{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "295e29d1-7802-44f4-aad8-00dc9f4ea1a9",
          "code": "223253-05-2",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94ZLA3W45F",
          "code_system": "CAS",
          "references": [
            "e1fb2a39-d666-45e2-b084-021096a71ac6"
          ]
        },
        {
          "uuid": "42403210-2fec-43a8-a0b6-ffa023533fbc",
          "code": "22880284",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22880284",
          "code_system": "PUBCHEM",
          "references": [
            "26ae81b0-403b-4779-8d4f-15326bc3be05"
          ]
        },
        {
          "uuid": "0c6b1567-453f-490d-b614-73b5c0c4cd24",
          "code": "51076-10-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51076-10-9",
          "code_system": "CAS",
          "references": [
            "e1fb2a39-d666-45e2-b084-021096a71ac6"
          ]
        },
        {
          "uuid": "8c8b9a49-bd47-6e44-d4f9-162f4d17a1bc",
          "code": "300000040692",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0f8c49db-3bf8-d10d-56f0-8f35156004f5"
          ]
        },
        {
          "uuid": "10568c18-98f7-44cb-9e86-e517ec609e23",
          "code": "7WJ8GC32VM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "e1fb2a39-d666-45e2-b084-021096a71ac6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eb7e88ff-07f1-4b0e-be59-a537a15c9260",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0f8c49db-3bf8-d10d-56f0-8f35156004f5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "26ae81b0-403b-4779-8d4f-15326bc3be05",
          "citation": "PUBCHEM",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22880284",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "200082cc-b2ea-4891-b5fe-a73c58f45535",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2b9fcded-3e22-49aa-8634-e33863823f6d",
          "id": "2b9fcded-3e22-49aa-8634-e33863823f6d",
          "molfile": "\n  Marvin  03182214332D          \n\n 12 11  0  0  1  0            999 V2000\n   14.0245   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3100   -5.3075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7389   -5.3075    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.5955   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4534   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7389   -6.1325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8811   -5.3075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1678   -5.3075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4534   -4.0700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1666   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1666   -4.0700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4522   -5.3075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  1  1  0  0  0\n  4  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  5  9  2  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\nM  END",
          "smiles": "C(C[C@@H](C(=O)O)N)CNC(=N)N",
          "formula": "C6H14N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a85b87e6-29e3-4c92-b0a6-e7dd943cbd00"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "174.2012",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "9e056d6f-7050-49a9-abd4-d5631557378a",
          "id": "9e056d6f-7050-49a9-abd4-d5631557378a",
          "molfile": "\n  Marvin  03182214332D          \n\n  4  3  0  0  1  0            999 V2000\n   13.3100   -2.8325    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   12.5955   -3.2450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3100   -2.0075    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   14.0245   -3.2450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\nM  CHG  2   1   1   3  -1\nM  END",
          "smiles": "[N+](=O)(O)[O-]",
          "formula": "HNO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2756328f-7ad5-4df3-8e8d-bd4d40232375"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "63.0129",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "cb399b67-0028-4706-98ed-284dfd537053",
      "version": "13",
      "structure": {
        "id": "80fb04dd-deeb-4489-9974-bb8f749a5034",
        "molfile": "L-Arginine, nitrate (1:?)\n   JSDraw203182214342D\n\n 16 14  0  0  1  0              0 V2000\n   39.7800   -9.3080    0.0000 N   0  3  0  0  0  0  5  0  0  0  0  0\n   38.4290  -10.0880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   39.7800   -7.7480    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   41.1310  -10.0880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5190   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680  -10.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8700  -10.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8170   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2210   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8700  -11.5960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4661  -10.0360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5719  -10.0360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2210   -7.6960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1151   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1151   -7.6960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7641  -10.0360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  1  0  0  0\n  8 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  9 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\nM  CHG  2   1   1   3  -1\nM  END",
        "smiles": "C(C[C@@H](C(=O)O)N)CNC(=N)N.[N+](=O)(O)[O-]",
        "formula": "C6H14N4O2.HNO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "237.2141",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e1fb2a39-d666-45e2-b084-021096a71ac6"
        ],
        "stereo_centers": 1
      },
      "unii": "7WJ8GC32VM",
      "relationships": [
        {
          "uuid": "fc04fb63-ab67-4b13-bc2c-0fbbc376da5f",
          "amount": {
            "uuid": "41353495-35c1-4287-a0e6-f8477c61c005"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "e1fb2a39-d666-45e2-b084-021096a71ac6"
          ],
          "related_substance": {
            "uuid": "05787570-e877-4c81-b03f-a6f756483ab0",
            "refuuid": "44a7792f-a146-4f82-ac61-0c49360fbf95",
            "name": "Nitric acid",
            "unii": "411VRN1TV4",
            "linking_id": "411VRN1TV4",
            "ref_pname": "Nitric acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1bcd0647-b336-46c8-82db-843fe24e132d",
          "amount": {
            "uuid": "ad4b0cad-1242-4d9f-becd-59e4e11494a2"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "e1fb2a39-d666-45e2-b084-021096a71ac6"
          ],
          "related_substance": {
            "uuid": "2d513afb-8d74-4971-9970-a763ff0e9094",
            "refuuid": "24d940bc-1e16-44c1-841a-40740861e06f",
            "name": "ARGININE",
            "unii": "94ZLA3W45F",
            "linking_id": "94ZLA3W45F",
            "ref_pname": "ARGININE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "25a0fd3b-006f-4a3a-ae43-4b16bab203df",
          "amount": {
            "uuid": "79a6bff1-b4bd-4f2a-be5e-6e7ce642c125"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "e1fb2a39-d666-45e2-b084-021096a71ac6"
          ],
          "related_substance": {
            "uuid": "69141bf9-65ba-4b71-9e8b-e35e95563edc",
            "refuuid": "24d940bc-1e16-44c1-841a-40740861e06f",
            "name": "ARGININE",
            "unii": "94ZLA3W45F",
            "linking_id": "94ZLA3W45F",
            "ref_pname": "ARGININE",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "77faf4c5-dd89-44e4-900e-664851a169d9",
          "name": "ARGININE NITRATE",
          "stdName": "ARGININE NITRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb7e88ff-07f1-4b0e-be59-a537a15c9260"
          ],
          "display_name": true
        },
        {
          "uuid": "8d8346bc-cfe8-1e85-c538-9a5dec3bbf41",
          "name": "Arginine nitrate [WHO-DD]",
          "stdName": "ARGININE NITRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb7e88ff-07f1-4b0e-be59-a537a15c9260"
          ],
          "display_name": false
        },
        {
          "uuid": "329f5b4c-10e3-4659-bc1c-c90f6fea2ceb",
          "name": "L-ARGININE, NITRATE",
          "stdName": "L-ARGININE, NITRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1fb2a39-d666-45e2-b084-021096a71ac6"
          ],
          "display_name": false
        },
        {
          "uuid": "07348b33-cb90-4efe-b89b-cbac13d6c3a9",
          "name": "L-ARGININE, NITRATE (1:?)",
          "stdName": "L-ARGININE, NITRATE (1:?)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1fb2a39-d666-45e2-b084-021096a71ac6"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "43755b3e-01e4-4c13-a20c-2ee7b025af12"
      }
    }
  ]
}