{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "243c5ad5-664f-480b-b5b1-dbf1df938081",
          "code": "245-718-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.547",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fbe3fd19-913a-439d-b970-24df4455d0c8"
          ]
        },
        {
          "uuid": "ec60c4f9-02e3-4336-92ad-ebcd4349b087",
          "code": "73759884",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73759884",
          "code_system": "PUBCHEM",
          "references": [
            "fbe3fd19-913a-439d-b970-24df4455d0c8"
          ]
        },
        {
          "uuid": "1147f63e-b14e-484d-ad02-b1eb65bd01ff",
          "code": "12221-52-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=12221-52-2",
          "code_system": "CAS",
          "references": [
            "fbe3fd19-913a-439d-b970-24df4455d0c8",
            "d40301a1-73b2-4b34-84ba-98f77ecb1e66"
          ]
        },
        {
          "uuid": "ca7941e8-7c96-4e60-bda5-283e1a47dfa4",
          "code": "C062964",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67062964",
          "code_system": "MESH",
          "references": [
            "fbe3fd19-913a-439d-b970-24df4455d0c8"
          ]
        },
        {
          "uuid": "4f230922-fe23-482e-b6c3-55ab4876f64b",
          "code": "23532-28-7",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23532-28-7",
          "code_system": "CAS",
          "references": [
            "fbe3fd19-913a-439d-b970-24df4455d0c8",
            "30c0e28b-b705-4290-bb64-7cd37226f7a4"
          ]
        },
        {
          "uuid": "e8708f1c-199e-491e-bd96-b043afa44b80",
          "code": "7W576V407R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c5bf27b6-40db-91c6-8817-0204cc7f65a2",
          "code": "DTXSID20874048",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20874048",
          "code_system": "EPA CompTox",
          "references": [
            "c68a932d-1015-5596-ba4b-bcf08b042734"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3aa8d270-6d72-4c2d-a396-2b9b26f9c7fb",
          "name": "4H-1,2,4-TRIAZOLIUM, 5-(2-(4-(DIETHYLAMINO)PHENYL)DIAZENYL)-1,4-DIMETHYL-, METHYL SULFATE (1:1)",
          "stdName": "4H-1,2,4-TRIAZOLIUM, 5-(2-(4-(DIETHYLAMINO)PHENYL)DIAZENYL)-1,4-DIMETHYL-, METHYL SULFATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb30aad6-3df5-47a3-be07-1754157afe0a",
            "31fe00ce-b98b-49e7-8b57-d93136c25af3"
          ],
          "display_name": false
        },
        {
          "uuid": "ee4e5cbf-9a66-445e-894c-40bf4ac6fc41",
          "name": "BASIC RED 22",
          "stdName": "BASIC RED 22",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb30aad6-3df5-47a3-be07-1754157afe0a",
            "b1acce21-554a-4a59-9a3d-878dbb827275",
            "f6bf805b-1e5a-4ad5-9796-cde5707a13a8"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "737b9a10-1979-42c9-bfc2-ced2a36551e2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b0442143-266e-4265-ba5e-31d6300a6af5",
          "name": "BASIC RED 22 METHOSULFATE",
          "stdName": "BASIC RED 22 METHOSULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb30aad6-3df5-47a3-be07-1754157afe0a",
            "20dcc42a-fc0a-4f61-88c6-b7167afca15a"
          ],
          "display_name": false
        },
        {
          "uuid": "f10f36f6-99d8-4bb1-8a08-6336d03d617e",
          "name": "C.I. 11055",
          "stdName": "C.I. 11055",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb30aad6-3df5-47a3-be07-1754157afe0a",
            "b1acce21-554a-4a59-9a3d-878dbb827275"
          ],
          "display_name": false
        },
        {
          "uuid": "e8baf79a-8ba4-4256-a37c-97e2bb247969",
          "name": "C.I. BASIC RED 22",
          "stdName": "C.I. BASIC RED 22",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff1d9815-1c60-407f-943f-a16624a87bd4"
          ],
          "display_name": false
        },
        {
          "uuid": "2304609b-74ca-4ee9-b566-329cf89bb6f3",
          "name": "CI 11055",
          "stdName": "CI 11055",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb30aad6-3df5-47a3-be07-1754157afe0a",
            "b1acce21-554a-4a59-9a3d-878dbb827275"
          ],
          "display_name": false
        },
        {
          "uuid": "bccb4fcb-c2a3-4e52-96e0-c81ca5862e85",
          "name": "SYNACRIL RED 3B",
          "stdName": "SYNACRIL RED 3B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "508e9c18-fb14-472d-a495-2e5140730f3d",
            "bb30aad6-3df5-47a3-be07-1754157afe0a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "508e9c18-fb14-472d-a495-2e5140730f3d",
          "citation": "http://www.ncbi.nlm.nih.gov/pubmed/2533534",
          "url": "http://www.ncbi.nlm.nih.gov/pubmed/2533534",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bb30aad6-3df5-47a3-be07-1754157afe0a",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1acce21-554a-4a59-9a3d-878dbb827275",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff1d9815-1c60-407f-943f-a16624a87bd4",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20dcc42a-fc0a-4f61-88c6-b7167afca15a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31fe00ce-b98b-49e7-8b57-d93136c25af3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fbe3fd19-913a-439d-b970-24df4455d0c8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c6e8b3e-46f1-40c3-ba4e-eefabc58d89a",
          "citation": "SRS import [7W576V407R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7W576V407R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "994b6f09-3ba5-47f9-904f-95198e139593",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6bf805b-1e5a-4ad5-9796-cde5707a13a8",
          "citation": "BASIC RED 22 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "30c0e28b-b705-4290-bb64-7cd37226f7a4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d40301a1-73b2-4b34-84ba-98f77ecb1e66",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c68a932d-1015-5596-ba4b-bcf08b042734",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ea1d34d7-1584-42b2-b649-05c71d179207",
          "id": "ea1d34d7-1584-42b2-b649-05c71d179207",
          "molfile": "\n  Marvin  01132112072D          \n\n  6  5  0  0  0  0            999 V2000\n    9.1358   -1.0149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9223   -1.8118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0973   -1.8118    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2723   -1.8118    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.0973   -0.9868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0973   -2.6368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  5  2  0  0  0  0\n  3  6  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "COS(=O)(=O)[O-]",
          "formula": "CH3O4S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4094a69b-f032-441b-81b2-de34035e215c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "111.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "f8d90867-815b-45d9-ba80-bdfeee858ac4",
          "id": "f8d90867-815b-45d9-ba80-bdfeee858ac4",
          "molfile": "\n  Marvin  01132112542D          \n\n 18 19  0  0  0  0            999 V2000\n    9.1060   -4.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1060   -3.7649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7788   -3.2706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5119   -2.4980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6813   -2.4980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1926   -1.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4446   -3.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6634   -3.5404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9490   -3.1287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2354   -3.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2354   -4.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5162   -4.7795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8139   -4.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8139   -3.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5162   -3.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0986   -4.7779    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.3813   -4.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0986   -5.6010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  3  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  3  0  0  0\n 11 10  1  0  0  0  0\n 10 15  1  0  0  0  0\n 12 11  2  3  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 16  2  3  0  0  0\n 15 14  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  CHG  1  16   1\nM  END",
          "smiles": "C[N+](=C1C=CC(=NN=c2n(C)cnn2C)C=C1)C",
          "formula": "C12H17N6",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7e14ef0f-bc62-4de8-b788-fdc3b8cce2fa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "245.304",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "39d7c6bc-4964-4758-9712-b227723adbb0",
      "version": "8",
      "structure": {
        "id": "fb14054a-c127-4d8e-a71c-4d4963696fcc",
        "molfile": "\n  Marvin  01132113002D          \n\n 24 24  0  0  0  0            999 V2000\n    9.5119   -2.4980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6813   -2.4980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4446   -3.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6634   -3.5404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9490   -3.1287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2354   -3.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5162   -3.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8139   -3.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8139   -4.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0986   -4.7779    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3813   -4.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0986   -5.6010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5162   -4.7795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2354   -4.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1060   -3.7649    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.1060   -4.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7788   -3.2706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1926   -1.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5352   -2.8739    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.8438   -2.8739    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8438   -1.5652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8438   -4.1825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1524   -2.8739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4911   -1.6098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n  9 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14  6  2  0  0  0  0\n  3 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17  1  2  0  0  0  0\n  2 18  1  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n 20 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  CHG  2  15   1  19  -1\nM  END",
        "smiles": "CN(C)c1ccc(cc1)/N=N/c2[n+](C)cnn2C.COS(=O)(=O)[O-]",
        "formula": "C12H17N6.CH3O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "356.4023",
        "optical_activity": "NONE",
        "references": [
          "6c6e8b3e-46f1-40c3-ba4e-eefabc58d89a",
          "994b6f09-3ba5-47f9-904f-95198e139593"
        ],
        "stereo_centers": 0
      },
      "unii": "7W576V407R"
    }
  ]
}