{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "18905835-077f-46f6-91bb-3e1429909d23",
          "code": "2896-70-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2896-70-0",
          "code_system": "CAS",
          "references": [
            "dcd6c9c3-3fa0-4279-a8f8-21cc44680d5e",
            "ecb3d1d0-e55f-4b99-bd91-e12c745e8e4b"
          ]
        },
        {
          "uuid": "8a0bc618-f8bb-42dd-8cbc-9c8115748b58",
          "code": "10757",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10757/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "dcd6c9c3-3fa0-4279-a8f8-21cc44680d5e"
          ]
        },
        {
          "uuid": "f0228953-0578-4090-8977-04a2f0edcce2",
          "code": "220-778-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.890",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "dcd6c9c3-3fa0-4279-a8f8-21cc44680d5e"
          ]
        },
        {
          "uuid": "b163a470-e449-46d7-8af3-bfee79be3fb1",
          "code": "520789",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/520789",
          "code_system": "PUBCHEM",
          "references": [
            "dcd6c9c3-3fa0-4279-a8f8-21cc44680d5e"
          ]
        },
        {
          "uuid": "bb650eeb-8387-0381-9159-082a01409d55",
          "code": "DTXSID4044905",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4044905",
          "code_system": "EPA CompTox",
          "references": [
            "217004ee-f08c-29bf-7cd5-4326aa71464e"
          ]
        },
        {
          "uuid": "6f0a05df-9dca-4559-a70f-625595efc23a",
          "code": "7W1863PEH5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e9a90be0-3ac0-4f58-8ebf-7abbb345bedc",
          "name": "(2,2,6,6-TETRAMETHYL-4-OXOPIPERIDIN-1-YL)OXIDANYL",
          "stdName": "(2,2,6,6-TETRAMETHYL-4-OXOPIPERIDIN-1-YL)OXIDANYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b929dff-b21e-490e-8e3a-ed9756fa92b1",
            "758716c2-decc-4fd3-bc77-ab993e3c80f9"
          ],
          "display_name": false
        },
        {
          "uuid": "504e51e2-3dca-4da7-b2bf-2fce2a89b5ec",
          "name": "1-PIPERIDINYLOXY, 2,2,6,6-TETRAMETHYL-4-OXO-",
          "stdName": "1-PIPERIDINYLOXY, 2,2,6,6-TETRAMETHYL-4-OXO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37b442ed-f703-49e3-b3f4-9a27366ecdc9",
            "3b929dff-b21e-490e-8e3a-ed9756fa92b1"
          ],
          "display_name": false
        },
        {
          "uuid": "bb88feb1-1e2f-4615-bef2-54cd348fa41c",
          "name": "2,2,6,6-TETRAMETHYL-4-OXO-1-PIPERIDINYLOXY RADICAL",
          "stdName": "2,2,6,6-TETRAMETHYL-4-OXO-1-PIPERIDINYLOXY RADICAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b929dff-b21e-490e-8e3a-ed9756fa92b1",
            "3cf4aa7e-890b-4bb5-9998-2e6ecb1f6408"
          ],
          "display_name": true
        },
        {
          "uuid": "25a9def8-d070-4380-a9ed-1fb1c96b35da",
          "name": "TANONE",
          "stdName": "TANONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37b442ed-f703-49e3-b3f4-9a27366ecdc9",
            "3b929dff-b21e-490e-8e3a-ed9756fa92b1"
          ],
          "display_name": false
        },
        {
          "uuid": "18f02995-c52d-43d7-9b4b-e807090cb000",
          "name": "TEMPONE",
          "stdName": "TEMPONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37b442ed-f703-49e3-b3f4-9a27366ecdc9",
            "3b929dff-b21e-490e-8e3a-ed9756fa92b1"
          ],
          "display_name": false
        },
        {
          "uuid": "9f891e7f-b64b-40b3-8890-f339e7a1a545",
          "name": "TRIACETONEAMINE-N-OXYL",
          "stdName": "TRIACETONEAMINE-N-OXYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b929dff-b21e-490e-8e3a-ed9756fa92b1",
            "c4e046ff-80ad-4240-8362-9010b9e5e9fa"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c4e046ff-80ad-4240-8362-9010b9e5e9fa",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3b929dff-b21e-490e-8e3a-ed9756fa92b1",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37b442ed-f703-49e3-b3f4-9a27366ecdc9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cf4aa7e-890b-4bb5-9998-2e6ecb1f6408",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "758716c2-decc-4fd3-bc77-ab993e3c80f9",
          "citation": "TOX21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcd6c9c3-3fa0-4279-a8f8-21cc44680d5e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391630000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ede6177-8e81-45f3-bc92-f548c0abe05f",
          "citation": "SRS import [7W1863PEH5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7W1863PEH5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391630000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0aca36a4-cf5e-44ae-b5ac-f1567efbd926",
          "citation": "CHEMID RECORD 2896-70-0",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "217004ee-f08c-29bf-7cd5-4326aa71464e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2896-70-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ecb3d1d0-e55f-4b99-bd91-e12c745e8e4b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "29b39bb5-8c69-44ef-94bc-ce077c2e9547",
          "id": "29b39bb5-8c69-44ef-94bc-ce077c2e9547",
          "molfile": "\n  Marvin  01132102162D          \n\n 12 12  0  0  0  0            999 V2000\n    8.8877   -7.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6364   -6.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3644   -6.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9988   -6.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3546   -6.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7169   -6.8848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3546   -5.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9988   -4.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5415   -3.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4819   -4.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6364   -5.3324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2742   -4.8170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n 11  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12 11  1  0  0  0  0\nM  RAD  1  12   2\nM  END",
          "smiles": "CC1(C)CC(=O)CC(C)(C)N1[O]",
          "formula": "C9H16NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a281fa56-db8c-4d80-b5c7-aaa712071be6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "170.2292",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fae65ed2-b0f6-423c-b1e1-89140bd67b09",
      "version": "3",
      "structure": {
        "id": "4a961f7d-cdb3-4da9-bf53-15431bf3b388",
        "molfile": "\n  Marvin  01132103542D          \n\n 12 12  0  0  0  0            999 V2000\n    9.2742   -4.8170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6364   -5.3324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6364   -6.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9988   -4.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8877   -7.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3644   -6.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9988   -6.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5415   -3.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4819   -4.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3546   -5.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3546   -6.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7169   -6.8848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  7 11  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\nM  RAD  1   1   2\nM  END",
        "smiles": "CC1(C)CC(=O)CC(C)(C)N1[O]",
        "formula": "C9H16NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "170.2292",
        "optical_activity": "NONE",
        "references": [
          "0aca36a4-cf5e-44ae-b5ac-f1567efbd926",
          "2ede6177-8e81-45f3-bc92-f548c0abe05f"
        ],
        "stereo_centers": 0
      },
      "unii": "7W1863PEH5"
    }
  ]
}