
          "code": "7WN5FYF8C7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "49140bf5-a3d8-46b7-86a8-1a0661b90369",
          "name": "N-(Aminocarbonyl)-D-phenylalanine",
          "stdName": "N-(AMINOCARBONYL)-D-PHENYLALANINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1544913c-aa8a-42e4-95c3-016dfce22aab"
          ],
          "display_name": true
        },
        {
          "uuid": "8d67f751-7d5b-4a7f-9387-c60b38a498aa",
          "name": "N-Carbamoyl-D-phenylalanine",
          "stdName": "N-CARBAMOYL-D-PHENYLALANINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1544913c-aa8a-42e4-95c3-016dfce22aab"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1038016e-2d92-8b03-9e88-0d358af3aa90",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "1544913c-aa8a-42e4-95c3-016dfce22aab",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2e75ff15-63f5-4af1-ac2d-662ce07cad23",
          "id": "2e75ff15-63f5-4af1-ac2d-662ce07cad23",
          "molfile": "N-Carbamoyl-D-phenylalanine\n  CDK     02272414072D\n54896-72-9 Copyright (C) 2024 ACS\n 15 15  0  0  1  0  0  0  0  0999 V2000\n    2.6674    3.8500    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.0011    4.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6674    2.3100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3336    4.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3336    1.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    3.8500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3336    6.1600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3336    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    2.3100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3347    3.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6685    4.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3347    2.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0021    3.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6685    1.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0021    2.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  1  0  0  0\n  1  4  1  0  0  0  0\n  2 10  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  5  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 13 15  2  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C[C@H](C(=O)O)NC(=O)N",
          "formula": "C10H12N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "eab1fc09-20ce-44fe-8732-729f91b3766b"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "208.2143",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "00b54651-2b33-4e15-8906-202f7d63fbee",
      "version": "5",
      "structure": {
        "id": "338856e7-8afe-475c-be89-a2b8a18fb0ea",
        "molfile": "N-Carbamoyl-D-phenylalanine\n   JSDraw202272414072D\n\n 15 15  0  0  1  0              0 V2000\n   23.8170   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1681   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8170   -8.4760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4659   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4659   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1150   -6.9160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4659   -4.5760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4659  -10.8160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1150   -8.4760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5190   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8701   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5190   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2210   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8701   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2210   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  1  0  0  0\n  1  4  1  0  0  0  0\n  2 10  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  5  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 13 15  2  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C[C@H](C(=O)O)NC(=O)N",
        "formula": "C10H12N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "208.2143",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "1544913c-aa8a-42e4-95c3-016dfce22aab"
        ],
        "stereo_centers": 1
      },
      "unii": "7WN5FYF8C7"
    }
  ]
}